';
print '';
print '';
- print img_object($langs->trans('ShowBill'),'bill').' '.$obj->ref_supplier.' '.dol_trunc($obj->libelle,14).' ';
+ $facturestatic->id=$obj->rowid;
+ $facturestatic->ref=($obj->ref?$obj->ref:$obj->rowid).($obj->ref_supplier?' - '.$obj->ref_supplier:'');
+ //$facturestatic->ref_supplier=$obj->ref_supplier;
+ print $facturestatic->getNomUrl(1);
+ //print img_object($langs->trans('ShowBill'),'bill').' '.($obj->ref?$obj->ref:$obj->rowid).' - '.$obj->ref_supplier.'';
+ print ' '.dol_trunc($obj->libelle,14);
+ print '';
print ''.dol_print_date($db->jdate($obj->df),'day').' ';
print ''.price($obj->amount).' ';
print '';
@@ -455,11 +461,11 @@ if ($object->fetch($id))
$parameters = array();
$reshook = $hookmanager->executeHooks('addMoreActionsButtons', $parameters, $object, $action); // Note that $action and $object may have been
// modified by hook
- if (empty($reshook))
+ if (empty($reshook))
{
print '';
-
+
if ($user->rights->fournisseur->commande->creer)
{
$langs->load("orders");
@@ -471,7 +477,7 @@ if ($object->fetch($id))
$langs->load("bills");
print '
'.$langs->trans("AddBill").' ';
}
-
+
if ($user->rights->fournisseur->facture->creer)
{
if (! empty($orders2invoice) && $orders2invoice > 0) print '
';
diff --git a/htdocs/fourn/class/fournisseur.commande.class.php b/htdocs/fourn/class/fournisseur.commande.class.php
index 853109fe195..b96e7f01c95 100644
--- a/htdocs/fourn/class/fournisseur.commande.class.php
+++ b/htdocs/fourn/class/fournisseur.commande.class.php
@@ -953,6 +953,8 @@ class CommandeFournisseur extends CommonOrder
if (! $error)
{
+ $action='create';
+
// Actions on extra fields (by external module or standard code)
// FIXME le hook fait double emploi avec le trigger !!
$hookmanager->initHooks(array('supplierorderdao'));
diff --git a/htdocs/fourn/class/fournisseur.facture.class.php b/htdocs/fourn/class/fournisseur.facture.class.php
index db4212308de..69c235fd831 100644
--- a/htdocs/fourn/class/fournisseur.facture.class.php
+++ b/htdocs/fourn/class/fournisseur.facture.class.php
@@ -255,6 +255,8 @@ class FactureFournisseur extends CommonInvoice
$result=$this->update_price();
if ($result > 0)
{
+ $action='create';
+
// Actions on extra fields (by external module or standard code)
// FIXME le hook fait double emploi avec le trigger !!
$hookmanager->initHooks(array('supplierinvoicedao'));
@@ -539,7 +541,7 @@ class FactureFournisseur extends CommonInvoice
* @param int $notrigger 0=launch triggers after, 1=disable triggers
* @return int <0 if KO, >0 if OK
*/
- function update($user=0, $notrigger=0)
+ function update($user=null, $notrigger=0)
{
global $conf, $langs;
$error=0;
diff --git a/htdocs/holiday/class/holiday.class.php b/htdocs/holiday/class/holiday.class.php
index 5ff23b45ec0..5381c99df07 100644
--- a/htdocs/holiday/class/holiday.class.php
+++ b/htdocs/holiday/class/holiday.class.php
@@ -470,7 +470,7 @@ class Holiday extends CommonObject
* @param int $notrigger 0=launch triggers after, 1=disable triggers
* @return int <0 if KO, >0 if OK
*/
- function update($user=0, $notrigger=0)
+ function update($user=null, $notrigger=0)
{
global $conf, $langs;
$error=0;
diff --git a/htdocs/includes/jquery/plugins/multiple-select/LICENSE b/htdocs/includes/jquery/plugins/multiple-select/LICENSE
deleted file mode 100644
index c3ebd2b5248..00000000000
--- a/htdocs/includes/jquery/plugins/multiple-select/LICENSE
+++ /dev/null
@@ -1,21 +0,0 @@
-(The MIT License)
-
-Copyright (c) 2012-2014 Zhixin Wen
-
-Permission is hereby granted, free of charge, to any person obtaining a copy
-of this software and associated documentation files (the "Software"), to deal
-in the Software without restriction, including without limitation the rights
-to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
-copies of the Software, and to permit persons to whom the Software is
-furnished to do so, subject to the following conditions:
-
-The above copyright notice and this permission notice shall be included in
-all copies or substantial portions of the Software.
-
-THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
-IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
-FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
-AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
-LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
-OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
-THE SOFTWARE.
\ No newline at end of file
diff --git a/htdocs/includes/jquery/plugins/multiple-select/README.md b/htdocs/includes/jquery/plugins/multiple-select/README.md
deleted file mode 100644
index 81b82ba74c0..00000000000
--- a/htdocs/includes/jquery/plugins/multiple-select/README.md
+++ /dev/null
@@ -1,96 +0,0 @@
-# Multiple Select
-
-Multiple select is a jQuery plugin to select multiple elements with checkboxes :).
-
-To get started checkout examples and documentation at http://wenzhixin.net.cn/p/multiple-select
-
-## Contributors
-
-Multiple select is due to the excellent work of the following contributors:
-
-
-
-## Changelog
-
-### 1.1.0
-
-* Fix #63: Add ```keepOpen``` option.
-* Fix #62: Fix ```isOpen``` and ```filter``` options are both true bug.
-* Fix #57: Fire onCheckAll event when literally select.
-* Add data attributes for support.
-* Fix #55: Add ```name``` option.
-
-### 1.0.9
-
-* Fix #42: Add ```styler``` option to custom item style.
-* Fix firefox click bug.
-* Add ```allSelected```, ```minumimCountSelected``` and ```countSelected``` options.
-* Fix #35: Add ```onFocus``` and ```onBlur``` events.
-* Fix #25: Add ```focus``` and ```blur``` methods.
-* Fix #31: Trigger the onCheckAll & onUncheckAll events when use filter to select all.
-
-### 1.0.8
-
-* Update the license to The MIT License.
-* Fix #47: Add ```No matches found``` message when there are no results found.
-* Fix #43: Add ```position``` option.
-
-### 1.0.7
-
-* Fix #44: The filters not working bugs.
-
-### 1.0.6
-
-* Fix #21: Add ```single``` option.
-* Add ```override``` option.
-* Add ```container``` option.
-* Fix #29: Update the optgroups select text.
-* Fix #30: Image is not shown in Firefox 25.0.1.
-* Fix #22: fix group filter problem.
-
-### 1.0.5
-
-* Update the button text witdh.
-* Add keyboard support.
-
-### 1.0.4
-
-* Fix #12: Add ```width``` option.
-* Fix #11: Add callback events.
-* Add ```maxHeight``` option.
-
-### 1.0.3
-
-* Fix #4: Add ```filter``` option.
-* Support mobile devices.
-* Fix #6: Add ```refresh``` method.
-
-### 1.0.2
-
-* Fix #7: Add ```selected``` and ```disabled``` options.
-* Fix #5: Add ```checkAll``` and ```uncheckAll``` methods.
-
-### 1.0.1
-
-* Fix #3: Add optgroups support.
-* Add ```placeholder``` option.
-* Fix #2: use prop method instead of attr.
-
-### 1.0.0
-
-* Initial release
-
-## LICENSE
-
-[The MIT License](https://github.com/wenzhixin/multiple-select/blob/master/LICENSE)
\ No newline at end of file
diff --git a/htdocs/includes/jquery/plugins/multiple-select/jquery.multiple.select.js b/htdocs/includes/jquery/plugins/multiple-select/jquery.multiple.select.js
deleted file mode 100644
index 32e6635bbaa..00000000000
--- a/htdocs/includes/jquery/plugins/multiple-select/jquery.multiple.select.js
+++ /dev/null
@@ -1,466 +0,0 @@
-/**
- * @author zhixin wen
- * @version 1.1.0
- *
- * http://wenzhixin.net.cn/p/multiple-select/
- */
-
-(function($) {
-
- 'use strict';
-
- function MultipleSelect($el, options) {
- var that = this,
- name = $el.attr('name') || options.name || '',
- elWidth = $el.width();
-
- this.$el = $el.hide();
- this.options = options;
-
- this.$parent = $('
');
- this.$choice = $('' +
- options.placeholder + '
');
- this.$drop = $('
');
- this.$el.after(this.$parent);
- this.$parent.append(this.$choice);
- this.$parent.append(this.$drop);
-
- if (this.$el.prop('disabled')) {
- this.$choice.addClass('disabled');
- }
- this.$choice.css('width', elWidth + 'px');
- this.$drop.css({
- width: (options.width || elWidth) + 'px'
- });
-
- if (!this.options.keepOpen) {
- $('body').click(function(e) {
- if ($(e.target)[0] === that.$choice[0] ||
- $(e.target).parents('.ms-choice')[0] === that.$choice[0]) {
- return;
- }
- if (($(e.target)[0] === that.$drop[0] ||
- $(e.target).parents('.ms-drop')[0] !== that.$drop[0]) &&
- that.options.isOpen) {
- that.close();
- }
- });
- }
-
- this.selectAllName = 'name="selectAll' + name + '"';
- this.selectGroupName = 'name="selectGroup' + name + '"';
- this.selectItemName = 'name="selectItem' + name + '"';
- }
-
- MultipleSelect.prototype = {
- constructor : MultipleSelect,
-
- init: function() {
- var that = this,
- html = [];
- if (this.options.filter) {
- html.push(
- '',
- ' ',
- '
'
- );
- }
- html.push('');
- this.$drop.html(html.join(''));
- this.$drop.find('ul').css('max-height', this.options.maxHeight + 'px');
- this.$drop.find('.multiple').css('width', this.options.multipleWidth + 'px');
-
- this.$searchInput = this.$drop.find('.ms-search input');
- this.$selectAll = this.$drop.find('input[' + this.selectAllName + ']');
- this.$selectGroups = this.$drop.find('input[' + this.selectGroupName + ']');
- this.$selectItems = this.$drop.find('input[' + this.selectItemName + ']:enabled');
- this.$disableItems = this.$drop.find('input[' + this.selectItemName + ']:disabled');
- this.$noResults = this.$drop.find('.ms-no-results');
- this.events();
- this.update();
-
- if (this.options.isOpen) {
- this.open();
- }
- },
-
- optionToHtml: function(i, elm, group, groupDisabled) {
- var that = this,
- $elm = $(elm),
- html = [],
- multiple = this.options.multiple,
- disabled,
- type = this.options.single ? 'radio' : 'checkbox';
-
- if ($elm.is('option')) {
- var value = $elm.val(),
- text = $elm.text(),
- selected = $elm.prop('selected'),
- style = this.options.styler(value) ? ' style="' + this.options.styler(value) + '"' : '';
-
- disabled = groupDisabled || $elm.prop('disabled');
- html.push(
- '',
- '',
- ' ',
- text,
- ' ',
- ' '
- );
- } else if (!group && $elm.is('optgroup')) {
- var _group = 'group_' + i,
- label = $elm.attr('label');
-
- disabled = $elm.prop('disabled');
- html.push(
- '',
- '',
- ' ',
- label,
- ' ',
- ' ');
- $.each($elm.children(), function(i, elm) {
- html.push(that.optionToHtml(i, elm, _group, disabled));
- });
- }
- return html.join('');
- },
-
- events: function() {
- var that = this;
- this.$choice.off('click').on('click', function(e) {
- e.preventDefault();
- that[that.options.isOpen ? 'close' : 'open']();
- })
- .off('focus').on('focus', this.options.onFocus)
- .off('blur').on('blur', this.options.onBlur);
-
- this.$parent.off('keydown').on('keydown', function(e) {
- switch (e.which) {
- case 27: // esc key
- that.close();
- that.$choice.focus();
- break;
- }
- });
- this.$searchInput.off('keyup').on('keyup', function() {
- that.filter();
- });
- this.$selectAll.off('click').on('click', function() {
- var checked = $(this).prop('checked'),
- $items = that.$selectItems.filter(':visible');
- if ($items.length === that.$selectItems.length) {
- that[checked ? 'checkAll' : 'uncheckAll']();
- } else { // when the filter option is true
- that.$selectGroups.prop('checked', checked);
- $items.prop('checked', checked);
- that.options[checked ? 'onCheckAll' : 'onUncheckAll']();
- that.update();
- }
- });
- this.$selectGroups.off('click').on('click', function() {
- var group = $(this).parent().attr('data-group'),
- $items = that.$selectItems.filter(':visible'),
- $children = $items.filter('[data-group="' + group + '"]'),
- checked = $children.length !== $children.filter(':checked').length;
- $children.prop('checked', checked);
- that.updateSelectAll();
- that.update();
- that.options.onOptgroupClick({
- label: $(this).parent().text(),
- checked: checked,
- children: $children.get()
- });
- });
- this.$selectItems.off('click').on('click', function() {
- that.updateSelectAll();
- that.update();
- that.updateOptGroupSelect();
- that.options.onClick({
- label: $(this).parent().text(),
- value: $(this).val(),
- checked: $(this).prop('checked')
- });
- });
- },
-
- open: function() {
- if (this.$choice.hasClass('disabled')) {
- return;
- }
- this.options.isOpen = true;
- this.$choice.find('>div').addClass('open');
- this.$drop.show();
- if (this.options.container) {
- var offset = this.$drop.offset();
- this.$drop.appendTo($(this.options.container));
- this.$drop.offset({ top: offset.top, left: offset.left });
- }
- if (this.options.filter) {
- this.$searchInput.val('');
- this.filter();
- }
- this.options.onOpen();
- },
-
- close: function() {
- this.options.isOpen = false;
- this.$choice.find('>div').removeClass('open');
- this.$drop.hide();
- if (this.options.container) {
- this.$parent.append(this.$drop);
- this.$drop.css({
- 'top': 'auto',
- 'left': 'auto'
- })
- }
- this.options.onClose();
- },
-
- update: function() {
- var selects = this.getSelects('text'),
- $span = this.$choice.find('>span');
- if (selects.length === this.$selectItems.length + this.$disableItems.length && this.options.allSelected) {
- $span.removeClass('placeholder').html(this.options.allSelected);
- } else if (selects.length > this.options.minumimCountSelected && this.options.countSelected) {
- $span.removeClass('placeholder').html(this.options.countSelected
- .replace('#', selects.length)
- .replace('%', this.$selectItems.length + this.$disableItems.length));
- } else if (selects.length) {
- $span.removeClass('placeholder').html(selects.join(', '));
- } else {
- $span.addClass('placeholder').html(this.options.placeholder);
- }
- // set selects to select
- this.$el.val(this.getSelects());
- },
-
- updateSelectAll: function() {
- var $items = this.$selectItems.filter(':visible');
- this.$selectAll.prop('checked', $items.length &&
- $items.length === $items.filter(':checked').length);
- if (this.$selectAll.prop('checked')) {
- this.options.onCheckAll();
- }
- },
-
- updateOptGroupSelect: function() {
- var $items = this.$selectItems.filter(':visible');
- $.each(this.$selectGroups, function(i, val) {
- var group = $(val).parent().attr('data-group'),
- $children = $items.filter('[data-group="' + group + '"]');
- $(val).prop('checked', $children.length &&
- $children.length === $children.filter(':checked').length);
- });
- },
-
- //value or text, default: 'value'
- getSelects: function(type) {
- var that = this,
- texts = [],
- values = [];
- this.$drop.find('input[' + this.selectItemName + ']:checked').each(function() {
- texts.push($(this).parent().text());
- values.push($(this).val());
- });
-
- if (type === 'text' && this.$selectGroups.length) {
- texts = [];
- this.$selectGroups.each(function() {
- var html = [],
- text = $.trim($(this).parent().text()),
- group = $(this).parent().data('group'),
- $children = that.$drop.find('[' + that.selectItemName + '][data-group="' + group + '"]'),
- $selected = $children.filter(':checked');
-
- if ($selected.length === 0) {
- return;
- }
-
- html.push('[');
- html.push(text);
- if ($children.length > $selected.length) {
- var list = [];
- $selected.each(function() {
- list.push($(this).parent().text());
- });
- html.push(': ' + list.join(', '));
- }
- html.push(']');
- texts.push(html.join(''));
- });
- }
- return type === 'text' ? texts : values;
- },
-
- setSelects: function(values) {
- var that = this;
- this.$selectItems.prop('checked', false);
- $.each(values, function(i, value) {
- that.$selectItems.filter('[value="' + value + '"]').prop('checked', true);
- });
- this.$selectAll.prop('checked', this.$selectItems.length ===
- this.$selectItems.filter(':checked').length);
- this.update();
- },
-
- enable: function() {
- this.$choice.removeClass('disabled');
- },
-
- disable: function() {
- this.$choice.addClass('disabled');
- },
-
- checkAll: function() {
- this.$selectItems.prop('checked', true);
- this.$selectGroups.prop('checked', true);
- this.$selectAll.prop('checked', true);
- this.update();
- this.options.onCheckAll();
- },
-
- uncheckAll: function() {
- this.$selectItems.prop('checked', false);
- this.$selectGroups.prop('checked', false);
- this.$selectAll.prop('checked', false);
- this.update();
- this.options.onUncheckAll();
- },
-
- focus: function() {
- this.$choice.focus();
- this.options.onFocus();
- },
-
- blur: function() {
- this.$choice.blur();
- this.options.onBlur();
- },
-
- refresh: function() {
- this.init();
- },
-
- filter: function() {
- var that = this,
- text = $.trim(this.$searchInput.val()).toLowerCase();
- if (text.length === 0) {
- this.$selectItems.parent().show();
- this.$disableItems.parent().show();
- this.$selectGroups.parent().show();
- } else {
- this.$selectItems.each(function() {
- var $parent = $(this).parent();
- $parent[$parent.text().toLowerCase().indexOf(text) < 0 ? 'hide' : 'show']();
- });
- this.$disableItems.parent().hide();
- this.$selectGroups.each(function() {
- var $parent = $(this).parent();
- var group = $parent.attr('data-group'),
- $items = that.$selectItems.filter(':visible');
- $parent[$items.filter('[data-group="' + group + '"]').length === 0 ? 'hide' : 'show']();
- });
-
- //Check if no matches found
- if (this.$selectItems.filter(':visible').length) {
- this.$selectAll.parent().show();
- this.$noResults.hide();
- } else {
- this.$selectAll.parent().hide();
- this.$noResults.show();
- }
- }
- this.updateOptGroupSelect();
- this.updateSelectAll();
- }
- };
-
- $.fn.multipleSelect = function() {
- var option = arguments[0],
- args = arguments,
-
- value,
- allowedMethods = [
- 'getSelects', 'setSelects',
- 'enable', 'disable',
- 'checkAll', 'uncheckAll',
- 'focus', 'blur',
- 'refresh'
- ];
-
- this.each(function() {
- var $this = $(this),
- data = $this.data('multipleSelect'),
- options = $.extend({}, $.fn.multipleSelect.defaults,
- $this.data(), typeof option === 'object' && option);
-
- if (!data) {
- data = new MultipleSelect($this, options);
- $this.data('multipleSelect', data);
- }
-
- if (typeof option === 'string') {
- if ($.inArray(option, allowedMethods) < 0) {
- throw "Unknown method: " + option;
- }
- value = data[option](args[1]);
- } else {
- data.init();
- }
- });
-
- return value ? value : this;
- };
-
- $.fn.multipleSelect.defaults = {
- name: '',
- isOpen: false,
- placeholder: '',
- selectAll: true,
- selectAllText: 'Select all',
- allSelected: 'All selected',
- minumimCountSelected: 3,
- countSelected: '# of % selected',
- multiple: false,
- multipleWidth: 80,
- single: false,
- filter: false,
- width: undefined,
- maxHeight: 250,
- container: null,
- position: 'bottom',
- keepOpen: false,
-
- styler: function() {return false;},
-
- onOpen: function() {return false;},
- onClose: function() {return false;},
- onCheckAll: function() {return false;},
- onUncheckAll: function() {return false;},
- onFocus: function() {return false;},
- onBlur: function() {return false;},
- onOptgroupClick: function() {return false;},
- onClick: function() {return false;}
- };
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/multiple-select/multiple-select.css b/htdocs/includes/jquery/plugins/multiple-select/multiple-select.css
deleted file mode 100644
index d824e0c7a2b..00000000000
--- a/htdocs/includes/jquery/plugins/multiple-select/multiple-select.css
+++ /dev/null
@@ -1,183 +0,0 @@
-/**
- * @author zhixin wen
- */
-
-.ms-parent {
- display: inline-block;
- position: relative;
- vertical-align: middle;
-}
-
-.ms-choice {
- display: block;
- height: 26px;
- padding: 0;
- overflow: hidden;
- cursor: pointer;
- border: 1px solid #aaa;
- text-align: left;
- white-space: nowrap;
- line-height: 26px;
- color: #444;
- text-decoration: none;
- -webkit-border-radius: 4px;
- -moz-border-radius: 4px;
- border-radius: 4px;
- background-color: #fff;
-}
-
-.ms-choice.disabled {
- background-color: #f4f4f4;
- background-image: none;
- border: 1px solid #ddd;
- cursor: default;
-}
-
-.ms-choice > span {
- position: absolute;
- top: 0;
- left: 0;
- right: 20px;
- white-space: nowrap;
- overflow: hidden;
- text-overflow: ellipsis;
- display: block;
- padding-left: 8px;
-}
-
-.ms-choice > span.placeholder {
- color: #999;
-}
-
-.ms-choice > div {
- position: absolute;
- top: 0;
- right: 0;
- width: 20px;
- height: 25px;
- background: url('multiple-select.png') right top no-repeat;
-}
-
-.ms-choice > div.open {
- background: url('multiple-select.png') left top no-repeat;
-}
-
-.ms-drop {
- overflow: hidden;
- display: none;
- margin-top: -1px;
- padding: 0;
- position: absolute;
- z-index: 1000;
- background: #fff;
- color: #000;
- border: 1px solid #aaa;
- -webkit-border-radius: 4px;
- -moz-border-radius: 4px;
- border-radius: 4px;
-}
-
-.ms-drop.bottom {
- top: 100%;
- -webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
- -moz-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
- box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
-}
-
-.ms-drop.top {
- bottom: 100%;
- -webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
- -moz-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
- box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
-}
-
-.ms-search {
- display: inline-block;
- margin: 0;
- min-height: 26px;
- padding: 4px;
- position: relative;
- white-space: nowrap;
- width: 100%;
- z-index: 10000;
-}
-
-.ms-search input {
- width: 100%;
- height: auto !important;
- min-height: 24px;
- padding: 0 20px 0 5px;
- margin: 0;
- outline: 0;
- font-family: sans-serif;
- font-size: 1em;
- border: 1px solid #aaa;
- -webkit-border-radius: 0;
- -moz-border-radius: 0;
- border-radius: 0;
- -webkit-box-shadow: none;
- -moz-box-shadow: none;
- box-shadow: none;
- background: #fff url('multiple-select.png') no-repeat 100% -22px;
- background: url('multiple-select.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, white), color-stop(0.99, #eeeeee));
- background: url('multiple-select.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, white 85%, #eeeeee 99%);
- background: url('multiple-select.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, white 85%, #eeeeee 99%);
- background: url('multiple-select.png') no-repeat 100% -22px, -o-linear-gradient(bottom, white 85%, #eeeeee 99%);
- background: url('multiple-select.png') no-repeat 100% -22px, -ms-linear-gradient(top, #ffffff 85%, #eeeeee 99%);
- background: url('multiple-select.png') no-repeat 100% -22px, linear-gradient(top, #ffffff 85%, #eeeeee 99%);
-}
-
-.ms-search, .ms-search input {
- -webkit-box-sizing: border-box;
- -khtml-box-sizing: border-box;
- -moz-box-sizing: border-box;
- -ms-box-sizing: border-box;
- box-sizing: border-box;
-}
-
-.ms-drop ul {
- overflow: auto;
- margin: 0;
- padding: 5px 8px;
-}
-
-.ms-drop ul > li {
- list-style: none;
- display: list-item;
- background-image: none;
- position: static;
-}
-
-.ms-drop ul > li .disabled {
- opacity: .35;
- filter: Alpha(Opacity=35);
-}
-
-.ms-drop ul > li.multiple {
- display: block;
- float: left;
-}
-
-.ms-drop ul > li.group {
- clear: both;
-}
-
-.ms-drop ul > li.multiple label {
- width: 100%;
- display: block;
- white-space: nowrap;
- overflow: hidden;
- text-overflow: ellipsis;
-}
-
-.ms-drop ul > li label.optgroup {
- font-weight: bold;
-}
-
-.ms-drop input[type="checkbox"] {
- vertical-align: middle;
-}
-
-.ms-drop .ms-no-results {
- display: none;
-}
\ No newline at end of file
diff --git a/htdocs/includes/jquery/plugins/multiple-select/multiple-select.jquery.json b/htdocs/includes/jquery/plugins/multiple-select/multiple-select.jquery.json
deleted file mode 100644
index dd636fda7e0..00000000000
--- a/htdocs/includes/jquery/plugins/multiple-select/multiple-select.jquery.json
+++ /dev/null
@@ -1,28 +0,0 @@
-{
- "name": "multiple-select",
- "version": "1.1.0",
- "title": "Multiple Select",
- "description": "Multiple select is a jQuery plugin to select multiple elements with checkboxes :).",
- "author": {
- "name": "zhixin wen",
- "email": "wenzhixin2010@gmail.com",
- "url": "http://wenzhixin.net.cn/"
- },
- "licenses": [
- {
- "type": "MIT License",
- "url": "http://opensource.org/licenses/MIT"
- }
- ],
- "dependencies": {
- "jquery": ">=1.7"
- },
- "keywords": ["multiple.select", "select.list", "multiple.choose", "checkbox"],
- "homepage": "http://wenzhixin.net.cn/p/multiple-select/",
- "demo": "http://wenzhixin.net.cn/p/multiple-select/#examples",
- "bugs": {
- "url": "https://github.com/wenzhixin/multiple-select/issues"
- },
- "docs": "http://wenzhixin.net.cn/p/multiple-select/#documentation",
- "download": "https://github.com/wenzhixin/multiple-select/archive/master.zip"
-}
\ No newline at end of file
diff --git a/htdocs/includes/jquery/plugins/multiple-select/multiple-select.png b/htdocs/includes/jquery/plugins/multiple-select/multiple-select.png
deleted file mode 100644
index 2a7ba608ea8..00000000000
Binary files a/htdocs/includes/jquery/plugins/multiple-select/multiple-select.png and /dev/null differ
diff --git a/htdocs/includes/jquery/plugins/select2/.gitignore b/htdocs/includes/jquery/plugins/select2/.gitignore
new file mode 100644
index 00000000000..c6ef2182bdc
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/.gitignore
@@ -0,0 +1,2 @@
+.idea
+
diff --git a/htdocs/includes/jquery/plugins/select2/CONTRIBUTING.md b/htdocs/includes/jquery/plugins/select2/CONTRIBUTING.md
new file mode 100644
index 00000000000..bca4baf61a3
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/CONTRIBUTING.md
@@ -0,0 +1,107 @@
+Contributing to Select2
+=======================
+Looking to contribute something to Select2? **Here's how you can help.**
+
+Please take a moment to review this document in order to make the contribution
+process easy and effective for everyone involved.
+
+Following these guidelines helps to communicate that you respect the time of
+the developers managing and developing this open source project. In return,
+they should reciprocate that respect in addressing your issue or assessing
+patches and features.
+
+Using the issue tracker
+-----------------------
+When [reporting bugs][reporting-bugs] or
+[requesting features][requesting-features], the
+[issue tracker on GitHub][issue-tracker] is the recommended channel to use.
+
+The issue tracker **is not** a place for support requests. The
+[mailing list][mailing-list] or [IRC channel][irc-channel] are better places to
+get help.
+
+Reporting bugs with Select2
+---------------------------
+We really appreciate clear bug reports that _consistently_ show an issue
+_within Select2_.
+
+The ideal bug report follows these guidelines:
+
+1. **Use the [GitHub issue search][issue-search]** — Check if the issue
+ has already been reported.
+2. **Check if the issue has been fixed** — Try to reproduce the problem
+ using the code in the `master` branch.
+3. **Isolate the problem** — Try to create an
+ [isolated test case][isolated-case] that consistently reproduces the problem.
+
+Please try to be as detailed as possible in your bug report, especially if an
+isolated test case cannot be made. Some useful questions to include the answer
+to are:
+
+- What steps can be used to reproduce the issue?
+- What is the bug and what is the expected outcome?
+- What browser(s) and Operating System have you tested with?
+- Does the bug happen consistently across all tested browsers?
+- What version of jQuery are you using? And what version of Select2?
+- Are you using Select2 with other plugins?
+
+All of these questions will help people fix and identify any potential bugs.
+
+Requesting features in Select2
+------------------------------
+Select2 is a large library that carries with it a lot of functionality. Because
+of this, many feature requests will not be implemented in the core library.
+
+Before starting work on a major feature for Select2, **contact the
+[community][community] first** or you may risk spending a considerable amount of
+time on something which the project developers are not interested in bringing
+into the project.
+
+### Select2 4.0
+
+Many feature requests will be closed off until 4.0, where Select2 plans to adopt
+a more flexible API. If you are interested in helping with the development of
+the next major Select2 release, please send a message to the
+[mailing list][mailing-list] or [irc channel][irc-channel] for more information.
+
+Triaging issues and pull requests
+---------------------------------
+Anyone can help the project maintainers triage issues and review pull requests.
+
+### Handling new issues
+
+Select2 regularly receives new issues which need to be tested and organized.
+
+When a new issue that comes in that is similar to another existing issue, it
+should be checked to make sure it is not a duplicate. Duplicates issues should
+be marked by replying to the issue with "Duplicate of #[issue number]" where
+`[issue number]` is the url or issue number for the existing issue. This will
+allow the project maintainers to quickly close off additional issues and keep
+the discussion focused within a single issue.
+
+If you can test issues that are reported to Select2 that contain test cases and
+confirm under what conditions bugs happen, that will allow others to identify
+what causes a bug quicker.
+
+### Reviewing pull requests
+
+It is very common for pull requests to be opened for issues that contain a clear
+solution to the problem. These pull requests should be rigorously reviewed by
+the community before being accepted. If you are not sure about a piece of
+submitted code, or know of a better way to do something, do not hesitate to make
+a comment on the pull request.
+
+It should also be made clear that **all code contributed to Select** must be
+licensable under the [Apache 2 or GPL 2 licenses][licensing]. Code that cannot
+be released under either of these licenses **cannot be accepted** into the
+project.
+
+[community]: https://github.com/ivaynberg/select2#community
+[reporting-bugs]: #reporting-bugs-with-select2
+[requesting-features]: #requesting-features-in-select2
+[issue-tracker]: https://github.com/ivaynberg/select2/issues
+[mailing-list]: https://github.com/ivaynberg/select2#mailing-list
+[irc-channel]: https://github.com/ivaynberg/select2#irc-channel
+[issue-search]: https://github.com/ivaynberg/select2/search?q=&type=Issues
+[isolated-case]: http://css-tricks.com/6263-reduced-test-cases/
+[licensing]: https://github.com/ivaynberg/select2#copyright-and-license
diff --git a/htdocs/includes/jquery/plugins/select2/LICENSE b/htdocs/includes/jquery/plugins/select2/LICENSE
new file mode 100644
index 00000000000..0247cc76273
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/LICENSE
@@ -0,0 +1,18 @@
+Copyright 2014 Igor Vaynberg
+
+Version: @@ver@@ Timestamp: @@timestamp@@
+
+This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
+General Public License version 2 (the "GPL License"). You may choose either license to govern your
+use of this software only upon the condition that you accept all of the terms of either the Apache
+License or the GPL License.
+
+You may obtain a copy of the Apache License and the GPL License at:
+
+http://www.apache.org/licenses/LICENSE-2.0
+http://www.gnu.org/licenses/gpl-2.0.html
+
+Unless required by applicable law or agreed to in writing, software distributed under the Apache License
+or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
+either express or implied. See the Apache License and the GPL License for the specific language governing
+permissions and limitations under the Apache License and the GPL License.
diff --git a/htdocs/includes/jquery/plugins/select2/README.md b/htdocs/includes/jquery/plugins/select2/README.md
new file mode 100644
index 00000000000..64380c45147
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/README.md
@@ -0,0 +1,114 @@
+Select2
+=======
+
+Select2 is a jQuery-based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.
+
+To get started, checkout examples and documentation at http://ivaynberg.github.com/select2
+
+Use cases
+---------
+
+* Enhancing native selects with search.
+* Enhancing native selects with a better multi-select interface.
+* Loading data from JavaScript: easily load items via ajax and have them searchable.
+* Nesting optgroups: native selects only support one level of nested. Select2 does not have this restriction.
+* Tagging: ability to add new items on the fly.
+* Working with large, remote datasets: ability to partially load a dataset based on the search term.
+* Paging of large datasets: easy support for loading more pages when the results are scrolled to the end.
+* Templating: support for custom rendering of results and selections.
+
+Browser compatibility
+---------------------
+* IE 8+
+* Chrome 8+
+* Firefox 10+
+* Safari 3+
+* Opera 10.6+
+
+Usage
+-----
+You can source Select2 directly from a CDN like [JSDliver](http://www.jsdelivr.com/#!select2) or [CDNJS](http://www.cdnjs.com/libraries/select2), [download it from this GitHub repo](https://github.com/ivaynberg/select2/tags), or use one of the integrations below.
+
+Integrations
+------------
+
+* [Wicket-Select2](https://github.com/ivaynberg/wicket-select2) (Java / [Apache Wicket](http://wicket.apache.org))
+* [select2-rails](https://github.com/argerim/select2-rails) (Ruby on Rails)
+* [AngularUI](http://angular-ui.github.io/#ui-select) ([AngularJS](https://angularjs.org/))
+* [Django](https://github.com/applegrew/django-select2)
+* [Symfony](https://github.com/19Gerhard85/sfSelect2WidgetsPlugin)
+* [Symfony2](https://github.com/avocode/FormExtensions)
+* [Bootstrap 2](https://github.com/t0m/select2-bootstrap-css) and [Bootstrap 3](https://github.com/t0m/select2-bootstrap-css/tree/bootstrap3) (CSS skins)
+* [Meteor](https://github.com/nate-strauser/meteor-select2) (modern reactive JavaScript framework; + [Bootstrap 3 skin](https://github.com/esperadomedia/meteor-select2-bootstrap3-css/))
+* [Meteor](https://jquery-select2.meteor.com)
+* [Yii 2.x](http://demos.krajee.com/widgets#select2)
+* [Yii 1.x](https://github.com/tonybolzan/yii-select2)
+* [AtmosphereJS](https://atmospherejs.com/package/jquery-select2)
+
+### Example Integrations
+
+* [Knockout.js](https://github.com/ivaynberg/select2/wiki/Knockout.js-Integration)
+* [Socket.IO](https://github.com/ivaynberg/select2/wiki/Socket.IO-Integration)
+* [PHP](https://github.com/ivaynberg/select2/wiki/PHP-Example)
+* [.Net MVC] (https://github.com/ivaynberg/select2/wiki/.Net-MVC-Example)
+
+Internationalization (i18n)
+---------------------------
+
+Select2 supports multiple languages by simply including the right language JS
+file (`select2_locale_it.js`, `select2_locale_nl.js`, etc.) after `select2.js`.
+
+Missing a language? Just copy `select2_locale_en.js.template`, translate
+it, and make a pull request back to Select2 here on GitHub.
+
+Documentation
+-------------
+
+The documentation for Select2 is available [through GitHub Pages](https://ivaynberg.github.io/select2/) and is located within this repository in the [`gh-pages` branch](https://github.com/ivaynberg/select2/tree/gh-pages).
+
+Community
+---------
+
+### Bug tracker
+
+Have a bug? Please create an issue here on GitHub!
+
+https://github.com/ivaynberg/select2/issues
+
+### Mailing list
+
+Have a question? Ask on our mailing list!
+
+select2@googlegroups.com
+
+https://groups.google.com/d/forum/select2
+
+### IRC channel
+
+Need help implementing Select2 in your project? Ask in our IRC channel!
+
+**Network:** [Freenode](https://freenode.net/) (`chat.freenode.net`)
+
+**Channel:** `#select2`
+
+**Web access:** https://webchat.freenode.net/?channels=select2
+
+Copyright and license
+---------------------
+
+Copyright 2012 Igor Vaynberg
+
+This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
+General Public License version 2 (the "GPL License"). You may choose either license to govern your
+use of this software only upon the condition that you accept all of the terms of either the Apache
+License or the GPL License.
+
+You may obtain a copy of the Apache License and the GPL License in the LICENSE file, or at:
+
+http://www.apache.org/licenses/LICENSE-2.0
+http://www.gnu.org/licenses/gpl-2.0.html
+
+Unless required by applicable law or agreed to in writing, software distributed under the Apache License
+or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
+either express or implied. See the Apache License and the GPL License for the specific language governing
+permissions and limitations under the Apache License and the GPL License.
diff --git a/htdocs/includes/jquery/plugins/select2/bower.json b/htdocs/includes/jquery/plugins/select2/bower.json
new file mode 100644
index 00000000000..54d44c4593b
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/bower.json
@@ -0,0 +1,8 @@
+{
+ "name": "select2",
+ "version": "3.5.2",
+ "main": ["select2.js", "select2.css", "select2.png", "select2x2.png", "select2-spinner.gif"],
+ "dependencies": {
+ "jquery": ">= 1.7.1"
+ }
+}
diff --git a/htdocs/includes/jquery/plugins/select2/component.json b/htdocs/includes/jquery/plugins/select2/component.json
new file mode 100644
index 00000000000..8bd3c020a29
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/component.json
@@ -0,0 +1,66 @@
+{
+ "name": "select2",
+ "repo": "ivaynberg/select2",
+ "description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
+ "version": "3.5.2",
+ "demo": "http://ivaynberg.github.io/select2/",
+ "keywords": [
+ "jquery"
+ ],
+ "main": "select2.js",
+ "styles": [
+ "select2.css",
+ "select2-bootstrap.css"
+ ],
+ "scripts": [
+ "select2.js",
+ "select2_locale_ar.js",
+ "select2_locale_bg.js",
+ "select2_locale_ca.js",
+ "select2_locale_cs.js",
+ "select2_locale_da.js",
+ "select2_locale_de.js",
+ "select2_locale_el.js",
+ "select2_locale_es.js",
+ "select2_locale_et.js",
+ "select2_locale_eu.js",
+ "select2_locale_fa.js",
+ "select2_locale_fi.js",
+ "select2_locale_fr.js",
+ "select2_locale_gl.js",
+ "select2_locale_he.js",
+ "select2_locale_hr.js",
+ "select2_locale_hu.js",
+ "select2_locale_id.js",
+ "select2_locale_is.js",
+ "select2_locale_it.js",
+ "select2_locale_ja.js",
+ "select2_locale_ka.js",
+ "select2_locale_ko.js",
+ "select2_locale_lt.js",
+ "select2_locale_lv.js",
+ "select2_locale_mk.js",
+ "select2_locale_ms.js",
+ "select2_locale_nl.js",
+ "select2_locale_no.js",
+ "select2_locale_pl.js",
+ "select2_locale_pt-BR.js",
+ "select2_locale_pt-PT.js",
+ "select2_locale_ro.js",
+ "select2_locale_ru.js",
+ "select2_locale_sk.js",
+ "select2_locale_sv.js",
+ "select2_locale_th.js",
+ "select2_locale_tr.js",
+ "select2_locale_uk.js",
+ "select2_locale_vi.js",
+ "select2_locale_zh-CN.js",
+ "select2_locale_zh-TW.js"
+ ],
+ "images": [
+ "select2-spinner.gif",
+ "select2.png",
+ "select2x2.png"
+ ],
+ "license": "MIT"
+}
diff --git a/htdocs/includes/jquery/plugins/select2/composer.json b/htdocs/includes/jquery/plugins/select2/composer.json
new file mode 100644
index 00000000000..cd2d26a2a98
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/composer.json
@@ -0,0 +1,29 @@
+{
+ "name":
+ "ivaynberg/select2",
+ "description": "Select2 is a jQuery based replacement for select boxes.",
+ "version": "3.5.2",
+ "type": "component",
+ "homepage": "http://ivaynberg.github.io/select2/",
+ "license": "Apache-2.0",
+ "require": {
+ "robloach/component-installer": "*",
+ "components/jquery": ">=1.7.1"
+ },
+ "extra": {
+ "component": {
+ "scripts": [
+ "select2.js"
+ ],
+ "files": [
+ "select2.js",
+ "select2_locale_*.js",
+ "select2.css",
+ "select2-bootstrap.css",
+ "select2-spinner.gif",
+ "select2.png",
+ "select2x2.png"
+ ]
+ }
+ }
+}
diff --git a/htdocs/includes/jquery/plugins/select2/package.json b/htdocs/includes/jquery/plugins/select2/package.json
new file mode 100644
index 00000000000..709cb1c66b4
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/package.json
@@ -0,0 +1,20 @@
+{
+ "name" : "Select2",
+ "description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
+ "homepage": "http://ivaynberg.github.io/select2",
+ "author": "Igor Vaynberg",
+ "repository": {"type": "git", "url": "git://github.com/ivaynberg/select2.git"},
+ "main": "select2.js",
+ "version": "3.5.2",
+ "jspm": {
+ "main": "select2",
+ "files": ["select2.js", "select2.png", "select2.css", "select2-spinner.gif"],
+ "shim": {
+ "select2": {
+ "imports": ["jquery", "./select2.css!"],
+ "exports": "$"
+ }
+ },
+ "buildConfig": { "uglify": true }
+ }
+}
diff --git a/htdocs/includes/jquery/plugins/select2/release.sh b/htdocs/includes/jquery/plugins/select2/release.sh
new file mode 100644
index 00000000000..3b63f96621e
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/release.sh
@@ -0,0 +1,79 @@
+#!/bin/bash
+set -e
+
+echo -n "Enter the version for this release: "
+
+read ver
+
+if [ ! $ver ]; then
+ echo "Invalid version."
+ exit
+fi
+
+name="select2"
+js="$name.js"
+mini="$name.min.js"
+css="$name.css"
+release="$name-$ver"
+tag="$ver"
+branch="build-$ver"
+curbranch=`git branch | grep "*" | sed "s/* //"`
+timestamp=$(date)
+tokens="s/@@ver@@/$ver/g;s/\@@timestamp@@/$timestamp/g"
+remote="origin"
+
+echo "Pulling from origin"
+
+git pull
+
+echo "Updating Version Identifiers"
+
+sed -E -e "s/\"version\": \"([0-9\.]+)\",/\"version\": \"$ver\",/g" -i -- bower.json select2.jquery.json component.json composer.json package.json
+
+git add bower.json
+git add select2.jquery.json
+git add component.json
+git add composer.json
+git add package.json
+
+git commit -m "modified version identifiers in descriptors for release $ver"
+git push
+
+git branch "$branch"
+git checkout "$branch"
+
+echo "Tokenizing..."
+
+find . -name "$js" | xargs -I{} sed -e "$tokens" -i -- {}
+find . -name "$css" | xargs -I{} sed -e "$tokens" -i -- {}
+
+sed -e "s/latest/$ver/g" -i -- bower.json
+
+git add "$js"
+git add "$css"
+
+echo "Minifying..."
+
+echo "/*" > "$mini"
+cat LICENSE | sed "$tokens" >> "$mini"
+echo "*/" >> "$mini"
+
+curl -s \
+ --data-urlencode "js_code@$js" \
+ http://marijnhaverbeke.nl/uglifyjs \
+ >> "$mini"
+
+git add "$mini"
+
+git commit -m "release $ver"
+
+echo "Tagging..."
+git tag -a "$tag" -m "tagged version $ver"
+git push "$remote" --tags
+
+echo "Cleaning Up..."
+
+git checkout "$curbranch"
+git branch -D "$branch"
+
+echo "Done"
diff --git a/htdocs/includes/jquery/plugins/select2/select2-bootstrap.css b/htdocs/includes/jquery/plugins/select2/select2-bootstrap.css
new file mode 100644
index 00000000000..3b83f0a2297
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2-bootstrap.css
@@ -0,0 +1,87 @@
+.form-control .select2-choice {
+ border: 0;
+ border-radius: 2px;
+}
+
+.form-control .select2-choice .select2-arrow {
+ border-radius: 0 2px 2px 0;
+}
+
+.form-control.select2-container {
+ height: auto !important;
+ padding: 0;
+}
+
+.form-control.select2-container.select2-dropdown-open {
+ border-color: #5897FB;
+ border-radius: 3px 3px 0 0;
+}
+
+.form-control .select2-container.select2-dropdown-open .select2-choices {
+ border-radius: 3px 3px 0 0;
+}
+
+.form-control.select2-container .select2-choices {
+ border: 0 !important;
+ border-radius: 3px;
+}
+
+.control-group.warning .select2-container .select2-choice,
+.control-group.warning .select2-container .select2-choices,
+.control-group.warning .select2-container-active .select2-choice,
+.control-group.warning .select2-container-active .select2-choices,
+.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choice,
+.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choices,
+.control-group.warning .select2-container-multi.select2-container-active .select2-choices {
+ border: 1px solid #C09853 !important;
+}
+
+.control-group.warning .select2-container .select2-choice div {
+ border-left: 1px solid #C09853 !important;
+ background: #FCF8E3 !important;
+}
+
+.control-group.error .select2-container .select2-choice,
+.control-group.error .select2-container .select2-choices,
+.control-group.error .select2-container-active .select2-choice,
+.control-group.error .select2-container-active .select2-choices,
+.control-group.error .select2-dropdown-open.select2-drop-above .select2-choice,
+.control-group.error .select2-dropdown-open.select2-drop-above .select2-choices,
+.control-group.error .select2-container-multi.select2-container-active .select2-choices {
+ border: 1px solid #B94A48 !important;
+}
+
+.control-group.error .select2-container .select2-choice div {
+ border-left: 1px solid #B94A48 !important;
+ background: #F2DEDE !important;
+}
+
+.control-group.info .select2-container .select2-choice,
+.control-group.info .select2-container .select2-choices,
+.control-group.info .select2-container-active .select2-choice,
+.control-group.info .select2-container-active .select2-choices,
+.control-group.info .select2-dropdown-open.select2-drop-above .select2-choice,
+.control-group.info .select2-dropdown-open.select2-drop-above .select2-choices,
+.control-group.info .select2-container-multi.select2-container-active .select2-choices {
+ border: 1px solid #3A87AD !important;
+}
+
+.control-group.info .select2-container .select2-choice div {
+ border-left: 1px solid #3A87AD !important;
+ background: #D9EDF7 !important;
+}
+
+.control-group.success .select2-container .select2-choice,
+.control-group.success .select2-container .select2-choices,
+.control-group.success .select2-container-active .select2-choice,
+.control-group.success .select2-container-active .select2-choices,
+.control-group.success .select2-dropdown-open.select2-drop-above .select2-choice,
+.control-group.success .select2-dropdown-open.select2-drop-above .select2-choices,
+.control-group.success .select2-container-multi.select2-container-active .select2-choices {
+ border: 1px solid #468847 !important;
+}
+
+.control-group.success .select2-container .select2-choice div {
+ border-left: 1px solid #468847 !important;
+ background: #DFF0D8 !important;
+}
diff --git a/htdocs/includes/jquery/plugins/select2/select2-spinner.gif b/htdocs/includes/jquery/plugins/select2/select2-spinner.gif
new file mode 100644
index 00000000000..5b33f7e54f4
Binary files /dev/null and b/htdocs/includes/jquery/plugins/select2/select2-spinner.gif differ
diff --git a/htdocs/includes/jquery/plugins/select2/select2.css b/htdocs/includes/jquery/plugins/select2/select2.css
new file mode 100644
index 00000000000..2d07a0343b0
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2.css
@@ -0,0 +1,704 @@
+/*
+Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
+*/
+.select2-container {
+ margin: 0;
+ position: relative;
+ display: inline-block;
+ /* inline-block for ie7 */
+ zoom: 1;
+ *display: inline;
+ vertical-align: middle;
+}
+
+.select2-container,
+.select2-drop,
+.select2-search,
+.select2-search input {
+ /*
+ Force border-box so that % widths fit the parent
+ container without overlap because of margin/padding.
+ More Info : http://www.quirksmode.org/css/box.html
+ */
+ -webkit-box-sizing: border-box; /* webkit */
+ -moz-box-sizing: border-box; /* firefox */
+ box-sizing: border-box; /* css3 */
+}
+
+.select2-container .select2-choice {
+ display: block;
+ height: 26px;
+ padding: 0 0 0 8px;
+ overflow: hidden;
+ position: relative;
+
+ border: 1px solid #aaa;
+ white-space: nowrap;
+ line-height: 26px;
+ color: #444;
+ text-decoration: none;
+
+ border-radius: 4px;
+
+ background-clip: padding-box;
+
+ -webkit-touch-callout: none;
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+
+ background-color: #fff;
+ background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
+ background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
+ background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
+ background-image: linear-gradient(to top, #eee 0%, #fff 50%);
+}
+
+html[dir="rtl"] .select2-container .select2-choice {
+ padding: 0 8px 0 0;
+}
+
+.select2-container.select2-drop-above .select2-choice {
+ border-bottom-color: #aaa;
+
+ border-radius: 0 0 4px 4px;
+
+ background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
+ background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
+ background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
+ background-image: linear-gradient(to bottom, #eee 0%, #fff 90%);
+}
+
+.select2-container.select2-allowclear .select2-choice .select2-chosen {
+ margin-right: 42px;
+}
+
+.select2-container .select2-choice > .select2-chosen {
+ margin-right: 26px;
+ display: block;
+ overflow: hidden;
+
+ white-space: nowrap;
+
+ text-overflow: ellipsis;
+ float: none;
+ width: auto;
+}
+
+html[dir="rtl"] .select2-container .select2-choice > .select2-chosen {
+ margin-left: 26px;
+ margin-right: 0;
+}
+
+.select2-container .select2-choice abbr {
+ display: none;
+ width: 12px;
+ height: 12px;
+ position: absolute;
+ right: 24px;
+ top: 8px;
+
+ font-size: 1px;
+ text-decoration: none;
+
+ border: 0;
+ background: url('select2.png') right top no-repeat;
+ cursor: pointer;
+ outline: 0;
+}
+
+.select2-container.select2-allowclear .select2-choice abbr {
+ display: inline-block;
+}
+
+.select2-container .select2-choice abbr:hover {
+ background-position: right -11px;
+ cursor: pointer;
+}
+
+.select2-drop-mask {
+ border: 0;
+ margin: 0;
+ padding: 0;
+ position: fixed;
+ left: 0;
+ top: 0;
+ min-height: 100%;
+ min-width: 100%;
+ height: auto;
+ width: auto;
+ opacity: 0;
+ z-index: 9998;
+ /* styles required for IE to work */
+ background-color: #fff;
+ filter: alpha(opacity=0);
+}
+
+.select2-drop {
+ width: 100%;
+ margin-top: -1px;
+ position: absolute;
+ z-index: 9999;
+ top: 100%;
+
+ background: #fff;
+ color: #000;
+ border: 1px solid #aaa;
+ border-top: 0;
+
+ border-radius: 0 0 4px 4px;
+
+ -webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
+ box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
+}
+
+.select2-drop.select2-drop-above {
+ margin-top: 1px;
+ border-top: 1px solid #aaa;
+ border-bottom: 0;
+
+ border-radius: 4px 4px 0 0;
+
+ -webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
+ box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
+}
+
+.select2-drop-active {
+ border: 1px solid #5897fb;
+ border-top: none;
+}
+
+.select2-drop.select2-drop-above.select2-drop-active {
+ border-top: 1px solid #5897fb;
+}
+
+.select2-drop-auto-width {
+ border-top: 1px solid #aaa;
+ width: auto;
+}
+
+.select2-drop-auto-width .select2-search {
+ padding-top: 4px;
+}
+
+.select2-container .select2-choice .select2-arrow {
+ display: inline-block;
+ width: 18px;
+ height: 100%;
+ position: absolute;
+ right: 0;
+ top: 0;
+
+ border-left: 1px solid #aaa;
+ border-radius: 0 4px 4px 0;
+
+ background-clip: padding-box;
+
+ background: #ccc;
+ background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
+ background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
+ background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
+ background-image: linear-gradient(to top, #ccc 0%, #eee 60%);
+}
+
+html[dir="rtl"] .select2-container .select2-choice .select2-arrow {
+ left: 0;
+ right: auto;
+
+ border-left: none;
+ border-right: 1px solid #aaa;
+ border-radius: 4px 0 0 4px;
+}
+
+.select2-container .select2-choice .select2-arrow b {
+ display: block;
+ width: 100%;
+ height: 100%;
+ background: url('select2.png') no-repeat 0 1px;
+}
+
+html[dir="rtl"] .select2-container .select2-choice .select2-arrow b {
+ background-position: 2px 1px;
+}
+
+.select2-search {
+ display: inline-block;
+ width: 100%;
+ min-height: 26px;
+ margin: 0;
+ padding-left: 4px;
+ padding-right: 4px;
+
+ position: relative;
+ z-index: 10000;
+
+ white-space: nowrap;
+}
+
+.select2-search input {
+ width: 100%;
+ height: auto !important;
+ min-height: 26px;
+ padding: 4px 20px 4px 5px;
+ margin: 0;
+
+ outline: 0;
+ font-family: sans-serif;
+ font-size: 1em;
+
+ border: 1px solid #aaa;
+ border-radius: 0;
+
+ -webkit-box-shadow: none;
+ box-shadow: none;
+
+ background: #fff url('select2.png') no-repeat 100% -22px;
+ background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
+ background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
+ background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
+ background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
+}
+
+html[dir="rtl"] .select2-search input {
+ padding: 4px 5px 4px 20px;
+
+ background: #fff url('select2.png') no-repeat -37px -22px;
+ background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
+ background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
+ background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
+ background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
+}
+
+.select2-drop.select2-drop-above .select2-search input {
+ margin-top: 4px;
+}
+
+.select2-search input.select2-active {
+ background: #fff url('select2-spinner.gif') no-repeat 100%;
+ background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
+ background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
+ background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
+ background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
+}
+
+.select2-container-active .select2-choice,
+.select2-container-active .select2-choices {
+ border: 1px solid #5897fb;
+ outline: none;
+
+ -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
+ box-shadow: 0 0 5px rgba(0, 0, 0, .3);
+}
+
+.select2-dropdown-open .select2-choice {
+ border-bottom-color: transparent;
+ -webkit-box-shadow: 0 1px 0 #fff inset;
+ box-shadow: 0 1px 0 #fff inset;
+
+ border-bottom-left-radius: 0;
+ border-bottom-right-radius: 0;
+
+ background-color: #eee;
+ background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
+ background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
+ background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
+ background-image: linear-gradient(to top, #fff 0%, #eee 50%);
+}
+
+.select2-dropdown-open.select2-drop-above .select2-choice,
+.select2-dropdown-open.select2-drop-above .select2-choices {
+ border: 1px solid #5897fb;
+ border-top-color: transparent;
+
+ background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
+ background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
+ background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
+ background-image: linear-gradient(to bottom, #fff 0%, #eee 50%);
+}
+
+.select2-dropdown-open .select2-choice .select2-arrow {
+ background: transparent;
+ border-left: none;
+ filter: none;
+}
+html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow {
+ border-right: none;
+}
+
+.select2-dropdown-open .select2-choice .select2-arrow b {
+ background-position: -18px 1px;
+}
+
+html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b {
+ background-position: -16px 1px;
+}
+
+.select2-hidden-accessible {
+ border: 0;
+ clip: rect(0 0 0 0);
+ height: 1px;
+ margin: -1px;
+ overflow: hidden;
+ padding: 0;
+ position: absolute;
+ width: 1px;
+}
+
+/* results */
+.select2-results {
+ max-height: 200px;
+ padding: 0 0 0 4px;
+ margin: 4px 4px 4px 0;
+ position: relative;
+ overflow-x: hidden;
+ overflow-y: auto;
+ -webkit-tap-highlight-color: rgba(0, 0, 0, 0);
+}
+
+html[dir="rtl"] .select2-results {
+ padding: 0 4px 0 0;
+ margin: 4px 0 4px 4px;
+}
+
+.select2-results ul.select2-result-sub {
+ margin: 0;
+ padding-left: 0;
+}
+
+.select2-results li {
+ list-style: none;
+ display: list-item;
+ background-image: none;
+}
+
+.select2-results li.select2-result-with-children > .select2-result-label {
+ font-weight: bold;
+}
+
+.select2-results .select2-result-label {
+ padding: 3px 7px 4px;
+ margin: 0;
+ cursor: pointer;
+
+ min-height: 1em;
+
+ -webkit-touch-callout: none;
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+}
+
+.select2-results-dept-1 .select2-result-label { padding-left: 20px }
+.select2-results-dept-2 .select2-result-label { padding-left: 40px }
+.select2-results-dept-3 .select2-result-label { padding-left: 60px }
+.select2-results-dept-4 .select2-result-label { padding-left: 80px }
+.select2-results-dept-5 .select2-result-label { padding-left: 100px }
+.select2-results-dept-6 .select2-result-label { padding-left: 110px }
+.select2-results-dept-7 .select2-result-label { padding-left: 120px }
+
+.select2-results .select2-highlighted {
+ background: #3875d7;
+ color: #fff;
+}
+
+.select2-results li em {
+ background: #feffde;
+ font-style: normal;
+}
+
+.select2-results .select2-highlighted em {
+ background: transparent;
+}
+
+.select2-results .select2-highlighted ul {
+ background: #fff;
+ color: #000;
+}
+
+.select2-results .select2-no-results,
+.select2-results .select2-searching,
+.select2-results .select2-ajax-error,
+.select2-results .select2-selection-limit {
+ background: #f4f4f4;
+ display: list-item;
+ padding-left: 5px;
+}
+
+/*
+disabled look for disabled choices in the results dropdown
+*/
+.select2-results .select2-disabled.select2-highlighted {
+ color: #666;
+ background: #f4f4f4;
+ display: list-item;
+ cursor: default;
+}
+.select2-results .select2-disabled {
+ background: #f4f4f4;
+ display: list-item;
+ cursor: default;
+}
+
+.select2-results .select2-selected {
+ display: none;
+}
+
+.select2-more-results.select2-active {
+ background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
+}
+
+.select2-results .select2-ajax-error {
+ background: rgba(255, 50, 50, .2);
+}
+
+.select2-more-results {
+ background: #f4f4f4;
+ display: list-item;
+}
+
+/* disabled styles */
+
+.select2-container.select2-container-disabled .select2-choice {
+ background-color: #f4f4f4;
+ background-image: none;
+ border: 1px solid #ddd;
+ cursor: default;
+}
+
+.select2-container.select2-container-disabled .select2-choice .select2-arrow {
+ background-color: #f4f4f4;
+ background-image: none;
+ border-left: 0;
+}
+
+.select2-container.select2-container-disabled .select2-choice abbr {
+ display: none;
+}
+
+
+/* multiselect */
+
+.select2-container-multi .select2-choices {
+ height: auto !important;
+ height: 1%;
+ margin: 0;
+ padding: 0 5px 0 0;
+ position: relative;
+
+ border: 1px solid #aaa;
+ cursor: text;
+ overflow: hidden;
+
+ background-color: #fff;
+ background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
+ background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
+ background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
+ background-image: linear-gradient(to bottom, #eee 1%, #fff 15%);
+}
+
+html[dir="rtl"] .select2-container-multi .select2-choices {
+ padding: 0 0 0 5px;
+}
+
+.select2-locked {
+ padding: 3px 5px 3px 5px !important;
+}
+
+.select2-container-multi .select2-choices {
+ min-height: 26px;
+}
+
+.select2-container-multi.select2-container-active .select2-choices {
+ border: 1px solid #5897fb;
+ outline: none;
+
+ -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
+ box-shadow: 0 0 5px rgba(0, 0, 0, .3);
+}
+.select2-container-multi .select2-choices li {
+ float: left;
+ list-style: none;
+}
+html[dir="rtl"] .select2-container-multi .select2-choices li
+{
+ float: right;
+}
+.select2-container-multi .select2-choices .select2-search-field {
+ margin: 0;
+ padding: 0;
+ white-space: nowrap;
+}
+
+.select2-container-multi .select2-choices .select2-search-field input {
+ padding: 5px;
+ margin: 1px 0;
+
+ font-family: sans-serif;
+ font-size: 100%;
+ color: #666;
+ outline: 0;
+ border: 0;
+ -webkit-box-shadow: none;
+ box-shadow: none;
+ background: transparent !important;
+}
+
+.select2-container-multi .select2-choices .select2-search-field input.select2-active {
+ background: #fff url('select2-spinner.gif') no-repeat 100% !important;
+}
+
+.select2-default {
+ color: #999 !important;
+}
+
+.select2-container-multi .select2-choices .select2-search-choice {
+ padding: 3px 5px 3px 18px;
+ margin: 3px 0 3px 5px;
+ position: relative;
+
+ line-height: 13px;
+ color: #333;
+ cursor: default;
+ border: 1px solid #aaaaaa;
+
+ border-radius: 3px;
+
+ -webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
+ box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
+
+ background-clip: padding-box;
+
+ -webkit-touch-callout: none;
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+
+ background-color: #e4e4e4;
+ filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0);
+ background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
+ background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
+ background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
+ background-image: linear-gradient(to bottom, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
+}
+html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice
+{
+ margin: 3px 5px 3px 0;
+ padding: 3px 18px 3px 5px;
+}
+.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
+ cursor: default;
+}
+.select2-container-multi .select2-choices .select2-search-choice-focus {
+ background: #d4d4d4;
+}
+
+.select2-search-choice-close {
+ display: block;
+ width: 12px;
+ height: 13px;
+ position: absolute;
+ right: 3px;
+ top: 4px;
+
+ font-size: 1px;
+ outline: none;
+ background: url('select2.png') right top no-repeat;
+}
+html[dir="rtl"] .select2-search-choice-close {
+ right: auto;
+ left: 3px;
+}
+
+.select2-container-multi .select2-search-choice-close {
+ left: 3px;
+}
+
+html[dir="rtl"] .select2-container-multi .select2-search-choice-close {
+ left: auto;
+ right: 2px;
+}
+
+.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
+ background-position: right -11px;
+}
+.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
+ background-position: right -11px;
+}
+
+/* disabled styles */
+.select2-container-multi.select2-container-disabled .select2-choices {
+ background-color: #f4f4f4;
+ background-image: none;
+ border: 1px solid #ddd;
+ cursor: default;
+}
+
+.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
+ padding: 3px 5px 3px 5px;
+ border: 1px solid #ddd;
+ background-image: none;
+ background-color: #f4f4f4;
+}
+
+.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none;
+ background: none;
+}
+/* end multiselect */
+
+
+.select2-result-selectable .select2-match,
+.select2-result-unselectable .select2-match {
+ text-decoration: underline;
+}
+
+.select2-offscreen, .select2-offscreen:focus {
+ clip: rect(0 0 0 0) !important;
+ width: 1px !important;
+ height: 1px !important;
+ border: 0 !important;
+ margin: 0 !important;
+ padding: 0 !important;
+ overflow: hidden !important;
+ position: absolute !important;
+ outline: 0 !important;
+ left: 0px !important;
+ top: 0px !important;
+}
+
+.select2-display-none {
+ display: none;
+}
+
+.select2-measure-scrollbar {
+ position: absolute;
+ top: -10000px;
+ left: -10000px;
+ width: 100px;
+ height: 100px;
+ overflow: scroll;
+}
+
+/* Retina-ize icons */
+
+@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) {
+ .select2-search input,
+ .select2-search-choice-close,
+ .select2-container .select2-choice abbr,
+ .select2-container .select2-choice .select2-arrow b {
+ background-image: url('select2x2.png') !important;
+ background-repeat: no-repeat !important;
+ background-size: 60px 40px !important;
+ }
+
+ .select2-search input {
+ background-position: 100% -21px !important;
+ }
+}
diff --git a/htdocs/includes/jquery/plugins/select2/select2.jquery.json b/htdocs/includes/jquery/plugins/select2/select2.jquery.json
new file mode 100644
index 00000000000..b005d8a2017
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2.jquery.json
@@ -0,0 +1,36 @@
+{
+ "name": "select2",
+ "title": "Select2",
+ "description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
+ "keywords": [
+ "select",
+ "autocomplete",
+ "typeahead",
+ "dropdown",
+ "multiselect",
+ "tag",
+ "tagging"
+ ],
+ "version": "3.5.2",
+ "author": {
+ "name": "Igor Vaynberg",
+ "url": "https://github.com/ivaynberg"
+ },
+ "licenses": [
+ {
+ "type": "Apache",
+ "url": "http://www.apache.org/licenses/LICENSE-2.0"
+ },
+ {
+ "type": "GPL v2",
+ "url": "http://www.gnu.org/licenses/gpl-2.0.html"
+ }
+ ],
+ "bugs": "https://github.com/ivaynberg/select2/issues",
+ "homepage": "http://ivaynberg.github.com/select2",
+ "docs": "http://ivaynberg.github.com/select2/",
+ "download": "https://github.com/ivaynberg/select2/tags",
+ "dependencies": {
+ "jquery": ">=1.7.1"
+ }
+}
diff --git a/htdocs/includes/jquery/plugins/select2/select2.js b/htdocs/includes/jquery/plugins/select2/select2.js
new file mode 100644
index 00000000000..7590b822953
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2.js
@@ -0,0 +1,3541 @@
+/*
+Copyright 2012 Igor Vaynberg
+
+Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
+
+This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
+General Public License version 2 (the "GPL License"). You may choose either license to govern your
+use of this software only upon the condition that you accept all of the terms of either the Apache
+License or the GPL License.
+
+You may obtain a copy of the Apache License and the GPL License at:
+
+ http://www.apache.org/licenses/LICENSE-2.0
+ http://www.gnu.org/licenses/gpl-2.0.html
+
+Unless required by applicable law or agreed to in writing, software distributed under the
+Apache License or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
+CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for
+the specific language governing permissions and limitations under the Apache License and the GPL License.
+*/
+(function ($) {
+ if(typeof $.fn.each2 == "undefined") {
+ $.extend($.fn, {
+ /*
+ * 4-10 times faster .each replacement
+ * use it carefully, as it overrides jQuery context of element on each iteration
+ */
+ each2 : function (c) {
+ var j = $([0]), i = -1, l = this.length;
+ while (
+ ++i < l
+ && (j.context = j[0] = this[i])
+ && c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object
+ );
+ return this;
+ }
+ });
+ }
+})(jQuery);
+
+(function ($, undefined) {
+ "use strict";
+ /*global document, window, jQuery, console */
+
+ if (window.Select2 !== undefined) {
+ return;
+ }
+
+ var AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer,
+ lastMousePosition={x:0,y:0}, $document, scrollBarDimensions,
+
+ KEY = {
+ TAB: 9,
+ ENTER: 13,
+ ESC: 27,
+ SPACE: 32,
+ LEFT: 37,
+ UP: 38,
+ RIGHT: 39,
+ DOWN: 40,
+ SHIFT: 16,
+ CTRL: 17,
+ ALT: 18,
+ PAGE_UP: 33,
+ PAGE_DOWN: 34,
+ HOME: 36,
+ END: 35,
+ BACKSPACE: 8,
+ DELETE: 46,
+ isArrow: function (k) {
+ k = k.which ? k.which : k;
+ switch (k) {
+ case KEY.LEFT:
+ case KEY.RIGHT:
+ case KEY.UP:
+ case KEY.DOWN:
+ return true;
+ }
+ return false;
+ },
+ isControl: function (e) {
+ var k = e.which;
+ switch (k) {
+ case KEY.SHIFT:
+ case KEY.CTRL:
+ case KEY.ALT:
+ return true;
+ }
+
+ if (e.metaKey) return true;
+
+ return false;
+ },
+ isFunctionKey: function (k) {
+ k = k.which ? k.which : k;
+ return k >= 112 && k <= 123;
+ }
+ },
+ MEASURE_SCROLLBAR_TEMPLATE = "
",
+
+ DIACRITICS = {"\u24B6":"A","\uFF21":"A","\u00C0":"A","\u00C1":"A","\u00C2":"A","\u1EA6":"A","\u1EA4":"A","\u1EAA":"A","\u1EA8":"A","\u00C3":"A","\u0100":"A","\u0102":"A","\u1EB0":"A","\u1EAE":"A","\u1EB4":"A","\u1EB2":"A","\u0226":"A","\u01E0":"A","\u00C4":"A","\u01DE":"A","\u1EA2":"A","\u00C5":"A","\u01FA":"A","\u01CD":"A","\u0200":"A","\u0202":"A","\u1EA0":"A","\u1EAC":"A","\u1EB6":"A","\u1E00":"A","\u0104":"A","\u023A":"A","\u2C6F":"A","\uA732":"AA","\u00C6":"AE","\u01FC":"AE","\u01E2":"AE","\uA734":"AO","\uA736":"AU","\uA738":"AV","\uA73A":"AV","\uA73C":"AY","\u24B7":"B","\uFF22":"B","\u1E02":"B","\u1E04":"B","\u1E06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24B8":"C","\uFF23":"C","\u0106":"C","\u0108":"C","\u010A":"C","\u010C":"C","\u00C7":"C","\u1E08":"C","\u0187":"C","\u023B":"C","\uA73E":"C","\u24B9":"D","\uFF24":"D","\u1E0A":"D","\u010E":"D","\u1E0C":"D","\u1E10":"D","\u1E12":"D","\u1E0E":"D","\u0110":"D","\u018B":"D","\u018A":"D","\u0189":"D","\uA779":"D","\u01F1":"DZ","\u01C4":"DZ","\u01F2":"Dz","\u01C5":"Dz","\u24BA":"E","\uFF25":"E","\u00C8":"E","\u00C9":"E","\u00CA":"E","\u1EC0":"E","\u1EBE":"E","\u1EC4":"E","\u1EC2":"E","\u1EBC":"E","\u0112":"E","\u1E14":"E","\u1E16":"E","\u0114":"E","\u0116":"E","\u00CB":"E","\u1EBA":"E","\u011A":"E","\u0204":"E","\u0206":"E","\u1EB8":"E","\u1EC6":"E","\u0228":"E","\u1E1C":"E","\u0118":"E","\u1E18":"E","\u1E1A":"E","\u0190":"E","\u018E":"E","\u24BB":"F","\uFF26":"F","\u1E1E":"F","\u0191":"F","\uA77B":"F","\u24BC":"G","\uFF27":"G","\u01F4":"G","\u011C":"G","\u1E20":"G","\u011E":"G","\u0120":"G","\u01E6":"G","\u0122":"G","\u01E4":"G","\u0193":"G","\uA7A0":"G","\uA77D":"G","\uA77E":"G","\u24BD":"H","\uFF28":"H","\u0124":"H","\u1E22":"H","\u1E26":"H","\u021E":"H","\u1E24":"H","\u1E28":"H","\u1E2A":"H","\u0126":"H","\u2C67":"H","\u2C75":"H","\uA78D":"H","\u24BE":"I","\uFF29":"I","\u00CC":"I","\u00CD":"I","\u00CE":"I","\u0128":"I","\u012A":"I","\u012C":"I","\u0130":"I","\u00CF":"I","\u1E2E":"I","\u1EC8":"I","\u01CF":"I","\u0208":"I","\u020A":"I","\u1ECA":"I","\u012E":"I","\u1E2C":"I","\u0197":"I","\u24BF":"J","\uFF2A":"J","\u0134":"J","\u0248":"J","\u24C0":"K","\uFF2B":"K","\u1E30":"K","\u01E8":"K","\u1E32":"K","\u0136":"K","\u1E34":"K","\u0198":"K","\u2C69":"K","\uA740":"K","\uA742":"K","\uA744":"K","\uA7A2":"K","\u24C1":"L","\uFF2C":"L","\u013F":"L","\u0139":"L","\u013D":"L","\u1E36":"L","\u1E38":"L","\u013B":"L","\u1E3C":"L","\u1E3A":"L","\u0141":"L","\u023D":"L","\u2C62":"L","\u2C60":"L","\uA748":"L","\uA746":"L","\uA780":"L","\u01C7":"LJ","\u01C8":"Lj","\u24C2":"M","\uFF2D":"M","\u1E3E":"M","\u1E40":"M","\u1E42":"M","\u2C6E":"M","\u019C":"M","\u24C3":"N","\uFF2E":"N","\u01F8":"N","\u0143":"N","\u00D1":"N","\u1E44":"N","\u0147":"N","\u1E46":"N","\u0145":"N","\u1E4A":"N","\u1E48":"N","\u0220":"N","\u019D":"N","\uA790":"N","\uA7A4":"N","\u01CA":"NJ","\u01CB":"Nj","\u24C4":"O","\uFF2F":"O","\u00D2":"O","\u00D3":"O","\u00D4":"O","\u1ED2":"O","\u1ED0":"O","\u1ED6":"O","\u1ED4":"O","\u00D5":"O","\u1E4C":"O","\u022C":"O","\u1E4E":"O","\u014C":"O","\u1E50":"O","\u1E52":"O","\u014E":"O","\u022E":"O","\u0230":"O","\u00D6":"O","\u022A":"O","\u1ECE":"O","\u0150":"O","\u01D1":"O","\u020C":"O","\u020E":"O","\u01A0":"O","\u1EDC":"O","\u1EDA":"O","\u1EE0":"O","\u1EDE":"O","\u1EE2":"O","\u1ECC":"O","\u1ED8":"O","\u01EA":"O","\u01EC":"O","\u00D8":"O","\u01FE":"O","\u0186":"O","\u019F":"O","\uA74A":"O","\uA74C":"O","\u01A2":"OI","\uA74E":"OO","\u0222":"OU","\u24C5":"P","\uFF30":"P","\u1E54":"P","\u1E56":"P","\u01A4":"P","\u2C63":"P","\uA750":"P","\uA752":"P","\uA754":"P","\u24C6":"Q","\uFF31":"Q","\uA756":"Q","\uA758":"Q","\u024A":"Q","\u24C7":"R","\uFF32":"R","\u0154":"R","\u1E58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1E5A":"R","\u1E5C":"R","\u0156":"R","\u1E5E":"R","\u024C":"R","\u2C64":"R","\uA75A":"R","\uA7A6":"R","\uA782":"R","\u24C8":"S","\uFF33":"S","\u1E9E":"S","\u015A":"S","\u1E64":"S","\u015C":"S","\u1E60":"S","\u0160":"S","\u1E66":"S","\u1E62":"S","\u1E68":"S","\u0218":"S","\u015E":"S","\u2C7E":"S","\uA7A8":"S","\uA784":"S","\u24C9":"T","\uFF34":"T","\u1E6A":"T","\u0164":"T","\u1E6C":"T","\u021A":"T","\u0162":"T","\u1E70":"T","\u1E6E":"T","\u0166":"T","\u01AC":"T","\u01AE":"T","\u023E":"T","\uA786":"T","\uA728":"TZ","\u24CA":"U","\uFF35":"U","\u00D9":"U","\u00DA":"U","\u00DB":"U","\u0168":"U","\u1E78":"U","\u016A":"U","\u1E7A":"U","\u016C":"U","\u00DC":"U","\u01DB":"U","\u01D7":"U","\u01D5":"U","\u01D9":"U","\u1EE6":"U","\u016E":"U","\u0170":"U","\u01D3":"U","\u0214":"U","\u0216":"U","\u01AF":"U","\u1EEA":"U","\u1EE8":"U","\u1EEE":"U","\u1EEC":"U","\u1EF0":"U","\u1EE4":"U","\u1E72":"U","\u0172":"U","\u1E76":"U","\u1E74":"U","\u0244":"U","\u24CB":"V","\uFF36":"V","\u1E7C":"V","\u1E7E":"V","\u01B2":"V","\uA75E":"V","\u0245":"V","\uA760":"VY","\u24CC":"W","\uFF37":"W","\u1E80":"W","\u1E82":"W","\u0174":"W","\u1E86":"W","\u1E84":"W","\u1E88":"W","\u2C72":"W","\u24CD":"X","\uFF38":"X","\u1E8A":"X","\u1E8C":"X","\u24CE":"Y","\uFF39":"Y","\u1EF2":"Y","\u00DD":"Y","\u0176":"Y","\u1EF8":"Y","\u0232":"Y","\u1E8E":"Y","\u0178":"Y","\u1EF6":"Y","\u1EF4":"Y","\u01B3":"Y","\u024E":"Y","\u1EFE":"Y","\u24CF":"Z","\uFF3A":"Z","\u0179":"Z","\u1E90":"Z","\u017B":"Z","\u017D":"Z","\u1E92":"Z","\u1E94":"Z","\u01B5":"Z","\u0224":"Z","\u2C7F":"Z","\u2C6B":"Z","\uA762":"Z","\u24D0":"a","\uFF41":"a","\u1E9A":"a","\u00E0":"a","\u00E1":"a","\u00E2":"a","\u1EA7":"a","\u1EA5":"a","\u1EAB":"a","\u1EA9":"a","\u00E3":"a","\u0101":"a","\u0103":"a","\u1EB1":"a","\u1EAF":"a","\u1EB5":"a","\u1EB3":"a","\u0227":"a","\u01E1":"a","\u00E4":"a","\u01DF":"a","\u1EA3":"a","\u00E5":"a","\u01FB":"a","\u01CE":"a","\u0201":"a","\u0203":"a","\u1EA1":"a","\u1EAD":"a","\u1EB7":"a","\u1E01":"a","\u0105":"a","\u2C65":"a","\u0250":"a","\uA733":"aa","\u00E6":"ae","\u01FD":"ae","\u01E3":"ae","\uA735":"ao","\uA737":"au","\uA739":"av","\uA73B":"av","\uA73D":"ay","\u24D1":"b","\uFF42":"b","\u1E03":"b","\u1E05":"b","\u1E07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24D2":"c","\uFF43":"c","\u0107":"c","\u0109":"c","\u010B":"c","\u010D":"c","\u00E7":"c","\u1E09":"c","\u0188":"c","\u023C":"c","\uA73F":"c","\u2184":"c","\u24D3":"d","\uFF44":"d","\u1E0B":"d","\u010F":"d","\u1E0D":"d","\u1E11":"d","\u1E13":"d","\u1E0F":"d","\u0111":"d","\u018C":"d","\u0256":"d","\u0257":"d","\uA77A":"d","\u01F3":"dz","\u01C6":"dz","\u24D4":"e","\uFF45":"e","\u00E8":"e","\u00E9":"e","\u00EA":"e","\u1EC1":"e","\u1EBF":"e","\u1EC5":"e","\u1EC3":"e","\u1EBD":"e","\u0113":"e","\u1E15":"e","\u1E17":"e","\u0115":"e","\u0117":"e","\u00EB":"e","\u1EBB":"e","\u011B":"e","\u0205":"e","\u0207":"e","\u1EB9":"e","\u1EC7":"e","\u0229":"e","\u1E1D":"e","\u0119":"e","\u1E19":"e","\u1E1B":"e","\u0247":"e","\u025B":"e","\u01DD":"e","\u24D5":"f","\uFF46":"f","\u1E1F":"f","\u0192":"f","\uA77C":"f","\u24D6":"g","\uFF47":"g","\u01F5":"g","\u011D":"g","\u1E21":"g","\u011F":"g","\u0121":"g","\u01E7":"g","\u0123":"g","\u01E5":"g","\u0260":"g","\uA7A1":"g","\u1D79":"g","\uA77F":"g","\u24D7":"h","\uFF48":"h","\u0125":"h","\u1E23":"h","\u1E27":"h","\u021F":"h","\u1E25":"h","\u1E29":"h","\u1E2B":"h","\u1E96":"h","\u0127":"h","\u2C68":"h","\u2C76":"h","\u0265":"h","\u0195":"hv","\u24D8":"i","\uFF49":"i","\u00EC":"i","\u00ED":"i","\u00EE":"i","\u0129":"i","\u012B":"i","\u012D":"i","\u00EF":"i","\u1E2F":"i","\u1EC9":"i","\u01D0":"i","\u0209":"i","\u020B":"i","\u1ECB":"i","\u012F":"i","\u1E2D":"i","\u0268":"i","\u0131":"i","\u24D9":"j","\uFF4A":"j","\u0135":"j","\u01F0":"j","\u0249":"j","\u24DA":"k","\uFF4B":"k","\u1E31":"k","\u01E9":"k","\u1E33":"k","\u0137":"k","\u1E35":"k","\u0199":"k","\u2C6A":"k","\uA741":"k","\uA743":"k","\uA745":"k","\uA7A3":"k","\u24DB":"l","\uFF4C":"l","\u0140":"l","\u013A":"l","\u013E":"l","\u1E37":"l","\u1E39":"l","\u013C":"l","\u1E3D":"l","\u1E3B":"l","\u017F":"l","\u0142":"l","\u019A":"l","\u026B":"l","\u2C61":"l","\uA749":"l","\uA781":"l","\uA747":"l","\u01C9":"lj","\u24DC":"m","\uFF4D":"m","\u1E3F":"m","\u1E41":"m","\u1E43":"m","\u0271":"m","\u026F":"m","\u24DD":"n","\uFF4E":"n","\u01F9":"n","\u0144":"n","\u00F1":"n","\u1E45":"n","\u0148":"n","\u1E47":"n","\u0146":"n","\u1E4B":"n","\u1E49":"n","\u019E":"n","\u0272":"n","\u0149":"n","\uA791":"n","\uA7A5":"n","\u01CC":"nj","\u24DE":"o","\uFF4F":"o","\u00F2":"o","\u00F3":"o","\u00F4":"o","\u1ED3":"o","\u1ED1":"o","\u1ED7":"o","\u1ED5":"o","\u00F5":"o","\u1E4D":"o","\u022D":"o","\u1E4F":"o","\u014D":"o","\u1E51":"o","\u1E53":"o","\u014F":"o","\u022F":"o","\u0231":"o","\u00F6":"o","\u022B":"o","\u1ECF":"o","\u0151":"o","\u01D2":"o","\u020D":"o","\u020F":"o","\u01A1":"o","\u1EDD":"o","\u1EDB":"o","\u1EE1":"o","\u1EDF":"o","\u1EE3":"o","\u1ECD":"o","\u1ED9":"o","\u01EB":"o","\u01ED":"o","\u00F8":"o","\u01FF":"o","\u0254":"o","\uA74B":"o","\uA74D":"o","\u0275":"o","\u01A3":"oi","\u0223":"ou","\uA74F":"oo","\u24DF":"p","\uFF50":"p","\u1E55":"p","\u1E57":"p","\u01A5":"p","\u1D7D":"p","\uA751":"p","\uA753":"p","\uA755":"p","\u24E0":"q","\uFF51":"q","\u024B":"q","\uA757":"q","\uA759":"q","\u24E1":"r","\uFF52":"r","\u0155":"r","\u1E59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1E5B":"r","\u1E5D":"r","\u0157":"r","\u1E5F":"r","\u024D":"r","\u027D":"r","\uA75B":"r","\uA7A7":"r","\uA783":"r","\u24E2":"s","\uFF53":"s","\u00DF":"s","\u015B":"s","\u1E65":"s","\u015D":"s","\u1E61":"s","\u0161":"s","\u1E67":"s","\u1E63":"s","\u1E69":"s","\u0219":"s","\u015F":"s","\u023F":"s","\uA7A9":"s","\uA785":"s","\u1E9B":"s","\u24E3":"t","\uFF54":"t","\u1E6B":"t","\u1E97":"t","\u0165":"t","\u1E6D":"t","\u021B":"t","\u0163":"t","\u1E71":"t","\u1E6F":"t","\u0167":"t","\u01AD":"t","\u0288":"t","\u2C66":"t","\uA787":"t","\uA729":"tz","\u24E4":"u","\uFF55":"u","\u00F9":"u","\u00FA":"u","\u00FB":"u","\u0169":"u","\u1E79":"u","\u016B":"u","\u1E7B":"u","\u016D":"u","\u00FC":"u","\u01DC":"u","\u01D8":"u","\u01D6":"u","\u01DA":"u","\u1EE7":"u","\u016F":"u","\u0171":"u","\u01D4":"u","\u0215":"u","\u0217":"u","\u01B0":"u","\u1EEB":"u","\u1EE9":"u","\u1EEF":"u","\u1EED":"u","\u1EF1":"u","\u1EE5":"u","\u1E73":"u","\u0173":"u","\u1E77":"u","\u1E75":"u","\u0289":"u","\u24E5":"v","\uFF56":"v","\u1E7D":"v","\u1E7F":"v","\u028B":"v","\uA75F":"v","\u028C":"v","\uA761":"vy","\u24E6":"w","\uFF57":"w","\u1E81":"w","\u1E83":"w","\u0175":"w","\u1E87":"w","\u1E85":"w","\u1E98":"w","\u1E89":"w","\u2C73":"w","\u24E7":"x","\uFF58":"x","\u1E8B":"x","\u1E8D":"x","\u24E8":"y","\uFF59":"y","\u1EF3":"y","\u00FD":"y","\u0177":"y","\u1EF9":"y","\u0233":"y","\u1E8F":"y","\u00FF":"y","\u1EF7":"y","\u1E99":"y","\u1EF5":"y","\u01B4":"y","\u024F":"y","\u1EFF":"y","\u24E9":"z","\uFF5A":"z","\u017A":"z","\u1E91":"z","\u017C":"z","\u017E":"z","\u1E93":"z","\u1E95":"z","\u01B6":"z","\u0225":"z","\u0240":"z","\u2C6C":"z","\uA763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038A":"\u0399","\u03AA":"\u0399","\u038C":"\u039F","\u038E":"\u03A5","\u03AB":"\u03A5","\u038F":"\u03A9","\u03AC":"\u03B1","\u03AD":"\u03B5","\u03AE":"\u03B7","\u03AF":"\u03B9","\u03CA":"\u03B9","\u0390":"\u03B9","\u03CC":"\u03BF","\u03CD":"\u03C5","\u03CB":"\u03C5","\u03B0":"\u03C5","\u03C9":"\u03C9","\u03C2":"\u03C3"};
+
+ $document = $(document);
+
+ nextUid=(function() { var counter=1; return function() { return counter++; }; }());
+
+
+ function reinsertElement(element) {
+ var placeholder = $(document.createTextNode(''));
+
+ element.before(placeholder);
+ placeholder.before(element);
+ placeholder.remove();
+ }
+
+ function stripDiacritics(str) {
+ // Used 'uni range + named function' from http://jsperf.com/diacritics/18
+ function match(a) {
+ return DIACRITICS[a] || a;
+ }
+
+ return str.replace(/[^\u0000-\u007E]/g, match);
+ }
+
+ function indexOf(value, array) {
+ var i = 0, l = array.length;
+ for (; i < l; i = i + 1) {
+ if (equal(value, array[i])) return i;
+ }
+ return -1;
+ }
+
+ function measureScrollbar () {
+ var $template = $( MEASURE_SCROLLBAR_TEMPLATE );
+ $template.appendTo(document.body);
+
+ var dim = {
+ width: $template.width() - $template[0].clientWidth,
+ height: $template.height() - $template[0].clientHeight
+ };
+ $template.remove();
+
+ return dim;
+ }
+
+ /**
+ * Compares equality of a and b
+ * @param a
+ * @param b
+ */
+ function equal(a, b) {
+ if (a === b) return true;
+ if (a === undefined || b === undefined) return false;
+ if (a === null || b === null) return false;
+ // Check whether 'a' or 'b' is a string (primitive or object).
+ // The concatenation of an empty string (+'') converts its argument to a string's primitive.
+ if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object
+ if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object
+ return false;
+ }
+
+ /**
+ * Splits the string into an array of values, transforming each value. An empty array is returned for nulls or empty
+ * strings
+ * @param string
+ * @param separator
+ */
+ function splitVal(string, separator, transform) {
+ var val, i, l;
+ if (string === null || string.length < 1) return [];
+ val = string.split(separator);
+ for (i = 0, l = val.length; i < l; i = i + 1) val[i] = transform(val[i]);
+ return val;
+ }
+
+ function getSideBorderPadding(element) {
+ return element.outerWidth(false) - element.width();
+ }
+
+ function installKeyUpChangeEvent(element) {
+ var key="keyup-change-value";
+ element.on("keydown", function () {
+ if ($.data(element, key) === undefined) {
+ $.data(element, key, element.val());
+ }
+ });
+ element.on("keyup", function () {
+ var val= $.data(element, key);
+ if (val !== undefined && element.val() !== val) {
+ $.removeData(element, key);
+ element.trigger("keyup-change");
+ }
+ });
+ }
+
+
+ /**
+ * filters mouse events so an event is fired only if the mouse moved.
+ *
+ * filters out mouse events that occur when mouse is stationary but
+ * the elements under the pointer are scrolled.
+ */
+ function installFilteredMouseMove(element) {
+ element.on("mousemove", function (e) {
+ var lastpos = lastMousePosition;
+ if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) {
+ $(e.target).trigger("mousemove-filtered", e);
+ }
+ });
+ }
+
+ /**
+ * Debounces a function. Returns a function that calls the original fn function only if no invocations have been made
+ * within the last quietMillis milliseconds.
+ *
+ * @param quietMillis number of milliseconds to wait before invoking fn
+ * @param fn function to be debounced
+ * @param ctx object to be used as this reference within fn
+ * @return debounced version of fn
+ */
+ function debounce(quietMillis, fn, ctx) {
+ ctx = ctx || undefined;
+ var timeout;
+ return function () {
+ var args = arguments;
+ window.clearTimeout(timeout);
+ timeout = window.setTimeout(function() {
+ fn.apply(ctx, args);
+ }, quietMillis);
+ };
+ }
+
+ function installDebouncedScroll(threshold, element) {
+ var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);});
+ element.on("scroll", function (e) {
+ if (indexOf(e.target, element.get()) >= 0) notify(e);
+ });
+ }
+
+ function focus($el) {
+ if ($el[0] === document.activeElement) return;
+
+ /* set the focus in a 0 timeout - that way the focus is set after the processing
+ of the current event has finished - which seems like the only reliable way
+ to set focus */
+ window.setTimeout(function() {
+ var el=$el[0], pos=$el.val().length, range;
+
+ $el.focus();
+
+ /* make sure el received focus so we do not error out when trying to manipulate the caret.
+ sometimes modals or others listeners may steal it after its set */
+ var isVisible = (el.offsetWidth > 0 || el.offsetHeight > 0);
+ if (isVisible && el === document.activeElement) {
+
+ /* after the focus is set move the caret to the end, necessary when we val()
+ just before setting focus */
+ if(el.setSelectionRange)
+ {
+ el.setSelectionRange(pos, pos);
+ }
+ else if (el.createTextRange) {
+ range = el.createTextRange();
+ range.collapse(false);
+ range.select();
+ }
+ }
+ }, 0);
+ }
+
+ function getCursorInfo(el) {
+ el = $(el)[0];
+ var offset = 0;
+ var length = 0;
+ if ('selectionStart' in el) {
+ offset = el.selectionStart;
+ length = el.selectionEnd - offset;
+ } else if ('selection' in document) {
+ el.focus();
+ var sel = document.selection.createRange();
+ length = document.selection.createRange().text.length;
+ sel.moveStart('character', -el.value.length);
+ offset = sel.text.length - length;
+ }
+ return { offset: offset, length: length };
+ }
+
+ function killEvent(event) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ function killEventImmediately(event) {
+ event.preventDefault();
+ event.stopImmediatePropagation();
+ }
+
+ function measureTextWidth(e) {
+ if (!sizer){
+ var style = e[0].currentStyle || window.getComputedStyle(e[0], null);
+ sizer = $(document.createElement("div")).css({
+ position: "absolute",
+ left: "-10000px",
+ top: "-10000px",
+ display: "none",
+ fontSize: style.fontSize,
+ fontFamily: style.fontFamily,
+ fontStyle: style.fontStyle,
+ fontWeight: style.fontWeight,
+ letterSpacing: style.letterSpacing,
+ textTransform: style.textTransform,
+ whiteSpace: "nowrap"
+ });
+ sizer.attr("class","select2-sizer");
+ $(document.body).append(sizer);
+ }
+ sizer.text(e.val());
+ return sizer.width();
+ }
+
+ function syncCssClasses(dest, src, adapter) {
+ var classes, replacements = [], adapted;
+
+ classes = $.trim(dest.attr("class"));
+
+ if (classes) {
+ classes = '' + classes; // for IE which returns object
+
+ $(classes.split(/\s+/)).each2(function() {
+ if (this.indexOf("select2-") === 0) {
+ replacements.push(this);
+ }
+ });
+ }
+
+ classes = $.trim(src.attr("class"));
+
+ if (classes) {
+ classes = '' + classes; // for IE which returns object
+
+ $(classes.split(/\s+/)).each2(function() {
+ if (this.indexOf("select2-") !== 0) {
+ adapted = adapter(this);
+
+ if (adapted) {
+ replacements.push(adapted);
+ }
+ }
+ });
+ }
+
+ dest.attr("class", replacements.join(" "));
+ }
+
+
+ function markMatch(text, term, markup, escapeMarkup) {
+ var match=stripDiacritics(text.toUpperCase()).indexOf(stripDiacritics(term.toUpperCase())),
+ tl=term.length;
+
+ if (match<0) {
+ markup.push(escapeMarkup(text));
+ return;
+ }
+
+ markup.push(escapeMarkup(text.substring(0, match)));
+ markup.push("");
+ markup.push(escapeMarkup(text.substring(match, match + tl)));
+ markup.push(" ");
+ markup.push(escapeMarkup(text.substring(match + tl, text.length)));
+ }
+
+ function defaultEscapeMarkup(markup) {
+ var replace_map = {
+ '\\': '\',
+ '&': '&',
+ '<': '<',
+ '>': '>',
+ '"': '"',
+ "'": ''',
+ "/": '/'
+ };
+
+ return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
+ return replace_map[match];
+ });
+ }
+
+ /**
+ * Produces an ajax-based query function
+ *
+ * @param options object containing configuration parameters
+ * @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax
+ * @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax
+ * @param options.url url for the data
+ * @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url.
+ * @param options.dataType request data type: ajax, jsonp, other datatypes supported by jQuery's $.ajax function or the transport function if specified
+ * @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often
+ * @param options.results a function(remoteData, pageNumber, query) that converts data returned form the remote request to the format expected by Select2.
+ * The expected format is an object containing the following keys:
+ * results array of objects that will be used as choices
+ * more (optional) boolean indicating whether there are more results available
+ * Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true}
+ */
+ function ajax(options) {
+ var timeout, // current scheduled but not yet executed request
+ handler = null,
+ quietMillis = options.quietMillis || 100,
+ ajaxUrl = options.url,
+ self = this;
+
+ return function (query) {
+ window.clearTimeout(timeout);
+ timeout = window.setTimeout(function () {
+ var data = options.data, // ajax data function
+ url = ajaxUrl, // ajax url string or function
+ transport = options.transport || $.fn.select2.ajaxDefaults.transport,
+ // deprecated - to be removed in 4.0 - use params instead
+ deprecated = {
+ type: options.type || 'GET', // set type of request (GET or POST)
+ cache: options.cache || false,
+ jsonpCallback: options.jsonpCallback||undefined,
+ dataType: options.dataType||"json"
+ },
+ params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated);
+
+ data = data ? data.call(self, query.term, query.page, query.context) : null;
+ url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url;
+
+ if (handler && typeof handler.abort === "function") { handler.abort(); }
+
+ if (options.params) {
+ if ($.isFunction(options.params)) {
+ $.extend(params, options.params.call(self));
+ } else {
+ $.extend(params, options.params);
+ }
+ }
+
+ $.extend(params, {
+ url: url,
+ dataType: options.dataType,
+ data: data,
+ success: function (data) {
+ // TODO - replace query.page with query so users have access to term, page, etc.
+ // added query as third paramter to keep backwards compatibility
+ var results = options.results(data, query.page, query);
+ query.callback(results);
+ },
+ error: function(jqXHR, textStatus, errorThrown){
+ var results = {
+ hasError: true,
+ jqXHR: jqXHR,
+ textStatus: textStatus,
+ errorThrown: errorThrown
+ };
+
+ query.callback(results);
+ }
+ });
+ handler = transport.call(self, params);
+ }, quietMillis);
+ };
+ }
+
+ /**
+ * Produces a query function that works with a local array
+ *
+ * @param options object containing configuration parameters. The options parameter can either be an array or an
+ * object.
+ *
+ * If the array form is used it is assumed that it contains objects with 'id' and 'text' keys.
+ *
+ * If the object form is used it is assumed that it contains 'data' and 'text' keys. The 'data' key should contain
+ * an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text'
+ * key can either be a String in which case it is expected that each element in the 'data' array has a key with the
+ * value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract
+ * the text.
+ */
+ function local(options) {
+ var data = options, // data elements
+ dataText,
+ tmp,
+ text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search
+
+ if ($.isArray(data)) {
+ tmp = data;
+ data = { results: tmp };
+ }
+
+ if ($.isFunction(data) === false) {
+ tmp = data;
+ data = function() { return tmp; };
+ }
+
+ var dataItem = data();
+ if (dataItem.text) {
+ text = dataItem.text;
+ // if text is not a function we assume it to be a key name
+ if (!$.isFunction(text)) {
+ dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available
+ text = function (item) { return item[dataText]; };
+ }
+ }
+
+ return function (query) {
+ var t = query.term, filtered = { results: [] }, process;
+ if (t === "") {
+ query.callback(data());
+ return;
+ }
+
+ process = function(datum, collection) {
+ var group, attr;
+ datum = datum[0];
+ if (datum.children) {
+ group = {};
+ for (attr in datum) {
+ if (datum.hasOwnProperty(attr)) group[attr]=datum[attr];
+ }
+ group.children=[];
+ $(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); });
+ if (group.children.length || query.matcher(t, text(group), datum)) {
+ collection.push(group);
+ }
+ } else {
+ if (query.matcher(t, text(datum), datum)) {
+ collection.push(datum);
+ }
+ }
+ };
+
+ $(data().results).each2(function(i, datum) { process(datum, filtered.results); });
+ query.callback(filtered);
+ };
+ }
+
+ // TODO javadoc
+ function tags(data) {
+ var isFunc = $.isFunction(data);
+ return function (query) {
+ var t = query.term, filtered = {results: []};
+ var result = isFunc ? data(query) : data;
+ if ($.isArray(result)) {
+ $(result).each(function () {
+ var isObject = this.text !== undefined,
+ text = isObject ? this.text : this;
+ if (t === "" || query.matcher(t, text)) {
+ filtered.results.push(isObject ? this : {id: this, text: this});
+ }
+ });
+ query.callback(filtered);
+ }
+ };
+ }
+
+ /**
+ * Checks if the formatter function should be used.
+ *
+ * Throws an error if it is not a function. Returns true if it should be used,
+ * false if no formatting should be performed.
+ *
+ * @param formatter
+ */
+ function checkFormatter(formatter, formatterName) {
+ if ($.isFunction(formatter)) return true;
+ if (!formatter) return false;
+ if (typeof(formatter) === 'string') return true;
+ throw new Error(formatterName +" must be a string, function, or falsy value");
+ }
+
+ /**
+ * Returns a given value
+ * If given a function, returns its output
+ *
+ * @param val string|function
+ * @param context value of "this" to be passed to function
+ * @returns {*}
+ */
+ function evaluate(val, context) {
+ if ($.isFunction(val)) {
+ var args = Array.prototype.slice.call(arguments, 2);
+ return val.apply(context, args);
+ }
+ return val;
+ }
+
+ function countResults(results) {
+ var count = 0;
+ $.each(results, function(i, item) {
+ if (item.children) {
+ count += countResults(item.children);
+ } else {
+ count++;
+ }
+ });
+ return count;
+ }
+
+ /**
+ * Default tokenizer. This function uses breaks the input on substring match of any string from the
+ * opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those
+ * two options have to be defined in order for the tokenizer to work.
+ *
+ * @param input text user has typed so far or pasted into the search field
+ * @param selection currently selected choices
+ * @param selectCallback function(choice) callback tho add the choice to selection
+ * @param opts select2's opts
+ * @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value
+ */
+ function defaultTokenizer(input, selection, selectCallback, opts) {
+ var original = input, // store the original so we can compare and know if we need to tell the search to update its text
+ dupe = false, // check for whether a token we extracted represents a duplicate selected choice
+ token, // token
+ index, // position at which the separator was found
+ i, l, // looping variables
+ separator; // the matched separator
+
+ if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined;
+
+ while (true) {
+ index = -1;
+
+ for (i = 0, l = opts.tokenSeparators.length; i < l; i++) {
+ separator = opts.tokenSeparators[i];
+ index = input.indexOf(separator);
+ if (index >= 0) break;
+ }
+
+ if (index < 0) break; // did not find any token separator in the input string, bail
+
+ token = input.substring(0, index);
+ input = input.substring(index + separator.length);
+
+ if (token.length > 0) {
+ token = opts.createSearchChoice.call(this, token, selection);
+ if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) {
+ dupe = false;
+ for (i = 0, l = selection.length; i < l; i++) {
+ if (equal(opts.id(token), opts.id(selection[i]))) {
+ dupe = true; break;
+ }
+ }
+
+ if (!dupe) selectCallback(token);
+ }
+ }
+ }
+
+ if (original!==input) return input;
+ }
+
+ function cleanupJQueryElements() {
+ var self = this;
+
+ $.each(arguments, function (i, element) {
+ self[element].remove();
+ self[element] = null;
+ });
+ }
+
+ /**
+ * Creates a new class
+ *
+ * @param superClass
+ * @param methods
+ */
+ function clazz(SuperClass, methods) {
+ var constructor = function () {};
+ constructor.prototype = new SuperClass;
+ constructor.prototype.constructor = constructor;
+ constructor.prototype.parent = SuperClass.prototype;
+ constructor.prototype = $.extend(constructor.prototype, methods);
+ return constructor;
+ }
+
+ AbstractSelect2 = clazz(Object, {
+
+ // abstract
+ bind: function (func) {
+ var self = this;
+ return function () {
+ func.apply(self, arguments);
+ };
+ },
+
+ // abstract
+ init: function (opts) {
+ var results, search, resultsSelector = ".select2-results";
+
+ // prepare options
+ this.opts = opts = this.prepareOpts(opts);
+
+ this.id=opts.id;
+
+ // destroy if called on an existing component
+ if (opts.element.data("select2") !== undefined &&
+ opts.element.data("select2") !== null) {
+ opts.element.data("select2").destroy();
+ }
+
+ this.container = this.createContainer();
+
+ this.liveRegion = $('.select2-hidden-accessible');
+ if (this.liveRegion.length == 0) {
+ this.liveRegion = $("", {
+ role: "status",
+ "aria-live": "polite"
+ })
+ .addClass("select2-hidden-accessible")
+ .appendTo(document.body);
+ }
+
+ this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid());
+ this.containerEventName= this.containerId
+ .replace(/([.])/g, '_')
+ .replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1');
+ this.container.attr("id", this.containerId);
+
+ this.container.attr("title", opts.element.attr("title"));
+
+ this.body = $(document.body);
+
+ syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
+
+ this.container.attr("style", opts.element.attr("style"));
+ this.container.css(evaluate(opts.containerCss, this.opts.element));
+ this.container.addClass(evaluate(opts.containerCssClass, this.opts.element));
+
+ this.elementTabIndex = this.opts.element.attr("tabindex");
+
+ // swap container for the element
+ this.opts.element
+ .data("select2", this)
+ .attr("tabindex", "-1")
+ .before(this.container)
+ .on("click.select2", killEvent); // do not leak click events
+
+ this.container.data("select2", this);
+
+ this.dropdown = this.container.find(".select2-drop");
+
+ syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
+
+ this.dropdown.addClass(evaluate(opts.dropdownCssClass, this.opts.element));
+ this.dropdown.data("select2", this);
+ this.dropdown.on("click", killEvent);
+
+ this.results = results = this.container.find(resultsSelector);
+ this.search = search = this.container.find("input.select2-input");
+
+ this.queryCount = 0;
+ this.resultsPage = 0;
+ this.context = null;
+
+ // initialize the container
+ this.initContainer();
+
+ this.container.on("click", killEvent);
+
+ installFilteredMouseMove(this.results);
+
+ this.dropdown.on("mousemove-filtered", resultsSelector, this.bind(this.highlightUnderEvent));
+ this.dropdown.on("touchstart touchmove touchend", resultsSelector, this.bind(function (event) {
+ this._touchEvent = true;
+ this.highlightUnderEvent(event);
+ }));
+ this.dropdown.on("touchmove", resultsSelector, this.bind(this.touchMoved));
+ this.dropdown.on("touchstart touchend", resultsSelector, this.bind(this.clearTouchMoved));
+
+ // Waiting for a click event on touch devices to select option and hide dropdown
+ // otherwise click will be triggered on an underlying element
+ this.dropdown.on('click', this.bind(function (event) {
+ if (this._touchEvent) {
+ this._touchEvent = false;
+ this.selectHighlighted();
+ }
+ }));
+
+ installDebouncedScroll(80, this.results);
+ this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded));
+
+ // do not propagate change event from the search field out of the component
+ $(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();});
+ $(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();});
+
+ // if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel
+ if ($.fn.mousewheel) {
+ results.mousewheel(function (e, delta, deltaX, deltaY) {
+ var top = results.scrollTop();
+ if (deltaY > 0 && top - deltaY <= 0) {
+ results.scrollTop(0);
+ killEvent(e);
+ } else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) {
+ results.scrollTop(results.get(0).scrollHeight - results.height());
+ killEvent(e);
+ }
+ });
+ }
+
+ installKeyUpChangeEvent(search);
+ search.on("keyup-change input paste", this.bind(this.updateResults));
+ search.on("focus", function () { search.addClass("select2-focused"); });
+ search.on("blur", function () { search.removeClass("select2-focused");});
+
+ this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) {
+ if ($(e.target).closest(".select2-result-selectable").length > 0) {
+ this.highlightUnderEvent(e);
+ this.selectHighlighted(e);
+ }
+ }));
+
+ // trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening
+ // for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's
+ // dom it will trigger the popup close, which is not what we want
+ // focusin can cause focus wars between modals and select2 since the dropdown is outside the modal.
+ this.dropdown.on("click mouseup mousedown touchstart touchend focusin", function (e) { e.stopPropagation(); });
+
+ this.nextSearchTerm = undefined;
+
+ if ($.isFunction(this.opts.initSelection)) {
+ // initialize selection based on the current value of the source element
+ this.initSelection();
+
+ // if the user has provided a function that can set selection based on the value of the source element
+ // we monitor the change event on the element and trigger it, allowing for two way synchronization
+ this.monitorSource();
+ }
+
+ if (opts.maximumInputLength !== null) {
+ this.search.attr("maxlength", opts.maximumInputLength);
+ }
+
+ var disabled = opts.element.prop("disabled");
+ if (disabled === undefined) disabled = false;
+ this.enable(!disabled);
+
+ var readonly = opts.element.prop("readonly");
+ if (readonly === undefined) readonly = false;
+ this.readonly(readonly);
+
+ // Calculate size of scrollbar
+ scrollBarDimensions = scrollBarDimensions || measureScrollbar();
+
+ this.autofocus = opts.element.prop("autofocus");
+ opts.element.prop("autofocus", false);
+ if (this.autofocus) this.focus();
+
+ this.search.attr("placeholder", opts.searchInputPlaceholder);
+ },
+
+ // abstract
+ destroy: function () {
+ var element=this.opts.element, select2 = element.data("select2"), self = this;
+
+ this.close();
+
+ if (element.length && element[0].detachEvent && self._sync) {
+ element.each(function () {
+ if (self._sync) {
+ this.detachEvent("onpropertychange", self._sync);
+ }
+ });
+ }
+ if (this.propertyObserver) {
+ this.propertyObserver.disconnect();
+ this.propertyObserver = null;
+ }
+ this._sync = null;
+
+ if (select2 !== undefined) {
+ select2.container.remove();
+ select2.liveRegion.remove();
+ select2.dropdown.remove();
+ element
+ .show()
+ .removeData("select2")
+ .off(".select2")
+ .prop("autofocus", this.autofocus || false);
+ if (this.elementTabIndex) {
+ element.attr({tabindex: this.elementTabIndex});
+ } else {
+ element.removeAttr("tabindex");
+ }
+ element.show();
+ }
+
+ cleanupJQueryElements.call(this,
+ "container",
+ "liveRegion",
+ "dropdown",
+ "results",
+ "search"
+ );
+ },
+
+ // abstract
+ optionToData: function(element) {
+ if (element.is("option")) {
+ return {
+ id:element.prop("value"),
+ text:element.text(),
+ element: element.get(),
+ css: element.attr("class"),
+ disabled: element.prop("disabled"),
+ locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true)
+ };
+ } else if (element.is("optgroup")) {
+ return {
+ text:element.attr("label"),
+ children:[],
+ element: element.get(),
+ css: element.attr("class")
+ };
+ }
+ },
+
+ // abstract
+ prepareOpts: function (opts) {
+ var element, select, idKey, ajaxUrl, self = this;
+
+ element = opts.element;
+
+ if (element.get(0).tagName.toLowerCase() === "select") {
+ this.select = select = opts.element;
+ }
+
+ if (select) {
+ // these options are not allowed when attached to a select because they are picked up off the element itself
+ $.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () {
+ if (this in opts) {
+ throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a element.");
+ }
+ });
+ }
+
+ opts = $.extend({}, {
+ populateResults: function(container, results, query) {
+ var populate, id=this.opts.id, liveRegion=this.liveRegion;
+
+ populate=function(results, container, depth) {
+
+ var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted;
+
+ results = opts.sortResults(results, container, query);
+
+ // collect the created nodes for bulk append
+ var nodes = [];
+ for (i = 0, l = results.length; i < l; i = i + 1) {
+
+ result=results[i];
+
+ disabled = (result.disabled === true);
+ selectable = (!disabled) && (id(result) !== undefined);
+
+ compound=result.children && result.children.length > 0;
+
+ node=$(" ");
+ node.addClass("select2-results-dept-"+depth);
+ node.addClass("select2-result");
+ node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable");
+ if (disabled) { node.addClass("select2-disabled"); }
+ if (compound) { node.addClass("select2-result-with-children"); }
+ node.addClass(self.opts.formatResultCssClass(result));
+ node.attr("role", "presentation");
+
+ label=$(document.createElement("div"));
+ label.addClass("select2-result-label");
+ label.attr("id", "select2-result-label-" + nextUid());
+ label.attr("role", "option");
+
+ formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup);
+ if (formatted!==undefined) {
+ label.html(formatted);
+ node.append(label);
+ }
+
+
+ if (compound) {
+
+ innerContainer=$("");
+ innerContainer.addClass("select2-result-sub");
+ populate(result.children, innerContainer, depth+1);
+ node.append(innerContainer);
+ }
+
+ node.data("select2-data", result);
+ nodes.push(node[0]);
+ }
+
+ // bulk append the created nodes
+ container.append(nodes);
+ liveRegion.text(opts.formatMatches(results.length));
+ };
+
+ populate(results, container, 0);
+ }
+ }, $.fn.select2.defaults, opts);
+
+ if (typeof(opts.id) !== "function") {
+ idKey = opts.id;
+ opts.id = function (e) { return e[idKey]; };
+ }
+
+ if ($.isArray(opts.element.data("select2Tags"))) {
+ if ("tags" in opts) {
+ throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id");
+ }
+ opts.tags=opts.element.data("select2Tags");
+ }
+
+ if (select) {
+ opts.query = this.bind(function (query) {
+ var data = { results: [], more: false },
+ term = query.term,
+ children, placeholderOption, process;
+
+ process=function(element, collection) {
+ var group;
+ if (element.is("option")) {
+ if (query.matcher(term, element.text(), element)) {
+ collection.push(self.optionToData(element));
+ }
+ } else if (element.is("optgroup")) {
+ group=self.optionToData(element);
+ element.children().each2(function(i, elm) { process(elm, group.children); });
+ if (group.children.length>0) {
+ collection.push(group);
+ }
+ }
+ };
+
+ children=element.children();
+
+ // ignore the placeholder option if there is one
+ if (this.getPlaceholder() !== undefined && children.length > 0) {
+ placeholderOption = this.getPlaceholderOption();
+ if (placeholderOption) {
+ children=children.not(placeholderOption);
+ }
+ }
+
+ children.each2(function(i, elm) { process(elm, data.results); });
+
+ query.callback(data);
+ });
+ // this is needed because inside val() we construct choices from options and their id is hardcoded
+ opts.id=function(e) { return e.id; };
+ } else {
+ if (!("query" in opts)) {
+
+ if ("ajax" in opts) {
+ ajaxUrl = opts.element.data("ajax-url");
+ if (ajaxUrl && ajaxUrl.length > 0) {
+ opts.ajax.url = ajaxUrl;
+ }
+ opts.query = ajax.call(opts.element, opts.ajax);
+ } else if ("data" in opts) {
+ opts.query = local(opts.data);
+ } else if ("tags" in opts) {
+ opts.query = tags(opts.tags);
+ if (opts.createSearchChoice === undefined) {
+ opts.createSearchChoice = function (term) { return {id: $.trim(term), text: $.trim(term)}; };
+ }
+ if (opts.initSelection === undefined) {
+ opts.initSelection = function (element, callback) {
+ var data = [];
+ $(splitVal(element.val(), opts.separator, opts.transformVal)).each(function () {
+ var obj = { id: this, text: this },
+ tags = opts.tags;
+ if ($.isFunction(tags)) tags=tags();
+ $(tags).each(function() { if (equal(this.id, obj.id)) { obj = this; return false; } });
+ data.push(obj);
+ });
+
+ callback(data);
+ };
+ }
+ }
+ }
+ }
+ if (typeof(opts.query) !== "function") {
+ throw "query function not defined for Select2 " + opts.element.attr("id");
+ }
+
+ if (opts.createSearchChoicePosition === 'top') {
+ opts.createSearchChoicePosition = function(list, item) { list.unshift(item); };
+ }
+ else if (opts.createSearchChoicePosition === 'bottom') {
+ opts.createSearchChoicePosition = function(list, item) { list.push(item); };
+ }
+ else if (typeof(opts.createSearchChoicePosition) !== "function") {
+ throw "invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";
+ }
+
+ return opts;
+ },
+
+ /**
+ * Monitor the original element for changes and update select2 accordingly
+ */
+ // abstract
+ monitorSource: function () {
+ var el = this.opts.element, observer, self = this;
+
+ el.on("change.select2", this.bind(function (e) {
+ if (this.opts.element.data("select2-change-triggered") !== true) {
+ this.initSelection();
+ }
+ }));
+
+ this._sync = this.bind(function () {
+
+ // sync enabled state
+ var disabled = el.prop("disabled");
+ if (disabled === undefined) disabled = false;
+ this.enable(!disabled);
+
+ var readonly = el.prop("readonly");
+ if (readonly === undefined) readonly = false;
+ this.readonly(readonly);
+
+ if (this.container) {
+ syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
+ this.container.addClass(evaluate(this.opts.containerCssClass, this.opts.element));
+ }
+
+ if (this.dropdown) {
+ syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
+ this.dropdown.addClass(evaluate(this.opts.dropdownCssClass, this.opts.element));
+ }
+
+ });
+
+ // IE8-10 (IE9/10 won't fire propertyChange via attachEventListener)
+ if (el.length && el[0].attachEvent) {
+ el.each(function() {
+ this.attachEvent("onpropertychange", self._sync);
+ });
+ }
+
+ // safari, chrome, firefox, IE11
+ observer = window.MutationObserver || window.WebKitMutationObserver|| window.MozMutationObserver;
+ if (observer !== undefined) {
+ if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
+ this.propertyObserver = new observer(function (mutations) {
+ $.each(mutations, self._sync);
+ });
+ this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false });
+ }
+ },
+
+ // abstract
+ triggerSelect: function(data) {
+ var evt = $.Event("select2-selecting", { val: this.id(data), object: data, choice: data });
+ this.opts.element.trigger(evt);
+ return !evt.isDefaultPrevented();
+ },
+
+ /**
+ * Triggers the change event on the source element
+ */
+ // abstract
+ triggerChange: function (details) {
+
+ details = details || {};
+ details= $.extend({}, details, { type: "change", val: this.val() });
+ // prevents recursive triggering
+ this.opts.element.data("select2-change-triggered", true);
+ this.opts.element.trigger(details);
+ this.opts.element.data("select2-change-triggered", false);
+
+ // some validation frameworks ignore the change event and listen instead to keyup, click for selects
+ // so here we trigger the click event manually
+ this.opts.element.click();
+
+ // ValidationEngine ignores the change event and listens instead to blur
+ // so here we trigger the blur event manually if so desired
+ if (this.opts.blurOnChange)
+ this.opts.element.blur();
+ },
+
+ //abstract
+ isInterfaceEnabled: function()
+ {
+ return this.enabledInterface === true;
+ },
+
+ // abstract
+ enableInterface: function() {
+ var enabled = this._enabled && !this._readonly,
+ disabled = !enabled;
+
+ if (enabled === this.enabledInterface) return false;
+
+ this.container.toggleClass("select2-container-disabled", disabled);
+ this.close();
+ this.enabledInterface = enabled;
+
+ return true;
+ },
+
+ // abstract
+ enable: function(enabled) {
+ if (enabled === undefined) enabled = true;
+ if (this._enabled === enabled) return;
+ this._enabled = enabled;
+
+ this.opts.element.prop("disabled", !enabled);
+ this.enableInterface();
+ },
+
+ // abstract
+ disable: function() {
+ this.enable(false);
+ },
+
+ // abstract
+ readonly: function(enabled) {
+ if (enabled === undefined) enabled = false;
+ if (this._readonly === enabled) return;
+ this._readonly = enabled;
+
+ this.opts.element.prop("readonly", enabled);
+ this.enableInterface();
+ },
+
+ // abstract
+ opened: function () {
+ return (this.container) ? this.container.hasClass("select2-dropdown-open") : false;
+ },
+
+ // abstract
+ positionDropdown: function() {
+ var $dropdown = this.dropdown,
+ container = this.container,
+ offset = container.offset(),
+ height = container.outerHeight(false),
+ width = container.outerWidth(false),
+ dropHeight = $dropdown.outerHeight(false),
+ $window = $(window),
+ windowWidth = $window.width(),
+ windowHeight = $window.height(),
+ viewPortRight = $window.scrollLeft() + windowWidth,
+ viewportBottom = $window.scrollTop() + windowHeight,
+ dropTop = offset.top + height,
+ dropLeft = offset.left,
+ enoughRoomBelow = dropTop + dropHeight <= viewportBottom,
+ enoughRoomAbove = (offset.top - dropHeight) >= $window.scrollTop(),
+ dropWidth = $dropdown.outerWidth(false),
+ enoughRoomOnRight = function() {
+ return dropLeft + dropWidth <= viewPortRight;
+ },
+ enoughRoomOnLeft = function() {
+ return offset.left + viewPortRight + container.outerWidth(false) > dropWidth;
+ },
+ aboveNow = $dropdown.hasClass("select2-drop-above"),
+ bodyOffset,
+ above,
+ changeDirection,
+ css,
+ resultsListNode;
+
+ // always prefer the current above/below alignment, unless there is not enough room
+ if (aboveNow) {
+ above = true;
+ if (!enoughRoomAbove && enoughRoomBelow) {
+ changeDirection = true;
+ above = false;
+ }
+ } else {
+ above = false;
+ if (!enoughRoomBelow && enoughRoomAbove) {
+ changeDirection = true;
+ above = true;
+ }
+ }
+
+ //if we are changing direction we need to get positions when dropdown is hidden;
+ if (changeDirection) {
+ $dropdown.hide();
+ offset = this.container.offset();
+ height = this.container.outerHeight(false);
+ width = this.container.outerWidth(false);
+ dropHeight = $dropdown.outerHeight(false);
+ viewPortRight = $window.scrollLeft() + windowWidth;
+ viewportBottom = $window.scrollTop() + windowHeight;
+ dropTop = offset.top + height;
+ dropLeft = offset.left;
+ dropWidth = $dropdown.outerWidth(false);
+ $dropdown.show();
+
+ // fix so the cursor does not move to the left within the search-textbox in IE
+ this.focusSearch();
+ }
+
+ if (this.opts.dropdownAutoWidth) {
+ resultsListNode = $('.select2-results', $dropdown)[0];
+ $dropdown.addClass('select2-drop-auto-width');
+ $dropdown.css('width', '');
+ // Add scrollbar width to dropdown if vertical scrollbar is present
+ dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width);
+ dropWidth > width ? width = dropWidth : dropWidth = width;
+ dropHeight = $dropdown.outerHeight(false);
+ }
+ else {
+ this.container.removeClass('select2-drop-auto-width');
+ }
+
+ //console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow);
+ //console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body.scrollTop(), "enough?", enoughRoomAbove);
+
+ // fix positioning when body has an offset and is not position: static
+ if (this.body.css('position') !== 'static') {
+ bodyOffset = this.body.offset();
+ dropTop -= bodyOffset.top;
+ dropLeft -= bodyOffset.left;
+ }
+
+ if (!enoughRoomOnRight() && enoughRoomOnLeft()) {
+ dropLeft = offset.left + this.container.outerWidth(false) - dropWidth;
+ }
+
+ css = {
+ left: dropLeft,
+ width: width
+ };
+
+ if (above) {
+ css.top = offset.top - dropHeight;
+ css.bottom = 'auto';
+ this.container.addClass("select2-drop-above");
+ $dropdown.addClass("select2-drop-above");
+ }
+ else {
+ css.top = dropTop;
+ css.bottom = 'auto';
+ this.container.removeClass("select2-drop-above");
+ $dropdown.removeClass("select2-drop-above");
+ }
+ css = $.extend(css, evaluate(this.opts.dropdownCss, this.opts.element));
+
+ $dropdown.css(css);
+ },
+
+ // abstract
+ shouldOpen: function() {
+ var event;
+
+ if (this.opened()) return false;
+
+ if (this._enabled === false || this._readonly === true) return false;
+
+ event = $.Event("select2-opening");
+ this.opts.element.trigger(event);
+ return !event.isDefaultPrevented();
+ },
+
+ // abstract
+ clearDropdownAlignmentPreference: function() {
+ // clear the classes used to figure out the preference of where the dropdown should be opened
+ this.container.removeClass("select2-drop-above");
+ this.dropdown.removeClass("select2-drop-above");
+ },
+
+ /**
+ * Opens the dropdown
+ *
+ * @return {Boolean} whether or not dropdown was opened. This method will return false if, for example,
+ * the dropdown is already open, or if the 'open' event listener on the element called preventDefault().
+ */
+ // abstract
+ open: function () {
+
+ if (!this.shouldOpen()) return false;
+
+ this.opening();
+
+ // Only bind the document mousemove when the dropdown is visible
+ $document.on("mousemove.select2Event", function (e) {
+ lastMousePosition.x = e.pageX;
+ lastMousePosition.y = e.pageY;
+ });
+
+ return true;
+ },
+
+ /**
+ * Performs the opening of the dropdown
+ */
+ // abstract
+ opening: function() {
+ var cid = this.containerEventName,
+ scroll = "scroll." + cid,
+ resize = "resize."+cid,
+ orient = "orientationchange."+cid,
+ mask;
+
+ this.container.addClass("select2-dropdown-open").addClass("select2-container-active");
+
+ this.clearDropdownAlignmentPreference();
+
+ if(this.dropdown[0] !== this.body.children().last()[0]) {
+ this.dropdown.detach().appendTo(this.body);
+ }
+
+ // create the dropdown mask if doesn't already exist
+ mask = $("#select2-drop-mask");
+ if (mask.length === 0) {
+ mask = $(document.createElement("div"));
+ mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask");
+ mask.hide();
+ mask.appendTo(this.body);
+ mask.on("mousedown touchstart click", function (e) {
+ // Prevent IE from generating a click event on the body
+ reinsertElement(mask);
+
+ var dropdown = $("#select2-drop"), self;
+ if (dropdown.length > 0) {
+ self=dropdown.data("select2");
+ if (self.opts.selectOnBlur) {
+ self.selectHighlighted({noFocus: true});
+ }
+ self.close();
+ e.preventDefault();
+ e.stopPropagation();
+ }
+ });
+ }
+
+ // ensure the mask is always right before the dropdown
+ if (this.dropdown.prev()[0] !== mask[0]) {
+ this.dropdown.before(mask);
+ }
+
+ // move the global id to the correct dropdown
+ $("#select2-drop").removeAttr("id");
+ this.dropdown.attr("id", "select2-drop");
+
+ // show the elements
+ mask.show();
+
+ this.positionDropdown();
+ this.dropdown.show();
+ this.positionDropdown();
+
+ this.dropdown.addClass("select2-drop-active");
+
+ // attach listeners to events that can change the position of the container and thus require
+ // the position of the dropdown to be updated as well so it does not come unglued from the container
+ var that = this;
+ this.container.parents().add(window).each(function () {
+ $(this).on(resize+" "+scroll+" "+orient, function (e) {
+ if (that.opened()) that.positionDropdown();
+ });
+ });
+
+
+ },
+
+ // abstract
+ close: function () {
+ if (!this.opened()) return;
+
+ var cid = this.containerEventName,
+ scroll = "scroll." + cid,
+ resize = "resize."+cid,
+ orient = "orientationchange."+cid;
+
+ // unbind event listeners
+ this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); });
+
+ this.clearDropdownAlignmentPreference();
+
+ $("#select2-drop-mask").hide();
+ this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id
+ this.dropdown.hide();
+ this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active");
+ this.results.empty();
+
+ // Now that the dropdown is closed, unbind the global document mousemove event
+ $document.off("mousemove.select2Event");
+
+ this.clearSearch();
+ this.search.removeClass("select2-active");
+ this.opts.element.trigger($.Event("select2-close"));
+ },
+
+ /**
+ * Opens control, sets input value, and updates results.
+ */
+ // abstract
+ externalSearch: function (term) {
+ this.open();
+ this.search.val(term);
+ this.updateResults(false);
+ },
+
+ // abstract
+ clearSearch: function () {
+
+ },
+
+ //abstract
+ getMaximumSelectionSize: function() {
+ return evaluate(this.opts.maximumSelectionSize, this.opts.element);
+ },
+
+ // abstract
+ ensureHighlightVisible: function () {
+ var results = this.results, children, index, child, hb, rb, y, more, topOffset;
+
+ index = this.highlight();
+
+ if (index < 0) return;
+
+ if (index == 0) {
+
+ // if the first element is highlighted scroll all the way to the top,
+ // that way any unselectable headers above it will also be scrolled
+ // into view
+
+ results.scrollTop(0);
+ return;
+ }
+
+ children = this.findHighlightableChoices().find('.select2-result-label');
+
+ child = $(children[index]);
+
+ topOffset = (child.offset() || {}).top || 0;
+
+ hb = topOffset + child.outerHeight(true);
+
+ // if this is the last child lets also make sure select2-more-results is visible
+ if (index === children.length - 1) {
+ more = results.find("li.select2-more-results");
+ if (more.length > 0) {
+ hb = more.offset().top + more.outerHeight(true);
+ }
+ }
+
+ rb = results.offset().top + results.outerHeight(false);
+ if (hb > rb) {
+ results.scrollTop(results.scrollTop() + (hb - rb));
+ }
+ y = topOffset - results.offset().top;
+
+ // make sure the top of the element is visible
+ if (y < 0 && child.css('display') != 'none' ) {
+ results.scrollTop(results.scrollTop() + y); // y is negative
+ }
+ },
+
+ // abstract
+ findHighlightableChoices: function() {
+ return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)");
+ },
+
+ // abstract
+ moveHighlight: function (delta) {
+ var choices = this.findHighlightableChoices(),
+ index = this.highlight();
+
+ while (index > -1 && index < choices.length) {
+ index += delta;
+ var choice = $(choices[index]);
+ if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) {
+ this.highlight(index);
+ break;
+ }
+ }
+ },
+
+ // abstract
+ highlight: function (index) {
+ var choices = this.findHighlightableChoices(),
+ choice,
+ data;
+
+ if (arguments.length === 0) {
+ return indexOf(choices.filter(".select2-highlighted")[0], choices.get());
+ }
+
+ if (index >= choices.length) index = choices.length - 1;
+ if (index < 0) index = 0;
+
+ this.removeHighlight();
+
+ choice = $(choices[index]);
+ choice.addClass("select2-highlighted");
+
+ // ensure assistive technology can determine the active choice
+ this.search.attr("aria-activedescendant", choice.find(".select2-result-label").attr("id"));
+
+ this.ensureHighlightVisible();
+
+ this.liveRegion.text(choice.text());
+
+ data = choice.data("select2-data");
+ if (data) {
+ this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data });
+ }
+ },
+
+ removeHighlight: function() {
+ this.results.find(".select2-highlighted").removeClass("select2-highlighted");
+ },
+
+ touchMoved: function() {
+ this._touchMoved = true;
+ },
+
+ clearTouchMoved: function() {
+ this._touchMoved = false;
+ },
+
+ // abstract
+ countSelectableResults: function() {
+ return this.findHighlightableChoices().length;
+ },
+
+ // abstract
+ highlightUnderEvent: function (event) {
+ var el = $(event.target).closest(".select2-result-selectable");
+ if (el.length > 0 && !el.is(".select2-highlighted")) {
+ var choices = this.findHighlightableChoices();
+ this.highlight(choices.index(el));
+ } else if (el.length == 0) {
+ // if we are over an unselectable item remove all highlights
+ this.removeHighlight();
+ }
+ },
+
+ // abstract
+ loadMoreIfNeeded: function () {
+ var results = this.results,
+ more = results.find("li.select2-more-results"),
+ below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible
+ page = this.resultsPage + 1,
+ self=this,
+ term=this.search.val(),
+ context=this.context;
+
+ if (more.length === 0) return;
+ below = more.offset().top - results.offset().top - results.height();
+
+ if (below <= this.opts.loadMorePadding) {
+ more.addClass("select2-active");
+ this.opts.query({
+ element: this.opts.element,
+ term: term,
+ page: page,
+ context: context,
+ matcher: this.opts.matcher,
+ callback: this.bind(function (data) {
+
+ // ignore a response if the select2 has been closed before it was received
+ if (!self.opened()) return;
+
+
+ self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context});
+ self.postprocessResults(data, false, false);
+
+ if (data.more===true) {
+ more.detach().appendTo(results).html(self.opts.escapeMarkup(evaluate(self.opts.formatLoadMore, self.opts.element, page+1)));
+ window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
+ } else {
+ more.remove();
+ }
+ self.positionDropdown();
+ self.resultsPage = page;
+ self.context = data.context;
+ this.opts.element.trigger({ type: "select2-loaded", items: data });
+ })});
+ }
+ },
+
+ /**
+ * Default tokenizer function which does nothing
+ */
+ tokenize: function() {
+
+ },
+
+ /**
+ * @param initial whether or not this is the call to this method right after the dropdown has been opened
+ */
+ // abstract
+ updateResults: function (initial) {
+ var search = this.search,
+ results = this.results,
+ opts = this.opts,
+ data,
+ self = this,
+ input,
+ term = search.val(),
+ lastTerm = $.data(this.container, "select2-last-term"),
+ // sequence number used to drop out-of-order responses
+ queryNumber;
+
+ // prevent duplicate queries against the same term
+ if (initial !== true && lastTerm && equal(term, lastTerm)) return;
+
+ $.data(this.container, "select2-last-term", term);
+
+ // if the search is currently hidden we do not alter the results
+ if (initial !== true && (this.showSearchInput === false || !this.opened())) {
+ return;
+ }
+
+ function postRender() {
+ search.removeClass("select2-active");
+ self.positionDropdown();
+ if (results.find('.select2-no-results,.select2-selection-limit,.select2-searching').length) {
+ self.liveRegion.text(results.text());
+ }
+ else {
+ self.liveRegion.text(self.opts.formatMatches(results.find('.select2-result-selectable:not(".select2-selected")').length));
+ }
+ }
+
+ function render(html) {
+ results.html(html);
+ postRender();
+ }
+
+ queryNumber = ++this.queryCount;
+
+ var maxSelSize = this.getMaximumSelectionSize();
+ if (maxSelSize >=1) {
+ data = this.data();
+ if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) {
+ render("" + evaluate(opts.formatSelectionTooBig, opts.element, maxSelSize) + " ");
+ return;
+ }
+ }
+
+ if (search.val().length < opts.minimumInputLength) {
+ if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) {
+ render("" + evaluate(opts.formatInputTooShort, opts.element, search.val(), opts.minimumInputLength) + " ");
+ } else {
+ render("");
+ }
+ if (initial && this.showSearch) this.showSearch(true);
+ return;
+ }
+
+ if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) {
+ if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) {
+ render("" + evaluate(opts.formatInputTooLong, opts.element, search.val(), opts.maximumInputLength) + " ");
+ } else {
+ render("");
+ }
+ return;
+ }
+
+ if (opts.formatSearching && this.findHighlightableChoices().length === 0) {
+ render("" + evaluate(opts.formatSearching, opts.element) + " ");
+ }
+
+ search.addClass("select2-active");
+
+ this.removeHighlight();
+
+ // give the tokenizer a chance to pre-process the input
+ input = this.tokenize();
+ if (input != undefined && input != null) {
+ search.val(input);
+ }
+
+ this.resultsPage = 1;
+
+ opts.query({
+ element: opts.element,
+ term: search.val(),
+ page: this.resultsPage,
+ context: null,
+ matcher: opts.matcher,
+ callback: this.bind(function (data) {
+ var def; // default choice
+
+ // ignore old responses
+ if (queryNumber != this.queryCount) {
+ return;
+ }
+
+ // ignore a response if the select2 has been closed before it was received
+ if (!this.opened()) {
+ this.search.removeClass("select2-active");
+ return;
+ }
+
+ // handle ajax error
+ if(data.hasError !== undefined && checkFormatter(opts.formatAjaxError, "formatAjaxError")) {
+ render("" + evaluate(opts.formatAjaxError, opts.element, data.jqXHR, data.textStatus, data.errorThrown) + " ");
+ return;
+ }
+
+ // save context, if any
+ this.context = (data.context===undefined) ? null : data.context;
+ // create a default choice and prepend it to the list
+ if (this.opts.createSearchChoice && search.val() !== "") {
+ def = this.opts.createSearchChoice.call(self, search.val(), data.results);
+ if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) {
+ if ($(data.results).filter(
+ function () {
+ return equal(self.id(this), self.id(def));
+ }).length === 0) {
+ this.opts.createSearchChoicePosition(data.results, def);
+ }
+ }
+ }
+
+ if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) {
+ render("" + evaluate(opts.formatNoMatches, opts.element, search.val()) + " ");
+ return;
+ }
+
+ results.empty();
+ self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null});
+
+ if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) {
+ results.append("" + opts.escapeMarkup(evaluate(opts.formatLoadMore, opts.element, this.resultsPage)) + " ");
+ window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
+ }
+
+ this.postprocessResults(data, initial);
+
+ postRender();
+
+ this.opts.element.trigger({ type: "select2-loaded", items: data });
+ })});
+ },
+
+ // abstract
+ cancel: function () {
+ this.close();
+ },
+
+ // abstract
+ blur: function () {
+ // if selectOnBlur == true, select the currently highlighted option
+ if (this.opts.selectOnBlur)
+ this.selectHighlighted({noFocus: true});
+
+ this.close();
+ this.container.removeClass("select2-container-active");
+ // synonymous to .is(':focus'), which is available in jquery >= 1.6
+ if (this.search[0] === document.activeElement) { this.search.blur(); }
+ this.clearSearch();
+ this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
+ },
+
+ // abstract
+ focusSearch: function () {
+ focus(this.search);
+ },
+
+ // abstract
+ selectHighlighted: function (options) {
+ if (this._touchMoved) {
+ this.clearTouchMoved();
+ return;
+ }
+ var index=this.highlight(),
+ highlighted=this.results.find(".select2-highlighted"),
+ data = highlighted.closest('.select2-result').data("select2-data");
+
+ if (data) {
+ this.highlight(index);
+ this.onSelect(data, options);
+ } else if (options && options.noFocus) {
+ this.close();
+ }
+ },
+
+ // abstract
+ getPlaceholder: function () {
+ var placeholderOption;
+ return this.opts.element.attr("placeholder") ||
+ this.opts.element.attr("data-placeholder") || // jquery 1.4 compat
+ this.opts.element.data("placeholder") ||
+ this.opts.placeholder ||
+ ((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined);
+ },
+
+ // abstract
+ getPlaceholderOption: function() {
+ if (this.select) {
+ var firstOption = this.select.children('option').first();
+ if (this.opts.placeholderOption !== undefined ) {
+ //Determine the placeholder option based on the specified placeholderOption setting
+ return (this.opts.placeholderOption === "first" && firstOption) ||
+ (typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select));
+ } else if ($.trim(firstOption.text()) === "" && firstOption.val() === "") {
+ //No explicit placeholder option specified, use the first if it's blank
+ return firstOption;
+ }
+ }
+ },
+
+ /**
+ * Get the desired width for the container element. This is
+ * derived first from option `width` passed to select2, then
+ * the inline 'style' on the original element, and finally
+ * falls back to the jQuery calculated element width.
+ */
+ // abstract
+ initContainerWidth: function () {
+ function resolveContainerWidth() {
+ var style, attrs, matches, i, l, attr;
+
+ if (this.opts.width === "off") {
+ return null;
+ } else if (this.opts.width === "element"){
+ return this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px';
+ } else if (this.opts.width === "copy" || this.opts.width === "resolve") {
+ // check if there is inline style on the element that contains width
+ style = this.opts.element.attr('style');
+ if (style !== undefined) {
+ attrs = style.split(';');
+ for (i = 0, l = attrs.length; i < l; i = i + 1) {
+ attr = attrs[i].replace(/\s/g, '');
+ matches = attr.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i);
+ if (matches !== null && matches.length >= 1)
+ return matches[1];
+ }
+ }
+
+ if (this.opts.width === "resolve") {
+ // next check if css('width') can resolve a width that is percent based, this is sometimes possible
+ // when attached to input type=hidden or elements hidden via css
+ style = this.opts.element.css('width');
+ if (style.indexOf("%") > 0) return style;
+
+ // finally, fallback on the calculated width of the element
+ return (this.opts.element.outerWidth(false) === 0 ? 'auto' : this.opts.element.outerWidth(false) + 'px');
+ }
+
+ return null;
+ } else if ($.isFunction(this.opts.width)) {
+ return this.opts.width();
+ } else {
+ return this.opts.width;
+ }
+ };
+
+ var width = resolveContainerWidth.call(this);
+ if (width !== null) {
+ this.container.css("width", width);
+ }
+ }
+ });
+
+ SingleSelect2 = clazz(AbstractSelect2, {
+
+ // single
+
+ createContainer: function () {
+ var container = $(document.createElement("div")).attr({
+ "class": "select2-container"
+ }).html([
+ "",
+ " ",
+ " ",
+ " ",
+ " ",
+ " ",
+ "",
+ "
",
+ " ",
+ " ",
+ "
",
+ "
",
+ "
"].join(""));
+ return container;
+ },
+
+ // single
+ enableInterface: function() {
+ if (this.parent.enableInterface.apply(this, arguments)) {
+ this.focusser.prop("disabled", !this.isInterfaceEnabled());
+ }
+ },
+
+ // single
+ opening: function () {
+ var el, range, len;
+
+ if (this.opts.minimumResultsForSearch >= 0) {
+ this.showSearch(true);
+ }
+
+ this.parent.opening.apply(this, arguments);
+
+ if (this.showSearchInput !== false) {
+ // IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range
+ // all other browsers handle this just fine
+
+ this.search.val(this.focusser.val());
+ }
+ if (this.opts.shouldFocusInput(this)) {
+ this.search.focus();
+ // move the cursor to the end after focussing, otherwise it will be at the beginning and
+ // new text will appear *before* focusser.val()
+ el = this.search.get(0);
+ if (el.createTextRange) {
+ range = el.createTextRange();
+ range.collapse(false);
+ range.select();
+ } else if (el.setSelectionRange) {
+ len = this.search.val().length;
+ el.setSelectionRange(len, len);
+ }
+ }
+
+ // initializes search's value with nextSearchTerm (if defined by user)
+ // ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
+ if(this.search.val() === "") {
+ if(this.nextSearchTerm != undefined){
+ this.search.val(this.nextSearchTerm);
+ this.search.select();
+ }
+ }
+
+ this.focusser.prop("disabled", true).val("");
+ this.updateResults(true);
+ this.opts.element.trigger($.Event("select2-open"));
+ },
+
+ // single
+ close: function () {
+ if (!this.opened()) return;
+ this.parent.close.apply(this, arguments);
+
+ this.focusser.prop("disabled", false);
+
+ if (this.opts.shouldFocusInput(this)) {
+ this.focusser.focus();
+ }
+ },
+
+ // single
+ focus: function () {
+ if (this.opened()) {
+ this.close();
+ } else {
+ this.focusser.prop("disabled", false);
+ if (this.opts.shouldFocusInput(this)) {
+ this.focusser.focus();
+ }
+ }
+ },
+
+ // single
+ isFocused: function () {
+ return this.container.hasClass("select2-container-active");
+ },
+
+ // single
+ cancel: function () {
+ this.parent.cancel.apply(this, arguments);
+ this.focusser.prop("disabled", false);
+
+ if (this.opts.shouldFocusInput(this)) {
+ this.focusser.focus();
+ }
+ },
+
+ // single
+ destroy: function() {
+ $("label[for='" + this.focusser.attr('id') + "']")
+ .attr('for', this.opts.element.attr("id"));
+ this.parent.destroy.apply(this, arguments);
+
+ cleanupJQueryElements.call(this,
+ "selection",
+ "focusser"
+ );
+ },
+
+ // single
+ initContainer: function () {
+
+ var selection,
+ container = this.container,
+ dropdown = this.dropdown,
+ idSuffix = nextUid(),
+ elementLabel;
+
+ if (this.opts.minimumResultsForSearch < 0) {
+ this.showSearch(false);
+ } else {
+ this.showSearch(true);
+ }
+
+ this.selection = selection = container.find(".select2-choice");
+
+ this.focusser = container.find(".select2-focusser");
+
+ // add aria associations
+ selection.find(".select2-chosen").attr("id", "select2-chosen-"+idSuffix);
+ this.focusser.attr("aria-labelledby", "select2-chosen-"+idSuffix);
+ this.results.attr("id", "select2-results-"+idSuffix);
+ this.search.attr("aria-owns", "select2-results-"+idSuffix);
+
+ // rewrite labels from original element to focusser
+ this.focusser.attr("id", "s2id_autogen"+idSuffix);
+
+ elementLabel = $("label[for='" + this.opts.element.attr("id") + "']");
+ this.opts.element.focus(this.bind(function () { this.focus(); }));
+
+ this.focusser.prev()
+ .text(elementLabel.text())
+ .attr('for', this.focusser.attr('id'));
+
+ // Ensure the original element retains an accessible name
+ var originalTitle = this.opts.element.attr("title");
+ this.opts.element.attr("title", (originalTitle || elementLabel.text()));
+
+ this.focusser.attr("tabindex", this.elementTabIndex);
+
+ // write label for search field using the label from the focusser element
+ this.search.attr("id", this.focusser.attr('id') + '_search');
+
+ this.search.prev()
+ .text($("label[for='" + this.focusser.attr('id') + "']").text())
+ .attr('for', this.search.attr('id'));
+
+ this.search.on("keydown", this.bind(function (e) {
+ if (!this.isInterfaceEnabled()) return;
+
+ // filter 229 keyCodes (input method editor is processing key input)
+ if (229 == e.keyCode) return;
+
+ if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
+ // prevent the page from scrolling
+ killEvent(e);
+ return;
+ }
+
+ switch (e.which) {
+ case KEY.UP:
+ case KEY.DOWN:
+ this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
+ killEvent(e);
+ return;
+ case KEY.ENTER:
+ this.selectHighlighted();
+ killEvent(e);
+ return;
+ case KEY.TAB:
+ this.selectHighlighted({noFocus: true});
+ return;
+ case KEY.ESC:
+ this.cancel(e);
+ killEvent(e);
+ return;
+ }
+ }));
+
+ this.search.on("blur", this.bind(function(e) {
+ // a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown.
+ // without this the search field loses focus which is annoying
+ if (document.activeElement === this.body.get(0)) {
+ window.setTimeout(this.bind(function() {
+ if (this.opened()) {
+ this.search.focus();
+ }
+ }), 0);
+ }
+ }));
+
+ this.focusser.on("keydown", this.bind(function (e) {
+ if (!this.isInterfaceEnabled()) return;
+
+ if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) {
+ return;
+ }
+
+ if (this.opts.openOnEnter === false && e.which === KEY.ENTER) {
+ killEvent(e);
+ return;
+ }
+
+ if (e.which == KEY.DOWN || e.which == KEY.UP
+ || (e.which == KEY.ENTER && this.opts.openOnEnter)) {
+
+ if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return;
+
+ this.open();
+ killEvent(e);
+ return;
+ }
+
+ if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) {
+ if (this.opts.allowClear) {
+ this.clear();
+ }
+ killEvent(e);
+ return;
+ }
+ }));
+
+
+ installKeyUpChangeEvent(this.focusser);
+ this.focusser.on("keyup-change input", this.bind(function(e) {
+ if (this.opts.minimumResultsForSearch >= 0) {
+ e.stopPropagation();
+ if (this.opened()) return;
+ this.open();
+ }
+ }));
+
+ selection.on("mousedown touchstart", "abbr", this.bind(function (e) {
+ if (!this.isInterfaceEnabled()) {
+ return;
+ }
+
+ this.clear();
+ killEventImmediately(e);
+ this.close();
+
+ if (this.selection) {
+ this.selection.focus();
+ }
+ }));
+
+ selection.on("mousedown touchstart", this.bind(function (e) {
+ // Prevent IE from generating a click event on the body
+ reinsertElement(selection);
+
+ if (!this.container.hasClass("select2-container-active")) {
+ this.opts.element.trigger($.Event("select2-focus"));
+ }
+
+ if (this.opened()) {
+ this.close();
+ } else if (this.isInterfaceEnabled()) {
+ this.open();
+ }
+
+ killEvent(e);
+ }));
+
+ dropdown.on("mousedown touchstart", this.bind(function() {
+ if (this.opts.shouldFocusInput(this)) {
+ this.search.focus();
+ }
+ }));
+
+ selection.on("focus", this.bind(function(e) {
+ killEvent(e);
+ }));
+
+ this.focusser.on("focus", this.bind(function(){
+ if (!this.container.hasClass("select2-container-active")) {
+ this.opts.element.trigger($.Event("select2-focus"));
+ }
+ this.container.addClass("select2-container-active");
+ })).on("blur", this.bind(function() {
+ if (!this.opened()) {
+ this.container.removeClass("select2-container-active");
+ this.opts.element.trigger($.Event("select2-blur"));
+ }
+ }));
+ this.search.on("focus", this.bind(function(){
+ if (!this.container.hasClass("select2-container-active")) {
+ this.opts.element.trigger($.Event("select2-focus"));
+ }
+ this.container.addClass("select2-container-active");
+ }));
+
+ this.initContainerWidth();
+ this.opts.element.hide();
+ this.setPlaceholder();
+
+ },
+
+ // single
+ clear: function(triggerChange) {
+ var data=this.selection.data("select2-data");
+ if (data) { // guard against queued quick consecutive clicks
+ var evt = $.Event("select2-clearing");
+ this.opts.element.trigger(evt);
+ if (evt.isDefaultPrevented()) {
+ return;
+ }
+ var placeholderOption = this.getPlaceholderOption();
+ this.opts.element.val(placeholderOption ? placeholderOption.val() : "");
+ this.selection.find(".select2-chosen").empty();
+ this.selection.removeData("select2-data");
+ this.setPlaceholder();
+
+ if (triggerChange !== false){
+ this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
+ this.triggerChange({removed:data});
+ }
+ }
+ },
+
+ /**
+ * Sets selection based on source element's value
+ */
+ // single
+ initSelection: function () {
+ var selected;
+ if (this.isPlaceholderOptionSelected()) {
+ this.updateSelection(null);
+ this.close();
+ this.setPlaceholder();
+ } else {
+ var self = this;
+ this.opts.initSelection.call(null, this.opts.element, function(selected){
+ if (selected !== undefined && selected !== null) {
+ self.updateSelection(selected);
+ self.close();
+ self.setPlaceholder();
+ self.nextSearchTerm = self.opts.nextSearchTerm(selected, self.search.val());
+ }
+ });
+ }
+ },
+
+ isPlaceholderOptionSelected: function() {
+ var placeholderOption;
+ if (this.getPlaceholder() === undefined) return false; // no placeholder specified so no option should be considered
+ return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.prop("selected"))
+ || (this.opts.element.val() === "")
+ || (this.opts.element.val() === undefined)
+ || (this.opts.element.val() === null);
+ },
+
+ // single
+ prepareOpts: function () {
+ var opts = this.parent.prepareOpts.apply(this, arguments),
+ self=this;
+
+ if (opts.element.get(0).tagName.toLowerCase() === "select") {
+ // install the selection initializer
+ opts.initSelection = function (element, callback) {
+ var selected = element.find("option").filter(function() { return this.selected && !this.disabled });
+ // a single select box always has a value, no need to null check 'selected'
+ callback(self.optionToData(selected));
+ };
+ } else if ("data" in opts) {
+ // install default initSelection when applied to hidden input and data is local
+ opts.initSelection = opts.initSelection || function (element, callback) {
+ var id = element.val();
+ //search in data by id, storing the actual matching item
+ var match = null;
+ opts.query({
+ matcher: function(term, text, el){
+ var is_match = equal(id, opts.id(el));
+ if (is_match) {
+ match = el;
+ }
+ return is_match;
+ },
+ callback: !$.isFunction(callback) ? $.noop : function() {
+ callback(match);
+ }
+ });
+ };
+ }
+
+ return opts;
+ },
+
+ // single
+ getPlaceholder: function() {
+ // if a placeholder is specified on a single select without a valid placeholder option ignore it
+ if (this.select) {
+ if (this.getPlaceholderOption() === undefined) {
+ return undefined;
+ }
+ }
+
+ return this.parent.getPlaceholder.apply(this, arguments);
+ },
+
+ // single
+ setPlaceholder: function () {
+ var placeholder = this.getPlaceholder();
+
+ if (this.isPlaceholderOptionSelected() && placeholder !== undefined) {
+
+ // check for a placeholder option if attached to a select
+ if (this.select && this.getPlaceholderOption() === undefined) return;
+
+ this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder));
+
+ this.selection.addClass("select2-default");
+
+ this.container.removeClass("select2-allowclear");
+ }
+ },
+
+ // single
+ postprocessResults: function (data, initial, noHighlightUpdate) {
+ var selected = 0, self = this, showSearchInput = true;
+
+ // find the selected element in the result list
+
+ this.findHighlightableChoices().each2(function (i, elm) {
+ if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) {
+ selected = i;
+ return false;
+ }
+ });
+
+ // and highlight it
+ if (noHighlightUpdate !== false) {
+ if (initial === true && selected >= 0) {
+ this.highlight(selected);
+ } else {
+ this.highlight(0);
+ }
+ }
+
+ // hide the search box if this is the first we got the results and there are enough of them for search
+
+ if (initial === true) {
+ var min = this.opts.minimumResultsForSearch;
+ if (min >= 0) {
+ this.showSearch(countResults(data.results) >= min);
+ }
+ }
+ },
+
+ // single
+ showSearch: function(showSearchInput) {
+ if (this.showSearchInput === showSearchInput) return;
+
+ this.showSearchInput = showSearchInput;
+
+ this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput);
+ this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput);
+ //add "select2-with-searchbox" to the container if search box is shown
+ $(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput);
+ },
+
+ // single
+ onSelect: function (data, options) {
+
+ if (!this.triggerSelect(data)) { return; }
+
+ var old = this.opts.element.val(),
+ oldData = this.data();
+
+ this.opts.element.val(this.id(data));
+ this.updateSelection(data);
+
+ this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data });
+
+ this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
+ this.close();
+
+ if ((!options || !options.noFocus) && this.opts.shouldFocusInput(this)) {
+ this.focusser.focus();
+ }
+
+ if (!equal(old, this.id(data))) {
+ this.triggerChange({ added: data, removed: oldData });
+ }
+ },
+
+ // single
+ updateSelection: function (data) {
+
+ var container=this.selection.find(".select2-chosen"), formatted, cssClass;
+
+ this.selection.data("select2-data", data);
+
+ container.empty();
+ if (data !== null) {
+ formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup);
+ }
+ if (formatted !== undefined) {
+ container.append(formatted);
+ }
+ cssClass=this.opts.formatSelectionCssClass(data, container);
+ if (cssClass !== undefined) {
+ container.addClass(cssClass);
+ }
+
+ this.selection.removeClass("select2-default");
+
+ if (this.opts.allowClear && this.getPlaceholder() !== undefined) {
+ this.container.addClass("select2-allowclear");
+ }
+ },
+
+ // single
+ val: function () {
+ var val,
+ triggerChange = false,
+ data = null,
+ self = this,
+ oldData = this.data();
+
+ if (arguments.length === 0) {
+ return this.opts.element.val();
+ }
+
+ val = arguments[0];
+
+ if (arguments.length > 1) {
+ triggerChange = arguments[1];
+ }
+
+ if (this.select) {
+ this.select
+ .val(val)
+ .find("option").filter(function() { return this.selected }).each2(function (i, elm) {
+ data = self.optionToData(elm);
+ return false;
+ });
+ this.updateSelection(data);
+ this.setPlaceholder();
+ if (triggerChange) {
+ this.triggerChange({added: data, removed:oldData});
+ }
+ } else {
+ // val is an id. !val is true for [undefined,null,'',0] - 0 is legal
+ if (!val && val !== 0) {
+ this.clear(triggerChange);
+ return;
+ }
+ if (this.opts.initSelection === undefined) {
+ throw new Error("cannot call val() if initSelection() is not defined");
+ }
+ this.opts.element.val(val);
+ this.opts.initSelection(this.opts.element, function(data){
+ self.opts.element.val(!data ? "" : self.id(data));
+ self.updateSelection(data);
+ self.setPlaceholder();
+ if (triggerChange) {
+ self.triggerChange({added: data, removed:oldData});
+ }
+ });
+ }
+ },
+
+ // single
+ clearSearch: function () {
+ this.search.val("");
+ this.focusser.val("");
+ },
+
+ // single
+ data: function(value) {
+ var data,
+ triggerChange = false;
+
+ if (arguments.length === 0) {
+ data = this.selection.data("select2-data");
+ if (data == undefined) data = null;
+ return data;
+ } else {
+ if (arguments.length > 1) {
+ triggerChange = arguments[1];
+ }
+ if (!value) {
+ this.clear(triggerChange);
+ } else {
+ data = this.data();
+ this.opts.element.val(!value ? "" : this.id(value));
+ this.updateSelection(value);
+ if (triggerChange) {
+ this.triggerChange({added: value, removed:data});
+ }
+ }
+ }
+ }
+ });
+
+ MultiSelect2 = clazz(AbstractSelect2, {
+
+ // multi
+ createContainer: function () {
+ var container = $(document.createElement("div")).attr({
+ "class": "select2-container select2-container-multi"
+ }).html([
+ "",
+ ""].join(""));
+ return container;
+ },
+
+ // multi
+ prepareOpts: function () {
+ var opts = this.parent.prepareOpts.apply(this, arguments),
+ self=this;
+
+ // TODO validate placeholder is a string if specified
+ if (opts.element.get(0).tagName.toLowerCase() === "select") {
+ // install the selection initializer
+ opts.initSelection = function (element, callback) {
+
+ var data = [];
+
+ element.find("option").filter(function() { return this.selected && !this.disabled }).each2(function (i, elm) {
+ data.push(self.optionToData(elm));
+ });
+ callback(data);
+ };
+ } else if ("data" in opts) {
+ // install default initSelection when applied to hidden input and data is local
+ opts.initSelection = opts.initSelection || function (element, callback) {
+ var ids = splitVal(element.val(), opts.separator, opts.transformVal);
+ //search in data by array of ids, storing matching items in a list
+ var matches = [];
+ opts.query({
+ matcher: function(term, text, el){
+ var is_match = $.grep(ids, function(id) {
+ return equal(id, opts.id(el));
+ }).length;
+ if (is_match) {
+ matches.push(el);
+ }
+ return is_match;
+ },
+ callback: !$.isFunction(callback) ? $.noop : function() {
+ // reorder matches based on the order they appear in the ids array because right now
+ // they are in the order in which they appear in data array
+ var ordered = [];
+ for (var i = 0; i < ids.length; i++) {
+ var id = ids[i];
+ for (var j = 0; j < matches.length; j++) {
+ var match = matches[j];
+ if (equal(id, opts.id(match))) {
+ ordered.push(match);
+ matches.splice(j, 1);
+ break;
+ }
+ }
+ }
+ callback(ordered);
+ }
+ });
+ };
+ }
+
+ return opts;
+ },
+
+ // multi
+ selectChoice: function (choice) {
+
+ var selected = this.container.find(".select2-search-choice-focus");
+ if (selected.length && choice && choice[0] == selected[0]) {
+
+ } else {
+ if (selected.length) {
+ this.opts.element.trigger("choice-deselected", selected);
+ }
+ selected.removeClass("select2-search-choice-focus");
+ if (choice && choice.length) {
+ this.close();
+ choice.addClass("select2-search-choice-focus");
+ this.opts.element.trigger("choice-selected", choice);
+ }
+ }
+ },
+
+ // multi
+ destroy: function() {
+ $("label[for='" + this.search.attr('id') + "']")
+ .attr('for', this.opts.element.attr("id"));
+ this.parent.destroy.apply(this, arguments);
+
+ cleanupJQueryElements.call(this,
+ "searchContainer",
+ "selection"
+ );
+ },
+
+ // multi
+ initContainer: function () {
+
+ var selector = ".select2-choices", selection;
+
+ this.searchContainer = this.container.find(".select2-search-field");
+ this.selection = selection = this.container.find(selector);
+
+ var _this = this;
+ this.selection.on("click", ".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)", function (e) {
+ _this.search[0].focus();
+ _this.selectChoice($(this));
+ });
+
+ // rewrite labels from original element to focusser
+ this.search.attr("id", "s2id_autogen"+nextUid());
+
+ this.search.prev()
+ .text($("label[for='" + this.opts.element.attr("id") + "']").text())
+ .attr('for', this.search.attr('id'));
+ this.opts.element.focus(this.bind(function () { this.focus(); }));
+
+ this.search.on("input paste", this.bind(function() {
+ if (this.search.attr('placeholder') && this.search.val().length == 0) return;
+ if (!this.isInterfaceEnabled()) return;
+ if (!this.opened()) {
+ this.open();
+ }
+ }));
+
+ this.search.attr("tabindex", this.elementTabIndex);
+
+ this.keydowns = 0;
+ this.search.on("keydown", this.bind(function (e) {
+ if (!this.isInterfaceEnabled()) return;
+
+ ++this.keydowns;
+ var selected = selection.find(".select2-search-choice-focus");
+ var prev = selected.prev(".select2-search-choice:not(.select2-locked)");
+ var next = selected.next(".select2-search-choice:not(.select2-locked)");
+ var pos = getCursorInfo(this.search);
+
+ if (selected.length &&
+ (e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) {
+ var selectedChoice = selected;
+ if (e.which == KEY.LEFT && prev.length) {
+ selectedChoice = prev;
+ }
+ else if (e.which == KEY.RIGHT) {
+ selectedChoice = next.length ? next : null;
+ }
+ else if (e.which === KEY.BACKSPACE) {
+ if (this.unselect(selected.first())) {
+ this.search.width(10);
+ selectedChoice = prev.length ? prev : next;
+ }
+ } else if (e.which == KEY.DELETE) {
+ if (this.unselect(selected.first())) {
+ this.search.width(10);
+ selectedChoice = next.length ? next : null;
+ }
+ } else if (e.which == KEY.ENTER) {
+ selectedChoice = null;
+ }
+
+ this.selectChoice(selectedChoice);
+ killEvent(e);
+ if (!selectedChoice || !selectedChoice.length) {
+ this.open();
+ }
+ return;
+ } else if (((e.which === KEY.BACKSPACE && this.keydowns == 1)
+ || e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) {
+
+ this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last());
+ killEvent(e);
+ return;
+ } else {
+ this.selectChoice(null);
+ }
+
+ if (this.opened()) {
+ switch (e.which) {
+ case KEY.UP:
+ case KEY.DOWN:
+ this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
+ killEvent(e);
+ return;
+ case KEY.ENTER:
+ this.selectHighlighted();
+ killEvent(e);
+ return;
+ case KEY.TAB:
+ this.selectHighlighted({noFocus:true});
+ this.close();
+ return;
+ case KEY.ESC:
+ this.cancel(e);
+ killEvent(e);
+ return;
+ }
+ }
+
+ if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e)
+ || e.which === KEY.BACKSPACE || e.which === KEY.ESC) {
+ return;
+ }
+
+ if (e.which === KEY.ENTER) {
+ if (this.opts.openOnEnter === false) {
+ return;
+ } else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) {
+ return;
+ }
+ }
+
+ this.open();
+
+ if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
+ // prevent the page from scrolling
+ killEvent(e);
+ }
+
+ if (e.which === KEY.ENTER) {
+ // prevent form from being submitted
+ killEvent(e);
+ }
+
+ }));
+
+ this.search.on("keyup", this.bind(function (e) {
+ this.keydowns = 0;
+ this.resizeSearch();
+ })
+ );
+
+ this.search.on("blur", this.bind(function(e) {
+ this.container.removeClass("select2-container-active");
+ this.search.removeClass("select2-focused");
+ this.selectChoice(null);
+ if (!this.opened()) this.clearSearch();
+ e.stopImmediatePropagation();
+ this.opts.element.trigger($.Event("select2-blur"));
+ }));
+
+ this.container.on("click", selector, this.bind(function (e) {
+ if (!this.isInterfaceEnabled()) return;
+ if ($(e.target).closest(".select2-search-choice").length > 0) {
+ // clicked inside a select2 search choice, do not open
+ return;
+ }
+ this.selectChoice(null);
+ this.clearPlaceholder();
+ if (!this.container.hasClass("select2-container-active")) {
+ this.opts.element.trigger($.Event("select2-focus"));
+ }
+ this.open();
+ this.focusSearch();
+ e.preventDefault();
+ }));
+
+ this.container.on("focus", selector, this.bind(function () {
+ if (!this.isInterfaceEnabled()) return;
+ if (!this.container.hasClass("select2-container-active")) {
+ this.opts.element.trigger($.Event("select2-focus"));
+ }
+ this.container.addClass("select2-container-active");
+ this.dropdown.addClass("select2-drop-active");
+ this.clearPlaceholder();
+ }));
+
+ this.initContainerWidth();
+ this.opts.element.hide();
+
+ // set the placeholder if necessary
+ this.clearSearch();
+ },
+
+ // multi
+ enableInterface: function() {
+ if (this.parent.enableInterface.apply(this, arguments)) {
+ this.search.prop("disabled", !this.isInterfaceEnabled());
+ }
+ },
+
+ // multi
+ initSelection: function () {
+ var data;
+ if (this.opts.element.val() === "" && this.opts.element.text() === "") {
+ this.updateSelection([]);
+ this.close();
+ // set the placeholder if necessary
+ this.clearSearch();
+ }
+ if (this.select || this.opts.element.val() !== "") {
+ var self = this;
+ this.opts.initSelection.call(null, this.opts.element, function(data){
+ if (data !== undefined && data !== null) {
+ self.updateSelection(data);
+ self.close();
+ // set the placeholder if necessary
+ self.clearSearch();
+ }
+ });
+ }
+ },
+
+ // multi
+ clearSearch: function () {
+ var placeholder = this.getPlaceholder(),
+ maxWidth = this.getMaxSearchWidth();
+
+ if (placeholder !== undefined && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) {
+ this.search.val(placeholder).addClass("select2-default");
+ // stretch the search box to full width of the container so as much of the placeholder is visible as possible
+ // we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944
+ this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width"));
+ } else {
+ this.search.val("").width(10);
+ }
+ },
+
+ // multi
+ clearPlaceholder: function () {
+ if (this.search.hasClass("select2-default")) {
+ this.search.val("").removeClass("select2-default");
+ }
+ },
+
+ // multi
+ opening: function () {
+ this.clearPlaceholder(); // should be done before super so placeholder is not used to search
+ this.resizeSearch();
+
+ this.parent.opening.apply(this, arguments);
+
+ this.focusSearch();
+
+ // initializes search's value with nextSearchTerm (if defined by user)
+ // ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
+ if(this.search.val() === "") {
+ if(this.nextSearchTerm != undefined){
+ this.search.val(this.nextSearchTerm);
+ this.search.select();
+ }
+ }
+
+ this.updateResults(true);
+ if (this.opts.shouldFocusInput(this)) {
+ this.search.focus();
+ }
+ this.opts.element.trigger($.Event("select2-open"));
+ },
+
+ // multi
+ close: function () {
+ if (!this.opened()) return;
+ this.parent.close.apply(this, arguments);
+ },
+
+ // multi
+ focus: function () {
+ this.close();
+ this.search.focus();
+ },
+
+ // multi
+ isFocused: function () {
+ return this.search.hasClass("select2-focused");
+ },
+
+ // multi
+ updateSelection: function (data) {
+ var ids = [], filtered = [], self = this;
+
+ // filter out duplicates
+ $(data).each(function () {
+ if (indexOf(self.id(this), ids) < 0) {
+ ids.push(self.id(this));
+ filtered.push(this);
+ }
+ });
+ data = filtered;
+
+ this.selection.find(".select2-search-choice").remove();
+ $(data).each(function () {
+ self.addSelectedChoice(this);
+ });
+ self.postprocessResults();
+ },
+
+ // multi
+ tokenize: function() {
+ var input = this.search.val();
+ input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts);
+ if (input != null && input != undefined) {
+ this.search.val(input);
+ if (input.length > 0) {
+ this.open();
+ }
+ }
+
+ },
+
+ // multi
+ onSelect: function (data, options) {
+
+ if (!this.triggerSelect(data) || data.text === "") { return; }
+
+ this.addSelectedChoice(data);
+
+ this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data });
+
+ // keep track of the search's value before it gets cleared
+ this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
+
+ this.clearSearch();
+ this.updateResults();
+
+ if (this.select || !this.opts.closeOnSelect) this.postprocessResults(data, false, this.opts.closeOnSelect===true);
+
+ if (this.opts.closeOnSelect) {
+ this.close();
+ this.search.width(10);
+ } else {
+ if (this.countSelectableResults()>0) {
+ this.search.width(10);
+ this.resizeSearch();
+ if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) {
+ // if we reached max selection size repaint the results so choices
+ // are replaced with the max selection reached message
+ this.updateResults(true);
+ } else {
+ // initializes search's value with nextSearchTerm and update search result
+ if(this.nextSearchTerm != undefined){
+ this.search.val(this.nextSearchTerm);
+ this.updateResults();
+ this.search.select();
+ }
+ }
+ this.positionDropdown();
+ } else {
+ // if nothing left to select close
+ this.close();
+ this.search.width(10);
+ }
+ }
+
+ // since its not possible to select an element that has already been
+ // added we do not need to check if this is a new element before firing change
+ this.triggerChange({ added: data });
+
+ if (!options || !options.noFocus)
+ this.focusSearch();
+ },
+
+ // multi
+ cancel: function () {
+ this.close();
+ this.focusSearch();
+ },
+
+ addSelectedChoice: function (data) {
+ var enableChoice = !data.locked,
+ enabledItem = $(
+ "" +
+ "
" +
+ " " +
+ " "),
+ disabledItem = $(
+ "" +
+ "
" +
+ " ");
+ var choice = enableChoice ? enabledItem : disabledItem,
+ id = this.id(data),
+ val = this.getVal(),
+ formatted,
+ cssClass;
+
+ formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup);
+ if (formatted != undefined) {
+ choice.find("div").replaceWith($("
").html(formatted));
+ }
+ cssClass=this.opts.formatSelectionCssClass(data, choice.find("div"));
+ if (cssClass != undefined) {
+ choice.addClass(cssClass);
+ }
+
+ if(enableChoice){
+ choice.find(".select2-search-choice-close")
+ .on("mousedown", killEvent)
+ .on("click dblclick", this.bind(function (e) {
+ if (!this.isInterfaceEnabled()) return;
+
+ this.unselect($(e.target));
+ this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
+ killEvent(e);
+ this.close();
+ this.focusSearch();
+ })).on("focus", this.bind(function () {
+ if (!this.isInterfaceEnabled()) return;
+ this.container.addClass("select2-container-active");
+ this.dropdown.addClass("select2-drop-active");
+ }));
+ }
+
+ choice.data("select2-data", data);
+ choice.insertBefore(this.searchContainer);
+
+ val.push(id);
+ this.setVal(val);
+ },
+
+ // multi
+ unselect: function (selected) {
+ var val = this.getVal(),
+ data,
+ index;
+ selected = selected.closest(".select2-search-choice");
+
+ if (selected.length === 0) {
+ throw "Invalid argument: " + selected + ". Must be .select2-search-choice";
+ }
+
+ data = selected.data("select2-data");
+
+ if (!data) {
+ // prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued
+ // and invoked on an element already removed
+ return;
+ }
+
+ var evt = $.Event("select2-removing");
+ evt.val = this.id(data);
+ evt.choice = data;
+ this.opts.element.trigger(evt);
+
+ if (evt.isDefaultPrevented()) {
+ return false;
+ }
+
+ while((index = indexOf(this.id(data), val)) >= 0) {
+ val.splice(index, 1);
+ this.setVal(val);
+ if (this.select) this.postprocessResults();
+ }
+
+ selected.remove();
+
+ this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
+ this.triggerChange({ removed: data });
+
+ return true;
+ },
+
+ // multi
+ postprocessResults: function (data, initial, noHighlightUpdate) {
+ var val = this.getVal(),
+ choices = this.results.find(".select2-result"),
+ compound = this.results.find(".select2-result-with-children"),
+ self = this;
+
+ choices.each2(function (i, choice) {
+ var id = self.id(choice.data("select2-data"));
+ if (indexOf(id, val) >= 0) {
+ choice.addClass("select2-selected");
+ // mark all children of the selected parent as selected
+ choice.find(".select2-result-selectable").addClass("select2-selected");
+ }
+ });
+
+ compound.each2(function(i, choice) {
+ // hide an optgroup if it doesn't have any selectable children
+ if (!choice.is('.select2-result-selectable')
+ && choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) {
+ choice.addClass("select2-selected");
+ }
+ });
+
+ if (this.highlight() == -1 && noHighlightUpdate !== false && this.opts.closeOnSelect === true){
+ self.highlight(0);
+ }
+
+ //If all results are chosen render formatNoMatches
+ if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){
+ if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) {
+ if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) {
+ this.results.append("" + evaluate(self.opts.formatNoMatches, self.opts.element, self.search.val()) + " ");
+ }
+ }
+ }
+
+ },
+
+ // multi
+ getMaxSearchWidth: function() {
+ return this.selection.width() - getSideBorderPadding(this.search);
+ },
+
+ // multi
+ resizeSearch: function () {
+ var minimumWidth, left, maxWidth, containerLeft, searchWidth,
+ sideBorderPadding = getSideBorderPadding(this.search);
+
+ minimumWidth = measureTextWidth(this.search) + 10;
+
+ left = this.search.offset().left;
+
+ maxWidth = this.selection.width();
+ containerLeft = this.selection.offset().left;
+
+ searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding;
+
+ if (searchWidth < minimumWidth) {
+ searchWidth = maxWidth - sideBorderPadding;
+ }
+
+ if (searchWidth < 40) {
+ searchWidth = maxWidth - sideBorderPadding;
+ }
+
+ if (searchWidth <= 0) {
+ searchWidth = minimumWidth;
+ }
+
+ this.search.width(Math.floor(searchWidth));
+ },
+
+ // multi
+ getVal: function () {
+ var val;
+ if (this.select) {
+ val = this.select.val();
+ return val === null ? [] : val;
+ } else {
+ val = this.opts.element.val();
+ return splitVal(val, this.opts.separator, this.opts.transformVal);
+ }
+ },
+
+ // multi
+ setVal: function (val) {
+ var unique;
+ if (this.select) {
+ this.select.val(val);
+ } else {
+ unique = [];
+ // filter out duplicates
+ $(val).each(function () {
+ if (indexOf(this, unique) < 0) unique.push(this);
+ });
+ this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator));
+ }
+ },
+
+ // multi
+ buildChangeDetails: function (old, current) {
+ var current = current.slice(0),
+ old = old.slice(0);
+
+ // remove intersection from each array
+ for (var i = 0; i < current.length; i++) {
+ for (var j = 0; j < old.length; j++) {
+ if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) {
+ current.splice(i, 1);
+ if(i>0){
+ i--;
+ }
+ old.splice(j, 1);
+ j--;
+ }
+ }
+ }
+
+ return {added: current, removed: old};
+ },
+
+
+ // multi
+ val: function (val, triggerChange) {
+ var oldData, self=this;
+
+ if (arguments.length === 0) {
+ return this.getVal();
+ }
+
+ oldData=this.data();
+ if (!oldData.length) oldData=[];
+
+ // val is an id. !val is true for [undefined,null,'',0] - 0 is legal
+ if (!val && val !== 0) {
+ this.opts.element.val("");
+ this.updateSelection([]);
+ this.clearSearch();
+ if (triggerChange) {
+ this.triggerChange({added: this.data(), removed: oldData});
+ }
+ return;
+ }
+
+ // val is a list of ids
+ this.setVal(val);
+
+ if (this.select) {
+ this.opts.initSelection(this.select, this.bind(this.updateSelection));
+ if (triggerChange) {
+ this.triggerChange(this.buildChangeDetails(oldData, this.data()));
+ }
+ } else {
+ if (this.opts.initSelection === undefined) {
+ throw new Error("val() cannot be called if initSelection() is not defined");
+ }
+
+ this.opts.initSelection(this.opts.element, function(data){
+ var ids=$.map(data, self.id);
+ self.setVal(ids);
+ self.updateSelection(data);
+ self.clearSearch();
+ if (triggerChange) {
+ self.triggerChange(self.buildChangeDetails(oldData, self.data()));
+ }
+ });
+ }
+ this.clearSearch();
+ },
+
+ // multi
+ onSortStart: function() {
+ if (this.select) {
+ throw new Error("Sorting of elements is not supported when attached to . Attach to instead.");
+ }
+
+ // collapse search field into 0 width so its container can be collapsed as well
+ this.search.width(0);
+ // hide the container
+ this.searchContainer.hide();
+ },
+
+ // multi
+ onSortEnd:function() {
+
+ var val=[], self=this;
+
+ // show search and move it to the end of the list
+ this.searchContainer.show();
+ // make sure the search container is the last item in the list
+ this.searchContainer.appendTo(this.searchContainer.parent());
+ // since we collapsed the width in dragStarted, we resize it here
+ this.resizeSearch();
+
+ // update selection
+ this.selection.find(".select2-search-choice").each(function() {
+ val.push(self.opts.id($(this).data("select2-data")));
+ });
+ this.setVal(val);
+ this.triggerChange();
+ },
+
+ // multi
+ data: function(values, triggerChange) {
+ var self=this, ids, old;
+ if (arguments.length === 0) {
+ return this.selection
+ .children(".select2-search-choice")
+ .map(function() { return $(this).data("select2-data"); })
+ .get();
+ } else {
+ old = this.data();
+ if (!values) { values = []; }
+ ids = $.map(values, function(e) { return self.opts.id(e); });
+ this.setVal(ids);
+ this.updateSelection(values);
+ this.clearSearch();
+ if (triggerChange) {
+ this.triggerChange(this.buildChangeDetails(old, this.data()));
+ }
+ }
+ }
+ });
+
+ $.fn.select2 = function () {
+
+ var args = Array.prototype.slice.call(arguments, 0),
+ opts,
+ select2,
+ method, value, multiple,
+ allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "disable", "readonly", "positionDropdown", "data", "search"],
+ valueMethods = ["opened", "isFocused", "container", "dropdown"],
+ propertyMethods = ["val", "data"],
+ methodsMap = { search: "externalSearch" };
+
+ this.each(function () {
+ if (args.length === 0 || typeof(args[0]) === "object") {
+ opts = args.length === 0 ? {} : $.extend({}, args[0]);
+ opts.element = $(this);
+
+ if (opts.element.get(0).tagName.toLowerCase() === "select") {
+ multiple = opts.element.prop("multiple");
+ } else {
+ multiple = opts.multiple || false;
+ if ("tags" in opts) {opts.multiple = multiple = true;}
+ }
+
+ select2 = multiple ? new window.Select2["class"].multi() : new window.Select2["class"].single();
+ select2.init(opts);
+ } else if (typeof(args[0]) === "string") {
+
+ if (indexOf(args[0], allowedMethods) < 0) {
+ throw "Unknown method: " + args[0];
+ }
+
+ value = undefined;
+ select2 = $(this).data("select2");
+ if (select2 === undefined) return;
+
+ method=args[0];
+
+ if (method === "container") {
+ value = select2.container;
+ } else if (method === "dropdown") {
+ value = select2.dropdown;
+ } else {
+ if (methodsMap[method]) method = methodsMap[method];
+
+ value = select2[method].apply(select2, args.slice(1));
+ }
+ if (indexOf(args[0], valueMethods) >= 0
+ || (indexOf(args[0], propertyMethods) >= 0 && args.length == 1)) {
+ return false; // abort the iteration, ready to return first matched value
+ }
+ } else {
+ throw "Invalid arguments to select2 plugin: " + args;
+ }
+ });
+ return (value === undefined) ? this : value;
+ };
+
+ // plugin defaults, accessible to users
+ $.fn.select2.defaults = {
+ width: "copy",
+ loadMorePadding: 0,
+ closeOnSelect: true,
+ openOnEnter: true,
+ containerCss: {},
+ dropdownCss: {},
+ containerCssClass: "",
+ dropdownCssClass: "",
+ formatResult: function(result, container, query, escapeMarkup) {
+ var markup=[];
+ markMatch(this.text(result), query.term, markup, escapeMarkup);
+ return markup.join("");
+ },
+ transformVal: function(val) {
+ return $.trim(val);
+ },
+ formatSelection: function (data, container, escapeMarkup) {
+ return data ? escapeMarkup(this.text(data)) : undefined;
+ },
+ sortResults: function (results, container, query) {
+ return results;
+ },
+ formatResultCssClass: function(data) {return data.css;},
+ formatSelectionCssClass: function(data, container) {return undefined;},
+ minimumResultsForSearch: 0,
+ minimumInputLength: 0,
+ maximumInputLength: null,
+ maximumSelectionSize: 0,
+ id: function (e) { return e == undefined ? null : e.id; },
+ text: function (e) {
+ if (e && this.data && this.data.text) {
+ if ($.isFunction(this.data.text)) {
+ return this.data.text(e);
+ } else {
+ return e[this.data.text];
+ }
+ } else {
+ return e.text;
+ }
+ },
+ matcher: function(term, text) {
+ return stripDiacritics(''+text).toUpperCase().indexOf(stripDiacritics(''+term).toUpperCase()) >= 0;
+ },
+ separator: ",",
+ tokenSeparators: [],
+ tokenizer: defaultTokenizer,
+ escapeMarkup: defaultEscapeMarkup,
+ blurOnChange: false,
+ selectOnBlur: false,
+ adaptContainerCssClass: function(c) { return c; },
+ adaptDropdownCssClass: function(c) { return null; },
+ nextSearchTerm: function(selectedObject, currentSearchTerm) { return undefined; },
+ searchInputPlaceholder: '',
+ createSearchChoicePosition: 'top',
+ shouldFocusInput: function (instance) {
+ // Attempt to detect touch devices
+ var supportsTouchEvents = (('ontouchstart' in window) ||
+ (navigator.msMaxTouchPoints > 0));
+
+ // Only devices which support touch events should be special cased
+ if (!supportsTouchEvents) {
+ return true;
+ }
+
+ // Never focus the input if search is disabled
+ if (instance.opts.minimumResultsForSearch < 0) {
+ return false;
+ }
+
+ return true;
+ }
+ };
+
+ $.fn.select2.locales = [];
+
+ $.fn.select2.locales['en'] = {
+ formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
+ formatNoMatches: function () { return "No matches found"; },
+ formatAjaxError: function (jqXHR, textStatus, errorThrown) { return "Loading failed"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
+ formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
+ formatLoadMore: function (pageNumber) { return "Loading more results…"; },
+ formatSearching: function () { return "Searching…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
+
+ $.fn.select2.ajaxDefaults = {
+ transport: $.ajax,
+ params: {
+ type: "GET",
+ cache: false,
+ dataType: "json"
+ }
+ };
+
+ // exports
+ window.Select2 = {
+ query: {
+ ajax: ajax,
+ local: local,
+ tags: tags
+ }, util: {
+ debounce: debounce,
+ markMatch: markMatch,
+ escapeMarkup: defaultEscapeMarkup,
+ stripDiacritics: stripDiacritics
+ }, "class": {
+ "abstract": AbstractSelect2,
+ "single": SingleSelect2,
+ "multi": MultiSelect2
+ }
+ };
+
+}(jQuery));
diff --git a/htdocs/includes/jquery/plugins/select2/select2.min.js b/htdocs/includes/jquery/plugins/select2/select2.min.js
new file mode 100644
index 00000000000..b56419e2e79
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2.min.js
@@ -0,0 +1,23 @@
+/*
+Copyright 2014 Igor Vaynberg
+
+Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014
+
+This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
+General Public License version 2 (the "GPL License"). You may choose either license to govern your
+use of this software only upon the condition that you accept all of the terms of either the Apache
+License or the GPL License.
+
+You may obtain a copy of the Apache License and the GPL License at:
+
+http://www.apache.org/licenses/LICENSE-2.0
+http://www.gnu.org/licenses/gpl-2.0.html
+
+Unless required by applicable law or agreed to in writing, software distributed under the Apache License
+or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
+either express or implied. See the Apache License and the GPL License for the specific language governing
+permissions and limitations under the Apache License and the GPL License.
+*/
+!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++dc;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a||a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","select2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push(""),c.push(d(a.substring(e,e+f))),c.push(" "),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="
",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".select2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.show().removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a element.")}),c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a(" "),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a(""),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("select2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(y.top=d.top-g,y.bottom="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(y.top=n,y.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.select2-result-selectable:not(".select2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n(""+K(f.formatSelectionTooBig,f.element,o)+" "),void 0;if(d.val().length"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+""):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n(""+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+" "):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n(""+K(f.formatSearching,f.element)+" "),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return n(""+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+" "),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n(""+K(f.formatNoMatches,f.element,d.val())+" "),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append(""+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+" "),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html([""," "," "," "," "," ",""].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".select2-choice"),this.focusser=c.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+e),this.focusser.attr("aria-labelledby","select2-chosen-"+e),this.results.attr("id","select2-results-"+e),this.search.attr("aria-owns","select2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.focus(this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h||g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)return A(a),void 0;switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case k.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return A(a),void 0;if(a.which==k.DOWN||a.which==k.UP||a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==k.DELETE||a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["",""].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("
"),f=a("
"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith(a("
").html(j)),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append(""+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+" ")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to . Attach to instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text
+},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery);
\ No newline at end of file
diff --git a/htdocs/includes/jquery/plugins/select2/select2.png b/htdocs/includes/jquery/plugins/select2/select2.png
new file mode 100644
index 00000000000..1d804ffb996
Binary files /dev/null and b/htdocs/includes/jquery/plugins/select2/select2.png differ
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_ar.js b/htdocs/includes/jquery/plugins/select2/select2_locale_ar.js
new file mode 100644
index 00000000000..e991b726cff
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_ar.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Arabic translation.
+ *
+ * Author: Adel KEDJOUR
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['ar'] = {
+ formatNoMatches: function () { return "لم يتم العثور على مطابقات"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; if (n == 1){ return "الرجاء إدخال حرف واحد على الأكثر"; } return n == 2 ? "الرجاء إدخال حرفين على الأكثر" : "الرجاء إدخال " + n + " على الأكثر"; },
+ formatInputTooLong: function (input, max) { var n = input.length - max; if (n == 1){ return "الرجاء إدخال حرف واحد على الأقل"; } return n == 2 ? "الرجاء إدخال حرفين على الأقل" : "الرجاء إدخال " + n + " على الأقل "; },
+ formatSelectionTooBig: function (limit) { if (limit == 1){ return "يمكنك أن تختار إختيار واحد فقط"; } return limit == 2 ? "يمكنك أن تختار إختيارين فقط" : "يمكنك أن تختار " + limit + " إختيارات فقط"; },
+ formatLoadMore: function (pageNumber) { return "تحميل المزيد من النتائج…"; },
+ formatSearching: function () { return "البحث…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['ar']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_az.js b/htdocs/includes/jquery/plugins/select2/select2_locale_az.js
new file mode 100644
index 00000000000..19fd95b7a5f
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_az.js
@@ -0,0 +1,20 @@
+/**
+ * Select2 Azerbaijani translation.
+ *
+ * Author: Farhad Safarov
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['az'] = {
+ formatMatches: function (matches) { return matches + " nəticə mövcuddur, hərəkət etdirmək üçün yuxarı və aşağı düymələrindən istifadə edin."; },
+ formatNoMatches: function () { return "Nəticə tapılmadı"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return n + " simvol daxil edin"; },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return n + " simvol silin"; },
+ formatSelectionTooBig: function (limit) { return "Sadəcə " + limit + " element seçə bilərsiniz"; },
+ formatLoadMore: function (pageNumber) { return "Daha çox nəticə yüklənir…"; },
+ formatSearching: function () { return "Axtarılır…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['az']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_bg.js b/htdocs/includes/jquery/plugins/select2/select2_locale_bg.js
new file mode 100644
index 00000000000..3283d0ae5d2
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_bg.js
@@ -0,0 +1,20 @@
+/**
+ * Select2 Bulgarian translation.
+ *
+ * @author Lubomir Vikev
+ * @author Uriy Efremochkin
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['bg'] = {
+ formatNoMatches: function () { return "Няма намерени съвпадения"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Моля въведете още " + n + " символ" + (n > 1 ? "а" : ""); },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Моля въведете с " + n + " по-малко символ" + (n > 1 ? "а" : ""); },
+ formatSelectionTooBig: function (limit) { return "Можете да направите до " + limit + (limit > 1 ? " избора" : " избор"); },
+ formatLoadMore: function (pageNumber) { return "Зареждат се още…"; },
+ formatSearching: function () { return "Търсене…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['bg']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_ca.js b/htdocs/includes/jquery/plugins/select2/select2_locale_ca.js
new file mode 100644
index 00000000000..dbea39e930b
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_ca.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Catalan translation.
+ *
+ * Author: David Planella
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['ca'] = {
+ formatNoMatches: function () { return "No s'ha trobat cap coincidència"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduïu " + n + " caràcter" + (n == 1 ? "" : "s") + " més"; },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Introduïu " + n + " caràcter" + (n == 1? "" : "s") + "menys"; },
+ formatSelectionTooBig: function (limit) { return "Només podeu seleccionar " + limit + " element" + (limit == 1 ? "" : "s"); },
+ formatLoadMore: function (pageNumber) { return "S'estan carregant més resultats…"; },
+ formatSearching: function () { return "S'està cercant…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['ca']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_cs.js b/htdocs/includes/jquery/plugins/select2/select2_locale_cs.js
new file mode 100644
index 00000000000..ef121856485
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_cs.js
@@ -0,0 +1,51 @@
+/**
+ * Select2 Czech translation.
+ *
+ * Author: Michal Marek
+ * Author - sklonovani: David Vallner
+ */
+(function ($) {
+ "use strict";
+ // use text for the numbers 2 through 4
+ var smallNumbers = {
+ 2: function(masc) { return (masc ? "dva" : "dvě"); },
+ 3: function() { return "tři"; },
+ 4: function() { return "čtyři"; }
+ }
+ $.fn.select2.locales['cs'] = {
+ formatNoMatches: function () { return "Nenalezeny žádné položky"; },
+ formatInputTooShort: function (input, min) {
+ var n = min - input.length;
+ if (n == 1) {
+ return "Prosím zadejte ještě jeden znak";
+ } else if (n <= 4) {
+ return "Prosím zadejte ještě další "+smallNumbers[n](true)+" znaky";
+ } else {
+ return "Prosím zadejte ještě dalších "+n+" znaků";
+ }
+ },
+ formatInputTooLong: function (input, max) {
+ var n = input.length - max;
+ if (n == 1) {
+ return "Prosím zadejte o jeden znak méně";
+ } else if (n <= 4) {
+ return "Prosím zadejte o "+smallNumbers[n](true)+" znaky méně";
+ } else {
+ return "Prosím zadejte o "+n+" znaků méně";
+ }
+ },
+ formatSelectionTooBig: function (limit) {
+ if (limit == 1) {
+ return "Můžete zvolit jen jednu položku";
+ } else if (limit <= 4) {
+ return "Můžete zvolit maximálně "+smallNumbers[limit](false)+" položky";
+ } else {
+ return "Můžete zvolit maximálně "+limit+" položek";
+ }
+ },
+ formatLoadMore: function (pageNumber) { return "Načítají se další výsledky…"; },
+ formatSearching: function () { return "Vyhledávání…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['cs']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_da.js b/htdocs/includes/jquery/plugins/select2/select2_locale_da.js
new file mode 100644
index 00000000000..702238b9a09
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_da.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Danish translation.
+ *
+ * Author: Anders Jenbo
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['da'] = {
+ formatNoMatches: function () { return "Ingen resultater fundet"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Angiv venligst " + n + " tegn mere"; },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Angiv venligst " + n + " tegn mindre"; },
+ formatSelectionTooBig: function (limit) { return "Du kan kun vælge " + limit + " emne" + (limit === 1 ? "" : "r"); },
+ formatLoadMore: function (pageNumber) { return "Indlæser flere resultater…"; },
+ formatSearching: function () { return "Søger…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['da']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_de.js b/htdocs/includes/jquery/plugins/select2/select2_locale_de.js
new file mode 100644
index 00000000000..e27541720c2
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_de.js
@@ -0,0 +1,18 @@
+/**
+ * Select2 German translation
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['de'] = {
+ formatNoMatches: function () { return "Keine Übereinstimmungen gefunden"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Bitte " + n + " Zeichen mehr eingeben"; },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Bitte " + n + " Zeichen weniger eingeben"; },
+ formatSelectionTooBig: function (limit) { return "Sie können nur " + limit + " Eintr" + (limit === 1 ? "ag" : "äge") + " auswählen"; },
+ formatLoadMore: function (pageNumber) { return "Lade mehr Ergebnisse…"; },
+ formatSearching: function () { return "Suche…"; },
+ formatMatches: function (matches) { return matches + " Ergebnis " + (matches > 1 ? "se" : "") + " verfügbar, zum Navigieren die Hoch-/Runter-Pfeiltasten verwenden."; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['de']);
+})(jQuery);
\ No newline at end of file
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_el.js b/htdocs/includes/jquery/plugins/select2/select2_locale_el.js
new file mode 100644
index 00000000000..d17459e1df3
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_el.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Greek translation.
+ *
+ * @author Uriy Efremochkin
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['el'] = {
+ formatNoMatches: function () { return "Δεν βρέθηκαν αποτελέσματα"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Παρακαλούμε εισάγετε " + n + " περισσότερο" + (n > 1 ? "υς" : "") + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Παρακαλούμε διαγράψτε " + n + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
+ formatSelectionTooBig: function (limit) { return "Μπορείτε να επιλέξετε μόνο " + limit + " αντικείμεν" + (limit > 1 ? "α" : "ο"); },
+ formatLoadMore: function (pageNumber) { return "Φόρτωση περισσότερων…"; },
+ formatSearching: function () { return "Αναζήτηση…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['el']);
+})(jQuery);
\ No newline at end of file
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_en.js.template b/htdocs/includes/jquery/plugins/select2/select2_locale_en.js.template
new file mode 100644
index 00000000000..f758b110079
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_en.js.template
@@ -0,0 +1,20 @@
+/**
+ * Select2 translation.
+ *
+ * Author: Your Name
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['en'] = {
+ formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
+ formatNoMatches: function () { return "No matches found"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
+ formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
+ formatLoadMore: function (pageNumber) { return "Loading more results…"; },
+ formatSearching: function () { return "Searching…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_es.js b/htdocs/includes/jquery/plugins/select2/select2_locale_es.js
new file mode 100644
index 00000000000..92a19861e40
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_es.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Spanish translation
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['es'] = {
+ formatMatches: function (matches) { if (matches === 1) { return "Un resultado disponible, presione enter para seleccionarlo."; } return matches + " resultados disponibles, use las teclas de dirección para navegar."; },
+ formatNoMatches: function () { return "No se encontraron resultados"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Por favor, introduzca " + n + " car" + (n == 1? "ácter" : "acteres"); },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Por favor, elimine " + n + " car" + (n == 1? "ácter" : "acteres"); },
+ formatSelectionTooBig: function (limit) { return "Sólo puede seleccionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
+ formatLoadMore: function (pageNumber) { return "Cargando más resultados…"; },
+ formatSearching: function () { return "Buscando…"; },
+ formatAjaxError: function() { return "La carga falló"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['es']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_et.js b/htdocs/includes/jquery/plugins/select2/select2_locale_et.js
new file mode 100644
index 00000000000..4d69f55e3fb
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_et.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Estonian translation.
+ *
+ * Author: Kuldar Kalvik
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['et'] = {
+ formatNoMatches: function () { return "Tulemused puuduvad"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Sisesta " + n + " täht" + (n == 1 ? "" : "e") + " rohkem"; },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Sisesta " + n + " täht" + (n == 1? "" : "e") + " vähem"; },
+ formatSelectionTooBig: function (limit) { return "Saad vaid " + limit + " tulemus" + (limit == 1 ? "e" : "t") + " valida"; },
+ formatLoadMore: function (pageNumber) { return "Laen tulemusi.."; },
+ formatSearching: function () { return "Otsin.."; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['et']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_eu.js b/htdocs/includes/jquery/plugins/select2/select2_locale_eu.js
new file mode 100644
index 00000000000..67ae8d05ae5
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_eu.js
@@ -0,0 +1,45 @@
+/**
+ * Select2 Basque translation.
+ *
+ * Author: Julen Ruiz Aizpuru
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['eu'] = {
+ formatNoMatches: function () {
+ return "Ez da bat datorrenik aurkitu";
+ },
+ formatInputTooShort: function (input, min) {
+ var n = min - input.length;
+ if (n === 1) {
+ return "Idatzi karaktere bat gehiago";
+ } else {
+ return "Idatzi " + n + " karaktere gehiago";
+ }
+ },
+ formatInputTooLong: function (input, max) {
+ var n = input.length - max;
+ if (n === 1) {
+ return "Idatzi karaktere bat gutxiago";
+ } else {
+ return "Idatzi " + n + " karaktere gutxiago";
+ }
+ },
+ formatSelectionTooBig: function (limit) {
+ if (limit === 1 ) {
+ return "Elementu bakarra hauta dezakezu";
+ } else {
+ return limit + " elementu hauta ditzakezu soilik";
+ }
+ },
+ formatLoadMore: function (pageNumber) {
+ return "Emaitza gehiago kargatzen…";
+ },
+ formatSearching: function () {
+ return "Bilatzen…";
+ }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['eu']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_fa.js b/htdocs/includes/jquery/plugins/select2/select2_locale_fa.js
new file mode 100644
index 00000000000..b3ffd8b7da6
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_fa.js
@@ -0,0 +1,21 @@
+/**
+ * Select2 Persian translation.
+ *
+ * Author: Ali Choopan
+ * Author: Ebrahim Byagowi
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['fa'] = {
+ formatMatches: function (matches) { return matches + " نتیجه موجود است، کلیدهای جهت بالا و پایین را برای گشتن استفاده کنید."; },
+ formatNoMatches: function () { return "نتیجهای یافت نشد."; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "لطفاً " + n + " نویسه بیشتر وارد نمایید"; },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "لطفاً " + n + " نویسه را حذف کنید."; },
+ formatSelectionTooBig: function (limit) { return "شما فقط میتوانید " + limit + " مورد را انتخاب کنید"; },
+ formatLoadMore: function (pageNumber) { return "در حال بارگیری موارد بیشتر…"; },
+ formatSearching: function () { return "در حال جستجو…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['fa']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_fi.js b/htdocs/includes/jquery/plugins/select2/select2_locale_fi.js
new file mode 100644
index 00000000000..6487fbdad35
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_fi.js
@@ -0,0 +1,30 @@
+/**
+ * Select2 Finnish translation
+ */
+(function ($) {
+ "use strict";
+ $.fn.select2.locales['fi'] = {
+ formatNoMatches: function () {
+ return "Ei tuloksia";
+ },
+ formatInputTooShort: function (input, min) {
+ var n = min - input.length;
+ return "Ole hyvä ja anna " + n + " merkkiä lisää";
+ },
+ formatInputTooLong: function (input, max) {
+ var n = input.length - max;
+ return "Ole hyvä ja anna " + n + " merkkiä vähemmän";
+ },
+ formatSelectionTooBig: function (limit) {
+ return "Voit valita ainoastaan " + limit + " kpl";
+ },
+ formatLoadMore: function (pageNumber) {
+ return "Ladataan lisää tuloksia…";
+ },
+ formatSearching: function () {
+ return "Etsitään…";
+ }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['fi']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_fr.js b/htdocs/includes/jquery/plugins/select2/select2_locale_fr.js
new file mode 100644
index 00000000000..d5485d6be76
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_fr.js
@@ -0,0 +1,18 @@
+/**
+ * Select2 French translation
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['fr'] = {
+ formatMatches: function (matches) { return matches + " résultats sont disponibles, utilisez les flèches haut et bas pour naviguer."; },
+ formatNoMatches: function () { return "Aucun résultat trouvé"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Saisissez " + n + " caractère" + (n == 1? "" : "s") + " supplémentaire" + (n == 1? "" : "s") ; },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Supprimez " + n + " caractère" + (n == 1? "" : "s"); },
+ formatSelectionTooBig: function (limit) { return "Vous pouvez seulement sélectionner " + limit + " élément" + (limit == 1 ? "" : "s"); },
+ formatLoadMore: function (pageNumber) { return "Chargement de résultats supplémentaires…"; },
+ formatSearching: function () { return "Recherche en cours…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['fr']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_gl.js b/htdocs/includes/jquery/plugins/select2/select2_locale_gl.js
new file mode 100644
index 00000000000..9335167da96
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_gl.js
@@ -0,0 +1,45 @@
+/**
+ * Select2 Galician translation
+ *
+ * Author: Leandro Regueiro
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['gl'] = {
+ formatNoMatches: function () {
+ return "Non se atoparon resultados";
+ },
+ formatInputTooShort: function (input, min) {
+ var n = min - input.length;
+ if (n === 1) {
+ return "Engada un carácter";
+ } else {
+ return "Engada " + n + " caracteres";
+ }
+ },
+ formatInputTooLong: function (input, max) {
+ var n = input.length - max;
+ if (n === 1) {
+ return "Elimine un carácter";
+ } else {
+ return "Elimine " + n + " caracteres";
+ }
+ },
+ formatSelectionTooBig: function (limit) {
+ if (limit === 1 ) {
+ return "Só pode seleccionar un elemento";
+ } else {
+ return "Só pode seleccionar " + limit + " elementos";
+ }
+ },
+ formatLoadMore: function (pageNumber) {
+ return "Cargando máis resultados…";
+ },
+ formatSearching: function () {
+ return "Buscando…";
+ }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['gl']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_he.js b/htdocs/includes/jquery/plugins/select2/select2_locale_he.js
new file mode 100644
index 00000000000..789dcdcaaf2
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_he.js
@@ -0,0 +1,19 @@
+/**
+* Select2 Hebrew translation.
+*
+* Author: Yakir Sitbon
+*/
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['he'] = {
+ formatNoMatches: function () { return "לא נמצאו התאמות"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "נא להזין עוד " + n + " תווים נוספים"; },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "נא להזין פחות " + n + " תווים"; },
+ formatSelectionTooBig: function (limit) { return "ניתן לבחור " + limit + " פריטים"; },
+ formatLoadMore: function (pageNumber) { return "טוען תוצאות נוספות…"; },
+ formatSearching: function () { return "מחפש…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['he']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_hr.js b/htdocs/includes/jquery/plugins/select2/select2_locale_hr.js
new file mode 100644
index 00000000000..ce8051c788e
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_hr.js
@@ -0,0 +1,24 @@
+/**
+ * Select2 Croatian translation.
+ *
+ * @author Edi Modrić
+ * @author Uriy Efremochkin
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['hr'] = {
+ formatNoMatches: function () { return "Nema rezultata"; },
+ formatInputTooShort: function (input, min) { return "Unesite još" + character(min - input.length); },
+ formatInputTooLong: function (input, max) { return "Unesite" + character(input.length - max) + " manje"; },
+ formatSelectionTooBig: function (limit) { return "Maksimalan broj odabranih stavki je " + limit; },
+ formatLoadMore: function (pageNumber) { return "Učitavanje rezultata…"; },
+ formatSearching: function () { return "Pretraga…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['hr']);
+
+ function character (n) {
+ return " " + n + " znak" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "a" : "" : "ova");
+ }
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_hu.js b/htdocs/includes/jquery/plugins/select2/select2_locale_hu.js
new file mode 100644
index 00000000000..f431f246360
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_hu.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Hungarian translation
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['hu'] = {
+ formatNoMatches: function () { return "Nincs találat."; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Túl rövid. Még " + n + " karakter hiányzik."; },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Túl hosszú. " + n + " karakterrel több, mint kellene."; },
+ formatSelectionTooBig: function (limit) { return "Csak " + limit + " elemet lehet kiválasztani."; },
+ formatLoadMore: function (pageNumber) { return "Töltés…"; },
+ formatSearching: function () { return "Keresés…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['hu']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_id.js b/htdocs/includes/jquery/plugins/select2/select2_locale_id.js
new file mode 100644
index 00000000000..e9c1fd9b974
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_id.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Indonesian translation.
+ *
+ * Author: Ibrahim Yusuf
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['id'] = {
+ formatNoMatches: function () { return "Tidak ada data yang sesuai"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Masukkan " + n + " huruf lagi" + (n == 1 ? "" : "s"); },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Hapus " + n + " huruf" + (n == 1 ? "" : "s"); },
+ formatSelectionTooBig: function (limit) { return "Anda hanya dapat memilih " + limit + " pilihan" + (limit == 1 ? "" : "s"); },
+ formatLoadMore: function (pageNumber) { return "Mengambil data…"; },
+ formatSearching: function () { return "Mencari…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['id']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_is.js b/htdocs/includes/jquery/plugins/select2/select2_locale_is.js
new file mode 100644
index 00000000000..273f33de8c0
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_is.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Icelandic translation.
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['is'] = {
+ formatNoMatches: function () { return "Ekkert fannst"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Vinsamlegast skrifið " + n + " staf" + (n > 1 ? "i" : "") + " í viðbót"; },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Vinsamlegast styttið texta um " + n + " staf" + (n > 1 ? "i" : ""); },
+ formatSelectionTooBig: function (limit) { return "Þú getur aðeins valið " + limit + " atriði"; },
+ formatLoadMore: function (pageNumber) { return "Sæki fleiri niðurstöður…"; },
+ formatSearching: function () { return "Leita…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['is']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_it.js b/htdocs/includes/jquery/plugins/select2/select2_locale_it.js
new file mode 100644
index 00000000000..6e2b8e23709
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_it.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Italian translation
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['it'] = {
+ formatNoMatches: function () { return "Nessuna corrispondenza trovata"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Inserisci ancora " + n + " caratter" + (n == 1? "e" : "i"); },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Inserisci " + n + " caratter" + (n == 1? "e" : "i") + " in meno"; },
+ formatSelectionTooBig: function (limit) { return "Puoi selezionare solo " + limit + " element" + (limit == 1 ? "o" : "i"); },
+ formatLoadMore: function (pageNumber) { return "Caricamento in corso…"; },
+ formatSearching: function () { return "Ricerca…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['it']);
+})(jQuery);
\ No newline at end of file
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_ja.js b/htdocs/includes/jquery/plugins/select2/select2_locale_ja.js
new file mode 100644
index 00000000000..7dbd8d7ee86
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_ja.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Japanese translation.
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['ja'] = {
+ formatNoMatches: function () { return "該当なし"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "後" + n + "文字入れてください"; },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "検索文字列が" + n + "文字長すぎます"; },
+ formatSelectionTooBig: function (limit) { return "最多で" + limit + "項目までしか選択できません"; },
+ formatLoadMore: function (pageNumber) { return "読込中・・・"; },
+ formatSearching: function () { return "検索中・・・"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['ja']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_ka.js b/htdocs/includes/jquery/plugins/select2/select2_locale_ka.js
new file mode 100644
index 00000000000..6cbe1d8f31e
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_ka.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Georgian (Kartuli) translation.
+ *
+ * Author: Dimitri Kurashvili dimakura@gmail.com
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['ka'] = {
+ formatNoMatches: function () { return "ვერ მოიძებნა"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "გთხოვთ შეიყვანოთ კიდევ " + n + " სიმბოლო"; },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "გთხოვთ წაშალოთ " + n + " სიმბოლო"; },
+ formatSelectionTooBig: function (limit) { return "თქვენ შეგიძლიათ მხოლოდ " + limit + " ჩანაწერის მონიშვნა"; },
+ formatLoadMore: function (pageNumber) { return "შედეგის ჩატვირთვა…"; },
+ formatSearching: function () { return "ძებნა…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['ka']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_ko.js b/htdocs/includes/jquery/plugins/select2/select2_locale_ko.js
new file mode 100644
index 00000000000..bf036e09e6e
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_ko.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Korean translation.
+ *
+ * @author Swen Mun
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['ko'] = {
+ formatNoMatches: function () { return "결과 없음"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "너무 짧습니다. "+n+"글자 더 입력해주세요."; },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "너무 깁니다. "+n+"글자 지워주세요."; },
+ formatSelectionTooBig: function (limit) { return "최대 "+limit+"개까지만 선택하실 수 있습니다."; },
+ formatLoadMore: function (pageNumber) { return "불러오는 중…"; },
+ formatSearching: function () { return "검색 중…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['ko']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_lt.js b/htdocs/includes/jquery/plugins/select2/select2_locale_lt.js
new file mode 100644
index 00000000000..7d7040f72f1
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_lt.js
@@ -0,0 +1,26 @@
+/**
+ * Select2 Lithuanian translation.
+ *
+ * @author CRONUS Karmalakas
+ * @author Uriy Efremochkin
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['lt'] = {
+ formatNoMatches: function () { return "Atitikmenų nerasta"; },
+ formatInputTooShort: function (input, min) { return "Įrašykite dar" + character(min - input.length); },
+ formatInputTooLong: function (input, max) { return "Pašalinkite" + character(input.length - max); },
+ formatSelectionTooBig: function (limit) {
+ return "Jūs galite pasirinkti tik " + limit + " element" + ((limit%100 > 9 && limit%100 < 21) || limit%10 == 0 ? "ų" : limit%10 > 1 ? "us" : "ą");
+ },
+ formatLoadMore: function (pageNumber) { return "Kraunama daugiau rezultatų…"; },
+ formatSearching: function () { return "Ieškoma…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['lt']);
+
+ function character (n) {
+ return " " + n + " simbol" + ((n%100 > 9 && n%100 < 21) || n%10 == 0 ? "ių" : n%10 > 1 ? "ius" : "į");
+ }
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_lv.js b/htdocs/includes/jquery/plugins/select2/select2_locale_lv.js
new file mode 100644
index 00000000000..4afc5b41c80
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_lv.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Latvian translation.
+ *
+ * @author Uriy Efremochkin
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['lv'] = {
+ formatNoMatches: function () { return "Sakritību nav"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Lūdzu ievadiet vēl " + n + " simbol" + (n == 11 ? "us" : n%10 == 1 ? "u" : "us"); },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Lūdzu ievadiet par " + n + " simbol" + (n == 11 ? "iem" : n%10 == 1 ? "u" : "iem") + " mazāk"; },
+ formatSelectionTooBig: function (limit) { return "Jūs varat izvēlēties ne vairāk kā " + limit + " element" + (limit == 11 ? "us" : limit%10 == 1 ? "u" : "us"); },
+ formatLoadMore: function (pageNumber) { return "Datu ielāde…"; },
+ formatSearching: function () { return "Meklēšana…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['lv']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_mk.js b/htdocs/includes/jquery/plugins/select2/select2_locale_mk.js
new file mode 100644
index 00000000000..8a51a9e0b3c
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_mk.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Macedonian translation.
+ *
+ * Author: Marko Aleksic
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['mk'] = {
+ formatNoMatches: function () { return "Нема пронајдено совпаѓања"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Ве молиме внесете уште " + n + " карактер" + (n == 1 ? "" : "и"); },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Ве молиме внесете " + n + " помалку карактер" + (n == 1? "" : "и"); },
+ formatSelectionTooBig: function (limit) { return "Можете да изберете само " + limit + " ставк" + (limit == 1 ? "а" : "и"); },
+ formatLoadMore: function (pageNumber) { return "Вчитување резултати…"; },
+ formatSearching: function () { return "Пребарување…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['mk']);
+})(jQuery);
\ No newline at end of file
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_ms.js b/htdocs/includes/jquery/plugins/select2/select2_locale_ms.js
new file mode 100644
index 00000000000..46588d6d72c
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_ms.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Malay translation.
+ *
+ * Author: Kepoweran
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['ms'] = {
+ formatNoMatches: function () { return "Tiada padanan yang ditemui"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Sila masukkan " + n + " aksara lagi"; },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Sila hapuskan " + n + " aksara"; },
+ formatSelectionTooBig: function (limit) { return "Anda hanya boleh memilih " + limit + " pilihan"; },
+ formatLoadMore: function (pageNumber) { return "Sedang memuatkan keputusan…"; },
+ formatSearching: function () { return "Mencari…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['ms']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_nb.js b/htdocs/includes/jquery/plugins/select2/select2_locale_nb.js
new file mode 100644
index 00000000000..cb5dfaeef22
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_nb.js
@@ -0,0 +1,22 @@
+/**
+ * Select2 Norwegian Bokmål translation.
+ *
+ * Author: Torgeir Veimo
+ * Author: Bjørn Johansen
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['nb'] = {
+ formatMatches: function (matches) { if (matches === 1) { return "Ett resultat er tilgjengelig, trykk enter for å velge det."; } return matches + " resultater er tilgjengelig. Bruk piltastene opp og ned for å navigere."; },
+ formatNoMatches: function () { return "Ingen treff"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Vennligst skriv inn " + n + (n>1 ? " flere tegn" : " tegn til"); },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Vennligst fjern " + n + " tegn"; },
+ formatSelectionTooBig: function (limit) { return "Du kan velge maks " + limit + " elementer"; },
+ formatLoadMore: function (pageNumber) { return "Laster flere resultater …"; },
+ formatSearching: function () { return "Søker …"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['no']);
+})(jQuery);
+
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_nl.js b/htdocs/includes/jquery/plugins/select2/select2_locale_nl.js
new file mode 100644
index 00000000000..985741ec20f
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_nl.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Dutch translation
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['nl'] = {
+ formatNoMatches: function () { return "Geen resultaten gevonden"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Vul nog " + n + " karakter" + (n == 1? "" : "s") + " in"; },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Haal " + n + " karakter" + (n == 1? "" : "s") + " weg"; },
+ formatSelectionTooBig: function (limit) { return "Maximaal " + limit + " item" + (limit == 1 ? "" : "s") + " toegestaan"; },
+ formatLoadMore: function (pageNumber) { return "Meer resultaten laden…"; },
+ formatSearching: function () { return "Zoeken…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['nl']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_pl.js b/htdocs/includes/jquery/plugins/select2/select2_locale_pl.js
new file mode 100644
index 00000000000..87c26194131
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_pl.js
@@ -0,0 +1,54 @@
+/**
+ * Select2 Polish translation.
+ *
+ * @author Jan Kondratowicz
+ * @author Uriy Efremochkin
+ * @author Michał Połtyn
+ * @author Damian Zajkowski
+ */
+(function($) {
+ "use strict";
+
+ $.fn.select2.locales['pl'] = {
+ formatNoMatches: function() {
+ return "Brak wyników";
+ },
+ formatInputTooShort: function(input, min) {
+ return "Wpisz co najmniej" + character(min - input.length, "znak", "i");
+ },
+ formatInputTooLong: function(input, max) {
+ return "Wpisana fraza jest za długa o" + character(input.length - max, "znak", "i");
+ },
+ formatSelectionTooBig: function(limit) {
+ return "Możesz zaznaczyć najwyżej" + character(limit, "element", "y");
+ },
+ formatLoadMore: function(pageNumber) {
+ return "Ładowanie wyników…";
+ },
+ formatSearching: function() {
+ return "Szukanie…";
+ }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['pl']);
+
+ function character(n, word, pluralSuffix) {
+ //Liczba pojedyncza - brak suffiksu
+ //jeden znak
+ //jeden element
+ var suffix = '';
+ if (n > 1 && n < 5) {
+ //Liczaba mnoga ilość od 2 do 4 - własny suffiks
+ //Dwa znaki, trzy znaki, cztery znaki.
+ //Dwa elementy, trzy elementy, cztery elementy
+ suffix = pluralSuffix;
+ } else if (n == 0 || n >= 5) {
+ //Ilość 0 suffiks ów
+ //Liczaba mnoga w ilości 5 i więcej - suffiks ów (nie poprawny dla wszystkich wyrazów, np. 100 wiadomości)
+ //Zero znaków, Pięć znaków, sześć znaków, siedem znaków, osiem znaków.
+ //Zero elementów Pięć elementów, sześć elementów, siedem elementów, osiem elementów.
+ suffix = 'ów';
+ }
+ return " " + n + " " + word + suffix;
+ }
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_pt-BR.js b/htdocs/includes/jquery/plugins/select2/select2_locale_pt-BR.js
new file mode 100644
index 00000000000..51b037de580
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_pt-BR.js
@@ -0,0 +1,18 @@
+/**
+ * Select2 Brazilian Portuguese translation
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['pt-BR'] = {
+ formatNoMatches: function () { return "Nenhum resultado encontrado"; },
+ formatAjaxError: function () { return "Erro na busca"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Digite " + (min == 1 ? "" : "mais") + " " + n + " caracter" + (n == 1? "" : "es"); },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " caracter" + (n == 1? "" : "es"); },
+ formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
+ formatLoadMore: function (pageNumber) { return "Carregando mais resultados…"; },
+ formatSearching: function () { return "Buscando…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['pt-BR']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_pt-PT.js b/htdocs/includes/jquery/plugins/select2/select2_locale_pt-PT.js
new file mode 100644
index 00000000000..ae55a4fc4ef
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_pt-PT.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Portuguese (Portugal) translation
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['pt-PT'] = {
+ formatNoMatches: function () { return "Nenhum resultado encontrado"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduza " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
+ formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
+ formatLoadMore: function (pageNumber) { return "A carregar mais resultados…"; },
+ formatSearching: function () { return "A pesquisar…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['pt-PT']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_ro.js b/htdocs/includes/jquery/plugins/select2/select2_locale_ro.js
new file mode 100644
index 00000000000..21b0cf18186
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_ro.js
@@ -0,0 +1,17 @@
+/**
+ * Select2 Romanian translation.
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['ro'] = {
+ formatNoMatches: function () { return "Nu a fost găsit nimic"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Vă rugăm să introduceți incă " + n + " caracter" + (n == 1 ? "" : "e"); },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Vă rugăm să introduceți mai puțin de " + n + " caracter" + (n == 1? "" : "e"); },
+ formatSelectionTooBig: function (limit) { return "Aveți voie să selectați cel mult " + limit + " element" + (limit == 1 ? "" : "e"); },
+ formatLoadMore: function (pageNumber) { return "Se încarcă…"; },
+ formatSearching: function () { return "Căutare…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['ro']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_rs.js b/htdocs/includes/jquery/plugins/select2/select2_locale_rs.js
new file mode 100644
index 00000000000..72c16389c9e
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_rs.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Serbian translation.
+ *
+ * @author Limon Monte
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['rs'] = {
+ formatNoMatches: function () { return "Ništa nije pronađeno"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Ukucajte bar još " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Obrišite " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); },
+ formatSelectionTooBig: function (limit) { return "Možete izabrati samo " + limit + " stavk" + (limit % 10 == 1 && limit % 100 != 11 ? "u" : (limit % 10 >= 2 && limit % 10 <= 4 && (limit % 100 < 12 || limit % 100 > 14)? "e" : "i")); },
+ formatLoadMore: function (pageNumber) { return "Preuzimanje još rezultata…"; },
+ formatSearching: function () { return "Pretraga…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['rs']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_ru.js b/htdocs/includes/jquery/plugins/select2/select2_locale_ru.js
new file mode 100644
index 00000000000..2a6c7702c42
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_ru.js
@@ -0,0 +1,23 @@
+/**
+ * Select2 Russian translation.
+ *
+ * @author Uriy Efremochkin
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['ru'] = {
+ formatNoMatches: function () { return "Совпадений не найдено"; },
+ formatInputTooShort: function (input, min) { return "Пожалуйста, введите еще хотя бы" + character(min - input.length); },
+ formatInputTooLong: function (input, max) { return "Пожалуйста, введите на" + character(input.length - max) + " меньше"; },
+ formatSelectionTooBig: function (limit) { return "Вы можете выбрать не более " + limit + " элемент" + (limit%10 == 1 && limit%100 != 11 ? "а" : "ов"); },
+ formatLoadMore: function (pageNumber) { return "Загрузка данных…"; },
+ formatSearching: function () { return "Поиск…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['ru']);
+
+ function character (n) {
+ return " " + n + " символ" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 20) ? n%10 > 1 ? "a" : "" : "ов");
+ }
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_sk.js b/htdocs/includes/jquery/plugins/select2/select2_locale_sk.js
new file mode 100644
index 00000000000..027530c9388
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_sk.js
@@ -0,0 +1,50 @@
+/**
+ * Select2 Slovak translation.
+ *
+ * Author: David Vallner
+ */
+(function ($) {
+ "use strict";
+ // use text for the numbers 2 through 4
+ var smallNumbers = {
+ 2: function(masc) { return (masc ? "dva" : "dve"); },
+ 3: function() { return "tri"; },
+ 4: function() { return "štyri"; }
+ };
+ $.fn.select2.locales['sk'] = {
+ formatNoMatches: function () { return "Nenašli sa žiadne položky"; },
+ formatInputTooShort: function (input, min) {
+ var n = min - input.length;
+ if (n == 1) {
+ return "Prosím, zadajte ešte jeden znak";
+ } else if (n <= 4) {
+ return "Prosím, zadajte ešte ďalšie "+smallNumbers[n](true)+" znaky";
+ } else {
+ return "Prosím, zadajte ešte ďalších "+n+" znakov";
+ }
+ },
+ formatInputTooLong: function (input, max) {
+ var n = input.length - max;
+ if (n == 1) {
+ return "Prosím, zadajte o jeden znak menej";
+ } else if (n >= 2 && n <= 4) {
+ return "Prosím, zadajte o "+smallNumbers[n](true)+" znaky menej";
+ } else {
+ return "Prosím, zadajte o "+n+" znakov menej";
+ }
+ },
+ formatSelectionTooBig: function (limit) {
+ if (limit == 1) {
+ return "Môžete zvoliť len jednu položku";
+ } else if (limit >= 2 && limit <= 4) {
+ return "Môžete zvoliť najviac "+smallNumbers[limit](false)+" položky";
+ } else {
+ return "Môžete zvoliť najviac "+limit+" položiek";
+ }
+ },
+ formatLoadMore: function (pageNumber) { return "Načítavajú sa ďalšie výsledky…"; },
+ formatSearching: function () { return "Vyhľadávanie…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['sk']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_sv.js b/htdocs/includes/jquery/plugins/select2/select2_locale_sv.js
new file mode 100644
index 00000000000..96f8c0a881d
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_sv.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Swedish translation.
+ *
+ * Author: Jens Rantil
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['sv'] = {
+ formatNoMatches: function () { return "Inga träffar"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Var god skriv in " + n + (n>1 ? " till tecken" : " tecken till"); },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Var god sudda ut " + n + " tecken"; },
+ formatSelectionTooBig: function (limit) { return "Du kan max välja " + limit + " element"; },
+ formatLoadMore: function (pageNumber) { return "Laddar fler resultat…"; },
+ formatSearching: function () { return "Söker…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['sv']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_th.js b/htdocs/includes/jquery/plugins/select2/select2_locale_th.js
new file mode 100644
index 00000000000..7f3e6ef8c39
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_th.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Thai translation.
+ *
+ * Author: Atsawin Chaowanakritsanakul
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['th'] = {
+ formatNoMatches: function () { return "ไม่พบข้อมูล"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "โปรดพิมพ์เพิ่มอีก " + n + " ตัวอักษร"; },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "โปรดลบออก " + n + " ตัวอักษร"; },
+ formatSelectionTooBig: function (limit) { return "คุณสามารถเลือกได้ไม่เกิน " + limit + " รายการ"; },
+ formatLoadMore: function (pageNumber) { return "กำลังค้นข้อมูลเพิ่ม…"; },
+ formatSearching: function () { return "กำลังค้นข้อมูล…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['th']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_tr.js b/htdocs/includes/jquery/plugins/select2/select2_locale_tr.js
new file mode 100644
index 00000000000..1dda95ca376
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_tr.js
@@ -0,0 +1,19 @@
+/**
+ * Select2 Turkish translation.
+ *
+ * Author: Salim KAYABAŞI
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['tr'] = {
+ formatNoMatches: function () { return "Sonuç bulunamadı"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "En az " + n + " karakter daha girmelisiniz"; },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return n + " karakter azaltmalısınız"; },
+ formatSelectionTooBig: function (limit) { return "Sadece " + limit + " seçim yapabilirsiniz"; },
+ formatLoadMore: function (pageNumber) { return "Daha fazla…"; },
+ formatSearching: function () { return "Aranıyor…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['tr']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_ug-CN.js b/htdocs/includes/jquery/plugins/select2/select2_locale_ug-CN.js
new file mode 100644
index 00000000000..579588a7ac0
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_ug-CN.js
@@ -0,0 +1,16 @@
+/**
+ * Select2 Uyghur translation
+ */
+(function ($) {
+ "use strict";
+ $.fn.select2.locales['ug-CN'] = {
+ formatNoMatches: function () { return "ماس كېلىدىغان ئۇچۇر تېپىلمىدى"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "يەنە " + n + " ھەرپ كىرگۈزۈڭ";},
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "" + n + "ھەرپ ئۆچۈرۈڭ";},
+ formatSelectionTooBig: function (limit) { return "ئەڭ كۆپ بولغاندا" + limit + " تال ئۇچۇر تاللىيالايسىز"; },
+ formatLoadMore: function (pageNumber) { return "ئۇچۇرلار ئوقۇلىۋاتىدۇ…"; },
+ formatSearching: function () { return "ئىزدەۋاتىدۇ…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['ug-CN']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_uk.js b/htdocs/includes/jquery/plugins/select2/select2_locale_uk.js
new file mode 100644
index 00000000000..b5bd0e02d2c
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_uk.js
@@ -0,0 +1,25 @@
+/**
+ * Select2 Ukrainian translation.
+ *
+ * @author bigmihail
+ * @author Uriy Efremochkin
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['uk'] = {
+ formatMatches: function (matches) { return character(matches, "результат") + " знайдено, використовуйте клавіші зі стрілками вверх та вниз для навігації."; },
+ formatNoMatches: function () { return "Нічого не знайдено"; },
+ formatInputTooShort: function (input, min) { return "Введіть буль ласка ще " + character(min - input.length, "символ"); },
+ formatInputTooLong: function (input, max) { return "Введіть буль ласка на " + character(input.length - max, "символ") + " менше"; },
+ formatSelectionTooBig: function (limit) { return "Ви можете вибрати лише " + character(limit, "елемент"); },
+ formatLoadMore: function (pageNumber) { return "Завантаження даних…"; },
+ formatSearching: function () { return "Пошук…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['uk']);
+
+ function character (n, word) {
+ return n + " " + word + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "и" : "" : "ів");
+ }
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_vi.js b/htdocs/includes/jquery/plugins/select2/select2_locale_vi.js
new file mode 100644
index 00000000000..cc67065f972
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_vi.js
@@ -0,0 +1,20 @@
+/**
+ * Select2 Vietnamese translation.
+ *
+ * Author: Long Nguyen
+ */
+(function ($) {
+ "use strict";
+
+ $.fn.select2.locales['vi'] = {
+ formatNoMatches: function () { return "Không tìm thấy kết quả"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "Vui lòng nhập nhiều hơn " + n + " ký tự" + (n == 1 ? "" : "s"); },
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "Vui lòng nhập ít hơn " + n + " ký tự" + (n == 1? "" : "s"); },
+ formatSelectionTooBig: function (limit) { return "Chỉ có thể chọn được " + limit + " tùy chọn" + (limit == 1 ? "" : "s"); },
+ formatLoadMore: function (pageNumber) { return "Đang lấy thêm kết quả…"; },
+ formatSearching: function () { return "Đang tìm…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['vi']);
+})(jQuery);
+
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_zh-CN.js b/htdocs/includes/jquery/plugins/select2/select2_locale_zh-CN.js
new file mode 100644
index 00000000000..e988dac1a4c
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_zh-CN.js
@@ -0,0 +1,16 @@
+/**
+ * Select2 Chinese translation
+ */
+(function ($) {
+ "use strict";
+ $.fn.select2.locales['zh-CN'] = {
+ formatNoMatches: function () { return "没有找到匹配项"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "请再输入" + n + "个字符";},
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "请删掉" + n + "个字符";},
+ formatSelectionTooBig: function (limit) { return "你只能选择最多" + limit + "项"; },
+ formatLoadMore: function (pageNumber) { return "加载结果中…"; },
+ formatSearching: function () { return "搜索中…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['zh-CN']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_zh-TW.js b/htdocs/includes/jquery/plugins/select2/select2_locale_zh-TW.js
new file mode 100644
index 00000000000..85dbd5afc23
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/select2_locale_zh-TW.js
@@ -0,0 +1,16 @@
+/**
+ * Select2 Traditional Chinese translation
+ */
+(function ($) {
+ "use strict";
+ $.fn.select2.locales['zh-TW'] = {
+ formatNoMatches: function () { return "沒有找到相符的項目"; },
+ formatInputTooShort: function (input, min) { var n = min - input.length; return "請再輸入" + n + "個字元";},
+ formatInputTooLong: function (input, max) { var n = input.length - max; return "請刪掉" + n + "個字元";},
+ formatSelectionTooBig: function (limit) { return "你只能選擇最多" + limit + "項"; },
+ formatLoadMore: function (pageNumber) { return "載入中…"; },
+ formatSearching: function () { return "搜尋中…"; }
+ };
+
+ $.extend($.fn.select2.defaults, $.fn.select2.locales['zh-TW']);
+})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2x2.png b/htdocs/includes/jquery/plugins/select2/select2x2.png
new file mode 100644
index 00000000000..4bdd5c961d4
Binary files /dev/null and b/htdocs/includes/jquery/plugins/select2/select2x2.png differ
diff --git a/htdocs/install/mysql/migration/3.6.0-3.7.0.sql b/htdocs/install/mysql/migration/3.6.0-3.7.0.sql
index e8c77100bf9..e4fbcfbec9a 100755
--- a/htdocs/install/mysql/migration/3.6.0-3.7.0.sql
+++ b/htdocs/install/mysql/migration/3.6.0-3.7.0.sql
@@ -183,9 +183,6 @@ UPDATE llx_product SET fk_barcode_type = NULL WHERE fk_barcode_type = 0;
ALTER TABLE llx_product ADD INDEX idx_product_fk_barcode_type (fk_barcode_type);
UPDATE llx_product SET fk_barcode_type = NULL WHERE fk_barcode_type NOT IN (SELECT rowid from llx_c_barcode_type);
--- This request make mysql drop (mysql bug):
-ALTER TABLE llx_product ADD CONSTRAINT fk_product_barcode_type FOREIGN KEY (fk_barcode_type) REFERENCES llx_c_barcode_type(rowid);
-
-- Added missing relations of llx_product_price
-- fk_user_author
@@ -1121,3 +1118,17 @@ ALTER TABLE llx_extrafields ADD alwayseditable INTEGER DEFAULT 0 AFTER pos;
-- add supplier webservice fields
ALTER TABLE llx_societe ADD webservices_url varchar(255) DEFAULT NULL;
ALTER TABLE llx_societe ADD webservices_key varchar(128) DEFAULT NULL;
+
+-- changes size of ref in commande_fourn and facture_fourn
+ALTER TABLE llx_commande_fournisseur MODIFY COLUMN ref VARCHAR(255);
+ALTER TABLE llx_commande_fournisseur MODIFY COLUMN ref_ext VARCHAR(255);
+ALTER TABLE llx_commande_fournisseur MODIFY COLUMN ref_supplier VARCHAR(255);
+
+ALTER TABLE llx_facture_fourn MODIFY COLUMN ref VARCHAR(255);
+ALTER TABLE llx_facture_fourn MODIFY COLUMN ref_ext VARCHAR(255);
+ALTER TABLE llx_facture_fourn MODIFY COLUMN ref_supplier VARCHAR(255);
+
+
+-- This request make mysql drop (mysql bug, so we add it at end):
+--ALTER TABLE llx_product ADD CONSTRAINT fk_product_barcode_type FOREIGN KEY (fk_barcode_type) REFERENCES llx_c_barcode_type(rowid);
+
diff --git a/htdocs/install/mysql/tables/llx_commande_fournisseur.sql b/htdocs/install/mysql/tables/llx_commande_fournisseur.sql
index 2ecf9e10442..ff87110c72a 100644
--- a/htdocs/install/mysql/tables/llx_commande_fournisseur.sql
+++ b/htdocs/install/mysql/tables/llx_commande_fournisseur.sql
@@ -23,11 +23,11 @@ create table llx_commande_fournisseur
(
rowid integer AUTO_INCREMENT PRIMARY KEY,
- ref varchar(30) NOT NULL, -- order number
+ ref varchar(255) NOT NULL, -- order number
entity integer DEFAULT 1 NOT NULL, -- multi company id
- ref_ext varchar(30), -- reference into an external system (not used by dolibarr)
- ref_supplier varchar(30),
+ ref_ext varchar(64), -- reference into an external system (not used by dolibarr)
+ ref_supplier varchar(255),
fk_soc integer NOT NULL,
fk_projet integer DEFAULT 0, -- project id
diff --git a/htdocs/install/mysql/tables/llx_facture_fourn.sql b/htdocs/install/mysql/tables/llx_facture_fourn.sql
index 3a71c2455aa..33773b7a9cb 100644
--- a/htdocs/install/mysql/tables/llx_facture_fourn.sql
+++ b/htdocs/install/mysql/tables/llx_facture_fourn.sql
@@ -22,11 +22,11 @@
create table llx_facture_fourn
(
rowid integer AUTO_INCREMENT PRIMARY KEY,
- ref varchar(30),
- ref_supplier varchar(50) NOT NULL,
+ ref varchar(255),
+ ref_supplier varchar(255) NOT NULL,
entity integer DEFAULT 1 NOT NULL, -- multi company id
- ref_ext varchar(30), -- reference into an external system (not used by dolibarr)
+ ref_ext varchar(255), -- reference into an external system (not used by dolibarr)
type smallint DEFAULT 0 NOT NULL,
fk_soc integer NOT NULL,
diff --git a/htdocs/langs/en_US/accountancy.lang b/htdocs/langs/en_US/accountancy.lang
index cfcdec83c2f..e1713acd57c 100644
--- a/htdocs/langs/en_US/accountancy.lang
+++ b/htdocs/langs/en_US/accountancy.lang
@@ -25,12 +25,12 @@ Selectchartofaccounts=Select a chart of accounts
Validate=Validate
Addanaccount=Add an accounting account
AccountAccounting=Accounting account
-Ventilation=Ventilation
+Ventilation=Breakdown
ToDispatch=To dispatch
Dispatched=Dispatched
-CustomersVentilation=Ventilation customers
-SuppliersVentilation=Ventilation suppliers
+CustomersVentilation=Breakdown customers
+SuppliersVentilation=Breakdown suppliers
TradeMargin=Trade margin
Reports=Reports
ByCustomerInvoice=By invoices customers
@@ -45,9 +45,9 @@ WriteBookKeeping=Record accounts in general ledger
Bookkeeping=General ledger
AccountBalanceByMonth=Account balance by month
-AccountingVentilation=Accounting ventilation
-AccountingVentilationSupplier=Accounting ventilation supplier
-AccountingVentilationCustomer=Accounting ventilation customer
+AccountingVentilation=Breakdown accounting
+AccountingVentilationSupplier=Breakdown accounting supplier
+AccountingVentilationCustomer=Breakdown accounting customer
Line=Line
CAHTF=Total purchase supplier HT
@@ -56,7 +56,7 @@ InvoiceLinesDone=Ventilated lines of invoice
IntoAccount=In the accounting account
Ventilate=Ventilate
-VentilationAuto=Automatic ventilation
+VentilationAuto=Automatic breakdown
Processing=Processing
EndProcessing=The end of processing
@@ -68,9 +68,9 @@ NotVentilatedinAccount=Not ventilated in the accounting account
ACCOUNTING_SEPARATORCSV=Separator CSV
-ACCOUNTING_LIMIT_LIST_VENTILATION=Number of elements to be ventilated shown by page (maximum recommended : 50)
-ACCOUNTING_LIST_SORT_VENTILATION_TODO=Begin the sorting of the pages of ventilation "Has to ventilate" by the most recent elements
-ACCOUNTING_LIST_SORT_VENTILATION_DONE=Begin the sorting of the pages of ventilation "Ventilated" by the most recent elements
+ACCOUNTING_LIMIT_LIST_VENTILATION=Number of elements to be breakdown shown by page (maximum recommended : 50)
+ACCOUNTING_LIST_SORT_VENTILATION_TODO=Begin the sorting of the breakdown pages "Has to breakdown" by the most recent elements
+ACCOUNTING_LIST_SORT_VENTILATION_DONE=Begin the sorting of the breakdown pages "Breakdown" by the most recent elements
AccountLength=Length of the accounting accounts shown in Dolibarr
AccountLengthDesc=Function allowing to feign a length of accounting account by replacing spaces by the zero figure. This function touches only the display, it does not modify the accounting accounts registered in Dolibarr. For the export, this function is necessary to be compatible with certain software.
@@ -140,14 +140,14 @@ Active=Statement
NewFiscalYear=New fiscal year
-DescVentilCustomer=Consult here the annual accounting ventilation of your invoices customers
+DescVentilCustomer=Consult here the annual breakdown accounting of your invoices customers
TotalVente=Total turnover HT
TotalMarge=Total sales margin
DescVentilDoneCustomer=Consult here the list of the lines of invoices customers and their accounting account
DescVentilTodoCustomer=Ventilate your lines of customer invoice with an accounting account
ChangeAccount=Change the accounting account for lines selected by the account:
Vide=-
-DescVentilSupplier=Consult here the annual accounting ventilation of your invoices suppliers
+DescVentilSupplier=Consult here the annual breakdown accounting of your invoices suppliers
DescVentilTodoSupplier=Ventilate your lines of invoice supplier with an accounting account
DescVentilDoneSupplier=Consult here the list of the lines of invoices supplier and their accounting account
@@ -155,4 +155,4 @@ ValidateHistory=Validate Automatically
ErrorAccountancyCodeIsAlreadyUse=Error, you cannot delete this accounting account because it is used
-FicheVentilation=Ventilation card
\ No newline at end of file
+FicheVentilation=Breakdown card
\ No newline at end of file
diff --git a/htdocs/langs/en_US/categories.lang b/htdocs/langs/en_US/categories.lang
index 3ee731f0824..0fe3b72b81f 100644
--- a/htdocs/langs/en_US/categories.lang
+++ b/htdocs/langs/en_US/categories.lang
@@ -111,4 +111,5 @@ ExtraFieldsCategories=Complementary attributes
CategoriesSetup=Categories setup
CategorieRecursiv=Link with parent category automatically
CategorieRecursivHelp=If activated, product will also linked to parent category when adding into a subcategory
-AddProductServiceIntoCategory=Add the following product/service
\ No newline at end of file
+AddProductServiceIntoCategory=Add the following product/service
+ShowCategory=Show category
\ No newline at end of file
diff --git a/htdocs/langs/fr_FR/accountancy.lang b/htdocs/langs/fr_FR/accountancy.lang
index f538e713b81..b5c74a10700 100644
--- a/htdocs/langs/fr_FR/accountancy.lang
+++ b/htdocs/langs/fr_FR/accountancy.lang
@@ -41,8 +41,8 @@ List=Liste
Create=Créer
UpdateAccount=Modification de compte comptable
UpdateMvts=Modification de mouvements
-WriteBookKeeping=Record accounts in general ledger
-Bookkeeping=General ledger
+WriteBookKeeping=Comptabiliser les écritures dans le grand livre
+Bookkeeping=Grand livre
AccountBalanceByMonth=Solde par mois
AccountingVentilation=Ventilation comptable
@@ -53,106 +53,106 @@ Line=Ligne
CAHTF=Total achats fournisseur HT
InvoiceLines=Lignes de factures à ventiler
InvoiceLinesDone=Lignes de factures ventilées
-IntoAccount=In the accounting account
+IntoAccount=Dans le compte comptable
-Ventilate=Ventilate
-VentilationAuto=Automatic ventilation
+Ventilate=Ventilation
+VentilationAuto=Ventilation automatique
-Processing=Processing
-EndProcessing=The end of processing
-AnyLineVentilate=Any lines to ventilate
+Processing=Traitement en cours
+EndProcessing=Fin de traitement
+AnyLineVentilate=Aucune ligne à ventiler
SelectedLines=Lignes sélectionnées
-Lineofinvoice=Line of invoice
-VentilatedinAccount=Ventilated successfully in the accounting account
-NotVentilatedinAccount=Not ventilated in the accounting account
+Lineofinvoice=Ligne de facture
+VentilatedinAccount=Ventilée avec succès dans le compte comptable
+NotVentilatedinAccount=Non ventilée dans le compte comptable
-ACCOUNTING_SEPARATORCSV=Separator CSV
+ACCOUNTING_SEPARATORCSV=Separateur CSV
-ACCOUNTING_LIMIT_LIST_VENTILATION=Number of elements to be ventilated shown by page (maximum recommended : 50)
-ACCOUNTING_LIST_SORT_VENTILATION_TODO=Begin the sorting of the pages of ventilation "Has to ventilate" by the most recent elements
-ACCOUNTING_LIST_SORT_VENTILATION_DONE=Begin the sorting of the pages of ventilation "Ventilated" by the most recent elements
+ACCOUNTING_LIMIT_LIST_VENTILATION=Nombre d'éléments à ventiler affichés par page (maximum conseillé : 50)
+ACCOUNTING_LIST_SORT_VENTILATION_TODO=Commencer le tri des pages de ventilation "A ventiler" par les éléments les plus récents
+ACCOUNTING_LIST_SORT_VENTILATION_DONE=Commencer le tri des pages de ventilation "Ventilées" par les éléments les plus récents
-AccountLength=Length of the accounting accounts shown in Dolibarr
-AccountLengthDesc=Function allowing to feign a length of accounting account by replacing spaces by the zero figure. This function touches only the display, it does not modify the accounting accounts registered in Dolibarr. For the export, this function is necessary to be compatible with certain software.
-ACCOUNTING_LENGTH_GACCOUNT=Length of the general accounts
-ACCOUNTING_LENGTH_AACCOUNT=Length of the third party accounts
+AccountLength=Longueur des comptes comptables affichés dans Dolibarr
+AccountLengthDesc=Fonction permettant de simuler une longueur de compte comptable en remplaçant les espaces par le chiffre zéro. Cette fonction touche uniquement à l'affichage, elle ne modifie pas les comptes comptables enregistrés dans Dolibarr. Pour l'export, cette fonction est nécessaire pour être compatible avec certains logiciels.
+ACCOUNTING_LENGTH_GACCOUNT=Longueur des comptes généraux
+ACCOUNTING_LENGTH_AACCOUNT=Longueur des comptes tiers
-ACCOUNTING_SELL_JOURNAL=Sell journal
-ACCOUNTING_PURCHASE_JOURNAL=Purchase journal
-ACCOUNTING_BANK_JOURNAL=Bank journal
-ACCOUNTING_CASH_JOURNAL=Cash journal
-ACCOUNTING_MISCELLANEOUS_JOURNAL=Miscellaneous journal
-ACCOUNTING_SOCIAL_JOURNAL=Social journal
+ACCOUNTING_SELL_JOURNAL=Journal des ventes
+ACCOUNTING_PURCHASE_JOURNAL=Journal des achats
+ACCOUNTING_BANK_JOURNAL=Journal de banque
+ACCOUNTING_CASH_JOURNAL=Journal de caisse
+ACCOUNTING_MISCELLANEOUS_JOURNAL=Journal des opérations diverses
+ACCOUNTING_SOCIAL_JOURNAL=Journal social
-ACCOUNTING_ACCOUNT_TRANSFER_CASH=Account of transfer
-ACCOUNTING_ACCOUNT_SUSPENSE=Account of wait
+ACCOUNTING_ACCOUNT_TRANSFER_CASH=Compte de transfert espèce
+ACCOUNTING_ACCOUNT_SUSPENSE=Compte d'attente
-ACCOUNTING_PRODUCT_BUY_ACCOUNT=Accounting account by default for bought products (if not defined in the product sheet)
-ACCOUNTING_PRODUCT_SOLD_ACCOUNT=Accounting account by default for the sold products (if not defined in the product sheet)
-ACCOUNTING_SERVICE_BUY_ACCOUNT=Accounting account by default for the bought services (if not defined in the service sheet)
-ACCOUNTING_SERVICE_SOLD_ACCOUNT=Accounting account by default for the sold services (if not defined in the service sheet)
+ACCOUNTING_PRODUCT_BUY_ACCOUNT=Compte comptable par défaut pour les produits achetés (si non défini dans la fiche produit)
+ACCOUNTING_PRODUCT_SOLD_ACCOUNT=Compte comptable par défaut pour les produits vendus (si non défini dans la fiche produit)
+ACCOUNTING_SERVICE_BUY_ACCOUNT=Compte comptable par défaut pour les services achetés (si non défini dans la fiche service)
+ACCOUNTING_SERVICE_SOLD_ACCOUNT=Compte comptable par défaut pour les services vendus (si non défini dans la fiche service)
Doctype=Type de documents
Docdate=Date
-Docref=Reference
+Docref=Référence
Numerocompte=Compte
Code_tiers=Tiers
-Labelcompte=Label account
+Labelcompte=Libellé compte
Debit=Débit
Credit=Crédit
Amount=Montant
Sens=Sens
Codejournal=Journal
-DelBookKeeping=Delete the records of the general ledger
+DelBookKeeping=Supprimer les écritures du grand livre
SellsJournal=Journal des ventes
PurchasesJournal=Journal des achats
DescSellsJournal=Journal des ventes
DescPurchasesJournal=Journal des achats
-BankJournal=Bank journal
-DescBankJournal=Bank journal including all the types of payments other than cash
-CashJournal=Cash journal
-DescCashJournal=Cash journal including the type of payment cash
+BankJournal=Journal de banque
+DescBankJournal=Journal de banque comprenant tous les types de règlements autres que espèce
+CashJournal=Journal de caisse
+DescCashJournal=Journal de caisse comprenant le type de règlement "espèce"
-CashPayment=Cash Payment
+CashPayment=Règlement espèce
-SupplierInvoicePayment=Payment of invoice supplier
-CustomerInvoicePayment=Payment of invoice customer
+SupplierInvoicePayment=Règlement de facture fournisseur
+CustomerInvoicePayment=Règlement de facture client
-ThirdPartyAccount=Thirdparty account
+ThirdPartyAccount=Compte tiers
-NewAccountingMvt=New movement
-NumMvts=Number of movement
+NewAccountingMvt=Nouveau mouvement
+NumMvts=Numéro du mouvement
ListeMvts=Liste des mouvements
-ErrorDebitCredit=Debit and Credit cannot have a value at the same time
+ErrorDebitCredit=Debit et Credit ne peuvent avoir une valeur en même temps
-ReportThirdParty=List thirdparty account
-DescThirdPartyReport=Consult here the list of the thirdparty customers and the suppliers and their accounting accounts
+ReportThirdParty=Liste compte tiers
+DescThirdPartyReport=Consultez ici la liste des tiers clients et fournisseurs et leurs codes comptables
-ListAccounts=List of the accounting accounts
+ListAccounts=Liste des comptes comptables
Pcgversion=Version du plan
Pcgtype=Classe de compte
-Pcgsubtype=Under class of account
+Pcgsubtype=Sous classe de compte
Accountparent=Racine des comptes
-Active=Relevé
+Active=État
NewFiscalYear=Nouvelle année fiscale
-DescVentilCustomer=Consult here the annual accounting ventilation of your invoices customers
-TotalVente=Total turnover HT
-TotalMarge=Total sales margin
-DescVentilDoneCustomer=Consult here the list of the lines of invoices customers and their accounting account
-DescVentilTodoCustomer=Ventilate your lines of customer invoice with an accounting account
-ChangeAccount=Change the accounting account for lines selected by the account:
+DescVentilCustomer=Consultez ici la ventilation comptable annuelle de vos factures clients
+TotalVente=Total chiffre affaires HT
+TotalMarge=Total marge commerciale
+DescVentilDoneCustomer=Consultez ici la liste des lignes de factures clients et leur compte comptable
+DescVentilTodoCustomer=Ventilez vos lignes de facture client avec un compte comptable
+ChangeAccount=Changer le compte comptable pour les lignes sélectionnées par le compte:
Vide=-
-DescVentilSupplier=Consult here the annual accounting ventilation of your invoices suppliers
-DescVentilTodoSupplier=Ventilate your lines of invoice supplier with an accounting account
-DescVentilDoneSupplier=Consult here the list of the lines of invoices supplier and their accounting account
+DescVentilSupplier=Consultez ici la ventilation comptable annuelle de vos factures fournisseurs
+DescVentilTodoSupplier=Ventilez vos lignes de facture fournisseur avec un compte comptable
+DescVentilDoneSupplier=Consultez ici la liste des lignes de factures fournisseur et leur compte comptable
-ValidateHistory=Validate Automatically
+ValidateHistory=Valider Automatiquement
-ErrorAccountancyCodeIsAlreadyUse=Erreur, vous ne pouvez pas détruire de compte comptable car il est utilisé
+ErrorAccountancyCodeIsAlreadyUse=Erreur, vous ne pouvez pas supprimer ce compte comptable car il est utilisé
-FicheVentilation=Ventilation card
+FicheVentilation=Fiche ventilation
diff --git a/htdocs/langs/fr_FR/categories.lang b/htdocs/langs/fr_FR/categories.lang
index a00d97ea191..1c8d988f403 100644
--- a/htdocs/langs/fr_FR/categories.lang
+++ b/htdocs/langs/fr_FR/categories.lang
@@ -112,3 +112,4 @@ CategoriesSetup=Configuration du module catégories
CategorieRecursiv=Lier avec les catégories parentes
CategorieRecursivHelp=Si activé : quand un élément est ajouté dans une catégorie, l'ajouter aussi dans toutes les catégories parentes
AddProductServiceIntoCategory=Ajouter le produit/service suivant
+ShowCategory=Afficher la catégorie
\ No newline at end of file
diff --git a/htdocs/langs/tr_TR/admin.lang b/htdocs/langs/tr_TR/admin.lang
index d1ee8c4ac6e..60121a579e1 100644
--- a/htdocs/langs/tr_TR/admin.lang
+++ b/htdocs/langs/tr_TR/admin.lang
@@ -35,14 +35,14 @@ ExternalUsers=Dış kullanıcılar
GlobalSetup=Genel Ayarlar
GUISetup=Görünüm
SetupArea=Ayarlar alanı
-FormToTestFileUploadForm=Dosya yükleme deneme formu (kuruluma göre)
-IfModuleEnabled=Not: evet yalnızca %s modülü etkinse etkilidir.
+FormToTestFileUploadForm=Dosya yükleme deneme formu (ayarlara göre)
+IfModuleEnabled=Not: yalnızca %s modülü etkinse evet etkilidir.
RemoveLock=%s dosyasını, güncelleme aracının kullanımına izin vermek için belirmişse kaldırın.
RestoreLock=%s dosyasını, güncelleme aracının her hangi bir kullanımını engellemek için, yalnızca okuma izniyle değiştirin.
SecuritySetup=Güvenlik ayarları
ErrorModuleRequirePHPVersion=Hata, bu modül %s veya daha yüksek PHP sürümü gerektirir.
ErrorModuleRequireDolibarrVersion=Hata, bu modül %s veya daha yüksek Dolibarr sürümü gerektirir.
-ErrorDecimalLargerThanAreForbidden=Hata, %s den daha yüksek hassasiyet desteklenmez.
+ErrorDecimalLargerThanAreForbidden=Hata, %s den daha yüksek doğruluk desteklenmez.
DictionarySetup=Sözlük ayarları
Dictionary=Sözlükler
Chartofaccounts=Hesap planı
@@ -120,17 +120,17 @@ LanguageBrowserParameter=Parametre %s
LocalisationDolibarrParameters=Yerelleştirme parametreleri
ClientTZ=İstemci Zaman Dilimi (kullanıcı)
ClientHour=İstemci zamanı (kullanıcı)
-OSTZ=Sunucu OS Zaman Dilimi
+OSTZ=Sunucu İşletim Siztemi Zaman Dilimi
PHPTZ=PHP Saat Dilimi (sunucu)
PHPServerOffsetWithGreenwich=PHP sunucusu Greenwich genişlik sapması (saniye)
ClientOffsetWithGreenwich=İstemci/Tarayıcı Greenwich genişlik sapması (saniye)
-DaylingSavingTime=Yaz saati
+DaylingSavingTime=Yaz saati uygulaması
CurrentHour=PHP saati (sunucu)
CompanyTZ=Firma Saat Dilimi (ana firma)
CompanyHour=Firma saati (ana firma)
CurrentSessionTimeOut=Geçerli oturumun zaman aşımı
YouCanEditPHPTZ=Farklı bir PHP saat dilimi (gerekli değildir) ayarlamak için "SetEnv TZ Europe/Paris" gibi bir satır içeren .htacces dosyası eklemeyi deneyin
-OSEnv=OS Ortamı
+OSEnv=İşletim Sistemi Ortamı
Box=Kutu
Boxes=Kutular
MaxNbOfLinesForBoxes=Kutulardaki ençok satır sayısı
@@ -159,35 +159,35 @@ NewBackup=Yeni yedekleme
GenerateBackup=Yedekleme oluştur
Backup=Yedekleme
Restore=Geri yükleme
-RunCommandSummary=Yedekleme aşağıdaki komutla başlatılacaktır
+RunCommandSummary=Yedekleme aşağıdaki komut ile başlatılmıştır
RunCommandSummaryToLaunch=Yedekleme aşağıdaki komut ile başlatılabilir
WebServerMustHavePermissionForCommand=Web sunucunuz bu gibi komutları çalıştırmak için gereken izne sahip olmalı
BackupResult=Yedekleme sonucu
BackupFileSuccessfullyCreated=Yedekleme dosyası başarıyla oluşturuldu
-YouCanDownloadBackupFile=Oluşturulan dosyaları artık indirilebilir
+YouCanDownloadBackupFile=Oluşturulan dosyalar artık indirilebilir
NoBackupFileAvailable=Hiç yedekleme dosyası yok.
ExportMethod=Dışaaktarma yöntemi
ImportMethod=İçeaktarma yöntemi
ToBuildBackupFileClickHere=Bir yedekleme dosyası oluşturmak için buraya ya tıklayın.
-ImportMySqlDesc=Bir yedekleme dosyası almak için, komut satırında mysql komutu kullanmalısınız:
-ImportPostgreSqlDesc=Bir yedekleme dosyası almak için, komut satırınd pg_restore komutu kullanmalısınız:
+ImportMySqlDesc=Bir yedekleme dosyası içeaktarmak için, komut satırında mysql komutu kullanmalısınız:
+ImportPostgreSqlDesc=Bir yedekleme dosyası içeaktarmak için, komut satırınd pg_restore komutu kullanmalısınız:
ImportMySqlCommand=%s %s < mybackupfile.sql
ImportPostgreSqlCommand=%s %s mybackupfile.sql
FileNameToGenerate=Oluşturulacak dosya adı
Compression=Sıkıştırma
CommandsToDisableForeignKeysForImport=İçeaktarmada devre dışı bırakılacak yabancı komut tuşları
-CommandsToDisableForeignKeysForImportWarning=SQL dökümünü daha sonra geri yükleyebilmeyi isterseniz zorunludur
-ExportCompatibility=Oluşturulan verme dosyasının uyumluluğu
-MySqlExportParameters=MySQL verme parametreleri
-PostgreSqlExportParameters= PostgreSQL dışaaktarım parametreleri
+CommandsToDisableForeignKeysForImportWarning=SQL dökümünü daha sonra geri yükleyebilmek isterseniz zorunludur
+ExportCompatibility=Oluşturulan dışaaktarma dosyasının uyumluluğu
+MySqlExportParameters=MySQL dışaaktarma parametreleri
+PostgreSqlExportParameters= PostgreSQL dışaaktarma parametreleri
UseTransactionnalMode=İşlem modunu kullanın
-FullPathToMysqldumpCommand=mysqldump komutu için tam yol
-FullPathToPostgreSQLdumpCommand=pg_dump komutunun tam yolu
-ExportOptions=Verme seçenekleri
+FullPathToMysqldumpCommand=mysqldump Komutunun için tam yol
+FullPathToPostgreSQLdumpCommand=pg_dump Komutunun tam yolu
+ExportOptions=Dışaaktarma seçenekleri
AddDropDatabase=DROP VERİTABANI komutu ekle
AddDropTable=DROP TABLOSU komutu ekle
ExportStructure=Yapısı
-Datas=Veriler
+Datas=Veri
NameColumn=Sütunları adlandır
ExtendedInsert=Genişletilmiş ARAYAEKLE
NoLockBeforeInsert=ARAYAEKLE yanında kilitle komutu olmaz
@@ -197,7 +197,7 @@ IgnoreDuplicateRecords=Çifte kayıt hatalarını gözardı et (GÖZARDI ET EKLE
Yes=Evet
No=Hayır
AutoDetectLang=Otoalgıla (tarayıcı dili)
-FeatureDisabledInDemo=Demoda özellik devre dışıdır
+FeatureDisabledInDemo=Özellik demoda devre dışıdır
Rights=İzinler
BoxesDesc=Kutular, bazı pencerelerde bilgi parçaları gösteren ekran alanlarıdır. Kutunun gösterilmesi ya da gösterilmemesi arasında seçim yapmak için hedef sayfayı seçerek ‘Etkinleştir’ e tıklayın veya çöpkutusuna tıklayarak devre dışı bırakın.
OnlyActiveElementsAreShown=Yalnızca etkinleştirilmiş modüllerin öğeleri gösterilmiştir.
diff --git a/htdocs/langs/tr_TR/agenda.lang b/htdocs/langs/tr_TR/agenda.lang
index 93514fcc242..ca20ca270f0 100644
--- a/htdocs/langs/tr_TR/agenda.lang
+++ b/htdocs/langs/tr_TR/agenda.lang
@@ -1,7 +1,7 @@
# Dolibarr language file - Source file is en_US - agenda
IdAgenda=Etkinlik kimliği
-Actions=Eylemler
-ActionsArea=Eylem alanı (Olaylar ve görevler)
+Actions=Etkinlikler
+ActionsArea=Etkinlik alanı (Olaylar ve görevler)
Agenda=Gündem
Agendas=Gündemler
Calendar=Takvim
@@ -24,12 +24,12 @@ MenuDoneActions=Tüm sonlanan eylemler
MenuToDoMyActions=Sonlanmayan eylemlerim
MenuDoneMyActions=Sonlanan eylemlerim
ListOfEvents=Etkinlik listesi (iç takvim)
-ActionsAskedBy=Eylemi bildiren
-ActionsToDoBy=Eylemden etkilenen
-ActionsDoneBy=Eylemi yapan
-ActionsForUser=Kullanıcı eylemleri
-ActionsForUsersGroup=Grupun tüm üyelerine ait eylemler
-AllMyActions= Tüm eylemlerim/görevlerim
+ActionsAskedBy=Etkinliği bildiren
+ActionsToDoBy=Etkinlikten etkilenen
+ActionsDoneBy=Etkinliği yapan
+ActionsForUser=Kullanıcı etkinlikleri
+ActionsForUsersGroup=Grupun tüm üyelerine ait etkinlikler
+AllMyActions= Tüm etkinliklerim/görevlerim
AllActions= Tüm eylemler/görevler
ViewList=Liste görünümü
ViewCal=Ay görünümü
@@ -38,8 +38,8 @@ ViewWeek=Hafta görünümü
ViewPerUser=Kullanıcı görünümü başına
ViewWithPredefinedFilters= Öntanımlı süzgeçler ile görünüm
AutoActions= Gündemin otomatik doldurulması
-AgendaAutoActionDesc= Burada Dolibarr'ın otomatik olarak gündemde oluşturmasını istediğiniz olayları tanımlayın. İşaretli bir şey yoksa (varsayılan olarak) sadece el ile girilen eylemler gündeme dahil edilecektir.
-AgendaSetupOtherDesc= Bu sayfa Dolibarr eylemlerinin dış bir takvime aktarılması için seçenekler sağlar. (thunderbird, google calendar, ...)
+AgendaAutoActionDesc= Burada Dolibarr'ın otomatik olarak gündemde oluşturmasını istediğiniz etkinlikleri tanımlayın. İşaretli bir şey yoksa (varsayılan olarak) sadece el ile girilen etkinlikler gündeme dahil edilecektir.
+AgendaSetupOtherDesc= Bu sayfa Dolibarr etkinliklerinin dış bir takvime aktarılması için seçenekler sağlar. (thunderbird, google calendar, ...)
AgendaExtSitesDesc=Bu sayfa takvimlerin dış kaynaklarında Dolibarr gündemindeki etkinliklerinin görünmesini sağlar.
ActionsEvents= Dolibarr'ın otomatik olarak gündemde bir etkinlik oluşturacağı eylemler
PropalValidatedInDolibarr= %s Teklifi doğrulandı
diff --git a/htdocs/langs/tr_TR/main.lang b/htdocs/langs/tr_TR/main.lang
index 63a4c3904c9..3f33d4bffa7 100644
--- a/htdocs/langs/tr_TR/main.lang
+++ b/htdocs/langs/tr_TR/main.lang
@@ -7,7 +7,7 @@ DIRECTION=ltr
FONTFORPDF=DejaVuSans
FONTSIZEFORPDF=8
SeparatorDecimal=,
-SeparatorThousand=Space
+SeparatorThousand=None
FormatDateShort=%d/%m/%Y
FormatDateShortInput=%d/%m/%Y
FormatDateShortJava=dd/MM/yyyy
@@ -64,7 +64,7 @@ SeeAlso=See also %s
BackgroundColorByDefault=Varsayılan arkaplan rengi
FileNotUploaded=Dosya yüklenmemiş
FileUploaded=Dosya yüklemesi başarılı
-FileWasNotUploaded=Bu ekleme için bir dosya seçildi ama henüz gönderilmedi. Bunun için “Dosya ekle” ye tıklayın.
+FileWasNotUploaded=Bu ekleme için bir dosya seçildi ama henüz gönderilmedi. Bunun için “Dosya ekle? ye tıklayın.
NbOfEntries=Kayıt sayısı
GoToWikiHelpPage=Çevrimiçi yardım oku (Internet erişimi gerekir)
GoToHelpPage=Yardım oku
@@ -622,7 +622,7 @@ CoreErrorTitle=Sistem hatası
CoreErrorMessage=Üzgünüz, bir hata oluştu. Günlükleri kontrol edin veya sistem yöneticinize başvurun.
CreditCard=Kredi kartı
FieldsWithAreMandatory=%s olan alanları zorunludur
-FieldsWithIsForPublic=Üyelerin genel listelerinde %s olan alanlar gösterilir. Bunu istemiyorsanız, “genel” kutusundan işareti kaldırın.
+FieldsWithIsForPublic=Üyelerin genel listelerinde %s olan alanlar gösterilir. Bunu istemiyorsanız, “genel? kutusundan işareti kaldırın.
AccordingToGeoIPDatabase=(GeoIP dönüşümüne göre)
Line=Satır
NotSupported=Desteklenmez
diff --git a/htdocs/main.inc.php b/htdocs/main.inc.php
index 6698866869e..c8553f29291 100644
--- a/htdocs/main.inc.php
+++ b/htdocs/main.inc.php
@@ -637,7 +637,7 @@ if (! defined('NOLOGIN'))
{
$db->rollback();
session_destroy();
- dol_print_error($db,'Error in some triggers on action USER_LOGIN',LOG_ERR);
+ dol_print_error($db,'Error in some triggers on action USER_LOGIN');
exit;
}
else
@@ -1015,13 +1015,10 @@ function top_htmlhead($head, $title='', $disablejs=0, $disablehead=0, $arrayofjs
//print ' '."\n";
print ' '."\n";
}
- if ((! empty($conf->global->MAIN_USE_JQUERY_MULTISELECT) && $conf->global->MAIN_USE_JQUERY_MULTISELECT == 'multiselect') || (defined('REQUIRE_JQUERY_MULTISELECT') && constant('REQUIRE_JQUERY_MULTISELECT') == 'multiselect')) // jQuery multiselect
+ if (! empty($conf->global->MAIN_USE_JQUERY_MULTISELECT) || defined('REQUIRE_JQUERY_MULTISELECT')) // jQuery plugin "mutiselect", "multiple-select", "select2"...
{
- print ' '."\n";
- }
- if ((! empty($conf->global->MAIN_USE_JQUERY_MULTISELECT) && $conf->global->MAIN_USE_JQUERY_MULTISELECT == 'multiple-select') || (defined('REQUIRE_JQUERY_MULTISELECT') && constant('REQUIRE_JQUERY_MULTISELECT') == 'multiple-select')) // jQuery multiple-select
- {
- print ' '."\n";
+ $tmpplugin=empty($conf->global->MAIN_USE_JQUERY_MULTISELECT)?constant('REQUIRE_JQUERY_MULTISELECT'):$conf->global->MAIN_USE_JQUERY_MULTISELECT;
+ print ' '."\n";
}
// jQuery Timepicker
if (! empty($conf->global->MAIN_USE_JQUERY_TIMEPICKER) || defined('REQUIRE_JQUERY_TIMEPICKER'))
@@ -1130,14 +1127,12 @@ function top_htmlhead($head, $title='', $disablejs=0, $disablehead=0, $arrayofjs
{
if (constant('JS_JQUERY_FLOT'))
{
- print ''."\n";
print ''."\n";
print ''."\n";
print ''."\n";
}
else
{
- print ''."\n";
print ''."\n";
print ''."\n";
print ''."\n";
@@ -1188,6 +1183,11 @@ function top_htmlhead($head, $title='', $disablejs=0, $disablehead=0, $arrayofjs
print ''."\n";
print ''."\n";
}
+ if (! empty($conf->global->MAIN_USE_JQUERY_MULTISELECT) || defined('REQUIRE_JQUERY_MULTISELECT')) // jQuery plugin "mutiselect", "multiple-select", "select2"...
+ {
+ $tmpplugin=empty($conf->global->MAIN_USE_JQUERY_MULTISELECT)?constant('REQUIRE_JQUERY_MULTISELECT'):$conf->global->MAIN_USE_JQUERY_MULTISELECT;
+ print ''."\n";
+ }
// jQuery jMobile
if (! empty($conf->global->MAIN_USE_JQUERY_JMOBILE) || defined('REQUIRE_JQUERY_JMOBILE') || (! empty($conf->dol_use_jmobile) && $conf->dol_use_jmobile > 0))
{
@@ -1414,6 +1414,7 @@ function top_menu($head, $title='', $target='', $disablejs=0, $disablehead=0, $a
$loginhtmltext.=''.$langs->trans("User").' ';
$loginhtmltext.=''.$langs->trans("Name").' : '.$user->getFullName($langs);
$loginhtmltext.=''.$langs->trans("Login").' : '.$user->login;
+ $loginhtmltext.=''.$langs->trans("EMail").' : '.$user->email;
$loginhtmltext.=''.$langs->trans("Administrator").' : '.yn($user->admin);
$type=($user->societe_id?$langs->trans("External").$company:$langs->trans("Internal"));
$loginhtmltext.=''.$langs->trans("Type").' : '.$type;
diff --git a/htdocs/opensurvey/class/opensurveysondage.class.php b/htdocs/opensurvey/class/opensurveysondage.class.php
index bcc1146c714..48119a7f16f 100644
--- a/htdocs/opensurvey/class/opensurveysondage.class.php
+++ b/htdocs/opensurvey/class/opensurveysondage.class.php
@@ -254,7 +254,7 @@ class Opensurveysondage extends CommonObject
* @param int $notrigger 0=launch triggers after, 1=disable triggers
* @return int <0 if KO, >0 if OK
*/
- function update($user=0, $notrigger=0)
+ function update($user=null, $notrigger=0)
{
global $conf, $langs;
$error=0;
diff --git a/htdocs/product/card.php b/htdocs/product/card.php
index 237fa97c0f0..5f9d42cdd44 100644
--- a/htdocs/product/card.php
+++ b/htdocs/product/card.php
@@ -74,7 +74,7 @@ if ($id > 0 || ! empty($ref))
// Get object canvas (By default, this is not defined, so standard usage of dolibarr)
$canvas = !empty($object->canvas)?$object->canvas:GETPOST("canvas");
-$objcanvas='';
+$objcanvas=null;
if (! empty($canvas))
{
require_once DOL_DOCUMENT_ROOT.'/core/class/canvas.class.php';
diff --git a/htdocs/product/class/product.class.php b/htdocs/product/class/product.class.php
index 98b5d155ba7..1bc30b2df5f 100644
--- a/htdocs/product/class/product.class.php
+++ b/htdocs/product/class/product.class.php
@@ -680,6 +680,8 @@ class Product extends CommonObject
}
}
+ $action='update';
+
// Actions on extra fields (by external module or standard code)
$hookmanager->initHooks(array('productdao'));
$parameters=array('id'=>$this->id);
@@ -1396,7 +1398,7 @@ class Product extends CommonObject
if (! $id && ! $ref && ! $ref_ext)
{
$this->error='ErrorWrongParameters';
- dol_print_error(get_class($this)."::fetch ".$this->error, LOG_ERR);
+ dol_print_error(get_class($this)."::fetch ".$this->error);
return -1;
}
diff --git a/htdocs/product/class/productbatch.class.php b/htdocs/product/class/productbatch.class.php
index c124f9648e3..a4df7a95829 100644
--- a/htdocs/product/class/productbatch.class.php
+++ b/htdocs/product/class/productbatch.class.php
@@ -34,7 +34,7 @@ class Productbatch extends CommonObject
private static $_table_element='product_batch'; //!< Name of table without prefix where object is stored
var $id;
-
+
var $tms='';
var $fk_product_stock;
var $sellby='';
@@ -43,7 +43,7 @@ class Productbatch extends CommonObject
var $qty;
var $import_key;
-
+
/**
@@ -92,7 +92,7 @@ class Productbatch extends CommonObject
$sql.= " ".(! isset($this->qty)?'NULL':$this->qty).",";
$sql.= " ".(! isset($this->import_key)?'NULL':"'".$this->db->escape($this->import_key)."'")."";
-
+
$sql.= ")";
$this->db->begin();
@@ -148,7 +148,7 @@ class Productbatch extends CommonObject
global $langs;
$sql = "SELECT";
$sql.= " t.rowid,";
-
+
$sql.= " t.tms,";
$sql.= " t.fk_product_stock,";
$sql.= " t.sellby,";
@@ -157,7 +157,7 @@ class Productbatch extends CommonObject
$sql.= " t.qty,";
$sql.= " t.import_key";
-
+
$sql.= " FROM ".MAIN_DB_PREFIX.self::$_table_element." as t";
$sql.= " WHERE t.rowid = ".$id;
@@ -196,7 +196,7 @@ class Productbatch extends CommonObject
* @param int $notrigger 0=launch triggers after, 1=disable triggers
* @return int <0 if KO, >0 if OK
*/
- function update($user=0, $notrigger=0)
+ function update($user=null, $notrigger=0)
{
global $conf, $langs;
$error=0;
@@ -376,7 +376,7 @@ class Productbatch extends CommonObject
function initAsSpecimen()
{
$this->id=0;
-
+
$this->tms='';
$this->fk_product_stock='';
$this->sellby='';
@@ -384,14 +384,14 @@ class Productbatch extends CommonObject
$this->batch='';
$this->import_key='';
-
+
}
/**
* Clean fields (triming)
*
* @return void
- */
+ */
private function clean_param() {
if (isset($this->fk_product_stock)) $this->fk_product_stock=(int) trim($this->fk_product_stock);
if (isset($this->batch)) $this->batch=trim($this->batch);
@@ -429,7 +429,7 @@ class Productbatch extends CommonObject
if (! empty($batch_number)) $sql.= " AND batch = '".$this->db->escape($batch_number)."'";
if (! empty($where)) $sql.= " AND (".implode(" OR ",$where).")";
-
+
dol_syslog(get_class($this)."::fetch", LOG_DEBUG);
$resql=$this->db->query($sql);
if ($resql)
@@ -439,7 +439,7 @@ class Productbatch extends CommonObject
$obj = $this->db->fetch_object($resql);
$this->id = $obj->rowid;
-
+
$this->tms = $this->db->jdate($obj->tms);
$this->fk_product_stock = $obj->fk_product_stock;
$this->sellby = $this->db->jdate($obj->sellby);
@@ -480,10 +480,10 @@ class Productbatch extends CommonObject
$sql.= " t.qty,";
$sql.= " t.import_key";
-
+
$sql.= " FROM ".MAIN_DB_PREFIX.self::$_table_element." as t";
$sql.= " WHERE fk_product_stock=".$fk_product_stock;
-
+
if ($with_qty) $sql.= " AND qty<>0";
dol_syslog("productbatch::findAll", LOG_DEBUG);
$resql=$db->query($sql);
diff --git a/htdocs/product/composition/card.php b/htdocs/product/composition/card.php
index 8c71f29581b..ec616b2f222 100644
--- a/htdocs/product/composition/card.php
+++ b/htdocs/product/composition/card.php
@@ -130,24 +130,28 @@ if ($action == 'search')
{
$current_lang = $langs->getDefaultLang();
- $sql = 'SELECT DISTINCT p.rowid, p.ref, p.label, p.price, p.fk_product_type as type';
+ $sql = 'SELECT DISTINCT p.rowid, p.ref, p.label, p.barcode, p.price, p.price_ttc, p.price_base_type,';
+ $sql.= ' p.fk_product_type, p.tms as datem';
if (! empty($conf->global->MAIN_MULTILANGS)) $sql.= ', pl.label as labelm, pl.description as descriptionm';
$sql.= ' FROM '.MAIN_DB_PREFIX.'product as p';
$sql.= ' LEFT JOIN '.MAIN_DB_PREFIX.'categorie_product as cp ON p.rowid = cp.fk_product';
if (! empty($conf->global->MAIN_MULTILANGS)) $sql.= " LEFT JOIN ".MAIN_DB_PREFIX."product_lang as pl ON pl.fk_product = p.rowid AND lang='".($current_lang)."'";
- $sql.= ' WHERE p.entity IN ('.getEntity("product", 1).')';
+ $sql.= ' WHERE p.entity IN ('.getEntity('product', 1).')';
if ($key != "")
{
+ // For natural search
+ $params = array('p.ref', 'p.label', 'p.description', 'p.note');
+ // multilang
if (! empty($conf->global->MAIN_MULTILANGS))
{
- $sql.= " AND (p.ref LIKE '%".$key."%'";
- $sql.= " OR pl.label LIKE '%".$key."%')";
+ $params[] = 'pl.label';
+ $params[] = 'pl.description';
+ $params[] = 'pl.note';
}
- else
- {
- $sql.= " AND (p.ref LIKE '%".$key."%'";
- $sql.= " OR p.label LIKE '%".$key."%')";
+ if (! empty($conf->barcode->enabled)) {
+ $params[] = 'p.barcode';
}
+ $sql .= natural_search($params, $key);
}
if (! empty($conf->categorie->enabled) && ! empty($parent) && $parent != -1)
{
diff --git a/htdocs/product/list.php b/htdocs/product/list.php
index ebf8b77f722..a6b09cea8a6 100644
--- a/htdocs/product/list.php
+++ b/htdocs/product/list.php
@@ -69,7 +69,7 @@ $limit = $conf->liste_limit;
// Get object canvas (By default, this is not defined, so standard usage of dolibarr)
$canvas=GETPOST("canvas");
-$objcanvas='';
+$objcanvas=null;
if (! empty($canvas))
{
require_once DOL_DOCUMENT_ROOT.'/core/class/canvas.class.php';
@@ -130,25 +130,22 @@ else
$sql = 'SELECT DISTINCT p.rowid, p.ref, p.label, p.barcode, p.price, p.price_ttc, p.price_base_type,';
$sql.= ' p.fk_product_type, p.tms as datem,';
- $sql.= ' p.duration, p.tosell, p.tobuy, p.seuil_stock_alerte,';
+ $sql.= ' p.duration, p.tosell, p.tobuy, p.seuil_stock_alerte, p.desiredstock,';
$sql.= ' MIN(pfp.unitprice) as minsellprice';
- $sql .= ', p.desiredstock';
$sql.= ' FROM '.MAIN_DB_PREFIX.'product as p';
if (! empty($search_categ) || ! empty($catid)) $sql.= ' LEFT JOIN '.MAIN_DB_PREFIX."categorie_product as cp ON p.rowid = cp.fk_product"; // We'll need this table joined to the select in order to filter by categ
$sql.= " LEFT JOIN ".MAIN_DB_PREFIX."product_fournisseur_price as pfp ON p.rowid = pfp.fk_product";
// multilang
- if ($conf->global->MAIN_MULTILANGS) // si l'option est active
- {
- $sql .= " LEFT JOIN ".MAIN_DB_PREFIX."product_lang as pl ON pl.fk_product = p.rowid AND pl.lang = '".$langs->getDefaultLang() ."'";
- }
+ if (! empty($conf->global->MAIN_MULTILANGS)) $sql.= " LEFT JOIN ".MAIN_DB_PREFIX."product_lang as pl ON pl.fk_product = p.rowid AND pl.lang = '".$langs->getDefaultLang() ."'";
$sql.= ' WHERE p.entity IN ('.getEntity('product', 1).')';
if ($sall)
{
// For natural search
$params = array('p.ref', 'p.label', 'p.description', 'p.note');
// multilang
- if ($conf->global->MAIN_MULTILANGS) // si l'option est active
+ if (! empty($conf->global->MAIN_MULTILANGS))
{
+ $params[] = 'pl.label';
$params[] = 'pl.description';
$params[] = 'pl.note';
}
@@ -169,7 +166,7 @@ else
{
$params = array('p.label');
// multilang
- if ($conf->global->MAIN_MULTILANGS) // si l'option est active
+ if (! empty($conf->global->MAIN_MULTILANGS))
{
$params[] = 'pl.label';
}
@@ -199,7 +196,6 @@ else
$sql.= $db->order($sortfield,$sortorder);
$sql.= $db->plimit($limit + 1, $offset);
- dol_syslog("product:list.php:", LOG_DEBUG);
$resql = $db->query($sql);
if ($resql)
{
diff --git a/htdocs/product/reassort.php b/htdocs/product/reassort.php
index d9b3538eb72..c8480d6e65a 100644
--- a/htdocs/product/reassort.php
+++ b/htdocs/product/reassort.php
@@ -63,7 +63,7 @@ $search_categ = GETPOST("search_categ");
// Get object canvas (By default, this is not defined, so standard usage of dolibarr)
$canvas=GETPOST("canvas");
-$objcanvas='';
+$objcanvas=null;
if (! empty($canvas))
{
require_once DOL_DOCUMENT_ROOT.'/core/class/canvas.class.php';
diff --git a/htdocs/projet/class/task.class.php b/htdocs/projet/class/task.class.php
index e3e6373962b..3e6219afb40 100644
--- a/htdocs/projet/class/task.class.php
+++ b/htdocs/projet/class/task.class.php
@@ -261,7 +261,7 @@ class Task extends CommonObject
* @param int $notrigger 0=launch triggers after, 1=disable triggers
* @return int <0 if KO, >0 if OK
*/
- function update($user=0, $notrigger=0)
+ function update($user=null, $notrigger=0)
{
global $conf, $langs;
$error=0;
@@ -801,7 +801,7 @@ class Task extends CommonObject
$this->db->rollback();
$ret = -2;
}
-
+
$sql = "UPDATE ".MAIN_DB_PREFIX."projet_task_time";
$sql.= " SET thm = (SELECT thm FROM ".MAIN_DB_PREFIX."user WHERE rowid = ".$this->timespent_fk_user.")";
$sql.= " WHERE rowid = ".$tasktime_id;
diff --git a/htdocs/public/test/test_arrays.php b/htdocs/public/test/test_arrays.php
index b447be4574b..6725c776cd4 100644
--- a/htdocs/public/test/test_arrays.php
+++ b/htdocs/public/test/test_arrays.php
@@ -4,10 +4,9 @@ define("NOCSRFCHECK",1); // We accept to go on this page from external web site.
require '../../main.inc.php';
-
-if (!empty($conf->global->MAIN_FEATURES_LEVEL))
+if ($_SERVER['HTTP_HOST'] != 'localhost')
{
- print "Page available onto dev environment only";
+ print "Page available only with url http://localhost/...";
exit;
}
$usedolheader=0; // 1 = Test inside a dolibarr page, 0 = Use hard coded header
@@ -30,16 +29,21 @@ if (empty($usedolheader))
+
-
+
+ " />
-
+
+--
+
-
+
+
-
-
-This page is a sample of page using tables. To make test with
-- css (edit page to change)
-- jmobile (edit page to enable/disable)
+
+This page is a sample of page using tables. It is designed to make test with
+- css (edit page to change to test another css)
+- jmobile (add parameter dol_use_jmobile=1 to enable view with jmobile)
- dataTables
- tablednd
-
+
Example 0a : Table with div+div+div containg a select that should be overflowed and truncated => Use this to align text or form
-
+
aaaaaaaaaaaaaaafd sf sf gfd gfds fsd gfd fhfg hf dhfg hg fhfgdhfgdh gh gfdhdgf h gfdh dfhg dfgh dfgh fdgh gfd hfd hfd gs fgdf gaaaa gdfs gdf g sdfg dfg fdsg dsfg dfs gdfs gds fgs gdfdf gd
-
+
aaaaaaaaaaaaaaafd sf sf gfd gfds fsd gfd fhfg hf dhfg hg fhfgdhfgdh gh gfdhdgf h gfdh dfhg dfgh dfgh fdgh gfd hfd hfd gs fgdf gaaaa gdfs gdf g sdfg dfg fdsg dsfg dfs gdfs gds fgs gdfdf gd
@@ -84,7 +87,7 @@ This page is a sample of page using tables. To make test with
aaaaaaaaaaaaaaafd sf sf gfd gfds fsd gfd fhfg hf dhfg hg fhfgdhfgdh gh gfdhdgf h gfdh dfhg dfgh dfgh fdgh gfd hfd hfd gs fgdf gaaaa gdfs gdf g sdfg dfg fdsg dsfg dfs gdfs gds fgs gdfdf gd
-
+
aaaaaaaaaaaaaaafd sf sf gfd gfds fsd gfd fhfg hf dhfg hg fhfgdhfgdh gh gfdhdgf h gfdh dfhg dfgh dfgh fdgh gfd hfd hfd gs fgdf gaaaa gdfs gdf g sdfg dfg fdsg dsfg dfs gdfs gds fgs gdfdf gd
@@ -97,7 +100,7 @@ This page is a sample of page using tables. To make test with
aaaaaaaaaaaaaaafd sf sf gfd gfds fsd gfd fhfg hf dhfg hg fhfgdhfgdh gh gfdhdgf h gfdh dfhg dfgh dfgh fdgh gfd hfd hfd gs fgdf gaaaa gdfs gdf g sdfg dfg fdsg dsfg dfs gdfs gds fgs gdfdf gd
-
+
aaaaaaaaaaaaaaafd sf sf gfd gfds fsd gfd fhfg hf dhfg hg fhfgdhfgdh gh gfdhdgf h gfdh dfhg dfgh dfgh fdgh gfd hfd hfd gs fgdf gaaaa gdfs gdf g sdfg dfg fdsg dsfg dfs gdfs gds fgs gdfdf gd
@@ -111,9 +114,8 @@ This page is a sample of page using tables. To make test with