From dbcf3ddbe8b95b2c30911f5b5a59527ceb989896 Mon Sep 17 00:00:00 2001
From: Laurent Destailleur <eldy@destailleur.fr>
Date: Sat, 21 Oct 2017 19:05:24 +0200
Subject: [PATCH] NEW Upgrade jquery select2 to 4.0.4

---
 COPYRIGHT                                     |    8 +-
 htdocs/core/ajax/selectsearchbox.php          |    2 +-
 htdocs/core/class/html.form.class.php         |   41 +-
 htdocs/core/js/lib_head.js.php                |  335 +-
 htdocs/core/lib/ajax.lib.php                  |   16 +-
 .../jquery/plugins/select2/.gitignore         |    2 -
 .../jquery/plugins/select2/CHANGELOG.md       |  254 +
 .../jquery/plugins/select2/CONTRIBUTING.md    |  107 -
 .../jquery/plugins/select2/Gruntfile.js       |  370 ++
 .../includes/jquery/plugins/select2/LICENSE   |   18 -
 .../jquery/plugins/select2/LICENSE.md         |   21 +
 .../includes/jquery/plugins/select2/README.md |  149 +-
 .../jquery/plugins/select2/bower.json         |   13 +-
 .../jquery/plugins/select2/component.json     |   61 +-
 .../jquery/plugins/select2/composer.json      |   26 +-
 .../plugins/select2/dist/css/select2.css      |  484 ++
 .../plugins/select2/dist/css/select2.min.css  |    1 +
 .../jquery/plugins/select2/dist/js/select2.js | 5746 +++++++++++++++++
 .../plugins/select2/dist/js/select2.min.js    |    1 +
 .../jquery/plugins/select2/package.json       |   83 +-
 .../jquery/plugins/select2/release.sh         |   79 -
 .../plugins/select2/select2-bootstrap.css     |   87 -
 .../plugins/select2/select2-spinner.gif       |  Bin 1849 -> 0 bytes
 .../jquery/plugins/select2/select2.css        |  704 --
 .../plugins/select2/select2.jquery.json       |   24 +-
 .../jquery/plugins/select2/select2.js         | 3541 ----------
 .../jquery/plugins/select2/select2.min.js     |   23 -
 .../jquery/plugins/select2/select2.png        |  Bin 613 -> 0 bytes
 .../plugins/select2/select2_locale_ar.js      |   19 -
 .../plugins/select2/select2_locale_az.js      |   20 -
 .../plugins/select2/select2_locale_bg.js      |   20 -
 .../plugins/select2/select2_locale_ca.js      |   19 -
 .../plugins/select2/select2_locale_cs.js      |   51 -
 .../plugins/select2/select2_locale_da.js      |   19 -
 .../plugins/select2/select2_locale_de.js      |   18 -
 .../plugins/select2/select2_locale_el.js      |   19 -
 .../select2/select2_locale_en.js.template     |   20 -
 .../plugins/select2/select2_locale_es.js      |   19 -
 .../plugins/select2/select2_locale_et.js      |   19 -
 .../plugins/select2/select2_locale_eu.js      |   45 -
 .../plugins/select2/select2_locale_fa.js      |   21 -
 .../plugins/select2/select2_locale_fi.js      |   30 -
 .../plugins/select2/select2_locale_fr.js      |   18 -
 .../plugins/select2/select2_locale_gl.js      |   45 -
 .../plugins/select2/select2_locale_he.js      |   19 -
 .../plugins/select2/select2_locale_hr.js      |   24 -
 .../plugins/select2/select2_locale_hu.js      |   17 -
 .../plugins/select2/select2_locale_id.js      |   19 -
 .../plugins/select2/select2_locale_is.js      |   17 -
 .../plugins/select2/select2_locale_it.js      |   17 -
 .../plugins/select2/select2_locale_ja.js      |   17 -
 .../plugins/select2/select2_locale_ka.js      |   19 -
 .../plugins/select2/select2_locale_ko.js      |   19 -
 .../plugins/select2/select2_locale_lt.js      |   26 -
 .../plugins/select2/select2_locale_lv.js      |   19 -
 .../plugins/select2/select2_locale_mk.js      |   19 -
 .../plugins/select2/select2_locale_ms.js      |   19 -
 .../plugins/select2/select2_locale_nb.js      |   22 -
 .../plugins/select2/select2_locale_nl.js      |   17 -
 .../plugins/select2/select2_locale_pl.js      |   54 -
 .../plugins/select2/select2_locale_pt-BR.js   |   18 -
 .../plugins/select2/select2_locale_pt-PT.js   |   17 -
 .../plugins/select2/select2_locale_ro.js      |   17 -
 .../plugins/select2/select2_locale_rs.js      |   19 -
 .../plugins/select2/select2_locale_ru.js      |   23 -
 .../plugins/select2/select2_locale_sk.js      |   50 -
 .../plugins/select2/select2_locale_sv.js      |   19 -
 .../plugins/select2/select2_locale_th.js      |   19 -
 .../plugins/select2/select2_locale_tr.js      |   19 -
 .../plugins/select2/select2_locale_ug-CN.js   |   16 -
 .../plugins/select2/select2_locale_uk.js      |   25 -
 .../plugins/select2/select2_locale_vi.js      |   20 -
 .../plugins/select2/select2_locale_zh-CN.js   |   16 -
 .../plugins/select2/select2_locale_zh-TW.js   |   16 -
 .../jquery/plugins/select2/select2x2.png      |  Bin 845 -> 0 bytes
 htdocs/main.inc.php                           |    4 +-
 htdocs/theme/eldy/style.css.php               |   40 +-
 77 files changed, 7170 insertions(+), 6110 deletions(-)
 delete mode 100644 htdocs/includes/jquery/plugins/select2/.gitignore
 create mode 100644 htdocs/includes/jquery/plugins/select2/CHANGELOG.md
 delete mode 100644 htdocs/includes/jquery/plugins/select2/CONTRIBUTING.md
 create mode 100644 htdocs/includes/jquery/plugins/select2/Gruntfile.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/LICENSE
 create mode 100644 htdocs/includes/jquery/plugins/select2/LICENSE.md
 create mode 100644 htdocs/includes/jquery/plugins/select2/dist/css/select2.css
 create mode 100644 htdocs/includes/jquery/plugins/select2/dist/css/select2.min.css
 create mode 100644 htdocs/includes/jquery/plugins/select2/dist/js/select2.js
 create mode 100644 htdocs/includes/jquery/plugins/select2/dist/js/select2.min.js
 delete mode 100755 htdocs/includes/jquery/plugins/select2/release.sh
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2-bootstrap.css
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2-spinner.gif
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2.css
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2.min.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2.png
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_ar.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_az.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_bg.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_ca.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_cs.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_da.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_de.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_el.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_en.js.template
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_es.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_et.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_eu.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_fa.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_fi.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_fr.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_gl.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_he.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_hr.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_hu.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_id.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_is.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_it.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_ja.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_ka.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_ko.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_lt.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_lv.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_mk.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_ms.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_nb.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_nl.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_pl.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_pt-BR.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_pt-PT.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_ro.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_rs.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_ru.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_sk.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_sv.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_th.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_tr.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_ug-CN.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_uk.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_vi.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_zh-CN.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2_locale_zh-TW.js
 delete mode 100644 htdocs/includes/jquery/plugins/select2/select2x2.png

diff --git a/COPYRIGHT b/COPYRIGHT
index 95cc95fcf47..0de4c6c90c5 100644
--- a/COPYRIGHT
+++ b/COPYRIGHT
@@ -34,12 +34,12 @@ Swift Mailer           5.4.2-DEV     MIT license                 Yes
 Stripe                 4.7.0         MIT licence                 Yes             Library for Stripe module
 
 JS libraries:
-jQuery                 1.11.3        MIT License                 Yes             JS library
-jQuery UI              1.11.4        GPL and MIT License         Yes             JS library plugin UI
-jQuery select2         3.5.2         GPL and Apache License      Yes             JS library plugin for sexier multiselect
+jQuery                 3.1.1         MIT License                 Yes             JS library
+jQuery UI              1.12.1        GPL and MIT License         Yes             JS library plugin UI
+jQuery select2         4.0.4         GPL and Apache License      Yes             JS library plugin for sexier multiselect
 jQuery blockUI         2.70.0        GPL and MIT License         Yes             JS library plugin blockUI (to use ajax popups)
 jQuery Colorpicker     1.1           MIT License                 Yes             JS library for color picker for a defined list of colors
-jQuery FileUpload      5.0.3         GPL and MIT License         Yes             JS library to upload files
+jQuery FileUpload      5.13          GPL and MIT License         Yes             JS library to upload files
 jQuery Flot            0.8.3         MIT License                 Yes             JS library to build graph
 jQuery JCrop           0.9.8         GPL and MIT License         Yes             JS library plugin Crop (to crop images)
 jQuery Jeditable       1.7.1         GPL and MIT License         Yes             JS library plugin jeditable (to edit in place)
diff --git a/htdocs/core/ajax/selectsearchbox.php b/htdocs/core/ajax/selectsearchbox.php
index 89f362a0253..0861ef160b6 100644
--- a/htdocs/core/ajax/selectsearchbox.php
+++ b/htdocs/core/ajax/selectsearchbox.php
@@ -49,7 +49,7 @@ include_once DOL_DOCUMENT_ROOT.'/core/lib/json.lib.php';
 //global $hookmanager;
 $hookmanager->initHooks(array('searchform'));
 
-$search_boxvalue=GETPOST('q');
+$search_boxvalue=GETPOST('q', 'none');
 
 $arrayresult=array();
 
diff --git a/htdocs/core/class/html.form.class.php b/htdocs/core/class/html.form.class.php
index d5118d66824..aef8f98648f 100644
--- a/htdocs/core/class/html.form.class.php
+++ b/htdocs/core/class/html.form.class.php
@@ -5252,6 +5252,7 @@ class Form
 	 *  @param  string  $placeholder            String to use as placeholder
 	 *  @param  integer $acceptdelayedhtml      1 if caller request to have html js content not returned but saved into global $delayedhtmlcontent (so caller can show it at end of page to avoid flash FOUC effect)
 	 * 	@return	string   						HTML select string
+	 *  @see ajax_combobox in ajax.lib.php
 	 */
 	static function selectArrayAjax($htmlname, $url, $id='', $moreparam='', $moreparamtourl='', $disabled=0, $minimumInputLength=1, $morecss='', $callurlonselect=0, $placeholder='', $acceptdelayedhtml=0)
 	{
@@ -5261,7 +5262,7 @@ class Form
 		// TODO Use an internal dolibarr component instead of select2
 		if (empty($conf->global->MAIN_USE_JQUERY_MULTISELECT) && ! defined('REQUIRE_JQUERY_MULTISELECT')) return '';
 
-		$out='<input type="text" class="'.$htmlname.($morecss?' '.$morecss:'').'" '.($moreparam?$moreparam.' ':'').'name="'.$htmlname.'">';
+		$out='<select type="text" class="'.$htmlname.($morecss?' '.$morecss:'').'" '.($moreparam?$moreparam.' ':'').'name="'.$htmlname.'"></select>';
 
 		$tmpplugin='select2';
 		$outdelayed="\n".'<!-- JS CODE TO ENABLE '.$tmpplugin.' for id '.$htmlname.' -->
@@ -5276,44 +5277,40 @@ class Form
 				    	url: "'.$url.'",
 				    	dataType: \'json\',
 				    	delay: 250,
-				    	data: function (searchTerm, pageNumber, context) {
+				    	data: function (params) {
 				    		return {
-						    	q: searchTerm, // search term
-				    			page: pageNumber
+						    	q: params.term, 	// search term
+				    			page: params.page
 				    		};
 			    		},
-			    		results: function (remoteData, pageNumber, query) {
-			    			console.log(remoteData);
-				    	    saveRemoteData = remoteData;
+			    		processResults: function (data) {
+			    			// parse the results into the format expected by Select2.
+			    			// since we are using custom formatting functions we do not need to alter the remote JSON data
+			    			//console.log(data);
+							saveRemoteData = data;
 				    	    /* format json result for select2 */
 				    	    result = []
-				    	    $.each( remoteData, function( key, value ) {
+				    	    $.each( data, function( key, value ) {
 				    	       result.push({id: key, text: value.text});
                             });
 			    			//return {results:[{id:\'none\', text:\'aa\'}, {id:\'rrr\', text:\'Red\'},{id:\'bbb\', text:\'Search a into projects\'}], more:false}
-			    			return {results: result, more:false}
-    					},
-			    		/*processResults: function (data, page) {
-			    			// parse the results into the format expected by Select2.
-			    			// since we are using custom formatting functions we do not need to
-			    			// alter the remote JSON data
-			    			console.log(data);
-			    			return {
-			    				results: data.items
-			    			};
-			    		},*/
+			    			//console.log(result);
+			    			return {results: result, more: false}
+			    		},
 			    		cache: true
 			    	},
-			        dropdownCssClass: "css-'.$htmlname.'",
+	 				language: select2arrayoflanguage,
+			        /* dropdownCssClass: "css-'.$htmlname.'", */
 				    placeholder: "'.dol_escape_js($placeholder).'",
-			    	escapeMarkup: function (markup) { return markup; }, // let our custom formatter work
+			    	escapeMarkup: function (markup) { return markup; }, 	// let our custom formatter work
 			    	minimumInputLength: '.$minimumInputLength.',
 			        formatResult: function(result, container, query, escapeMarkup) {
                         return escapeMarkup(result.text);
-                    }
+                    },
 			    });
 
                 '.($callurlonselect ? '
+                /* Code to execute a GET when we select a value */
                 $(".'.$htmlname.'").change(function() {
 			    	var selected = $(".'.$htmlname.'").select2("val");
 			        $(".'.$htmlname.'").select2("val","");  /* reset visible combo value */
diff --git a/htdocs/core/js/lib_head.js.php b/htdocs/core/js/lib_head.js.php
index a68995e5eeb..ddfe5d257e1 100644
--- a/htdocs/core/js/lib_head.js.php
+++ b/htdocs/core/js/lib_head.js.php
@@ -152,237 +152,27 @@ jQuery(function($){
 
 
 /**
- * Set select2 translations (if module was loaded).
+ * Set array used for select2 translations
  */
-(function ($) {
-    "use strict";
 
-    if (typeof $.fn.select2 != "undefined") {
-	/* console.log($.fn.select2);
-    console.log("ok"); */
-
-    $.fn.select2.locales['xx'] = {
-        formatMatches: function (matches) { return matches + " <?php echo dol_escape_js($langs->trans("Select2ResultFoundUseArrows")); ?>"; },
-        formatNoMatches: function () { return "<?php echo dol_escape_js($langs->trans("Select2NotFound")); ?>"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length;
-        	if (n > 1) return "<?php echo dol_escape_js($langs->trans("Select2Enter")); ?> " + n + " <?php echo dol_escape_js($langs->trans("Select2MoreCharacters")); ?>";
-        	else return "<?php echo dol_escape_js($langs->trans("Select2Enter")); ?> " + n + " <?php echo dol_escape_js($langs->trans("Select2MoreCharacter")); ?>"
-        	},
-        formatLoadMore: function (pageNumber) { return "<?php echo dol_escape_js($langs->trans("Select2LoadingMoreResults")); ?>"; },
-        formatSearching: function () { return "<?php echo dol_escape_js($langs->trans("Select2SearchInProgress")); ?>"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['xx']);
-
-    }
-})(jQuery);
+var select2arrayoflanguage = {
+	matches: function (matches) { return matches + " <?php echo dol_escape_js($langs->transnoentitiesnoconv("Select2ResultFoundUseArrows")); ?>"; },
+	noResults: function () { return "<?php echo dol_escape_js($langs->transnoentitiesnoconv("Select2NotFound")); ?>"; },
+	inputTooShort: function (input) {
+		var n = input.minimum;
+		console.log(input);
+		console.log(input.minimum);
+		if (n > 1) return "<?php echo dol_escape_js($langs->transnoentitiesnoconv("Select2Enter")); ?> " + n + " <?php echo dol_escape_js($langs->transnoentitiesnoconv("Select2MoreCharacters")); ?>";
+			else return "<?php echo dol_escape_js($langs->transnoentitiesnoconv("Select2Enter")); ?> " + n + " <?php echo dol_escape_js($langs->transnoentitiesnoconv("Select2MoreCharacter")); ?>"
+		},
+	loadMore: function (pageNumber) { return "<?php echo dol_escape_js($langs->transnoentitiesnoconv("Select2LoadingMoreResults")); ?>"; },
+	searching: function () { return "<?php echo dol_escape_js($langs->transnoentitiesnoconv("Select2SearchInProgress")); ?>"; }
+};
 
 
-/*
- * =================================================================
- * Purpose:
- * Pour la saisie des dates par calendrier Input: base "/theme/eldy" dateFieldID
- * "dateo" Nom du champ format "dd/MM/yyyy" Format issu de Dolibarr de
- * SimpleDateFormat a utiliser pour retour
- * ==================================================================
+/**
+ * For calendar input
  */
- /*
-function showDP(base,dateFieldID,format,codelang)
-{
-	// check to see if another box is already showing
-	var alreadybox=getObjectFromID("DPCancel");
-	if (alreadybox) closeDPBox();	// This erase value of showDP.datefieldID
-
-	// alert("showDP "+codelang);
-	showDP.datefieldID=dateFieldID;	// Must be after the close
-
-	var dateField=getObjectFromID(dateFieldID);
-
-	// get positioning
-	var thetop=getTop(dateField)+dateField.offsetHeight;
-
-// var xxx=getObjectFromID('bottompage');
-// alert(xxx.style.pixelTop);
-// alert(document.body.clientHeight);
-// alert(document.body.style.offsetTop);
-// alert(thetop);
-// alert(window.innerHeight);
-	if (thetop+160 > window.innerHeight)
-		thetop=thetop-160-20;
-	var theleft=getLeft(dateField);
-	if (theleft+140 > window.innerWidth)
-		theleft= theleft-140+dateField.offsetWidth-15;
-
-	showDP.box=document.createElement("div");
-	showDP.box.className="bodyline";
-	showDP.box.style.display="block";
-	showDP.box.style.zIndex="1000";
-	showDP.box.style.position="absolute";
-	showDP.box.style.top=thetop + "px";
-	showDP.box.style.left=theleft + "px";
-
-	if (dateField.value)	// Si il y avait valeur initiale dans champ
-	{
-		selDate=getDateFromFormat(dateField.value,format);
-		if (selDate)
-		{
-			// Success to parse value in field according to format
-			year=selDate.getFullYear();
-			month=selDate.getMonth()+1;
-			day=selDate.getDate();
-			datetime=selDate.getTime();
-			ymd=formatDate(selDate,'yyyyMMdd');
-		}
-		else
-		{
-			// Failed to parse value in field according to format
-			selDate=new Date();
-			year=selDate.getFullYear();
-			month=selDate.getUTCMonth()+1;
-			day=selDate.getDate();
-			datetime=selDate.getTime();
-			ymd=formatDate(selDate,'yyyyMMdd');
-		}
-	}
-	else
-	{
-		selDate=new Date();
-		year=selDate.getFullYear();
-		month=selDate.getUTCMonth()+1;
-		day=selDate.getDate();
-		datetime=selDate.getTime();
-		ymd=formatDate(selDate,'yyyyMMdd');
-	}
-	loadMonth(base,month,year,ymd,codelang);
-	hideSelectBoxes();
-	document.body.appendChild(showDP.box);
-}
-
-function resetDP(base,dateFieldID,format,codelang)
-{
-	var dateField=getObjectFromID(dateFieldID);
-	dateField.value = formatDate(new Date(), format);
-	dpChangeDay(dateFieldID,format);
-
-	var alreadybox=getObjectFromID("DPCancel");
-	if (alreadybox) showDP(base,dateFieldID,format,codelang);
-}
-
-function loadMonth(base,month,year,ymd,codelang)
-{
-	// showDP.box.innerHTML="Loading...";
-	// alert(codelang);
-	var theURL=base+"datepicker.php?cm=shw&lang="+codelang;
-	theURL+="&m="+encodeURIComponent(month);
-	theURL+="&y="+encodeURIComponent(year);
-	if (selDate)
-	{
-		theURL+="&sd="+ymd;
-	}
-
-	var req=null;
-
-	req=loadXMLDoc(theURL,null,false);
-	if (req.responseText == '') alert('Failed to get URL '.theURL);
- 	// alert(theURL+' - '+req.responseText); // L'url doit avoir la meme racine
-	// que la pages et elements sinon pb de securite.
-	showDP.box.innerHTML=req.responseText;
-}
-
-function closeDPBox()
-{
-	document.body.removeChild(showDP.box);
-	displaySelectBoxes();
-	showDP.box=null;
-	showDP.datefieldID=null;
-}
-
-function dpClickDay(year,month,day,format)
-{
-	var thefield=getObjectFromID(showDP.datefieldID);
-	var thefieldday=getObjectFromID(showDP.datefieldID+"day");
-	var thefieldmonth=getObjectFromID(showDP.datefieldID+"month");
-	var thefieldyear=getObjectFromID(showDP.datefieldID+"year");
-
-	var dt = new Date(year, month-1, day);
-
-	thefield.value=formatDate(dt,format);
-	if(thefield.onchange) thefield.onchange.call(thefield);
-
-	thefieldday.value=day;
-	if(thefieldday.onchange) thefieldday.onchange.call(thefieldday);
-	thefieldmonth.value=month;
-	if(thefieldmonth.onchange) thefieldmonth.onchange.call(thefieldmonth);
-	thefieldyear.value=year;
-	if(thefieldyear.onchange) thefieldyear.onchange.call(thefieldyear);
-
-	closeDPBox();
-}
-
-function dpHighlightDay(year,month,day,months){
-	var displayinfo=getObjectFromID("dpExp");
-	displayinfo.innerHTML=months[month-1]+" "+day+", "+year;
-}
-
-// This Function returns the top position of an object
-function getTop(theitem){
-	var offsetTrail = theitem;
-	var offsetTop = 0;
-	while (offsetTrail) {
-		offsetTop += offsetTrail.offsetTop;
-		offsetTrail = offsetTrail.offsetParent;
-	}
-	if (navigator.userAgent.indexOf("Mac") != -1 && typeof document.body.leftMargin != "undefined")
-		offsetTop += document.body.TopMargin;
-	return offsetTop;
-}
-
-// This Function returns the left position of an object
-function getLeft(theitem){
-	var offsetTrail = theitem;
-	var offsetLeft = 0;
-	while (offsetTrail) {
-		offsetLeft += offsetTrail.offsetLeft;
-		offsetTrail = offsetTrail.offsetParent;
-	}
-	if (navigator.userAgent.indexOf("Mac") != -1 && typeof document.body.leftMargin != "undefined")
-		offsetLeft += document.body.leftMargin;
-	return offsetLeft;
-}
-
-// To hide/show select Boxes with IE6 (and only IE6 because IE6 has a bug and
-// not put popup completely on the front)
-// Used only bu popup calendar
-function hideSelectBoxes() {
-	var brsVersion = parseInt(window.navigator.appVersion.charAt(0), 10);
-	if (brsVersion <= 6 && window.navigator.userAgent.indexOf("MSIE 6") > -1)
-	{
-		for(var i = 0; i < document.all.length; i++)
-		{
-			if(document.all[i].tagName)
-				if(document.all[i].tagName == "SELECT")
-			  		document.all[i].style.visibility="hidden";
-		}
-	}
-}
-// To hide/show select Boxes with IE6 (and only IE6 because IE6 has a bug and
-// not put popup completely on the front)
-// Used only bu popup calendar
-function displaySelectBoxes() {
-	var brsVersion = parseInt(window.navigator.appVersion.charAt(0), 10);
-	if (brsVersion <= 6 && window.navigator.userAgent.indexOf("MSIE 6") > -1)
-	{
-	       for(var i = 0; i < document.all.length; i++)
-	       {
-	               if(document.all[i].tagName)
-	                       if(document.all[i].tagName == "SELECT")
-	                               document.all[i].style.visibility="visible";
-	       }
-	}
-}
-
-*/
-
 
 // Returns an object given an id
 function getObjectFromID(id){
@@ -426,69 +216,6 @@ function dpChangeDay(dateFieldID,format)
 	}
 }
 
-
-
-
-
-// Create XMLHttpRequest object and load url
-// Used by calendar or other ajax processes
-// Return req built or false if error
-function loadXMLDoc(url,readyStateFunction,async)
-{
-	// req must be defined by caller with
-	// var req = false;
-
-	// branch for native XMLHttpRequest object (Mozilla, Safari...)
-	if (window.XMLHttpRequest)
-	{
-		req = new XMLHttpRequest();
-
-// if (req.overrideMimeType) {
-// req.overrideMimeType('text/xml');
-// }
-	}
-	// branch for IE/Windows ActiveX version
-	else if (window.ActiveXObject)
-	{
-        try
-        {
-            req = new ActiveXObject("Msxml2.XMLHTTP");
-        }
-        catch (e)
-        {
-            try {
-                req = new ActiveXObject("Microsoft.XMLHTTP");
-            } catch (e) {}
-        }
-	}
-
-	// If XMLHttpRequestObject req is ok, call URL
-	if (! req)
-	{
-    	alert('Cannot create XMLHTTP instance');
-      	return false;
-	}
-
-	if (readyStateFunction) req.onreadystatechange = readyStateFunction;
-	// Exemple of function for readyStateFuncyion:
-	// function ()
-       // {
-       // if ( (req.readyState == 4) && (req.status == 200) ) {
-       // if (req.responseText == 1) { newStatus = 'AAA'; }
-       // if (req.responseText == 0) { newStatus = 'BBB'; }
-       // if (currentStatus != newStatus) {
-       // if (newStatus == "AAA") { obj.innerHTML = 'AAA'; }
-       // else { obj.innerHTML = 'BBB'; }
-       // currentStatus = newStatus;
-       // }
-       // }
-       // }
-	req.open("GET", url, async);
-	req.send(null);
-	return req;
-}
-
-
 /*
  * =================================================================
  * Function:
@@ -552,9 +279,9 @@ function formatDate(date,format)
 
 /*
  * =================================================================
- * Function:
- * getDateFromFormat(date_string, format_string) Purpose: This function takes a
- * date string and a format string. It parses the date string with format and it
+ * Function: getDateFromFormat(date_string, format_string)
+ * Purpose:  This function takes a date string and a format string.
+ * It parses the date string with format and it
  * returns the date as a javascript Date() object. If date does not match
  * format, it returns 0. The format string can use the following tags:
  * Field        | Tags
@@ -650,9 +377,8 @@ function getDateFromFormat(val,format)
 
 /*
  * =================================================================
- * Function:
- * stringIsInteger(string)
- * Purpose: Return true if string is an integer
+ * Function: stringIsInteger(string)
+ * Purpose:  Return true if string is an integer
  * ==================================================================
  */
 function stringIsInteger(str)
@@ -670,9 +396,8 @@ function stringIsInteger(str)
 
 /*
  * =================================================================
- * Function:
- * getIntegerInString(string,pos,minlength,maxlength)
- * Purpose: Return part of string from position i that is integer
+ * Function: getIntegerInString(string,pos,minlength,maxlength)
+ * Purpose:  Return part of string from position i that is integer
  * ==================================================================
  */
 function getIntegerInString(str,i,minlength,maxlength)
@@ -689,10 +414,9 @@ function getIntegerInString(str,i,minlength,maxlength)
 
 /*
  * =================================================================
- * Purpose:
- * Clean string to have it url encoded
- * Input: s
- * Author: Laurent Destailleur
+ * Purpose: Clean string to have it url encoded
+ * Input:   s
+ * Author:  Laurent Destailleur
  * Licence: GPL
  * ==================================================================
  */
@@ -706,8 +430,7 @@ function urlencode(s) {
 
 /*
  * =================================================================
- * Purpose:
- * Applique un delai avant execution. Used for autocompletion of companies.
+ * Purpose: Applique un delai avant execution. Used for autocompletion of companies.
  * Input:   funct, delay
  * Author:  Regis Houssin
  * Licence: GPL
@@ -955,6 +678,7 @@ function confirmConstantAction(action, url, code, input, box, entity, yesButton,
 	}
 }
 
+
 /*
  * =================================================================
  * This is to allow to transform all select box into ajax autocomplete box
@@ -1070,6 +794,7 @@ function confirmConstantAction(action, url, code, input, box, entity, yesButton,
 })( jQuery );
 
 
+
 /**
  * Function to output a dialog bog for copy/paste
  *
@@ -1303,7 +1028,7 @@ function price2numjs(amount) {
 	// If rounding higher than max shown
 	if (rounding > main_max_dec_shown) rounding = main_max_dec_shown;
 	if (thousand != ',' && thousand != '.') amount = amount.replace(',', '.');
-	amount = amount.replace(' ', '');            // To avoid spaces
+	amount = amount.replace(' ', '');             // To avoid spaces
 	amount = amount.replace(thousand, '');        // Replace of thousand before replace of dec to avoid pb if thousand is .
 	amount = amount.replace(dec, '.');
 	//console.log("amount before="+amount+" rouding="+rounding)
diff --git a/htdocs/core/lib/ajax.lib.php b/htdocs/core/lib/ajax.lib.php
index 500bbbb3ffb..0ee1ea98a5b 100644
--- a/htdocs/core/lib/ajax.lib.php
+++ b/htdocs/core/lib/ajax.lib.php
@@ -387,6 +387,7 @@ function ajax_autoselect($htmlname, $addlink='')
  * @param	int		$forcefocus					Force focus on field
  * @param	string	$widthTypeOfAutocomplete	'resolve' or 'off'
  * @return	string								Return html string to convert a select field into a combo, or '' if feature has been disabled for some reason.
+ * @see selectArrayAjax of html.form.class
  */
 function ajax_combobox($htmlname, $events=array(), $minLengthToAutocomplete=0, $forcefocus=0, $widthTypeOfAutocomplete='resolve')
 {
@@ -404,10 +405,23 @@ function ajax_combobox($htmlname, $events=array(), $minLengthToAutocomplete=0, $
     $msg="\n".'<!-- JS CODE TO ENABLE '.$tmpplugin.' for id = '.$htmlname.' -->
           <script type="text/javascript">
         	$(document).ready(function () {
+    			var query = {};
         		$(\''.(preg_match('/^\./',$htmlname)?$htmlname:'#'.$htmlname).'\').'.$tmpplugin.'({
         		    dir: \'ltr\',
         			width: \''.$widthTypeOfAutocomplete.'\',		/* off or resolve */
-					minimumInputLength: '.$minLengthToAutocomplete.'
+					minimumInputLength: '.$minLengthToAutocomplete.',
+					language: select2arrayoflanguage,
+					templateResult: function (data, container) {	/* Format visible output into combo list */
+	 					/* Code to add class of origin option propagated to the new select2 li tag */
+						if (data.element) {
+							$(container).addClass($(data.element).attr("class"));
+						}
+
+					    return data.text;
+					},
+					templateSelection: function (selection) {		/* Format visible output of selected value */
+						return selection.text;
+					},
 				})';
 	if ($forcefocus) $msg.= '.select2(\'focus\')';
 	$msg.= ';'."\n";
diff --git a/htdocs/includes/jquery/plugins/select2/.gitignore b/htdocs/includes/jquery/plugins/select2/.gitignore
deleted file mode 100644
index c6ef2182bdc..00000000000
--- a/htdocs/includes/jquery/plugins/select2/.gitignore
+++ /dev/null
@@ -1,2 +0,0 @@
-.idea
-
diff --git a/htdocs/includes/jquery/plugins/select2/CHANGELOG.md b/htdocs/includes/jquery/plugins/select2/CHANGELOG.md
new file mode 100644
index 00000000000..3ae60aff255
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/CHANGELOG.md
@@ -0,0 +1,254 @@
+# Change Log
+
+## 4.0.4
+
+### New features / Improvements
+- Make tag matching case insensitive [https://github.com/select2/select2/commit/cb9a90457867ffb14c7b1550bb67e872e0a5c2dd, https://github.com/select2/select2/commit/1167bace78cd3b1a918c1b04f3bac54674eab62b]
+- Support selecting options with blank or `0` option values [https://github.com/select2/select2/commit/16b4840c0e2df0461998e3b464ee0a546173950d, https://github.com/select2/select2/commit/0358ee528765157234643d289bce6b8ca5889c72]
+
+### Bug fixes
+- Fix issue with entire form losing focus when tabbing away from a Select2 control (#4419)
+- Fix UMD support for CommonJS [https://github.com/select2/select2/commit/45a877345482956021161203ac789c25f40a7d5e]
+
+### Documentation
+- Github Pages documentation has been deprecated, replaced with https://github.com/select2/docs
+- Add django-autocomplete-light to integrations [https://github.com/select2/select2/pull/4597]
+- Correct typo in options page [https://github.com/select2/select2/pull/4389]
+- Correct misspelling in AJAX query parameters example [https://github.com/select2/select2/pull/4435]
+- "highlight" should be "focus" in focus example [https://github.com/select2/select2/pull/4441]
+- Correct misspelling in `<select>` serialization example [https://github.com/select2/select2/pull/4538]
+- Correct typos in documentation [https://github.com/select2/select2/pull/4663]
+
+### Translations
+- Add `errorLoading` Hungarian translation [https://github.com/select2/select2/commit/7d1d13352321e21670ff1c6cba7413aa264fd57a]
+- Add `errorLoading` German translation [https://github.com/select2/select2/commit/4df965219ea4c39147fde9335bc260840465933a]
+- Add Slovene language [https://github.com/select2/select2/commit/8e6422c570a87da8d89c45daf0d253695a943c84]
+- Add `errorLoading` Galician translation [https://github.com/select2/select2/commit/8fcc6202c37f4e06d951342bf142a3b906b6b8e3]
+- Add `errorLoading` Thai translation [https://github.com/select2/select2/commit/625fc78ee616baedf64aa37357403b4b72c7363c]
+- Add `searching` and `errorLoading` Finnish translations [https://github.com/select2/select2/pull/4730]
+- Add `errorLoading` Turkish translation [https://github.com/select2/select2/commit/fd4a0825315c7055347726d5818c999279f96ff8, https://github.com/select2/select2/commit/751b36767f9f28b9de9428d5e8035c9a404915d9]
+- Add Armenian language [https://github.com/select2/select2/commit/f6fa52dcc02341df1523f50348f2effc54ee2911]
+
+## 4.0.3
+
+This is the third bugfix release of Select2 4.0.0. It builds upon the [second bugfix release](https://github.com/select2/select2/releases/tag/4.0.2) and fixes many common issues.
+
+### New features / Improvements
+- The old `dropdownAutoWidth` option now properly works [https://github.com/select2/select2/commit/fe26b083eb830836061de1458e483782cefef424]
+- A `focus` event on the original `<select>` is now handled [https://github.com/select2/select2/commit/31e7a1d4c52ed7477769fcad5d15166ae3c9b4d0]
+- Adding and removing options now refreshes the selection automatically [https://github.com/select2/select2/commit/ea79a197e0ffe55aa600eed6d18cbd1c804c3176]
+
+### Bug fixes
+- `select2('option')` no longer mutate the arguments when working on multiple elements [https://github.com/select2/select2/commit/c2c1aeef31c95c6df5545c900a4e1782d712497c]
+- Better detect aborted requests [https://github.com/select2/select2/commit/cfb66f5e4f71a56c46a6890c5dde4b7f24f11fa8]
+- New options are now properly created during tokenization [https://github.com/select2/select2/commit/3b8cd2e36990e695e4cb4b966c8658e7ca1574dc]
+- Fix positioning bug with non-static parents for the dropdown [https://github.com/select2/select2/pull/4267]
+- Infinite scrolling no longer resets the keyboard focus [https://github.com/select2/select2/commit/e897d008a672da262ba84cee2a144578696ada29, https://github.com/select2/select2/commit/9f581285d88128b29a01fc1e5fd2d445d610b553]
+- `selectOnClose` now works properly with `closeOnSelect` [https://github.com/select2/select2/commit/481c43883e23874e9c35879d173eb8cc5b994b12]
+- Apply `ajax.delay` to empty search terms as well [https://github.com/select2/select2/commit/4b9e02f02211248be25ac4c16d4635cf38237bb9]
+
+### Documentation
+- Added example for attaching event listeners [https://github.com/select2/select2/commit/84d6b5d840f7f4e6b7a2fb3f08424bf5495c876d]
+- Correct link to the [Select2 Bootstrap Theme](https://github.com/select2/select2-bootstrap-theme) [https://github.com/select2/select2/pull/4318]
+- Added example for using a `<label>` [https://github.com/select2/select2/commit/3bc7f4ac78b58eff8cd17b3273596638c3c9c5c1]
+- Add documentation for `ajax.url` [https://github.com/select2/select2/commit/5a831afb9a7d46e8f20aec21164cfbfd182024de]
+- Added favicon [https://github.com/select2/select2/pull/4379]
+
+### Translations
+- Add Khmer translation [https://github.com/select2/select2/pull/4246]
+- Added Norwegian bokmaal for `errorLoading` [https://github.com/select2/select2/pull/4259]
+- Fixed pluralization in Lithuanian translation [https://github.com/select2/select2/commit/5b5eddd183c87bf43165b3a98e03eabe10e9fa58]
+- Add French translation for `errorLoading` [https://github.com/select2/select2/commit/b1ea28bb7d8c02b3b352f558031ccfc8041122eb]
+- Add Greek translation [https://github.com/select2/select2/pull/4139]
+
+## 4.0.2
+
+This is the second bugfix release of Select2 4.0.0. It builds upon the [first release candidate of Select2 4.0.2](https://github.com/select2/select2/releases/tag/4.0.2-rc.1) with some minor improvements.
+
+### New features / Improvements
+
+- Added `insertTag` option to control the placement of the `tags` option [https://github.com/select2/select2/pull/4008]
+- Added handler for AJAX errors [https://github.com/select2/select2/issues/3501]
+- Added insertTag to control the tag position [https://github.com/select2/select2/pull/4008]
+
+### Bug fixes
+
+- Fixed positioning issues with static dropdown parents [https://github.com/select2/select2/issues/3970]
+- Fixed existing selections not always being respected with array data [https://github.com/select2/select2/issues/3990]
+- Sanitize automatically generated ids so CSS identifiers can be used [https://github.com/select2/select2/issues/3618]
+- Recursively apply defaults so AJAX defaults can be set [https://github.com/select2/select2/commit/983cd8e765c5345bfe7d3bdcc3b0c882a35461ca]
+- No need to recalculate the top of the dropdown twice [https://github.com/select2/select2/pull/4155]
+
+### Documentation
+
+- Updated Bootstrap and Font Awesome dependencies [https://github.com/select2/select2/commit/a5e539b509778eabeb8ce79e191b3ee1e81f6deb, https://github.com/select2/select2/commit/81a4a68b113e0d3e0fb1d0f8b1c33ae1b48ba04f, https://github.com/select2/select2/commit/6369f5f173fb81ec692213782945cc737e248da5]
+- Use Jekyll's highlighting instead of prettify [https://github.com/select2/select2/commit/54441e6a22be3969dd934ccb769f5d7dde684bfb, https://github.com/select2/select2/commit/74387b98632c75b06d15d83ad5359b9daf0f5dcb, https://github.com/select2/select2/commit/a126b53b4c90fac33b5d855894647cd8bcac3558, https://github.com/select2/select2/commit/75163d67cb80e4279965a97e9eeda5b171806085]
+- Corrected responsive width example to properly show it working [https://github.com/select2/select2/commit/63d531a9c0ab51f05327492a56f3245777762b45]
+- Replaced protocol-relative URLs with HTTPS protocol [https://github.com/select2/select2/pull/4127]
+- Code snippets for mapping `id` and `text` [https://github.com/select2/select2/issues/4086]
+- Document how to trigger `change` just for Select2 [https://github.com/select2/select2/issues/3620]
+- Added notes about DOM events [https://github.com/select2/select2/commit/37dbe059fce4578b46b7561e6243b7fdc63ac002]
+
+### Translations
+- Correct Romanian translation [https://github.com/select2/select2/commit/72d905f9e026d49e7c600f37a1ce742c404654d7]
+
+## 4.0.1
+
+This is the first bugfix release of Select2 4.0.0. It builds upon the [first release candidate of Select2 4.0.1](https://github.com/select2/select2/releases/tag/4.0.1-rc.1) with some minor improvements.
+
+### New features / improvements
+- The option container is now passed in as the second argument when templating selections using `templateResult` [https://github.com/select2/select2/commit/dc516e7073605723be59bc727b96a3b3dea1ae5a]
+- The option container is now passed in as the second argument when templating selections using `templateSelection` [https://github.com/select2/select2/pull/3324]
+- You can immediately start typing to search when tabbing into a multiple select [https://github.com/select2/select2/commit/02cca7baa7b78e73cdcf393172ee3a54be387167, https://github.com/select2/select2/commit/79cdcc0956e242c1ce642bbaa93e538c54f4be0]
+- All parameters passed in for AJAX requests are now set as query string parameters by default [https://github.com/select2/select2/issues/3548]
+
+### Bug fixes
+- The search box will now be properly sized after removing a selection [https://github.com/select2/select2/commit/5f80c5d9f81f3c5398c3e6e3e84fd6c67c8873f1]
+- Dropdown results will now be spoken by screen readers [https://github.com/select2/select2/commit/9fae3d74e373fc646da4e39a0c2ab11efa808c3f]
+- Options are now properly cloned when initializing multiple instances at once [https://github.com/select2/select2/commit/3c8366e8769233a6b20ade934fe629279e7be6ff]
+- `selectOnClose` and now be used with `closeOnSelect` without getting a stack overflow [https://github.com/select2/select2/commit/393ca4cf7f7f7097d3a994bda3dbf195e945eba1]
+- Fixed positioning with non-static parents [https://github.com/select2/select2/commit/c9216b4b966653dd63a67e815b47899ef5325298]
+- Fixed bug where multiple selects with placeholders were buggy in IE [https://github.com/select2/select2/issues/3300]
+- Fixed bug where AJAX selects could not be initialized with array data [https://github.com/select2/select2/pull/3375]
+- `:all:` is now correctly removed when used in `containerCss` and `dropdownCss` options [https://github.com/select2/select2/pull/3464]
+- Fixed bug where the multiple select search box would appear on the left in RTL mode [https://github.com/select2/select2/pull/3502]
+- Change ALT + UP to close the dropdown instead of opening it [https://github.com/select2/select2/commit/d2346cc33186c2a00fa2dad29e8e559c42bfea00]
+- Fix focus issue with the multiple select search box when the `change` event was triggered [https://github.com/select2/select2/commit/698fe7b9e187e182f679aa679eb8b0ecb64a846b, https://github.com/select2/select2/commit/88503d2c67dc7f4fb9395a17f17edfe4948cf738, https://github.com/select2/select2/commit/dd2990adead92593a2dffff6ae004ea8b647d130]
+- Fix bug in `ArrayAdapter` where the existing `<option>` data would be used instead of the array data [https://github.com/select2/select2/pull/3565]
+- Remove random call to `$dropdownContainer.width()` in the `AttachBody` decorator [https://github.com/select2/select2/pull/3654]
+- Fix memory leak in `AttachBody` decorator [https://github.com/select2/select2/commit/671f5a2ce21005090e0b69059799cd3dd1fbbf84]
+- Selections can no longer be removed when Select2 is in a disabled state [https://github.com/select2/select2/commit/68d068f1d2c7722d011d285a291d1f974bf09772, https://github.com/select2/select2/commit/7d8f86cbf85ebd2179195ff6a2a7a1c5dcb9da58]
+- Remove redundant `open` event trigger [https://github.com/select2/select2/pull/3507]
+- Correct references to `this` in `ajax.data` and `ajax.url` callback functions [https://github.com/select2/select2/issues/3361]
+- Apply select2('option') calls on all elements [https://github.com/select2/select2/pull/3495]
+
+### Design
+
+- Fixed original `<select>` not always being hidden correctly in some cases [https://github.com/select2/select2/pull/3301]
+- Fix potential issue with Bootstrap's gradients in Internet Explorer [https://github.com/select2/select2/pull/3307]
+- Improve compatibility with Zurb Foundation [https://github.com/select2/select2/pull/3290]
+- Remove padding on mobile safari search field in multiple selects [https://github.com/select2/select2/pull/3605]
+- Fix the clear button appearing beneath long text [https://github.com/select2/select2/issues/3306]
+- Migrate the CSS classes for the "Loading more results" message to BEM [https://github.com/select2/select2/issues/3889]
+- Fix inline search not displaying properly in Safari [https://github.com/select2/select2/issues/3459]
+
+### Documentation
+
+- New documentation theme designed by @fk [https://github.com/select2/select2/pull/3376, https://github.com/select2/select2/pull/3467, https://github.com/select2/select2/pull/3488]
+- Update ajax example to reflect pagination [https://github.com/select2/select2/pull/3357]
+- Fix incorrect option name in `maxiumSelectionLength` example [https://github.com/select2/select2/pull/3454]
+- Fix typos in the disabled mode/results examples [https://github.com/select2/select2/pull/3665]
+- Fix `Option` parameters in the 4.0 announcement [https://github.com/select2/select2/pull/3547]
+- Fix invalid JSON in the tags example within the 4.0 announcement [https://github.com/select2/select2/pull/3637]
+
+### Translations
+- Added Cyrillic variant of the Serbian language [https://github.com/select2/select2/pull/3943]
+- Corrected Thai "no results found" translation [https://github.com/select2/select2/pull/3782]
+- Swapped the `inputTooLong` and `inputTooShort` messages in the Galician translation [https://github.com/select2/select2/pull/3291]
+- Fix improper grammar in Dutch translation [https://github.com/select2/select2/pull/3692]
+- Add Japanese translation [https://github.com/select2/select2/pull/3477]
+- Polish translation: Fixed typo in maximum selected message [https://github.com/select2/select2/pull/3587]
+- Add Malay translation [https://github.com/select2/select2/pull/3635]
+- Add `errorLoading` for Indonesian translation [https://github.com/select2/select2/pull/3635]
+- Correct grammar issues in Hebrew translation [https://github.com/select2/select2/pull/3911]
+- Add `errorLoading` for Danish translation [https://github.com/select2/select2/pull/3870]
+- Add Arabic translation [https://github.com/select2/select2/pull/3859]
+
+## 4.0.0
+
+
+This builds upon [the second release candidate](https://github.com/select2/select2/tree/4.0.0-rc.2), **so review all previous release notes** before upgrading from previous versions of Select2.
+
+### Supported environments
+- jQuery 1.7.2+
+- Modern browsers (Chrome, Firefox, Safari)
+- Internet Explorer 8+
+
+### New features
+- Fully compatible with AMD and UMD based loaders.
+- Advanced plugin system that [uses custom adapters](https://select2.org/advanced/adapters-and-decorators).
+- Full support for `jQuery.noConflict`.
+- A `<select>` is the recommended element and [can be used for all options](https://select2.org/upgrading/migrating-from-35#no-more-hidden-input-tags).  There is limited backwards-compatible support for the `<input>` element in [full builds](https://select2.org/getting-started/builds-and-modules).
+- [Declarative configuration through `data-*` attributes](https://select2.org/configuration/data-attributes)
+- Easy to configure theme system and new default theme
+- You can use more specific locales (like `en-US`) and Select2 will be able to determine what translation files to load.
+
+### Breaking changes
+- Select2 now uses the MIT license
+- [The full build](https://select2.org/getting-started/builds-and-modules) of Select2 no longer includes jQuery - You must include jQuery separately on your page.
+- Select2 will prevent the inner scrolling of modals (and other scrollable containers) when it is open to prevent the UI from breaking. [Read more at the commit.](https://github.com/select2/select2/commit/003d6053a9fff587c688008397e7d5824463fe99)
+- jQuery is no longer listed as a dependency in the `bower.json`/`component.json` files.
+- [`<select>` has replaced `<input type="hidden" />`](https://select2.org/upgrading/migrating-from-35#no-more-hidden-input-tags) for **all options** (_including remote data_)
+- The [`matcher` has been revamped](https://select2.org/upgrading/migrating-from-35#advanced-matching-of-searches) to include full context, a compatibility module (`select2/compat/matcher`) has been created
+- The [display always reflects the order](https://select2.org/upgrading/migrating-from-35#display-reflects-the-actual-order-of-the-values) data is sent to the server
+- The click mask is no longer the default (again). You can get back the old functionality by wrapping your `selectionAdapter` with the `ClickMask` (`select2/selection/clickMask`) decorator.
+- Select2 no longer stops the propagation of events happening within the dropdown and selection. You can use the `StopPropagation` modules available in the [full builds](https://select2.org/getting-started/builds-and-modules) to prevent this. [https://github.com/select2/select2/commit/8f8140e3b00c5d5bb232455137c4c633d7da4275]
+- The enter key no longer toggles the state of multiple select items in the results, but instead will only select them. Use CTRL + Space instead to toggle the state. [https://github.com/select2/select2/commit/017c20109471fa5b835603faf5dc37f7c2c2ea45]
+- Warnings will now be triggered in the developer console if Select2 detects an unsupported configuration.
+
+#### Options
+
+- The default value of the `width` option has been changed from `style` to `resolve`.
+- The `copy` value for the `width` option has been renamed to `style`.
+
+##### Renamed
+- `formatSelection` -> `templateSelection`
+- `formatResult` -> `templateResult`
+- `sortResults` -> `sorter`
+- `createSearchChoice` -> `createTag`
+- `selectOnBlur` -> `selectOnClose`
+- `ajax.jsonpCallback` -> `ajax.jsonp`
+- `ajax.results` -> `ajax.processResults`
+- `tags: [array,of,data]` -> `data: [array,of,data], tags: true`
+- `placeholderOption` has been replaced by `placeholder.id` (`placeholder` -> `placeholder.text`)
+
+##### [Internationalization](https://select2.org/i18n)
+- `formatNoMatches` -> `language.noMatches`
+- `formatSearching` -> `language.searching`
+- `formatInputTooShort` -> `language.inputTooShort`
+- `formatInputTooLong` -> `language.inputTooLong`
+- `formatAjaxError` -> `language.errorLoading`
+- `formatLoading` -> `language.loadingMore`
+- `formatSelectionTooBig` -> `language.maximumSelected`
+
+##### Deprecated/Removed
+- `initSelection` - This is [no longer needed](https://select2.org/upgrading/migrating-from-35#removed-the-requirement-of-initselection) with `<select>` tags.  Limited backwards compatibility in the [full build](https://select2.org/getting-started/builds-and-modules).
+- `id` - Data objects should now always have `id` and `text` attributes that are strings, use [`$.map`](https://api.jquery.com/jquery.map/) when migrating
+- `query` - Use a [custom data adapter](https://select2.org/upgrading/migrating-from-35#custom-data-adapters-instead-of-query) instead.  Limited backwards compatibility in the [full build](https://select2.org/getting-started/builds-and-modules).
+- `ajax.params` - All parameters passed to `ajax` will be passed to the AJAX data transport function
+
+#### Methods
+
+##### Renamed
+- `.select2("val", [value])` -> `.val([value])`
+- `.select2("enable", !disabled)` -> `.prop("disabled", disabled)`
+
+##### Removed
+- `.select2("onSortStart")` and `.select2("onSortEnd")` - A custom [selection adapter](https://select2.org/advanced/default-adapters/selection) should be created instead
+- `.select2("data", data)` - Create the `<option>` tags for the objects that you would like to set, and set the `.val` to select them
+- `.select2("readonly")` - There is [no way to make a `<select>` element read-only](http://stackoverflow.com/q/368813/359284), disable it instead
+
+#### Events
+
+##### New
+- `select2:closing` is triggered before the dropdown is closed
+- `select2:select` is triggered when an option is selected
+
+##### Renamed
+- `select2-close` is now `select2:close`
+- `select2-open` is now `select2:open`
+- `select2-opening` is now `select2:opening`
+- `select2-selecting` is now `select2:selecting`
+- `select2-removed` is now `select2:unselect`
+- `select2-removing` is now `select2:unselecting`
+
+##### Removed
+- `select2-clearing` has been removed in favor of `select2:unselecting`
+- `select2-highlight`
+- `select2-loaded`
+- `select2-focus` - Use the native `focus` event instead
+- `select2-blur` - Use the native `blur` event instead
+- All extra properties from the `change` event were removed
+  - `val` can be retrieved with `$element.val()` instead
+  - `added` can be retrieved by listening to `select2:select`
+  - `removed` can be retrieved by listening to `select2:unselect`
diff --git a/htdocs/includes/jquery/plugins/select2/CONTRIBUTING.md b/htdocs/includes/jquery/plugins/select2/CONTRIBUTING.md
deleted file mode 100644
index bca4baf61a3..00000000000
--- a/htdocs/includes/jquery/plugins/select2/CONTRIBUTING.md
+++ /dev/null
@@ -1,107 +0,0 @@
-Contributing to Select2
-=======================
-Looking to contribute something to Select2? **Here's how you can help.**
-
-Please take a moment to review this document in order to make the contribution
-process easy and effective for everyone involved.
-
-Following these guidelines helps to communicate that you respect the time of
-the developers managing and developing this open source project. In return,
-they should reciprocate that respect in addressing your issue or assessing
-patches and features.
-
-Using the issue tracker
------------------------
-When [reporting bugs][reporting-bugs] or
-[requesting features][requesting-features], the
-[issue tracker on GitHub][issue-tracker] is the recommended channel to use.
-
-The issue tracker **is not** a place for support requests. The
-[mailing list][mailing-list] or [IRC channel][irc-channel] are better places to
-get help.
-
-Reporting bugs with Select2
----------------------------
-We really appreciate clear bug reports that _consistently_ show an issue
-_within Select2_.
-
-The ideal bug report follows these guidelines:
-
-1. **Use the [GitHub issue search][issue-search]**  &mdash; Check if the issue
-   has already been reported.
-2. **Check if the issue has been fixed**  &mdash; Try to reproduce the problem
-   using the code in the `master` branch.
-3. **Isolate the problem**  &mdash; Try to create an
-   [isolated test case][isolated-case] that consistently reproduces the problem.
-
-Please try to be as detailed as possible in your bug report, especially if an
-isolated test case cannot be made. Some useful questions to include the answer
-to are:
-
-- What steps can be used to reproduce the issue?
-- What is the bug and what is the expected outcome?
-- What browser(s) and Operating System have you tested with?
-- Does the bug happen consistently across all tested browsers?
-- What version of jQuery are you using? And what version of Select2?
-- Are you using Select2 with other plugins?
-
-All of these questions will help people fix and identify any potential bugs.
-
-Requesting features in Select2
-------------------------------
-Select2 is a large library that carries with it a lot of functionality. Because
-of this, many feature requests will not be implemented in the core library.
-
-Before starting work on a major feature for Select2, **contact the
-[community][community] first** or you may risk spending a considerable amount of
-time on something which the project developers are not interested in bringing
-into the project.
-
-### Select2 4.0
-
-Many feature requests will be closed off until 4.0, where Select2 plans to adopt
-a more flexible API.  If you are interested in helping with the development of
-the next major Select2 release, please send a message to the
-[mailing list][mailing-list] or [irc channel][irc-channel] for more information.
-
-Triaging issues and pull requests
----------------------------------
-Anyone can help the project maintainers triage issues and review pull requests.
-
-### Handling new issues
-
-Select2 regularly receives new issues which need to be tested and organized.
-
-When a new issue that comes in that is similar to another existing issue, it
-should be checked to make sure it is not a duplicate.  Duplicates issues should
-be marked by replying to the issue with "Duplicate of #[issue number]" where
-`[issue number]` is the url or issue number for the existing issue.  This will
-allow the project maintainers to quickly close off additional issues and keep
-the discussion focused within a single issue.
-
-If you can test issues that are reported to Select2 that contain test cases and
-confirm under what conditions bugs happen, that will allow others to identify
-what causes a bug quicker.
-
-### Reviewing pull requests
-
-It is very common for pull requests to be opened for issues that contain a clear
-solution to the problem.  These pull requests should be rigorously reviewed by
-the community before being accepted.  If you are not sure about a piece of
-submitted code, or know of a better way to do something, do not hesitate to make
-a comment on the pull request.
-
-It should also be made clear that **all code contributed to Select** must be
-licensable under the [Apache 2 or GPL 2 licenses][licensing].  Code that cannot
-be released under either of these licenses **cannot be accepted** into the
-project.
-
-[community]: https://github.com/ivaynberg/select2#community
-[reporting-bugs]: #reporting-bugs-with-select2
-[requesting-features]: #requesting-features-in-select2
-[issue-tracker]: https://github.com/ivaynberg/select2/issues
-[mailing-list]: https://github.com/ivaynberg/select2#mailing-list
-[irc-channel]: https://github.com/ivaynberg/select2#irc-channel
-[issue-search]: https://github.com/ivaynberg/select2/search?q=&type=Issues
-[isolated-case]: http://css-tricks.com/6263-reduced-test-cases/
-[licensing]: https://github.com/ivaynberg/select2#copyright-and-license
diff --git a/htdocs/includes/jquery/plugins/select2/Gruntfile.js b/htdocs/includes/jquery/plugins/select2/Gruntfile.js
new file mode 100644
index 00000000000..bf0f38d4303
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/Gruntfile.js
@@ -0,0 +1,370 @@
+module.exports = function (grunt) {
+  // Full list of files that must be included by RequireJS
+  includes = [
+    'jquery.select2',
+    'almond',
+
+    'jquery-mousewheel' // shimmed for non-full builds
+  ];
+
+  fullIncludes = [
+    'jquery',
+
+    'select2/compat/containerCss',
+    'select2/compat/dropdownCss',
+
+    'select2/compat/initSelection',
+    'select2/compat/inputData',
+    'select2/compat/matcher',
+    'select2/compat/query',
+
+    'select2/dropdown/attachContainer',
+    'select2/dropdown/stopPropagation',
+
+    'select2/selection/stopPropagation'
+  ].concat(includes);
+
+  var i18nModules = [];
+  var i18nPaths = {};
+
+  var i18nFiles = grunt.file.expand({
+    cwd: 'src/js'
+  }, 'select2/i18n/*.js');
+
+  var testFiles = grunt.file.expand('tests/**/*.html');
+  var testUrls = testFiles.map(function (filePath) {
+    return 'http://localhost:9999/' + filePath;
+  });
+
+  var testBuildNumber = "unknown";
+
+  if (process.env.TRAVIS_JOB_ID) {
+    testBuildNumber = "travis-" + process.env.TRAVIS_JOB_ID;
+  } else {
+    var currentTime = new Date();
+
+    testBuildNumber = "manual-" + currentTime.getTime();
+  }
+
+  for (var i = 0; i < i18nFiles.length; i++) {
+    var file = i18nFiles[i];
+    var name = file.split('.')[0];
+
+    i18nModules.push({
+      name: name
+    });
+
+    i18nPaths[name] = '../../' + name;
+  }
+
+  var minifiedBanner = '/*! Select2 <%= package.version %> | https://github.com/select2/select2/blob/master/LICENSE.md */';
+
+  grunt.initConfig({
+    package: grunt.file.readJSON('package.json'),
+
+    clean: {
+      docs: ['docs/_site']
+    },
+
+    concat: {
+      'dist': {
+        options: {
+          banner: grunt.file.read('src/js/wrapper.start.js'),
+        },
+        src: [
+          'dist/js/select2.js',
+          'src/js/wrapper.end.js'
+        ],
+        dest: 'dist/js/select2.js'
+      },
+      'dist.full': {
+        options: {
+          banner: grunt.file.read('src/js/wrapper.start.js'),
+        },
+        src: [
+          'dist/js/select2.full.js',
+          'src/js/wrapper.end.js'
+        ],
+        dest: 'dist/js/select2.full.js'
+      }
+    },
+
+    connect: {
+      tests: {
+        options: {
+          base: '.',
+          hostname: '127.0.0.1',
+          port: 9999
+        }
+      }
+    },
+
+    uglify: {
+      'dist': {
+        src: 'dist/js/select2.js',
+        dest: 'dist/js/select2.min.js',
+        options: {
+          banner: minifiedBanner
+        }
+      },
+      'dist.full': {
+        src: 'dist/js/select2.full.js',
+        dest: 'dist/js/select2.full.min.js',
+        options: {
+          banner: minifiedBanner
+        }
+      }
+    },
+
+    qunit: {
+      all: {
+        options: {
+          urls: testUrls
+        }
+      }
+    },
+
+    'saucelabs-qunit': {
+      all: {
+        options: {
+          build: testBuildNumber,
+          tags: ['tests', 'qunit'],
+          urls: testUrls,
+          testname: 'QUnit test for Select2',
+          browsers: [
+            {
+              browserName: 'internet explorer',
+              version: '8'
+            },
+            {
+              browserName: 'internet explorer',
+              version: '9'
+            },
+            {
+              browserName: 'internet explorer',
+              version: '10'
+            },
+            {
+              browserName: 'internet explorer',
+              version: '11'
+            },
+
+            {
+              browserName: 'firefox',
+              platform: 'linux'
+            },
+
+            {
+              browserName: 'chrome'
+            },
+
+            {
+              browserName: 'opera',
+              version: '12',
+              platform: 'linux'
+            }
+          ]
+        }
+      }
+    },
+
+    'gh-pages': {
+      options: {
+        base: 'docs',
+        branch: 'master',
+        clone: 'node_modules/grunt-gh-pages/repo',
+        message: 'Updated docs with master',
+        push: true,
+        repo: 'git@github.com:select2/select2.github.io.git'
+      },
+      src: '**'
+    },
+
+    jekyll: {
+      options: {
+        src: 'docs',
+        dest: 'docs/_site'
+      },
+      build: {
+        d: null
+      },
+      serve: {
+        options: {
+          serve: true,
+          watch: true
+        }
+      }
+    },
+
+    jshint: {
+      options: {
+        jshintrc: true
+      },
+      code: {
+        src: ['src/js/**/*.js']
+      },
+      tests: {
+        src: ['tests/**/*.js']
+      }
+    },
+
+    sass: {
+      dist: {
+        options: {
+          outputStyle: 'compressed'
+        },
+        files: {
+          'dist/css/select2.min.css': [
+            'src/scss/core.scss',
+            'src/scss/theme/default/layout.css'
+          ]
+        }
+      },
+      dev: {
+        options: {
+          outputStyle: 'nested'
+        },
+        files: {
+          'dist/css/select2.css': [
+            'src/scss/core.scss',
+            'src/scss/theme/default/layout.css'
+          ]
+        }
+      }
+    },
+
+    symlink: {
+      docs: {
+        cwd: 'dist',
+        expand: true,
+        overwrite: false,
+        src: [
+          '*'
+        ],
+        dest: 'docs/dist',
+        filter: 'isDirectory'
+      }
+    },
+
+    requirejs: {
+      'dist': {
+        options: {
+          baseUrl: 'src/js',
+          optimize: 'none',
+          name: 'select2/core',
+          out: 'dist/js/select2.js',
+          include: includes,
+          namespace: 'S2',
+          paths: {
+            'almond': require.resolve('almond').slice(0, -3),
+            'jquery': 'jquery.shim',
+            'jquery-mousewheel': 'jquery.mousewheel.shim'
+          },
+          wrap: {
+            startFile: 'src/js/banner.start.js',
+            endFile: 'src/js/banner.end.js'
+          }
+        }
+      },
+      'dist.full': {
+        options: {
+          baseUrl: 'src/js',
+          optimize: 'none',
+          name: 'select2/core',
+          out: 'dist/js/select2.full.js',
+          include: fullIncludes,
+          namespace: 'S2',
+          paths: {
+            'almond': require.resolve('almond').slice(0, -3),
+            'jquery': 'jquery.shim',
+            'jquery-mousewheel': require.resolve('jquery-mousewheel').slice(0, -3)
+          },
+          wrap: {
+            startFile: 'src/js/banner.start.js',
+            endFile: 'src/js/banner.end.js'
+          }
+        }
+      },
+      'i18n': {
+        options: {
+          baseUrl: 'src/js/select2/i18n',
+          dir: 'dist/js/i18n',
+          paths: i18nPaths,
+          modules: i18nModules,
+          namespace: 'S2',
+          wrap: {
+            start: minifiedBanner + grunt.file.read('src/js/banner.start.js'),
+            end: grunt.file.read('src/js/banner.end.js')
+          }
+        }
+      }
+    },
+
+    watch: {
+      js: {
+        files: [
+          'src/js/select2/**/*.js',
+          'tests/**/*.js'
+        ],
+        tasks: [
+          'compile',
+          'test',
+          'minify'
+        ]
+      },
+      css: {
+        files: [
+          'src/scss/**/*.scss'
+        ],
+        tasks: [
+          'compile',
+          'minify'
+        ]
+      }
+    }
+  });
+
+  grunt.loadNpmTasks('grunt-contrib-clean');
+  grunt.loadNpmTasks('grunt-contrib-concat');
+  grunt.loadNpmTasks('grunt-contrib-connect');
+  grunt.loadNpmTasks('grunt-contrib-jshint');
+  grunt.loadNpmTasks('grunt-contrib-qunit');
+  grunt.loadNpmTasks('grunt-contrib-requirejs');
+  grunt.loadNpmTasks('grunt-contrib-symlink');
+  grunt.loadNpmTasks('grunt-contrib-uglify');
+  grunt.loadNpmTasks('grunt-contrib-watch');
+
+  grunt.loadNpmTasks('grunt-gh-pages');
+  grunt.loadNpmTasks('grunt-jekyll');
+  grunt.loadNpmTasks('grunt-saucelabs');
+  grunt.loadNpmTasks('grunt-sass');
+
+  grunt.registerTask('default', ['compile', 'test', 'minify']);
+
+  grunt.registerTask('compile', [
+    'requirejs:dist', 'requirejs:dist.full', 'requirejs:i18n',
+    'concat:dist', 'concat:dist.full',
+    'sass:dev'
+  ]);
+  grunt.registerTask('minify', ['uglify', 'sass:dist']);
+  grunt.registerTask('test', ['connect:tests', 'qunit', 'jshint']);
+
+  var ciTasks = [];
+
+  ciTasks.push('compile');
+  ciTasks.push('connect:tests');
+
+  // Can't run Sauce Labs tests in pull requests
+  if (process.env.TRAVIS_PULL_REQUEST == 'false') {
+    ciTasks.push('saucelabs-qunit');
+  }
+
+  ciTasks.push('qunit');
+  ciTasks.push('jshint');
+
+  grunt.registerTask('ci', ciTasks);
+
+  grunt.registerTask('docs', ['symlink:docs', 'jekyll:serve']);
+
+  grunt.registerTask('docs-release', ['default', 'clean:docs', 'gh-pages']);
+};
diff --git a/htdocs/includes/jquery/plugins/select2/LICENSE b/htdocs/includes/jquery/plugins/select2/LICENSE
deleted file mode 100644
index 0247cc76273..00000000000
--- a/htdocs/includes/jquery/plugins/select2/LICENSE
+++ /dev/null
@@ -1,18 +0,0 @@
-Copyright 2014 Igor Vaynberg
-
-Version: @@ver@@ Timestamp: @@timestamp@@
-
-This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
-General Public License version 2 (the "GPL License"). You may choose either license to govern your
-use of this software only upon the condition that you accept all of the terms of either the Apache
-License or the GPL License.
-
-You may obtain a copy of the Apache License and the GPL License at:
-
-http://www.apache.org/licenses/LICENSE-2.0
-http://www.gnu.org/licenses/gpl-2.0.html
-
-Unless required by applicable law or agreed to in writing, software distributed under the Apache License
-or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
-either express or implied. See the Apache License and the GPL License for the specific language governing
-permissions and limitations under the Apache License and the GPL License.
diff --git a/htdocs/includes/jquery/plugins/select2/LICENSE.md b/htdocs/includes/jquery/plugins/select2/LICENSE.md
new file mode 100644
index 00000000000..8cb8a2b12cb
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/LICENSE.md
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2012-2017 Kevin Brown, Igor Vaynberg, and Select2 contributors
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/htdocs/includes/jquery/plugins/select2/README.md b/htdocs/includes/jquery/plugins/select2/README.md
index 64380c45147..6ee975d6ee0 100644
--- a/htdocs/includes/jquery/plugins/select2/README.md
+++ b/htdocs/includes/jquery/plugins/select2/README.md
@@ -1,20 +1,26 @@
 Select2
 =======
+[![Build Status][travis-ci-image]][travis-ci-status]
 
-Select2 is a jQuery-based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.
+Select2 is a jQuery-based replacement for select boxes. It supports searching,
+remote data sets, and pagination of results.
 
-To get started, checkout examples and documentation at http://ivaynberg.github.com/select2
+To get started, checkout examples and documentation at
+https://select2.org/
 
 Use cases
 ---------
-
 * Enhancing native selects with search.
 * Enhancing native selects with a better multi-select interface.
-* Loading data from JavaScript: easily load items via ajax and have them searchable.
-* Nesting optgroups: native selects only support one level of nested. Select2 does not have this restriction.
+* Loading data from JavaScript: easily load items via AJAX and have them
+  searchable.
+* Nesting optgroups: native selects only support one level of nesting. Select2
+  does not have this restriction.
 * Tagging: ability to add new items on the fly.
-* Working with large, remote datasets: ability to partially load a dataset based on the search term.
-* Paging of large datasets: easy support for loading more pages when the results are scrolled to the end.
+* Working with large, remote datasets: ability to partially load a dataset based
+  on the search term.
+* Paging of large datasets: easy support for loading more pages when the results
+  are scrolled to the end.
 * Templating: support for custom rendering of results and selections.
 
 Browser compatibility
@@ -25,90 +31,93 @@ Browser compatibility
 * Safari 3+
 * Opera 10.6+
 
+Select2 is automatically tested on the following browsers.
+
+[![Sauce Labs Test Status][saucelabs-matrix]][saucelabs-status]
+
 Usage
 -----
-You can source Select2 directly from a CDN like [JSDliver](http://www.jsdelivr.com/#!select2) or [CDNJS](http://www.cdnjs.com/libraries/select2), [download it from this GitHub repo](https://github.com/ivaynberg/select2/tags), or use one of the integrations below.
+You can source Select2 directly from a CDN like [JSDliver][jsdelivr] or
+[CDNJS][cdnjs], [download it from this GitHub repo][releases], or use one of
+the integrations below.
 
 Integrations
 ------------
+Third party developers have created plugins for platforms which allow Select2 to be integrated more natively and quickly. For many platforms, additional plugins are not required because Select2 acts as a standard `<select>` box.
 
-* [Wicket-Select2](https://github.com/ivaynberg/wicket-select2) (Java / [Apache Wicket](http://wicket.apache.org))
-* [select2-rails](https://github.com/argerim/select2-rails) (Ruby on Rails)
-* [AngularUI](http://angular-ui.github.io/#ui-select) ([AngularJS](https://angularjs.org/))
-* [Django](https://github.com/applegrew/django-select2)
-* [Symfony](https://github.com/19Gerhard85/sfSelect2WidgetsPlugin)
-* [Symfony2](https://github.com/avocode/FormExtensions)
-* [Bootstrap 2](https://github.com/t0m/select2-bootstrap-css) and [Bootstrap 3](https://github.com/t0m/select2-bootstrap-css/tree/bootstrap3) (CSS skins)
-* [Meteor](https://github.com/nate-strauser/meteor-select2) (modern reactive JavaScript framework; + [Bootstrap 3 skin](https://github.com/esperadomedia/meteor-select2-bootstrap3-css/))
-* [Meteor](https://jquery-select2.meteor.com)
-* [Yii 2.x](http://demos.krajee.com/widgets#select2)
-* [Yii 1.x](https://github.com/tonybolzan/yii-select2)
-* [AtmosphereJS](https://atmospherejs.com/package/jquery-select2)
+Plugins
 
-### Example Integrations
+* [Django]
+  - [django-autocomplete-light]
+  - [django-easy-select2]
+  - [django-select2]
+* [Meteor] - [meteor-select2]
+* [Ruby on Rails][ruby-on-rails] - [select2-rails]
+* [Wicket] - [wicketstuff-select2]
+* [Yii 2][yii2] - [yii2-widget-select2]
 
-* [Knockout.js](https://github.com/ivaynberg/select2/wiki/Knockout.js-Integration)
-* [Socket.IO](https://github.com/ivaynberg/select2/wiki/Socket.IO-Integration)
-* [PHP](https://github.com/ivaynberg/select2/wiki/PHP-Example)
-* [.Net MVC] (https://github.com/ivaynberg/select2/wiki/.Net-MVC-Example)
+Themes
+
+- [Bootstrap 3][bootstrap3] - [select2-bootstrap-theme]
+- [Flat UI][flat-ui] - [select2-flat-theme]
+- [Metro UI][metro-ui] - [select2-metro]
+
+Missing an integration? Modify this `README` and make a pull request back here to Select2 on GitHub.
 
 Internationalization (i18n)
 ---------------------------
-
 Select2 supports multiple languages by simply including the right language JS
-file (`select2_locale_it.js`, `select2_locale_nl.js`, etc.) after `select2.js`.
+file (`dist/js/i18n/it.js`, `dist/js/i18n/nl.js`, etc.) after
+`dist/js/select2.js`.
 
-Missing a language? Just copy `select2_locale_en.js.template`, translate
-it, and make a pull request back to Select2 here on GitHub.
+Missing a language? Just copy `src/js/select2/i18n/en.js`, translate it, and
+make a pull request back to Select2 here on GitHub.
 
 Documentation
 -------------
-
-The documentation for Select2 is available [through GitHub Pages](https://ivaynberg.github.io/select2/) and is located within this repository in the [`gh-pages` branch](https://github.com/ivaynberg/select2/tree/gh-pages).
+The documentation for Select2 is available
+[through GitHub Pages][documentation] and is located within this repository
+in the [`docs` folder][documentation-folder].
 
 Community
 ---------
-
-### Bug tracker
-
-Have a bug? Please create an issue here on GitHub!
-
-https://github.com/ivaynberg/select2/issues
-
-### Mailing list
-
-Have a question? Ask on our mailing list!
-
-select2@googlegroups.com
-
-https://groups.google.com/d/forum/select2
-
-### IRC channel
-
-Need help implementing Select2 in your project? Ask in our IRC channel!
-
-**Network:** [Freenode](https://freenode.net/) (`chat.freenode.net`)
-
-**Channel:** `#select2`
-
-**Web access:** https://webchat.freenode.net/?channels=select2
+You can find out about the different ways to get in touch with the Select2
+community at the [Select2 community page][community].
 
 Copyright and license
 ---------------------
+The license is available within the repository in the [LICENSE][license] file.
 
-Copyright 2012 Igor Vaynberg
+[cdnjs]: http://www.cdnjs.com/libraries/select2
+[community]: https://select2.org/getting-help
+[documentation]: https://select2.org
+[documentation-folder]: https://github.com/select2/select2/tree/master/docs
+[freenode]: https://freenode.net/
+[jsdelivr]: http://www.jsdelivr.com/#!select2
+[license]: LICENSE.md
+[releases]: https://github.com/select2/select2/releases
+[saucelabs-matrix]: https://saucelabs.com/browser-matrix/select2.svg
+[saucelabs-status]: https://saucelabs.com/u/select2
+[travis-ci-image]: https://img.shields.io/travis/select2/select2/master.svg
+[travis-ci-status]: https://travis-ci.org/select2/select2
 
-This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
-General Public License version 2 (the "GPL License"). You may choose either license to govern your
-use of this software only upon the condition that you accept all of the terms of either the Apache
-License or the GPL License.
-
-You may obtain a copy of the Apache License and the GPL License in the LICENSE file, or at:
-
-http://www.apache.org/licenses/LICENSE-2.0
-http://www.gnu.org/licenses/gpl-2.0.html
-
-Unless required by applicable law or agreed to in writing, software distributed under the Apache License
-or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
-either express or implied. See the Apache License and the GPL License for the specific language governing
-permissions and limitations under the Apache License and the GPL License.
+[bootstrap3]: https://getbootstrap.com/
+[django]: https://www.djangoproject.com/
+[django-autocomplete-light]: https://github.com/yourlabs/django-autocomplete-light
+[django-easy-select2]: https://github.com/asyncee/django-easy-select2
+[django-select2]: https://github.com/applegrew/django-select2
+[flat-ui]: http://designmodo.github.io/Flat-UI/
+[meteor]: https://www.meteor.com/
+[meteor-select2]: https://github.com/nate-strauser/meteor-select2
+[metro-ui]: http://metroui.org.ua/
+[select2-metro]: http://metroui.org.ua/select2.html
+[ruby-on-rails]: http://rubyonrails.org/
+[select2-bootstrap-theme]: https://github.com/select2/select2-bootstrap-theme
+[select2-flat-theme]: https://github.com/techhysahil/select2-Flat_Theme
+[select2-rails]: https://github.com/argerim/select2-rails
+[vue.js]: http://vuejs.org/
+[select2-vue]: http://vuejs.org/examples/select2.html
+[wicket]: https://wicket.apache.org/
+[wicketstuff-select2]: https://github.com/wicketstuff/core/tree/master/select2-parent
+[yii2]: http://www.yiiframework.com/
+[yii2-widget-select2]: https://github.com/kartik-v/yii2-widget-select2
diff --git a/htdocs/includes/jquery/plugins/select2/bower.json b/htdocs/includes/jquery/plugins/select2/bower.json
index 54d44c4593b..681600b50c7 100644
--- a/htdocs/includes/jquery/plugins/select2/bower.json
+++ b/htdocs/includes/jquery/plugins/select2/bower.json
@@ -1,8 +1,13 @@
 {
     "name": "select2",
-    "version": "3.5.2",
-    "main": ["select2.js", "select2.css", "select2.png", "select2x2.png", "select2-spinner.gif"],
-    "dependencies": {
-        "jquery": ">= 1.7.1"
+    "description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
+    "main": [
+        "dist/js/select2.js",
+        "src/scss/core.scss"
+    ],
+    "license": "MIT",
+    "repository": {
+        "type": "git",
+        "url": "git@github.com:select2/select2.git"
     }
 }
diff --git a/htdocs/includes/jquery/plugins/select2/component.json b/htdocs/includes/jquery/plugins/select2/component.json
index 8bd3c020a29..078338b59d3 100644
--- a/htdocs/includes/jquery/plugins/select2/component.json
+++ b/htdocs/includes/jquery/plugins/select2/component.json
@@ -1,66 +1,19 @@
 {
   "name": "select2",
-  "repo": "ivaynberg/select2",
+  "repo": "select/select2",
   "description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
-  "version": "3.5.2",
-  "demo": "http://ivaynberg.github.io/select2/",
+  "version": "4.0.4",
+  "demo": "https://select2.org/",
   "keywords": [
     "jquery"
   ],
-  "main": "select2.js",
+  "main": "dist/js/select2.js",
   "styles": [
-    "select2.css",
-    "select2-bootstrap.css"
+    "dist/css/select2.css"
   ],
   "scripts": [
-    "select2.js",
-    "select2_locale_ar.js",
-    "select2_locale_bg.js",
-    "select2_locale_ca.js",
-    "select2_locale_cs.js",
-    "select2_locale_da.js",
-    "select2_locale_de.js",
-    "select2_locale_el.js",
-    "select2_locale_es.js",
-    "select2_locale_et.js",
-    "select2_locale_eu.js",
-    "select2_locale_fa.js",
-    "select2_locale_fi.js",
-    "select2_locale_fr.js",
-    "select2_locale_gl.js",
-    "select2_locale_he.js",
-    "select2_locale_hr.js",
-    "select2_locale_hu.js",
-    "select2_locale_id.js",
-    "select2_locale_is.js",
-    "select2_locale_it.js",
-    "select2_locale_ja.js",
-    "select2_locale_ka.js",
-    "select2_locale_ko.js",
-    "select2_locale_lt.js",
-    "select2_locale_lv.js",
-    "select2_locale_mk.js",
-    "select2_locale_ms.js",
-    "select2_locale_nl.js",
-    "select2_locale_no.js",
-    "select2_locale_pl.js",
-    "select2_locale_pt-BR.js",
-    "select2_locale_pt-PT.js",
-    "select2_locale_ro.js",
-    "select2_locale_ru.js",
-    "select2_locale_sk.js",
-    "select2_locale_sv.js",
-    "select2_locale_th.js",
-    "select2_locale_tr.js",
-    "select2_locale_uk.js",
-    "select2_locale_vi.js",
-    "select2_locale_zh-CN.js",
-    "select2_locale_zh-TW.js"
-  ],
-  "images": [
-    "select2-spinner.gif",
-    "select2.png",
-    "select2x2.png"
+    "dist/js/select2.js",
+    "dist/js/i18n/*.js"
   ],
   "license": "MIT"
 }
diff --git a/htdocs/includes/jquery/plugins/select2/composer.json b/htdocs/includes/jquery/plugins/select2/composer.json
index cd2d26a2a98..141f4e14155 100644
--- a/htdocs/includes/jquery/plugins/select2/composer.json
+++ b/htdocs/includes/jquery/plugins/select2/composer.json
@@ -1,28 +1,24 @@
 {
-  "name":
-  "ivaynberg/select2",
+  "name": "select2/select2",
   "description": "Select2 is a jQuery based replacement for select boxes.",
-  "version": "3.5.2",
   "type": "component",
-  "homepage": "http://ivaynberg.github.io/select2/",
-  "license": "Apache-2.0",
+  "homepage": "https://select2.org/",
+  "license": "MIT",
   "require": {
-    "robloach/component-installer": "*",
-    "components/jquery": ">=1.7.1"
+    "robloach/component-installer": "*"
   },
   "extra": {
     "component": {
       "scripts": [
-        "select2.js"
+        "dist/js/select2.js"
+      ],
+      "styles": [
+        "dist/css/select2.css"
       ],
       "files": [
-        "select2.js",
-        "select2_locale_*.js",
-        "select2.css",
-        "select2-bootstrap.css",
-        "select2-spinner.gif",
-        "select2.png",
-        "select2x2.png"
+        "dist/js/select2.js",
+        "dist/js/i18n/*.js",
+        "dist/css/select2.css"
       ]
     }
   }
diff --git a/htdocs/includes/jquery/plugins/select2/dist/css/select2.css b/htdocs/includes/jquery/plugins/select2/dist/css/select2.css
new file mode 100644
index 00000000000..447b2b86cc0
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/dist/css/select2.css
@@ -0,0 +1,484 @@
+.select2-container {
+  box-sizing: border-box;
+  display: inline-block;
+  margin: 0;
+  position: relative;
+  vertical-align: middle; }
+  .select2-container .select2-selection--single {
+    box-sizing: border-box;
+    cursor: pointer;
+    display: block;
+    height: 28px;
+    user-select: none;
+    -webkit-user-select: none; }
+    .select2-container .select2-selection--single .select2-selection__rendered {
+      display: block;
+      padding-left: 8px;
+      padding-right: 20px;
+      overflow: hidden;
+      text-overflow: ellipsis;
+      white-space: nowrap; }
+    .select2-container .select2-selection--single .select2-selection__clear {
+      position: relative; }
+  .select2-container[dir="rtl"] .select2-selection--single .select2-selection__rendered {
+    padding-right: 8px;
+    padding-left: 20px; }
+  .select2-container .select2-selection--multiple {
+    box-sizing: border-box;
+    cursor: pointer;
+    display: block;
+    min-height: 32px;
+    user-select: none;
+    -webkit-user-select: none; }
+    .select2-container .select2-selection--multiple .select2-selection__rendered {
+      display: inline-block;
+      overflow: hidden;
+      padding-left: 8px;
+      text-overflow: ellipsis;
+      white-space: nowrap; }
+  .select2-container .select2-search--inline {
+    float: left; }
+    .select2-container .select2-search--inline .select2-search__field {
+      box-sizing: border-box;
+      border: none;
+      font-size: 100%;
+      margin-top: 5px;
+      padding: 0; }
+      .select2-container .select2-search--inline .select2-search__field::-webkit-search-cancel-button {
+        -webkit-appearance: none; }
+
+.select2-dropdown {
+  background-color: white;
+  border: 1px solid #aaa;
+  border-radius: 4px;
+  box-sizing: border-box;
+  display: block;
+  position: absolute;
+  left: -100000px;
+  width: 100%;
+  z-index: 1051; }
+
+.select2-results {
+  display: block; }
+
+.select2-results__options {
+  list-style: none;
+  margin: 0;
+  padding: 0; }
+
+.select2-results__option {
+  padding: 6px;
+  user-select: none;
+  -webkit-user-select: none; }
+  .select2-results__option[aria-selected] {
+    cursor: pointer; }
+
+.select2-container--open .select2-dropdown {
+  left: 0; }
+
+.select2-container--open .select2-dropdown--above {
+  border-bottom: none;
+  border-bottom-left-radius: 0;
+  border-bottom-right-radius: 0; }
+
+.select2-container--open .select2-dropdown--below {
+  border-top: none;
+  border-top-left-radius: 0;
+  border-top-right-radius: 0; }
+
+.select2-search--dropdown {
+  display: block;
+  padding: 4px; }
+  .select2-search--dropdown .select2-search__field {
+    padding: 4px;
+    width: 100%;
+    box-sizing: border-box; }
+    .select2-search--dropdown .select2-search__field::-webkit-search-cancel-button {
+      -webkit-appearance: none; }
+  .select2-search--dropdown.select2-search--hide {
+    display: none; }
+
+.select2-close-mask {
+  border: 0;
+  margin: 0;
+  padding: 0;
+  display: block;
+  position: fixed;
+  left: 0;
+  top: 0;
+  min-height: 100%;
+  min-width: 100%;
+  height: auto;
+  width: auto;
+  opacity: 0;
+  z-index: 99;
+  background-color: #fff;
+  filter: alpha(opacity=0); }
+
+.select2-hidden-accessible {
+  border: 0 !important;
+  clip: rect(0 0 0 0) !important;
+  height: 1px !important;
+  margin: -1px !important;
+  overflow: hidden !important;
+  padding: 0 !important;
+  position: absolute !important;
+  width: 1px !important; }
+
+.select2-container--default .select2-selection--single {
+  background-color: #fff;
+  border: 1px solid #aaa;
+  border-radius: 4px; }
+  .select2-container--default .select2-selection--single .select2-selection__rendered {
+    color: #444;
+    line-height: 28px; }
+  .select2-container--default .select2-selection--single .select2-selection__clear {
+    cursor: pointer;
+    float: right;
+    font-weight: bold; }
+  .select2-container--default .select2-selection--single .select2-selection__placeholder {
+    color: #999; }
+  .select2-container--default .select2-selection--single .select2-selection__arrow {
+    height: 26px;
+    position: absolute;
+    top: 1px;
+    right: 1px;
+    width: 20px; }
+    .select2-container--default .select2-selection--single .select2-selection__arrow b {
+      border-color: #888 transparent transparent transparent;
+      border-style: solid;
+      border-width: 5px 4px 0 4px;
+      height: 0;
+      left: 50%;
+      margin-left: -4px;
+      margin-top: -2px;
+      position: absolute;
+      top: 50%;
+      width: 0; }
+
+.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__clear {
+  float: left; }
+
+.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__arrow {
+  left: 1px;
+  right: auto; }
+
+.select2-container--default.select2-container--disabled .select2-selection--single {
+  background-color: #eee;
+  cursor: default; }
+  .select2-container--default.select2-container--disabled .select2-selection--single .select2-selection__clear {
+    display: none; }
+
+.select2-container--default.select2-container--open .select2-selection--single .select2-selection__arrow b {
+  border-color: transparent transparent #888 transparent;
+  border-width: 0 4px 5px 4px; }
+
+.select2-container--default .select2-selection--multiple {
+  background-color: white;
+  border: 1px solid #aaa;
+  border-radius: 4px;
+  cursor: text; }
+  .select2-container--default .select2-selection--multiple .select2-selection__rendered {
+    box-sizing: border-box;
+    list-style: none;
+    margin: 0;
+    padding: 0 5px;
+    width: 100%; }
+    .select2-container--default .select2-selection--multiple .select2-selection__rendered li {
+      list-style: none; }
+  .select2-container--default .select2-selection--multiple .select2-selection__placeholder {
+    color: #999;
+    margin-top: 5px;
+    float: left; }
+  .select2-container--default .select2-selection--multiple .select2-selection__clear {
+    cursor: pointer;
+    float: right;
+    font-weight: bold;
+    margin-top: 5px;
+    margin-right: 10px; }
+  .select2-container--default .select2-selection--multiple .select2-selection__choice {
+    background-color: #e4e4e4;
+    border: 1px solid #aaa;
+    border-radius: 4px;
+    cursor: default;
+    float: left;
+    margin-right: 5px;
+    margin-top: 5px;
+    padding: 0 5px; }
+  .select2-container--default .select2-selection--multiple .select2-selection__choice__remove {
+    color: #999;
+    cursor: pointer;
+    display: inline-block;
+    font-weight: bold;
+    margin-right: 2px; }
+    .select2-container--default .select2-selection--multiple .select2-selection__choice__remove:hover {
+      color: #333; }
+
+.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice, .select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__placeholder, .select2-container--default[dir="rtl"] .select2-selection--multiple .select2-search--inline {
+  float: right; }
+
+.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice {
+  margin-left: 5px;
+  margin-right: auto; }
+
+.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove {
+  margin-left: 2px;
+  margin-right: auto; }
+
+.select2-container--default.select2-container--focus .select2-selection--multiple {
+  border: solid black 1px;
+  outline: 0; }
+
+.select2-container--default.select2-container--disabled .select2-selection--multiple {
+  background-color: #eee;
+  cursor: default; }
+
+.select2-container--default.select2-container--disabled .select2-selection__choice__remove {
+  display: none; }
+
+.select2-container--default.select2-container--open.select2-container--above .select2-selection--single, .select2-container--default.select2-container--open.select2-container--above .select2-selection--multiple {
+  border-top-left-radius: 0;
+  border-top-right-radius: 0; }
+
+.select2-container--default.select2-container--open.select2-container--below .select2-selection--single, .select2-container--default.select2-container--open.select2-container--below .select2-selection--multiple {
+  border-bottom-left-radius: 0;
+  border-bottom-right-radius: 0; }
+
+.select2-container--default .select2-search--dropdown .select2-search__field {
+  border: 1px solid #aaa; }
+
+.select2-container--default .select2-search--inline .select2-search__field {
+  background: transparent;
+  border: none;
+  outline: 0;
+  box-shadow: none;
+  -webkit-appearance: textfield; }
+
+.select2-container--default .select2-results > .select2-results__options {
+  max-height: 200px;
+  overflow-y: auto; }
+
+.select2-container--default .select2-results__option[role=group] {
+  padding: 0; }
+
+.select2-container--default .select2-results__option[aria-disabled=true] {
+  color: #999; }
+
+.select2-container--default .select2-results__option[aria-selected=true] {
+  background-color: #ddd; }
+
+.select2-container--default .select2-results__option .select2-results__option {
+  padding-left: 1em; }
+  .select2-container--default .select2-results__option .select2-results__option .select2-results__group {
+    padding-left: 0; }
+  .select2-container--default .select2-results__option .select2-results__option .select2-results__option {
+    margin-left: -1em;
+    padding-left: 2em; }
+    .select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option {
+      margin-left: -2em;
+      padding-left: 3em; }
+      .select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option {
+        margin-left: -3em;
+        padding-left: 4em; }
+        .select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option {
+          margin-left: -4em;
+          padding-left: 5em; }
+          .select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option {
+            margin-left: -5em;
+            padding-left: 6em; }
+
+.select2-container--default .select2-results__option--highlighted[aria-selected] {
+  background-color: #5897fb;
+  color: white; }
+
+.select2-container--default .select2-results__group {
+  cursor: default;
+  display: block;
+  padding: 6px; }
+
+.select2-container--classic .select2-selection--single {
+  background-color: #f7f7f7;
+  border: 1px solid #aaa;
+  border-radius: 4px;
+  outline: 0;
+  background-image: -webkit-linear-gradient(top, white 50%, #eeeeee 100%);
+  background-image: -o-linear-gradient(top, white 50%, #eeeeee 100%);
+  background-image: linear-gradient(to bottom, white 50%, #eeeeee 100%);
+  background-repeat: repeat-x;
+  filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0); }
+  .select2-container--classic .select2-selection--single:focus {
+    border: 1px solid #5897fb; }
+  .select2-container--classic .select2-selection--single .select2-selection__rendered {
+    color: #444;
+    line-height: 28px; }
+  .select2-container--classic .select2-selection--single .select2-selection__clear {
+    cursor: pointer;
+    float: right;
+    font-weight: bold;
+    margin-right: 10px; }
+  .select2-container--classic .select2-selection--single .select2-selection__placeholder {
+    color: #999; }
+  .select2-container--classic .select2-selection--single .select2-selection__arrow {
+    background-color: #ddd;
+    border: none;
+    border-left: 1px solid #aaa;
+    border-top-right-radius: 4px;
+    border-bottom-right-radius: 4px;
+    height: 26px;
+    position: absolute;
+    top: 1px;
+    right: 1px;
+    width: 20px;
+    background-image: -webkit-linear-gradient(top, #eeeeee 50%, #cccccc 100%);
+    background-image: -o-linear-gradient(top, #eeeeee 50%, #cccccc 100%);
+    background-image: linear-gradient(to bottom, #eeeeee 50%, #cccccc 100%);
+    background-repeat: repeat-x;
+    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFCCCCCC', GradientType=0); }
+    .select2-container--classic .select2-selection--single .select2-selection__arrow b {
+      border-color: #888 transparent transparent transparent;
+      border-style: solid;
+      border-width: 5px 4px 0 4px;
+      height: 0;
+      left: 50%;
+      margin-left: -4px;
+      margin-top: -2px;
+      position: absolute;
+      top: 50%;
+      width: 0; }
+
+.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__clear {
+  float: left; }
+
+.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__arrow {
+  border: none;
+  border-right: 1px solid #aaa;
+  border-radius: 0;
+  border-top-left-radius: 4px;
+  border-bottom-left-radius: 4px;
+  left: 1px;
+  right: auto; }
+
+.select2-container--classic.select2-container--open .select2-selection--single {
+  border: 1px solid #5897fb; }
+  .select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow {
+    background: transparent;
+    border: none; }
+    .select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow b {
+      border-color: transparent transparent #888 transparent;
+      border-width: 0 4px 5px 4px; }
+
+.select2-container--classic.select2-container--open.select2-container--above .select2-selection--single {
+  border-top: none;
+  border-top-left-radius: 0;
+  border-top-right-radius: 0;
+  background-image: -webkit-linear-gradient(top, white 0%, #eeeeee 50%);
+  background-image: -o-linear-gradient(top, white 0%, #eeeeee 50%);
+  background-image: linear-gradient(to bottom, white 0%, #eeeeee 50%);
+  background-repeat: repeat-x;
+  filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0); }
+
+.select2-container--classic.select2-container--open.select2-container--below .select2-selection--single {
+  border-bottom: none;
+  border-bottom-left-radius: 0;
+  border-bottom-right-radius: 0;
+  background-image: -webkit-linear-gradient(top, #eeeeee 50%, white 100%);
+  background-image: -o-linear-gradient(top, #eeeeee 50%, white 100%);
+  background-image: linear-gradient(to bottom, #eeeeee 50%, white 100%);
+  background-repeat: repeat-x;
+  filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFFFFFFF', GradientType=0); }
+
+.select2-container--classic .select2-selection--multiple {
+  background-color: white;
+  border: 1px solid #aaa;
+  border-radius: 4px;
+  cursor: text;
+  outline: 0; }
+  .select2-container--classic .select2-selection--multiple:focus {
+    border: 1px solid #5897fb; }
+  .select2-container--classic .select2-selection--multiple .select2-selection__rendered {
+    list-style: none;
+    margin: 0;
+    padding: 0 5px; }
+  .select2-container--classic .select2-selection--multiple .select2-selection__clear {
+    display: none; }
+  .select2-container--classic .select2-selection--multiple .select2-selection__choice {
+    background-color: #e4e4e4;
+    border: 1px solid #aaa;
+    border-radius: 4px;
+    cursor: default;
+    float: left;
+    margin-right: 5px;
+    margin-top: 5px;
+    padding: 0 5px; }
+  .select2-container--classic .select2-selection--multiple .select2-selection__choice__remove {
+    color: #888;
+    cursor: pointer;
+    display: inline-block;
+    font-weight: bold;
+    margin-right: 2px; }
+    .select2-container--classic .select2-selection--multiple .select2-selection__choice__remove:hover {
+      color: #555; }
+
+.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice {
+  float: right; }
+
+.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice {
+  margin-left: 5px;
+  margin-right: auto; }
+
+.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove {
+  margin-left: 2px;
+  margin-right: auto; }
+
+.select2-container--classic.select2-container--open .select2-selection--multiple {
+  border: 1px solid #5897fb; }
+
+.select2-container--classic.select2-container--open.select2-container--above .select2-selection--multiple {
+  border-top: none;
+  border-top-left-radius: 0;
+  border-top-right-radius: 0; }
+
+.select2-container--classic.select2-container--open.select2-container--below .select2-selection--multiple {
+  border-bottom: none;
+  border-bottom-left-radius: 0;
+  border-bottom-right-radius: 0; }
+
+.select2-container--classic .select2-search--dropdown .select2-search__field {
+  border: 1px solid #aaa;
+  outline: 0; }
+
+.select2-container--classic .select2-search--inline .select2-search__field {
+  outline: 0;
+  box-shadow: none; }
+
+.select2-container--classic .select2-dropdown {
+  background-color: white;
+  border: 1px solid transparent; }
+
+.select2-container--classic .select2-dropdown--above {
+  border-bottom: none; }
+
+.select2-container--classic .select2-dropdown--below {
+  border-top: none; }
+
+.select2-container--classic .select2-results > .select2-results__options {
+  max-height: 200px;
+  overflow-y: auto; }
+
+.select2-container--classic .select2-results__option[role=group] {
+  padding: 0; }
+
+.select2-container--classic .select2-results__option[aria-disabled=true] {
+  color: grey; }
+
+.select2-container--classic .select2-results__option--highlighted[aria-selected] {
+  background-color: #3875d7;
+  color: white; }
+
+.select2-container--classic .select2-results__group {
+  cursor: default;
+  display: block;
+  padding: 6px; }
+
+.select2-container--classic.select2-container--open .select2-dropdown {
+  border-color: #5897fb; }
diff --git a/htdocs/includes/jquery/plugins/select2/dist/css/select2.min.css b/htdocs/includes/jquery/plugins/select2/dist/css/select2.min.css
new file mode 100644
index 00000000000..76de04d9233
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/dist/css/select2.min.css
@@ -0,0 +1 @@
+.select2-container{box-sizing:border-box;display:inline-block;margin:0;position:relative;vertical-align:middle}.select2-container .select2-selection--single{box-sizing:border-box;cursor:pointer;display:block;height:28px;user-select:none;-webkit-user-select:none}.select2-container .select2-selection--single .select2-selection__rendered{display:block;padding-left:8px;padding-right:20px;overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.select2-container .select2-selection--single .select2-selection__clear{position:relative}.select2-container[dir="rtl"] .select2-selection--single .select2-selection__rendered{padding-right:8px;padding-left:20px}.select2-container .select2-selection--multiple{box-sizing:border-box;cursor:pointer;display:block;min-height:32px;user-select:none;-webkit-user-select:none}.select2-container .select2-selection--multiple .select2-selection__rendered{display:inline-block;overflow:hidden;padding-left:8px;text-overflow:ellipsis;white-space:nowrap}.select2-container .select2-search--inline{float:left}.select2-container .select2-search--inline .select2-search__field{box-sizing:border-box;border:none;font-size:100%;margin-top:5px;padding:0}.select2-container .select2-search--inline .select2-search__field::-webkit-search-cancel-button{-webkit-appearance:none}.select2-dropdown{background-color:white;border:1px solid #aaa;border-radius:4px;box-sizing:border-box;display:block;position:absolute;left:-100000px;width:100%;z-index:1051}.select2-results{display:block}.select2-results__options{list-style:none;margin:0;padding:0}.select2-results__option{padding:6px;user-select:none;-webkit-user-select:none}.select2-results__option[aria-selected]{cursor:pointer}.select2-container--open .select2-dropdown{left:0}.select2-container--open .select2-dropdown--above{border-bottom:none;border-bottom-left-radius:0;border-bottom-right-radius:0}.select2-container--open .select2-dropdown--below{border-top:none;border-top-left-radius:0;border-top-right-radius:0}.select2-search--dropdown{display:block;padding:4px}.select2-search--dropdown .select2-search__field{padding:4px;width:100%;box-sizing:border-box}.select2-search--dropdown .select2-search__field::-webkit-search-cancel-button{-webkit-appearance:none}.select2-search--dropdown.select2-search--hide{display:none}.select2-close-mask{border:0;margin:0;padding:0;display:block;position:fixed;left:0;top:0;min-height:100%;min-width:100%;height:auto;width:auto;opacity:0;z-index:99;background-color:#fff;filter:alpha(opacity=0)}.select2-hidden-accessible{border:0 !important;clip:rect(0 0 0 0) !important;height:1px !important;margin:-1px !important;overflow:hidden !important;padding:0 !important;position:absolute !important;width:1px !important}.select2-container--default .select2-selection--single{background-color:#fff;border:1px solid #aaa;border-radius:4px}.select2-container--default .select2-selection--single .select2-selection__rendered{color:#444;line-height:28px}.select2-container--default .select2-selection--single .select2-selection__clear{cursor:pointer;float:right;font-weight:bold}.select2-container--default .select2-selection--single .select2-selection__placeholder{color:#999}.select2-container--default .select2-selection--single .select2-selection__arrow{height:26px;position:absolute;top:1px;right:1px;width:20px}.select2-container--default .select2-selection--single .select2-selection__arrow b{border-color:#888 transparent transparent transparent;border-style:solid;border-width:5px 4px 0 4px;height:0;left:50%;margin-left:-4px;margin-top:-2px;position:absolute;top:50%;width:0}.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__clear{float:left}.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__arrow{left:1px;right:auto}.select2-container--default.select2-container--disabled .select2-selection--single{background-color:#eee;cursor:default}.select2-container--default.select2-container--disabled .select2-selection--single .select2-selection__clear{display:none}.select2-container--default.select2-container--open .select2-selection--single .select2-selection__arrow b{border-color:transparent transparent #888 transparent;border-width:0 4px 5px 4px}.select2-container--default .select2-selection--multiple{background-color:white;border:1px solid #aaa;border-radius:4px;cursor:text}.select2-container--default .select2-selection--multiple .select2-selection__rendered{box-sizing:border-box;list-style:none;margin:0;padding:0 5px;width:100%}.select2-container--default .select2-selection--multiple .select2-selection__rendered li{list-style:none}.select2-container--default .select2-selection--multiple .select2-selection__placeholder{color:#999;margin-top:5px;float:left}.select2-container--default .select2-selection--multiple .select2-selection__clear{cursor:pointer;float:right;font-weight:bold;margin-top:5px;margin-right:10px}.select2-container--default .select2-selection--multiple .select2-selection__choice{background-color:#e4e4e4;border:1px solid #aaa;border-radius:4px;cursor:default;float:left;margin-right:5px;margin-top:5px;padding:0 5px}.select2-container--default .select2-selection--multiple .select2-selection__choice__remove{color:#999;cursor:pointer;display:inline-block;font-weight:bold;margin-right:2px}.select2-container--default .select2-selection--multiple .select2-selection__choice__remove:hover{color:#333}.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice,.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__placeholder,.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-search--inline{float:right}.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice{margin-left:5px;margin-right:auto}.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove{margin-left:2px;margin-right:auto}.select2-container--default.select2-container--focus .select2-selection--multiple{border:solid black 1px;outline:0}.select2-container--default.select2-container--disabled .select2-selection--multiple{background-color:#eee;cursor:default}.select2-container--default.select2-container--disabled .select2-selection__choice__remove{display:none}.select2-container--default.select2-container--open.select2-container--above .select2-selection--single,.select2-container--default.select2-container--open.select2-container--above .select2-selection--multiple{border-top-left-radius:0;border-top-right-radius:0}.select2-container--default.select2-container--open.select2-container--below .select2-selection--single,.select2-container--default.select2-container--open.select2-container--below .select2-selection--multiple{border-bottom-left-radius:0;border-bottom-right-radius:0}.select2-container--default .select2-search--dropdown .select2-search__field{border:1px solid #aaa}.select2-container--default .select2-search--inline .select2-search__field{background:transparent;border:none;outline:0;box-shadow:none;-webkit-appearance:textfield}.select2-container--default .select2-results>.select2-results__options{max-height:200px;overflow-y:auto}.select2-container--default .select2-results__option[role=group]{padding:0}.select2-container--default .select2-results__option[aria-disabled=true]{color:#999}.select2-container--default .select2-results__option[aria-selected=true]{background-color:#ddd}.select2-container--default .select2-results__option .select2-results__option{padding-left:1em}.select2-container--default .select2-results__option .select2-results__option .select2-results__group{padding-left:0}.select2-container--default .select2-results__option .select2-results__option .select2-results__option{margin-left:-1em;padding-left:2em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-2em;padding-left:3em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-3em;padding-left:4em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-4em;padding-left:5em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-5em;padding-left:6em}.select2-container--default .select2-results__option--highlighted[aria-selected]{background-color:#5897fb;color:white}.select2-container--default .select2-results__group{cursor:default;display:block;padding:6px}.select2-container--classic .select2-selection--single{background-color:#f7f7f7;border:1px solid #aaa;border-radius:4px;outline:0;background-image:-webkit-linear-gradient(top, #fff 50%, #eee 100%);background-image:-o-linear-gradient(top, #fff 50%, #eee 100%);background-image:linear-gradient(to bottom, #fff 50%, #eee 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0)}.select2-container--classic .select2-selection--single:focus{border:1px solid #5897fb}.select2-container--classic .select2-selection--single .select2-selection__rendered{color:#444;line-height:28px}.select2-container--classic .select2-selection--single .select2-selection__clear{cursor:pointer;float:right;font-weight:bold;margin-right:10px}.select2-container--classic .select2-selection--single .select2-selection__placeholder{color:#999}.select2-container--classic .select2-selection--single .select2-selection__arrow{background-color:#ddd;border:none;border-left:1px solid #aaa;border-top-right-radius:4px;border-bottom-right-radius:4px;height:26px;position:absolute;top:1px;right:1px;width:20px;background-image:-webkit-linear-gradient(top, #eee 50%, #ccc 100%);background-image:-o-linear-gradient(top, #eee 50%, #ccc 100%);background-image:linear-gradient(to bottom, #eee 50%, #ccc 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFCCCCCC', GradientType=0)}.select2-container--classic .select2-selection--single .select2-selection__arrow b{border-color:#888 transparent transparent transparent;border-style:solid;border-width:5px 4px 0 4px;height:0;left:50%;margin-left:-4px;margin-top:-2px;position:absolute;top:50%;width:0}.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__clear{float:left}.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__arrow{border:none;border-right:1px solid #aaa;border-radius:0;border-top-left-radius:4px;border-bottom-left-radius:4px;left:1px;right:auto}.select2-container--classic.select2-container--open .select2-selection--single{border:1px solid #5897fb}.select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow{background:transparent;border:none}.select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow b{border-color:transparent transparent #888 transparent;border-width:0 4px 5px 4px}.select2-container--classic.select2-container--open.select2-container--above .select2-selection--single{border-top:none;border-top-left-radius:0;border-top-right-radius:0;background-image:-webkit-linear-gradient(top, #fff 0%, #eee 50%);background-image:-o-linear-gradient(top, #fff 0%, #eee 50%);background-image:linear-gradient(to bottom, #fff 0%, #eee 50%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0)}.select2-container--classic.select2-container--open.select2-container--below .select2-selection--single{border-bottom:none;border-bottom-left-radius:0;border-bottom-right-radius:0;background-image:-webkit-linear-gradient(top, #eee 50%, #fff 100%);background-image:-o-linear-gradient(top, #eee 50%, #fff 100%);background-image:linear-gradient(to bottom, #eee 50%, #fff 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFFFFFFF', GradientType=0)}.select2-container--classic .select2-selection--multiple{background-color:white;border:1px solid #aaa;border-radius:4px;cursor:text;outline:0}.select2-container--classic .select2-selection--multiple:focus{border:1px solid #5897fb}.select2-container--classic .select2-selection--multiple .select2-selection__rendered{list-style:none;margin:0;padding:0 5px}.select2-container--classic .select2-selection--multiple .select2-selection__clear{display:none}.select2-container--classic .select2-selection--multiple .select2-selection__choice{background-color:#e4e4e4;border:1px solid #aaa;border-radius:4px;cursor:default;float:left;margin-right:5px;margin-top:5px;padding:0 5px}.select2-container--classic .select2-selection--multiple .select2-selection__choice__remove{color:#888;cursor:pointer;display:inline-block;font-weight:bold;margin-right:2px}.select2-container--classic .select2-selection--multiple .select2-selection__choice__remove:hover{color:#555}.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice{float:right}.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice{margin-left:5px;margin-right:auto}.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove{margin-left:2px;margin-right:auto}.select2-container--classic.select2-container--open .select2-selection--multiple{border:1px solid #5897fb}.select2-container--classic.select2-container--open.select2-container--above .select2-selection--multiple{border-top:none;border-top-left-radius:0;border-top-right-radius:0}.select2-container--classic.select2-container--open.select2-container--below .select2-selection--multiple{border-bottom:none;border-bottom-left-radius:0;border-bottom-right-radius:0}.select2-container--classic .select2-search--dropdown .select2-search__field{border:1px solid #aaa;outline:0}.select2-container--classic .select2-search--inline .select2-search__field{outline:0;box-shadow:none}.select2-container--classic .select2-dropdown{background-color:#fff;border:1px solid transparent}.select2-container--classic .select2-dropdown--above{border-bottom:none}.select2-container--classic .select2-dropdown--below{border-top:none}.select2-container--classic .select2-results>.select2-results__options{max-height:200px;overflow-y:auto}.select2-container--classic .select2-results__option[role=group]{padding:0}.select2-container--classic .select2-results__option[aria-disabled=true]{color:grey}.select2-container--classic .select2-results__option--highlighted[aria-selected]{background-color:#3875d7;color:#fff}.select2-container--classic .select2-results__group{cursor:default;display:block;padding:6px}.select2-container--classic.select2-container--open .select2-dropdown{border-color:#5897fb}
diff --git a/htdocs/includes/jquery/plugins/select2/dist/js/select2.js b/htdocs/includes/jquery/plugins/select2/dist/js/select2.js
new file mode 100644
index 00000000000..da16adfdc22
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/dist/js/select2.js
@@ -0,0 +1,5746 @@
+/*!
+ * Select2 4.0.4
+ * https://select2.github.io
+ *
+ * Released under the MIT license
+ * https://github.com/select2/select2/blob/master/LICENSE.md
+ */
+(function (factory) {
+  if (typeof define === 'function' && define.amd) {
+    // AMD. Register as an anonymous module.
+    define(['jquery'], factory);
+  } else if (typeof module === 'object' && module.exports) {
+    // Node/CommonJS
+    module.exports = function (root, jQuery) {
+      if (jQuery === undefined) {
+        // require('jQuery') returns a factory that requires window to
+        // build a jQuery instance, we normalize how we use modules
+        // that require this pattern but the window provided is a noop
+        // if it's defined (how jquery works)
+        if (typeof window !== 'undefined') {
+          jQuery = require('jquery');
+        }
+        else {
+          jQuery = require('jquery')(root);
+        }
+      }
+      factory(jQuery);
+      return jQuery;
+    };
+  } else {
+    // Browser globals
+    factory(jQuery);
+  }
+} (function (jQuery) {
+  // This is needed so we can catch the AMD loader configuration and use it
+  // The inner file should be wrapped (by `banner.start.js`) in a function that
+  // returns the AMD loader references.
+  var S2 =(function () {
+  // Restore the Select2 AMD loader so it can be used
+  // Needed mostly in the language files, where the loader is not inserted
+  if (jQuery && jQuery.fn && jQuery.fn.select2 && jQuery.fn.select2.amd) {
+    var S2 = jQuery.fn.select2.amd;
+  }
+var S2;(function () { if (!S2 || !S2.requirejs) {
+if (!S2) { S2 = {}; } else { require = S2; }
+/**
+ * @license almond 0.3.3 Copyright jQuery Foundation and other contributors.
+ * Released under MIT license, http://github.com/requirejs/almond/LICENSE
+ */
+//Going sloppy to avoid 'use strict' string cost, but strict practices should
+//be followed.
+/*global setTimeout: false */
+
+var requirejs, require, define;
+(function (undef) {
+    var main, req, makeMap, handlers,
+        defined = {},
+        waiting = {},
+        config = {},
+        defining = {},
+        hasOwn = Object.prototype.hasOwnProperty,
+        aps = [].slice,
+        jsSuffixRegExp = /\.js$/;
+
+    function hasProp(obj, prop) {
+        return hasOwn.call(obj, prop);
+    }
+
+    /**
+     * Given a relative module name, like ./something, normalize it to
+     * a real name that can be mapped to a path.
+     * @param {String} name the relative name
+     * @param {String} baseName a real name that the name arg is relative
+     * to.
+     * @returns {String} normalized name
+     */
+    function normalize(name, baseName) {
+        var nameParts, nameSegment, mapValue, foundMap, lastIndex,
+            foundI, foundStarMap, starI, i, j, part, normalizedBaseParts,
+            baseParts = baseName && baseName.split("/"),
+            map = config.map,
+            starMap = (map && map['*']) || {};
+
+        //Adjust any relative paths.
+        if (name) {
+            name = name.split('/');
+            lastIndex = name.length - 1;
+
+            // If wanting node ID compatibility, strip .js from end
+            // of IDs. Have to do this here, and not in nameToUrl
+            // because node allows either .js or non .js to map
+            // to same file.
+            if (config.nodeIdCompat && jsSuffixRegExp.test(name[lastIndex])) {
+                name[lastIndex] = name[lastIndex].replace(jsSuffixRegExp, '');
+            }
+
+            // Starts with a '.' so need the baseName
+            if (name[0].charAt(0) === '.' && baseParts) {
+                //Convert baseName to array, and lop off the last part,
+                //so that . matches that 'directory' and not name of the baseName's
+                //module. For instance, baseName of 'one/two/three', maps to
+                //'one/two/three.js', but we want the directory, 'one/two' for
+                //this normalization.
+                normalizedBaseParts = baseParts.slice(0, baseParts.length - 1);
+                name = normalizedBaseParts.concat(name);
+            }
+
+            //start trimDots
+            for (i = 0; i < name.length; i++) {
+                part = name[i];
+                if (part === '.') {
+                    name.splice(i, 1);
+                    i -= 1;
+                } else if (part === '..') {
+                    // If at the start, or previous value is still ..,
+                    // keep them so that when converted to a path it may
+                    // still work when converted to a path, even though
+                    // as an ID it is less than ideal. In larger point
+                    // releases, may be better to just kick out an error.
+                    if (i === 0 || (i === 1 && name[2] === '..') || name[i - 1] === '..') {
+                        continue;
+                    } else if (i > 0) {
+                        name.splice(i - 1, 2);
+                        i -= 2;
+                    }
+                }
+            }
+            //end trimDots
+
+            name = name.join('/');
+        }
+
+        //Apply map config if available.
+        if ((baseParts || starMap) && map) {
+            nameParts = name.split('/');
+
+            for (i = nameParts.length; i > 0; i -= 1) {
+                nameSegment = nameParts.slice(0, i).join("/");
+
+                if (baseParts) {
+                    //Find the longest baseName segment match in the config.
+                    //So, do joins on the biggest to smallest lengths of baseParts.
+                    for (j = baseParts.length; j > 0; j -= 1) {
+                        mapValue = map[baseParts.slice(0, j).join('/')];
+
+                        //baseName segment has  config, find if it has one for
+                        //this name.
+                        if (mapValue) {
+                            mapValue = mapValue[nameSegment];
+                            if (mapValue) {
+                                //Match, update name to the new value.
+                                foundMap = mapValue;
+                                foundI = i;
+                                break;
+                            }
+                        }
+                    }
+                }
+
+                if (foundMap) {
+                    break;
+                }
+
+                //Check for a star map match, but just hold on to it,
+                //if there is a shorter segment match later in a matching
+                //config, then favor over this star map.
+                if (!foundStarMap && starMap && starMap[nameSegment]) {
+                    foundStarMap = starMap[nameSegment];
+                    starI = i;
+                }
+            }
+
+            if (!foundMap && foundStarMap) {
+                foundMap = foundStarMap;
+                foundI = starI;
+            }
+
+            if (foundMap) {
+                nameParts.splice(0, foundI, foundMap);
+                name = nameParts.join('/');
+            }
+        }
+
+        return name;
+    }
+
+    function makeRequire(relName, forceSync) {
+        return function () {
+            //A version of a require function that passes a moduleName
+            //value for items that may need to
+            //look up paths relative to the moduleName
+            var args = aps.call(arguments, 0);
+
+            //If first arg is not require('string'), and there is only
+            //one arg, it is the array form without a callback. Insert
+            //a null so that the following concat is correct.
+            if (typeof args[0] !== 'string' && args.length === 1) {
+                args.push(null);
+            }
+            return req.apply(undef, args.concat([relName, forceSync]));
+        };
+    }
+
+    function makeNormalize(relName) {
+        return function (name) {
+            return normalize(name, relName);
+        };
+    }
+
+    function makeLoad(depName) {
+        return function (value) {
+            defined[depName] = value;
+        };
+    }
+
+    function callDep(name) {
+        if (hasProp(waiting, name)) {
+            var args = waiting[name];
+            delete waiting[name];
+            defining[name] = true;
+            main.apply(undef, args);
+        }
+
+        if (!hasProp(defined, name) && !hasProp(defining, name)) {
+            throw new Error('No ' + name);
+        }
+        return defined[name];
+    }
+
+    //Turns a plugin!resource to [plugin, resource]
+    //with the plugin being undefined if the name
+    //did not have a plugin prefix.
+    function splitPrefix(name) {
+        var prefix,
+            index = name ? name.indexOf('!') : -1;
+        if (index > -1) {
+            prefix = name.substring(0, index);
+            name = name.substring(index + 1, name.length);
+        }
+        return [prefix, name];
+    }
+
+    //Creates a parts array for a relName where first part is plugin ID,
+    //second part is resource ID. Assumes relName has already been normalized.
+    function makeRelParts(relName) {
+        return relName ? splitPrefix(relName) : [];
+    }
+
+    /**
+     * Makes a name map, normalizing the name, and using a plugin
+     * for normalization if necessary. Grabs a ref to plugin
+     * too, as an optimization.
+     */
+    makeMap = function (name, relParts) {
+        var plugin,
+            parts = splitPrefix(name),
+            prefix = parts[0],
+            relResourceName = relParts[1];
+
+        name = parts[1];
+
+        if (prefix) {
+            prefix = normalize(prefix, relResourceName);
+            plugin = callDep(prefix);
+        }
+
+        //Normalize according
+        if (prefix) {
+            if (plugin && plugin.normalize) {
+                name = plugin.normalize(name, makeNormalize(relResourceName));
+            } else {
+                name = normalize(name, relResourceName);
+            }
+        } else {
+            name = normalize(name, relResourceName);
+            parts = splitPrefix(name);
+            prefix = parts[0];
+            name = parts[1];
+            if (prefix) {
+                plugin = callDep(prefix);
+            }
+        }
+
+        //Using ridiculous property names for space reasons
+        return {
+            f: prefix ? prefix + '!' + name : name, //fullName
+            n: name,
+            pr: prefix,
+            p: plugin
+        };
+    };
+
+    function makeConfig(name) {
+        return function () {
+            return (config && config.config && config.config[name]) || {};
+        };
+    }
+
+    handlers = {
+        require: function (name) {
+            return makeRequire(name);
+        },
+        exports: function (name) {
+            var e = defined[name];
+            if (typeof e !== 'undefined') {
+                return e;
+            } else {
+                return (defined[name] = {});
+            }
+        },
+        module: function (name) {
+            return {
+                id: name,
+                uri: '',
+                exports: defined[name],
+                config: makeConfig(name)
+            };
+        }
+    };
+
+    main = function (name, deps, callback, relName) {
+        var cjsModule, depName, ret, map, i, relParts,
+            args = [],
+            callbackType = typeof callback,
+            usingExports;
+
+        //Use name if no relName
+        relName = relName || name;
+        relParts = makeRelParts(relName);
+
+        //Call the callback to define the module, if necessary.
+        if (callbackType === 'undefined' || callbackType === 'function') {
+            //Pull out the defined dependencies and pass the ordered
+            //values to the callback.
+            //Default to [require, exports, module] if no deps
+            deps = !deps.length && callback.length ? ['require', 'exports', 'module'] : deps;
+            for (i = 0; i < deps.length; i += 1) {
+                map = makeMap(deps[i], relParts);
+                depName = map.f;
+
+                //Fast path CommonJS standard dependencies.
+                if (depName === "require") {
+                    args[i] = handlers.require(name);
+                } else if (depName === "exports") {
+                    //CommonJS module spec 1.1
+                    args[i] = handlers.exports(name);
+                    usingExports = true;
+                } else if (depName === "module") {
+                    //CommonJS module spec 1.1
+                    cjsModule = args[i] = handlers.module(name);
+                } else if (hasProp(defined, depName) ||
+                           hasProp(waiting, depName) ||
+                           hasProp(defining, depName)) {
+                    args[i] = callDep(depName);
+                } else if (map.p) {
+                    map.p.load(map.n, makeRequire(relName, true), makeLoad(depName), {});
+                    args[i] = defined[depName];
+                } else {
+                    throw new Error(name + ' missing ' + depName);
+                }
+            }
+
+            ret = callback ? callback.apply(defined[name], args) : undefined;
+
+            if (name) {
+                //If setting exports via "module" is in play,
+                //favor that over return value and exports. After that,
+                //favor a non-undefined return value over exports use.
+                if (cjsModule && cjsModule.exports !== undef &&
+                        cjsModule.exports !== defined[name]) {
+                    defined[name] = cjsModule.exports;
+                } else if (ret !== undef || !usingExports) {
+                    //Use the return value from the function.
+                    defined[name] = ret;
+                }
+            }
+        } else if (name) {
+            //May just be an object definition for the module. Only
+            //worry about defining if have a module name.
+            defined[name] = callback;
+        }
+    };
+
+    requirejs = require = req = function (deps, callback, relName, forceSync, alt) {
+        if (typeof deps === "string") {
+            if (handlers[deps]) {
+                //callback in this case is really relName
+                return handlers[deps](callback);
+            }
+            //Just return the module wanted. In this scenario, the
+            //deps arg is the module name, and second arg (if passed)
+            //is just the relName.
+            //Normalize module name, if it contains . or ..
+            return callDep(makeMap(deps, makeRelParts(callback)).f);
+        } else if (!deps.splice) {
+            //deps is a config object, not an array.
+            config = deps;
+            if (config.deps) {
+                req(config.deps, config.callback);
+            }
+            if (!callback) {
+                return;
+            }
+
+            if (callback.splice) {
+                //callback is an array, which means it is a dependency list.
+                //Adjust args if there are dependencies
+                deps = callback;
+                callback = relName;
+                relName = null;
+            } else {
+                deps = undef;
+            }
+        }
+
+        //Support require(['a'])
+        callback = callback || function () {};
+
+        //If relName is a function, it is an errback handler,
+        //so remove it.
+        if (typeof relName === 'function') {
+            relName = forceSync;
+            forceSync = alt;
+        }
+
+        //Simulate async callback;
+        if (forceSync) {
+            main(undef, deps, callback, relName);
+        } else {
+            //Using a non-zero value because of concern for what old browsers
+            //do, and latest browsers "upgrade" to 4 if lower value is used:
+            //http://www.whatwg.org/specs/web-apps/current-work/multipage/timers.html#dom-windowtimers-settimeout:
+            //If want a value immediately, use require('id') instead -- something
+            //that works in almond on the global level, but not guaranteed and
+            //unlikely to work in other AMD implementations.
+            setTimeout(function () {
+                main(undef, deps, callback, relName);
+            }, 4);
+        }
+
+        return req;
+    };
+
+    /**
+     * Just drops the config on the floor, but returns req in case
+     * the config return value is used.
+     */
+    req.config = function (cfg) {
+        return req(cfg);
+    };
+
+    /**
+     * Expose module registry for debugging and tooling
+     */
+    requirejs._defined = defined;
+
+    define = function (name, deps, callback) {
+        if (typeof name !== 'string') {
+            throw new Error('See almond README: incorrect module build, no module name');
+        }
+
+        //This module may not have dependencies
+        if (!deps.splice) {
+            //deps is not an array, so probably means
+            //an object literal or factory function for
+            //the value. Adjust args.
+            callback = deps;
+            deps = [];
+        }
+
+        if (!hasProp(defined, name) && !hasProp(waiting, name)) {
+            waiting[name] = [name, deps, callback];
+        }
+    };
+
+    define.amd = {
+        jQuery: true
+    };
+}());
+
+S2.requirejs = requirejs;S2.require = require;S2.define = define;
+}
+}());
+S2.define("almond", function(){});
+
+/* global jQuery:false, $:false */
+S2.define('jquery',[],function () {
+  var _$ = jQuery || $;
+
+  if (_$ == null && console && console.error) {
+    console.error(
+      'Select2: An instance of jQuery or a jQuery-compatible library was not ' +
+      'found. Make sure that you are including jQuery before Select2 on your ' +
+      'web page.'
+    );
+  }
+
+  return _$;
+});
+
+S2.define('select2/utils',[
+  'jquery'
+], function ($) {
+  var Utils = {};
+
+  Utils.Extend = function (ChildClass, SuperClass) {
+    var __hasProp = {}.hasOwnProperty;
+
+    function BaseConstructor () {
+      this.constructor = ChildClass;
+    }
+
+    for (var key in SuperClass) {
+      if (__hasProp.call(SuperClass, key)) {
+        ChildClass[key] = SuperClass[key];
+      }
+    }
+
+    BaseConstructor.prototype = SuperClass.prototype;
+    ChildClass.prototype = new BaseConstructor();
+    ChildClass.__super__ = SuperClass.prototype;
+
+    return ChildClass;
+  };
+
+  function getMethods (theClass) {
+    var proto = theClass.prototype;
+
+    var methods = [];
+
+    for (var methodName in proto) {
+      var m = proto[methodName];
+
+      if (typeof m !== 'function') {
+        continue;
+      }
+
+      if (methodName === 'constructor') {
+        continue;
+      }
+
+      methods.push(methodName);
+    }
+
+    return methods;
+  }
+
+  Utils.Decorate = function (SuperClass, DecoratorClass) {
+    var decoratedMethods = getMethods(DecoratorClass);
+    var superMethods = getMethods(SuperClass);
+
+    function DecoratedClass () {
+      var unshift = Array.prototype.unshift;
+
+      var argCount = DecoratorClass.prototype.constructor.length;
+
+      var calledConstructor = SuperClass.prototype.constructor;
+
+      if (argCount > 0) {
+        unshift.call(arguments, SuperClass.prototype.constructor);
+
+        calledConstructor = DecoratorClass.prototype.constructor;
+      }
+
+      calledConstructor.apply(this, arguments);
+    }
+
+    DecoratorClass.displayName = SuperClass.displayName;
+
+    function ctr () {
+      this.constructor = DecoratedClass;
+    }
+
+    DecoratedClass.prototype = new ctr();
+
+    for (var m = 0; m < superMethods.length; m++) {
+        var superMethod = superMethods[m];
+
+        DecoratedClass.prototype[superMethod] =
+          SuperClass.prototype[superMethod];
+    }
+
+    var calledMethod = function (methodName) {
+      // Stub out the original method if it's not decorating an actual method
+      var originalMethod = function () {};
+
+      if (methodName in DecoratedClass.prototype) {
+        originalMethod = DecoratedClass.prototype[methodName];
+      }
+
+      var decoratedMethod = DecoratorClass.prototype[methodName];
+
+      return function () {
+        var unshift = Array.prototype.unshift;
+
+        unshift.call(arguments, originalMethod);
+
+        return decoratedMethod.apply(this, arguments);
+      };
+    };
+
+    for (var d = 0; d < decoratedMethods.length; d++) {
+      var decoratedMethod = decoratedMethods[d];
+
+      DecoratedClass.prototype[decoratedMethod] = calledMethod(decoratedMethod);
+    }
+
+    return DecoratedClass;
+  };
+
+  var Observable = function () {
+    this.listeners = {};
+  };
+
+  Observable.prototype.on = function (event, callback) {
+    this.listeners = this.listeners || {};
+
+    if (event in this.listeners) {
+      this.listeners[event].push(callback);
+    } else {
+      this.listeners[event] = [callback];
+    }
+  };
+
+  Observable.prototype.trigger = function (event) {
+    var slice = Array.prototype.slice;
+    var params = slice.call(arguments, 1);
+
+    this.listeners = this.listeners || {};
+
+    // Params should always come in as an array
+    if (params == null) {
+      params = [];
+    }
+
+    // If there are no arguments to the event, use a temporary object
+    if (params.length === 0) {
+      params.push({});
+    }
+
+    // Set the `_type` of the first object to the event
+    params[0]._type = event;
+
+    if (event in this.listeners) {
+      this.invoke(this.listeners[event], slice.call(arguments, 1));
+    }
+
+    if ('*' in this.listeners) {
+      this.invoke(this.listeners['*'], arguments);
+    }
+  };
+
+  Observable.prototype.invoke = function (listeners, params) {
+    for (var i = 0, len = listeners.length; i < len; i++) {
+      listeners[i].apply(this, params);
+    }
+  };
+
+  Utils.Observable = Observable;
+
+  Utils.generateChars = function (length) {
+    var chars = '';
+
+    for (var i = 0; i < length; i++) {
+      var randomChar = Math.floor(Math.random() * 36);
+      chars += randomChar.toString(36);
+    }
+
+    return chars;
+  };
+
+  Utils.bind = function (func, context) {
+    return function () {
+      func.apply(context, arguments);
+    };
+  };
+
+  Utils._convertData = function (data) {
+    for (var originalKey in data) {
+      var keys = originalKey.split('-');
+
+      var dataLevel = data;
+
+      if (keys.length === 1) {
+        continue;
+      }
+
+      for (var k = 0; k < keys.length; k++) {
+        var key = keys[k];
+
+        // Lowercase the first letter
+        // By default, dash-separated becomes camelCase
+        key = key.substring(0, 1).toLowerCase() + key.substring(1);
+
+        if (!(key in dataLevel)) {
+          dataLevel[key] = {};
+        }
+
+        if (k == keys.length - 1) {
+          dataLevel[key] = data[originalKey];
+        }
+
+        dataLevel = dataLevel[key];
+      }
+
+      delete data[originalKey];
+    }
+
+    return data;
+  };
+
+  Utils.hasScroll = function (index, el) {
+    // Adapted from the function created by @ShadowScripter
+    // and adapted by @BillBarry on the Stack Exchange Code Review website.
+    // The original code can be found at
+    // http://codereview.stackexchange.com/q/13338
+    // and was designed to be used with the Sizzle selector engine.
+
+    var $el = $(el);
+    var overflowX = el.style.overflowX;
+    var overflowY = el.style.overflowY;
+
+    //Check both x and y declarations
+    if (overflowX === overflowY &&
+        (overflowY === 'hidden' || overflowY === 'visible')) {
+      return false;
+    }
+
+    if (overflowX === 'scroll' || overflowY === 'scroll') {
+      return true;
+    }
+
+    return ($el.innerHeight() < el.scrollHeight ||
+      $el.innerWidth() < el.scrollWidth);
+  };
+
+  Utils.escapeMarkup = function (markup) {
+    var replaceMap = {
+      '\\': '&#92;',
+      '&': '&amp;',
+      '<': '&lt;',
+      '>': '&gt;',
+      '"': '&quot;',
+      '\'': '&#39;',
+      '/': '&#47;'
+    };
+
+    // Do not try to escape the markup if it's not a string
+    if (typeof markup !== 'string') {
+      return markup;
+    }
+
+    return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
+      return replaceMap[match];
+    });
+  };
+
+  // Append an array of jQuery nodes to a given element.
+  Utils.appendMany = function ($element, $nodes) {
+    // jQuery 1.7.x does not support $.fn.append() with an array
+    // Fall back to a jQuery object collection using $.fn.add()
+    if ($.fn.jquery.substr(0, 3) === '1.7') {
+      var $jqNodes = $();
+
+      $.map($nodes, function (node) {
+        $jqNodes = $jqNodes.add(node);
+      });
+
+      $nodes = $jqNodes;
+    }
+
+    $element.append($nodes);
+  };
+
+  return Utils;
+});
+
+S2.define('select2/results',[
+  'jquery',
+  './utils'
+], function ($, Utils) {
+  function Results ($element, options, dataAdapter) {
+    this.$element = $element;
+    this.data = dataAdapter;
+    this.options = options;
+
+    Results.__super__.constructor.call(this);
+  }
+
+  Utils.Extend(Results, Utils.Observable);
+
+  Results.prototype.render = function () {
+    var $results = $(
+      '<ul class="select2-results__options" role="tree"></ul>'
+    );
+
+    if (this.options.get('multiple')) {
+      $results.attr('aria-multiselectable', 'true');
+    }
+
+    this.$results = $results;
+
+    return $results;
+  };
+
+  Results.prototype.clear = function () {
+    this.$results.empty();
+  };
+
+  Results.prototype.displayMessage = function (params) {
+    var escapeMarkup = this.options.get('escapeMarkup');
+
+    this.clear();
+    this.hideLoading();
+
+    var $message = $(
+      '<li role="treeitem" aria-live="assertive"' +
+      ' class="select2-results__option"></li>'
+    );
+
+    var message = this.options.get('translations').get(params.message);
+
+    $message.append(
+      escapeMarkup(
+        message(params.args)
+      )
+    );
+
+    $message[0].className += ' select2-results__message';
+
+    this.$results.append($message);
+  };
+
+  Results.prototype.hideMessages = function () {
+    this.$results.find('.select2-results__message').remove();
+  };
+
+  Results.prototype.append = function (data) {
+    this.hideLoading();
+
+    var $options = [];
+
+    if (data.results == null || data.results.length === 0) {
+      if (this.$results.children().length === 0) {
+        this.trigger('results:message', {
+          message: 'noResults'
+        });
+      }
+
+      return;
+    }
+
+    data.results = this.sort(data.results);
+
+    for (var d = 0; d < data.results.length; d++) {
+      var item = data.results[d];
+
+      var $option = this.option(item);
+
+      $options.push($option);
+    }
+
+    this.$results.append($options);
+  };
+
+  Results.prototype.position = function ($results, $dropdown) {
+    var $resultsContainer = $dropdown.find('.select2-results');
+    $resultsContainer.append($results);
+  };
+
+  Results.prototype.sort = function (data) {
+    var sorter = this.options.get('sorter');
+
+    return sorter(data);
+  };
+
+  Results.prototype.highlightFirstItem = function () {
+    var $options = this.$results
+      .find('.select2-results__option[aria-selected]');
+
+    var $selected = $options.filter('[aria-selected=true]');
+
+    // Check if there are any selected options
+    if ($selected.length > 0) {
+      // If there are selected options, highlight the first
+      $selected.first().trigger('mouseenter');
+    } else {
+      // If there are no selected options, highlight the first option
+      // in the dropdown
+      $options.first().trigger('mouseenter');
+    }
+
+    this.ensureHighlightVisible();
+  };
+
+  Results.prototype.setClasses = function () {
+    var self = this;
+
+    this.data.current(function (selected) {
+      var selectedIds = $.map(selected, function (s) {
+        return s.id.toString();
+      });
+
+      var $options = self.$results
+        .find('.select2-results__option[aria-selected]');
+
+      $options.each(function () {
+        var $option = $(this);
+
+        var item = $.data(this, 'data');
+
+        // id needs to be converted to a string when comparing
+        var id = '' + item.id;
+
+        if ((item.element != null && item.element.selected) ||
+            (item.element == null && $.inArray(id, selectedIds) > -1)) {
+          $option.attr('aria-selected', 'true');
+        } else {
+          $option.attr('aria-selected', 'false');
+        }
+      });
+
+    });
+  };
+
+  Results.prototype.showLoading = function (params) {
+    this.hideLoading();
+
+    var loadingMore = this.options.get('translations').get('searching');
+
+    var loading = {
+      disabled: true,
+      loading: true,
+      text: loadingMore(params)
+    };
+    var $loading = this.option(loading);
+    $loading.className += ' loading-results';
+
+    this.$results.prepend($loading);
+  };
+
+  Results.prototype.hideLoading = function () {
+    this.$results.find('.loading-results').remove();
+  };
+
+  Results.prototype.option = function (data) {
+    var option = document.createElement('li');
+    option.className = 'select2-results__option';
+
+    var attrs = {
+      'role': 'treeitem',
+      'aria-selected': 'false'
+    };
+
+    if (data.disabled) {
+      delete attrs['aria-selected'];
+      attrs['aria-disabled'] = 'true';
+    }
+
+    if (data.id == null) {
+      delete attrs['aria-selected'];
+    }
+
+    if (data._resultId != null) {
+      option.id = data._resultId;
+    }
+
+    if (data.title) {
+      option.title = data.title;
+    }
+
+    if (data.children) {
+      attrs.role = 'group';
+      attrs['aria-label'] = data.text;
+      delete attrs['aria-selected'];
+    }
+
+    for (var attr in attrs) {
+      var val = attrs[attr];
+
+      option.setAttribute(attr, val);
+    }
+
+    if (data.children) {
+      var $option = $(option);
+
+      var label = document.createElement('strong');
+      label.className = 'select2-results__group';
+
+      var $label = $(label);
+      this.template(data, label);
+
+      var $children = [];
+
+      for (var c = 0; c < data.children.length; c++) {
+        var child = data.children[c];
+
+        var $child = this.option(child);
+
+        $children.push($child);
+      }
+
+      var $childrenContainer = $('<ul></ul>', {
+        'class': 'select2-results__options select2-results__options--nested'
+      });
+
+      $childrenContainer.append($children);
+
+      $option.append(label);
+      $option.append($childrenContainer);
+    } else {
+      this.template(data, option);
+    }
+
+    $.data(option, 'data', data);
+
+    return option;
+  };
+
+  Results.prototype.bind = function (container, $container) {
+    var self = this;
+
+    var id = container.id + '-results';
+
+    this.$results.attr('id', id);
+
+    container.on('results:all', function (params) {
+      self.clear();
+      self.append(params.data);
+
+      if (container.isOpen()) {
+        self.setClasses();
+        self.highlightFirstItem();
+      }
+    });
+
+    container.on('results:append', function (params) {
+      self.append(params.data);
+
+      if (container.isOpen()) {
+        self.setClasses();
+      }
+    });
+
+    container.on('query', function (params) {
+      self.hideMessages();
+      self.showLoading(params);
+    });
+
+    container.on('select', function () {
+      if (!container.isOpen()) {
+        return;
+      }
+
+      self.setClasses();
+      self.highlightFirstItem();
+    });
+
+    container.on('unselect', function () {
+      if (!container.isOpen()) {
+        return;
+      }
+
+      self.setClasses();
+      self.highlightFirstItem();
+    });
+
+    container.on('open', function () {
+      // When the dropdown is open, aria-expended="true"
+      self.$results.attr('aria-expanded', 'true');
+      self.$results.attr('aria-hidden', 'false');
+
+      self.setClasses();
+      self.ensureHighlightVisible();
+    });
+
+    container.on('close', function () {
+      // When the dropdown is closed, aria-expended="false"
+      self.$results.attr('aria-expanded', 'false');
+      self.$results.attr('aria-hidden', 'true');
+      self.$results.removeAttr('aria-activedescendant');
+    });
+
+    container.on('results:toggle', function () {
+      var $highlighted = self.getHighlightedResults();
+
+      if ($highlighted.length === 0) {
+        return;
+      }
+
+      $highlighted.trigger('mouseup');
+    });
+
+    container.on('results:select', function () {
+      var $highlighted = self.getHighlightedResults();
+
+      if ($highlighted.length === 0) {
+        return;
+      }
+
+      var data = $highlighted.data('data');
+
+      if ($highlighted.attr('aria-selected') == 'true') {
+        self.trigger('close', {});
+      } else {
+        self.trigger('select', {
+          data: data
+        });
+      }
+    });
+
+    container.on('results:previous', function () {
+      var $highlighted = self.getHighlightedResults();
+
+      var $options = self.$results.find('[aria-selected]');
+
+      var currentIndex = $options.index($highlighted);
+
+      // If we are already at te top, don't move further
+      if (currentIndex === 0) {
+        return;
+      }
+
+      var nextIndex = currentIndex - 1;
+
+      // If none are highlighted, highlight the first
+      if ($highlighted.length === 0) {
+        nextIndex = 0;
+      }
+
+      var $next = $options.eq(nextIndex);
+
+      $next.trigger('mouseenter');
+
+      var currentOffset = self.$results.offset().top;
+      var nextTop = $next.offset().top;
+      var nextOffset = self.$results.scrollTop() + (nextTop - currentOffset);
+
+      if (nextIndex === 0) {
+        self.$results.scrollTop(0);
+      } else if (nextTop - currentOffset < 0) {
+        self.$results.scrollTop(nextOffset);
+      }
+    });
+
+    container.on('results:next', function () {
+      var $highlighted = self.getHighlightedResults();
+
+      var $options = self.$results.find('[aria-selected]');
+
+      var currentIndex = $options.index($highlighted);
+
+      var nextIndex = currentIndex + 1;
+
+      // If we are at the last option, stay there
+      if (nextIndex >= $options.length) {
+        return;
+      }
+
+      var $next = $options.eq(nextIndex);
+
+      $next.trigger('mouseenter');
+
+      var currentOffset = self.$results.offset().top +
+        self.$results.outerHeight(false);
+      var nextBottom = $next.offset().top + $next.outerHeight(false);
+      var nextOffset = self.$results.scrollTop() + nextBottom - currentOffset;
+
+      if (nextIndex === 0) {
+        self.$results.scrollTop(0);
+      } else if (nextBottom > currentOffset) {
+        self.$results.scrollTop(nextOffset);
+      }
+    });
+
+    container.on('results:focus', function (params) {
+      params.element.addClass('select2-results__option--highlighted');
+    });
+
+    container.on('results:message', function (params) {
+      self.displayMessage(params);
+    });
+
+    if ($.fn.mousewheel) {
+      this.$results.on('mousewheel', function (e) {
+        var top = self.$results.scrollTop();
+
+        var bottom = self.$results.get(0).scrollHeight - top + e.deltaY;
+
+        var isAtTop = e.deltaY > 0 && top - e.deltaY <= 0;
+        var isAtBottom = e.deltaY < 0 && bottom <= self.$results.height();
+
+        if (isAtTop) {
+          self.$results.scrollTop(0);
+
+          e.preventDefault();
+          e.stopPropagation();
+        } else if (isAtBottom) {
+          self.$results.scrollTop(
+            self.$results.get(0).scrollHeight - self.$results.height()
+          );
+
+          e.preventDefault();
+          e.stopPropagation();
+        }
+      });
+    }
+
+    this.$results.on('mouseup', '.select2-results__option[aria-selected]',
+      function (evt) {
+      var $this = $(this);
+
+      var data = $this.data('data');
+
+      if ($this.attr('aria-selected') === 'true') {
+        if (self.options.get('multiple')) {
+          self.trigger('unselect', {
+            originalEvent: evt,
+            data: data
+          });
+        } else {
+          self.trigger('close', {});
+        }
+
+        return;
+      }
+
+      self.trigger('select', {
+        originalEvent: evt,
+        data: data
+      });
+    });
+
+    this.$results.on('mouseenter', '.select2-results__option[aria-selected]',
+      function (evt) {
+      var data = $(this).data('data');
+
+      self.getHighlightedResults()
+          .removeClass('select2-results__option--highlighted');
+
+      self.trigger('results:focus', {
+        data: data,
+        element: $(this)
+      });
+    });
+  };
+
+  Results.prototype.getHighlightedResults = function () {
+    var $highlighted = this.$results
+    .find('.select2-results__option--highlighted');
+
+    return $highlighted;
+  };
+
+  Results.prototype.destroy = function () {
+    this.$results.remove();
+  };
+
+  Results.prototype.ensureHighlightVisible = function () {
+    var $highlighted = this.getHighlightedResults();
+
+    if ($highlighted.length === 0) {
+      return;
+    }
+
+    var $options = this.$results.find('[aria-selected]');
+
+    var currentIndex = $options.index($highlighted);
+
+    var currentOffset = this.$results.offset().top;
+    var nextTop = $highlighted.offset().top;
+    var nextOffset = this.$results.scrollTop() + (nextTop - currentOffset);
+
+    var offsetDelta = nextTop - currentOffset;
+    nextOffset -= $highlighted.outerHeight(false) * 2;
+
+    if (currentIndex <= 2) {
+      this.$results.scrollTop(0);
+    } else if (offsetDelta > this.$results.outerHeight() || offsetDelta < 0) {
+      this.$results.scrollTop(nextOffset);
+    }
+  };
+
+  Results.prototype.template = function (result, container) {
+    var template = this.options.get('templateResult');
+    var escapeMarkup = this.options.get('escapeMarkup');
+
+    var content = template(result, container);
+
+    if (content == null) {
+      container.style.display = 'none';
+    } else if (typeof content === 'string') {
+      container.innerHTML = escapeMarkup(content);
+    } else {
+      $(container).append(content);
+    }
+  };
+
+  return Results;
+});
+
+S2.define('select2/keys',[
+
+], function () {
+  var KEYS = {
+    BACKSPACE: 8,
+    TAB: 9,
+    ENTER: 13,
+    SHIFT: 16,
+    CTRL: 17,
+    ALT: 18,
+    ESC: 27,
+    SPACE: 32,
+    PAGE_UP: 33,
+    PAGE_DOWN: 34,
+    END: 35,
+    HOME: 36,
+    LEFT: 37,
+    UP: 38,
+    RIGHT: 39,
+    DOWN: 40,
+    DELETE: 46
+  };
+
+  return KEYS;
+});
+
+S2.define('select2/selection/base',[
+  'jquery',
+  '../utils',
+  '../keys'
+], function ($, Utils, KEYS) {
+  function BaseSelection ($element, options) {
+    this.$element = $element;
+    this.options = options;
+
+    BaseSelection.__super__.constructor.call(this);
+  }
+
+  Utils.Extend(BaseSelection, Utils.Observable);
+
+  BaseSelection.prototype.render = function () {
+    var $selection = $(
+      '<span class="select2-selection" role="combobox" ' +
+      ' aria-haspopup="true" aria-expanded="false">' +
+      '</span>'
+    );
+
+    this._tabindex = 0;
+
+    if (this.$element.data('old-tabindex') != null) {
+      this._tabindex = this.$element.data('old-tabindex');
+    } else if (this.$element.attr('tabindex') != null) {
+      this._tabindex = this.$element.attr('tabindex');
+    }
+
+    $selection.attr('title', this.$element.attr('title'));
+    $selection.attr('tabindex', this._tabindex);
+
+    this.$selection = $selection;
+
+    return $selection;
+  };
+
+  BaseSelection.prototype.bind = function (container, $container) {
+    var self = this;
+
+    var id = container.id + '-container';
+    var resultsId = container.id + '-results';
+
+    this.container = container;
+
+    this.$selection.on('focus', function (evt) {
+      self.trigger('focus', evt);
+    });
+
+    this.$selection.on('blur', function (evt) {
+      self._handleBlur(evt);
+    });
+
+    this.$selection.on('keydown', function (evt) {
+      self.trigger('keypress', evt);
+
+      if (evt.which === KEYS.SPACE) {
+        evt.preventDefault();
+      }
+    });
+
+    container.on('results:focus', function (params) {
+      self.$selection.attr('aria-activedescendant', params.data._resultId);
+    });
+
+    container.on('selection:update', function (params) {
+      self.update(params.data);
+    });
+
+    container.on('open', function () {
+      // When the dropdown is open, aria-expanded="true"
+      self.$selection.attr('aria-expanded', 'true');
+      self.$selection.attr('aria-owns', resultsId);
+
+      self._attachCloseHandler(container);
+    });
+
+    container.on('close', function () {
+      // When the dropdown is closed, aria-expanded="false"
+      self.$selection.attr('aria-expanded', 'false');
+      self.$selection.removeAttr('aria-activedescendant');
+      self.$selection.removeAttr('aria-owns');
+
+      self.$selection.focus();
+
+      self._detachCloseHandler(container);
+    });
+
+    container.on('enable', function () {
+      self.$selection.attr('tabindex', self._tabindex);
+    });
+
+    container.on('disable', function () {
+      self.$selection.attr('tabindex', '-1');
+    });
+  };
+
+  BaseSelection.prototype._handleBlur = function (evt) {
+    var self = this;
+
+    // This needs to be delayed as the active element is the body when the tab
+    // key is pressed, possibly along with others.
+    window.setTimeout(function () {
+      // Don't trigger `blur` if the focus is still in the selection
+      if (
+        (document.activeElement == self.$selection[0]) ||
+        ($.contains(self.$selection[0], document.activeElement))
+      ) {
+        return;
+      }
+
+      self.trigger('blur', evt);
+    }, 1);
+  };
+
+  BaseSelection.prototype._attachCloseHandler = function (container) {
+    var self = this;
+
+    $(document.body).on('mousedown.select2.' + container.id, function (e) {
+      var $target = $(e.target);
+
+      var $select = $target.closest('.select2');
+
+      var $all = $('.select2.select2-container--open');
+
+      $all.each(function () {
+        var $this = $(this);
+
+        if (this == $select[0]) {
+          return;
+        }
+
+        var $element = $this.data('element');
+
+        $element.select2('close');
+      });
+    });
+  };
+
+  BaseSelection.prototype._detachCloseHandler = function (container) {
+    $(document.body).off('mousedown.select2.' + container.id);
+  };
+
+  BaseSelection.prototype.position = function ($selection, $container) {
+    var $selectionContainer = $container.find('.selection');
+    $selectionContainer.append($selection);
+  };
+
+  BaseSelection.prototype.destroy = function () {
+    this._detachCloseHandler(this.container);
+  };
+
+  BaseSelection.prototype.update = function (data) {
+    throw new Error('The `update` method must be defined in child classes.');
+  };
+
+  return BaseSelection;
+});
+
+S2.define('select2/selection/single',[
+  'jquery',
+  './base',
+  '../utils',
+  '../keys'
+], function ($, BaseSelection, Utils, KEYS) {
+  function SingleSelection () {
+    SingleSelection.__super__.constructor.apply(this, arguments);
+  }
+
+  Utils.Extend(SingleSelection, BaseSelection);
+
+  SingleSelection.prototype.render = function () {
+    var $selection = SingleSelection.__super__.render.call(this);
+
+    $selection.addClass('select2-selection--single');
+
+    $selection.html(
+      '<span class="select2-selection__rendered"></span>' +
+      '<span class="select2-selection__arrow" role="presentation">' +
+        '<b role="presentation"></b>' +
+      '</span>'
+    );
+
+    return $selection;
+  };
+
+  SingleSelection.prototype.bind = function (container, $container) {
+    var self = this;
+
+    SingleSelection.__super__.bind.apply(this, arguments);
+
+    var id = container.id + '-container';
+
+    this.$selection.find('.select2-selection__rendered').attr('id', id);
+    this.$selection.attr('aria-labelledby', id);
+
+    this.$selection.on('mousedown', function (evt) {
+      // Only respond to left clicks
+      if (evt.which !== 1) {
+        return;
+      }
+
+      self.trigger('toggle', {
+        originalEvent: evt
+      });
+    });
+
+    this.$selection.on('focus', function (evt) {
+      // User focuses on the container
+    });
+
+    this.$selection.on('blur', function (evt) {
+      // User exits the container
+    });
+
+    container.on('focus', function (evt) {
+      if (!container.isOpen()) {
+        self.$selection.focus();
+      }
+    });
+
+    container.on('selection:update', function (params) {
+      self.update(params.data);
+    });
+  };
+
+  SingleSelection.prototype.clear = function () {
+    this.$selection.find('.select2-selection__rendered').empty();
+  };
+
+  SingleSelection.prototype.display = function (data, container) {
+    var template = this.options.get('templateSelection');
+    var escapeMarkup = this.options.get('escapeMarkup');
+
+    return escapeMarkup(template(data, container));
+  };
+
+  SingleSelection.prototype.selectionContainer = function () {
+    return $('<span></span>');
+  };
+
+  SingleSelection.prototype.update = function (data) {
+    if (data.length === 0) {
+      this.clear();
+      return;
+    }
+
+    var selection = data[0];
+
+    var $rendered = this.$selection.find('.select2-selection__rendered');
+    var formatted = this.display(selection, $rendered);
+
+    $rendered.empty().append(formatted);
+    $rendered.prop('title', selection.title || selection.text);
+  };
+
+  return SingleSelection;
+});
+
+S2.define('select2/selection/multiple',[
+  'jquery',
+  './base',
+  '../utils'
+], function ($, BaseSelection, Utils) {
+  function MultipleSelection ($element, options) {
+    MultipleSelection.__super__.constructor.apply(this, arguments);
+  }
+
+  Utils.Extend(MultipleSelection, BaseSelection);
+
+  MultipleSelection.prototype.render = function () {
+    var $selection = MultipleSelection.__super__.render.call(this);
+
+    $selection.addClass('select2-selection--multiple');
+
+    $selection.html(
+      '<ul class="select2-selection__rendered"></ul>'
+    );
+
+    return $selection;
+  };
+
+  MultipleSelection.prototype.bind = function (container, $container) {
+    var self = this;
+
+    MultipleSelection.__super__.bind.apply(this, arguments);
+
+    this.$selection.on('click', function (evt) {
+      self.trigger('toggle', {
+        originalEvent: evt
+      });
+    });
+
+    this.$selection.on(
+      'click',
+      '.select2-selection__choice__remove',
+      function (evt) {
+        // Ignore the event if it is disabled
+        if (self.options.get('disabled')) {
+          return;
+        }
+
+        var $remove = $(this);
+        var $selection = $remove.parent();
+
+        var data = $selection.data('data');
+
+        self.trigger('unselect', {
+          originalEvent: evt,
+          data: data
+        });
+      }
+    );
+  };
+
+  MultipleSelection.prototype.clear = function () {
+    this.$selection.find('.select2-selection__rendered').empty();
+  };
+
+  MultipleSelection.prototype.display = function (data, container) {
+    var template = this.options.get('templateSelection');
+    var escapeMarkup = this.options.get('escapeMarkup');
+
+    return escapeMarkup(template(data, container));
+  };
+
+  MultipleSelection.prototype.selectionContainer = function () {
+    var $container = $(
+      '<li class="select2-selection__choice">' +
+        '<span class="select2-selection__choice__remove" role="presentation">' +
+          '&times;' +
+        '</span>' +
+      '</li>'
+    );
+
+    return $container;
+  };
+
+  MultipleSelection.prototype.update = function (data) {
+    this.clear();
+
+    if (data.length === 0) {
+      return;
+    }
+
+    var $selections = [];
+
+    for (var d = 0; d < data.length; d++) {
+      var selection = data[d];
+
+      var $selection = this.selectionContainer();
+      var formatted = this.display(selection, $selection);
+
+      $selection.append(formatted);
+      $selection.prop('title', selection.title || selection.text);
+
+      $selection.data('data', selection);
+
+      $selections.push($selection);
+    }
+
+    var $rendered = this.$selection.find('.select2-selection__rendered');
+
+    Utils.appendMany($rendered, $selections);
+  };
+
+  return MultipleSelection;
+});
+
+S2.define('select2/selection/placeholder',[
+  '../utils'
+], function (Utils) {
+  function Placeholder (decorated, $element, options) {
+    this.placeholder = this.normalizePlaceholder(options.get('placeholder'));
+
+    decorated.call(this, $element, options);
+  }
+
+  Placeholder.prototype.normalizePlaceholder = function (_, placeholder) {
+    if (typeof placeholder === 'string') {
+      placeholder = {
+        id: '',
+        text: placeholder
+      };
+    }
+
+    return placeholder;
+  };
+
+  Placeholder.prototype.createPlaceholder = function (decorated, placeholder) {
+    var $placeholder = this.selectionContainer();
+
+    $placeholder.html(this.display(placeholder));
+    $placeholder.addClass('select2-selection__placeholder')
+                .removeClass('select2-selection__choice');
+
+    return $placeholder;
+  };
+
+  Placeholder.prototype.update = function (decorated, data) {
+    var singlePlaceholder = (
+      data.length == 1 && data[0].id != this.placeholder.id
+    );
+    var multipleSelections = data.length > 1;
+
+    if (multipleSelections || singlePlaceholder) {
+      return decorated.call(this, data);
+    }
+
+    this.clear();
+
+    var $placeholder = this.createPlaceholder(this.placeholder);
+
+    this.$selection.find('.select2-selection__rendered').append($placeholder);
+  };
+
+  return Placeholder;
+});
+
+S2.define('select2/selection/allowClear',[
+  'jquery',
+  '../keys'
+], function ($, KEYS) {
+  function AllowClear () { }
+
+  AllowClear.prototype.bind = function (decorated, container, $container) {
+    var self = this;
+
+    decorated.call(this, container, $container);
+
+    if (this.placeholder == null) {
+      if (this.options.get('debug') && window.console && console.error) {
+        console.error(
+          'Select2: The `allowClear` option should be used in combination ' +
+          'with the `placeholder` option.'
+        );
+      }
+    }
+
+    this.$selection.on('mousedown', '.select2-selection__clear',
+      function (evt) {
+        self._handleClear(evt);
+    });
+
+    container.on('keypress', function (evt) {
+      self._handleKeyboardClear(evt, container);
+    });
+  };
+
+  AllowClear.prototype._handleClear = function (_, evt) {
+    // Ignore the event if it is disabled
+    if (this.options.get('disabled')) {
+      return;
+    }
+
+    var $clear = this.$selection.find('.select2-selection__clear');
+
+    // Ignore the event if nothing has been selected
+    if ($clear.length === 0) {
+      return;
+    }
+
+    evt.stopPropagation();
+
+    var data = $clear.data('data');
+
+    for (var d = 0; d < data.length; d++) {
+      var unselectData = {
+        data: data[d]
+      };
+
+      // Trigger the `unselect` event, so people can prevent it from being
+      // cleared.
+      this.trigger('unselect', unselectData);
+
+      // If the event was prevented, don't clear it out.
+      if (unselectData.prevented) {
+        return;
+      }
+    }
+
+    this.$element.val(this.placeholder.id).trigger('change');
+
+    this.trigger('toggle', {});
+  };
+
+  AllowClear.prototype._handleKeyboardClear = function (_, evt, container) {
+    if (container.isOpen()) {
+      return;
+    }
+
+    if (evt.which == KEYS.DELETE || evt.which == KEYS.BACKSPACE) {
+      this._handleClear(evt);
+    }
+  };
+
+  AllowClear.prototype.update = function (decorated, data) {
+    decorated.call(this, data);
+
+    if (this.$selection.find('.select2-selection__placeholder').length > 0 ||
+        data.length === 0) {
+      return;
+    }
+
+    var $remove = $(
+      '<span class="select2-selection__clear">' +
+        '&times;' +
+      '</span>'
+    );
+    $remove.data('data', data);
+
+    this.$selection.find('.select2-selection__rendered').prepend($remove);
+  };
+
+  return AllowClear;
+});
+
+S2.define('select2/selection/search',[
+  'jquery',
+  '../utils',
+  '../keys'
+], function ($, Utils, KEYS) {
+  function Search (decorated, $element, options) {
+    decorated.call(this, $element, options);
+  }
+
+  Search.prototype.render = function (decorated) {
+    var $search = $(
+      '<li class="select2-search select2-search--inline">' +
+        '<input class="select2-search__field" type="search" tabindex="-1"' +
+        ' autocomplete="off" autocorrect="off" autocapitalize="off"' +
+        ' spellcheck="false" role="textbox" aria-autocomplete="list" />' +
+      '</li>'
+    );
+
+    this.$searchContainer = $search;
+    this.$search = $search.find('input');
+
+    var $rendered = decorated.call(this);
+
+    this._transferTabIndex();
+
+    return $rendered;
+  };
+
+  Search.prototype.bind = function (decorated, container, $container) {
+    var self = this;
+
+    decorated.call(this, container, $container);
+
+    container.on('open', function () {
+      self.$search.trigger('focus');
+    });
+
+    container.on('close', function () {
+      self.$search.val('');
+      self.$search.removeAttr('aria-activedescendant');
+      self.$search.trigger('focus');
+    });
+
+    container.on('enable', function () {
+      self.$search.prop('disabled', false);
+
+      self._transferTabIndex();
+    });
+
+    container.on('disable', function () {
+      self.$search.prop('disabled', true);
+    });
+
+    container.on('focus', function (evt) {
+      self.$search.trigger('focus');
+    });
+
+    container.on('results:focus', function (params) {
+      self.$search.attr('aria-activedescendant', params.id);
+    });
+
+    this.$selection.on('focusin', '.select2-search--inline', function (evt) {
+      self.trigger('focus', evt);
+    });
+
+    this.$selection.on('focusout', '.select2-search--inline', function (evt) {
+      self._handleBlur(evt);
+    });
+
+    this.$selection.on('keydown', '.select2-search--inline', function (evt) {
+      evt.stopPropagation();
+
+      self.trigger('keypress', evt);
+
+      self._keyUpPrevented = evt.isDefaultPrevented();
+
+      var key = evt.which;
+
+      if (key === KEYS.BACKSPACE && self.$search.val() === '') {
+        var $previousChoice = self.$searchContainer
+          .prev('.select2-selection__choice');
+
+        if ($previousChoice.length > 0) {
+          var item = $previousChoice.data('data');
+
+          self.searchRemoveChoice(item);
+
+          evt.preventDefault();
+        }
+      }
+    });
+
+    // Try to detect the IE version should the `documentMode` property that
+    // is stored on the document. This is only implemented in IE and is
+    // slightly cleaner than doing a user agent check.
+    // This property is not available in Edge, but Edge also doesn't have
+    // this bug.
+    var msie = document.documentMode;
+    var disableInputEvents = msie && msie <= 11;
+
+    // Workaround for browsers which do not support the `input` event
+    // This will prevent double-triggering of events for browsers which support
+    // both the `keyup` and `input` events.
+    this.$selection.on(
+      'input.searchcheck',
+      '.select2-search--inline',
+      function (evt) {
+        // IE will trigger the `input` event when a placeholder is used on a
+        // search box. To get around this issue, we are forced to ignore all
+        // `input` events in IE and keep using `keyup`.
+        if (disableInputEvents) {
+          self.$selection.off('input.search input.searchcheck');
+          return;
+        }
+
+        // Unbind the duplicated `keyup` event
+        self.$selection.off('keyup.search');
+      }
+    );
+
+    this.$selection.on(
+      'keyup.search input.search',
+      '.select2-search--inline',
+      function (evt) {
+        // IE will trigger the `input` event when a placeholder is used on a
+        // search box. To get around this issue, we are forced to ignore all
+        // `input` events in IE and keep using `keyup`.
+        if (disableInputEvents && evt.type === 'input') {
+          self.$selection.off('input.search input.searchcheck');
+          return;
+        }
+
+        var key = evt.which;
+
+        // We can freely ignore events from modifier keys
+        if (key == KEYS.SHIFT || key == KEYS.CTRL || key == KEYS.ALT) {
+          return;
+        }
+
+        // Tabbing will be handled during the `keydown` phase
+        if (key == KEYS.TAB) {
+          return;
+        }
+
+        self.handleSearch(evt);
+      }
+    );
+  };
+
+  /**
+   * This method will transfer the tabindex attribute from the rendered
+   * selection to the search box. This allows for the search box to be used as
+   * the primary focus instead of the selection container.
+   *
+   * @private
+   */
+  Search.prototype._transferTabIndex = function (decorated) {
+    this.$search.attr('tabindex', this.$selection.attr('tabindex'));
+    this.$selection.attr('tabindex', '-1');
+  };
+
+  Search.prototype.createPlaceholder = function (decorated, placeholder) {
+    this.$search.attr('placeholder', placeholder.text);
+  };
+
+  Search.prototype.update = function (decorated, data) {
+    var searchHadFocus = this.$search[0] == document.activeElement;
+
+    this.$search.attr('placeholder', '');
+
+    decorated.call(this, data);
+
+    this.$selection.find('.select2-selection__rendered')
+                   .append(this.$searchContainer);
+
+    this.resizeSearch();
+    if (searchHadFocus) {
+      this.$search.focus();
+    }
+  };
+
+  Search.prototype.handleSearch = function () {
+    this.resizeSearch();
+
+    if (!this._keyUpPrevented) {
+      var input = this.$search.val();
+
+      this.trigger('query', {
+        term: input
+      });
+    }
+
+    this._keyUpPrevented = false;
+  };
+
+  Search.prototype.searchRemoveChoice = function (decorated, item) {
+    this.trigger('unselect', {
+      data: item
+    });
+
+    this.$search.val(item.text);
+    this.handleSearch();
+  };
+
+  Search.prototype.resizeSearch = function () {
+    this.$search.css('width', '25px');
+
+    var width = '';
+
+    if (this.$search.attr('placeholder') !== '') {
+      width = this.$selection.find('.select2-selection__rendered').innerWidth();
+    } else {
+      var minimumWidth = this.$search.val().length + 1;
+
+      width = (minimumWidth * 0.75) + 'em';
+    }
+
+    this.$search.css('width', width);
+  };
+
+  return Search;
+});
+
+S2.define('select2/selection/eventRelay',[
+  'jquery'
+], function ($) {
+  function EventRelay () { }
+
+  EventRelay.prototype.bind = function (decorated, container, $container) {
+    var self = this;
+    var relayEvents = [
+      'open', 'opening',
+      'close', 'closing',
+      'select', 'selecting',
+      'unselect', 'unselecting'
+    ];
+
+    var preventableEvents = ['opening', 'closing', 'selecting', 'unselecting'];
+
+    decorated.call(this, container, $container);
+
+    container.on('*', function (name, params) {
+      // Ignore events that should not be relayed
+      if ($.inArray(name, relayEvents) === -1) {
+        return;
+      }
+
+      // The parameters should always be an object
+      params = params || {};
+
+      // Generate the jQuery event for the Select2 event
+      var evt = $.Event('select2:' + name, {
+        params: params
+      });
+
+      self.$element.trigger(evt);
+
+      // Only handle preventable events if it was one
+      if ($.inArray(name, preventableEvents) === -1) {
+        return;
+      }
+
+      params.prevented = evt.isDefaultPrevented();
+    });
+  };
+
+  return EventRelay;
+});
+
+S2.define('select2/translation',[
+  'jquery',
+  'require'
+], function ($, require) {
+  function Translation (dict) {
+    this.dict = dict || {};
+  }
+
+  Translation.prototype.all = function () {
+    return this.dict;
+  };
+
+  Translation.prototype.get = function (key) {
+    return this.dict[key];
+  };
+
+  Translation.prototype.extend = function (translation) {
+    this.dict = $.extend({}, translation.all(), this.dict);
+  };
+
+  // Static functions
+
+  Translation._cache = {};
+
+  Translation.loadPath = function (path) {
+    if (!(path in Translation._cache)) {
+      var translations = require(path);
+
+      Translation._cache[path] = translations;
+    }
+
+    return new Translation(Translation._cache[path]);
+  };
+
+  return Translation;
+});
+
+S2.define('select2/diacritics',[
+
+], function () {
+  var diacritics = {
+    '\u24B6': 'A',
+    '\uFF21': 'A',
+    '\u00C0': 'A',
+    '\u00C1': 'A',
+    '\u00C2': 'A',
+    '\u1EA6': 'A',
+    '\u1EA4': 'A',
+    '\u1EAA': 'A',
+    '\u1EA8': 'A',
+    '\u00C3': 'A',
+    '\u0100': 'A',
+    '\u0102': 'A',
+    '\u1EB0': 'A',
+    '\u1EAE': 'A',
+    '\u1EB4': 'A',
+    '\u1EB2': 'A',
+    '\u0226': 'A',
+    '\u01E0': 'A',
+    '\u00C4': 'A',
+    '\u01DE': 'A',
+    '\u1EA2': 'A',
+    '\u00C5': 'A',
+    '\u01FA': 'A',
+    '\u01CD': 'A',
+    '\u0200': 'A',
+    '\u0202': 'A',
+    '\u1EA0': 'A',
+    '\u1EAC': 'A',
+    '\u1EB6': 'A',
+    '\u1E00': 'A',
+    '\u0104': 'A',
+    '\u023A': 'A',
+    '\u2C6F': 'A',
+    '\uA732': 'AA',
+    '\u00C6': 'AE',
+    '\u01FC': 'AE',
+    '\u01E2': 'AE',
+    '\uA734': 'AO',
+    '\uA736': 'AU',
+    '\uA738': 'AV',
+    '\uA73A': 'AV',
+    '\uA73C': 'AY',
+    '\u24B7': 'B',
+    '\uFF22': 'B',
+    '\u1E02': 'B',
+    '\u1E04': 'B',
+    '\u1E06': 'B',
+    '\u0243': 'B',
+    '\u0182': 'B',
+    '\u0181': 'B',
+    '\u24B8': 'C',
+    '\uFF23': 'C',
+    '\u0106': 'C',
+    '\u0108': 'C',
+    '\u010A': 'C',
+    '\u010C': 'C',
+    '\u00C7': 'C',
+    '\u1E08': 'C',
+    '\u0187': 'C',
+    '\u023B': 'C',
+    '\uA73E': 'C',
+    '\u24B9': 'D',
+    '\uFF24': 'D',
+    '\u1E0A': 'D',
+    '\u010E': 'D',
+    '\u1E0C': 'D',
+    '\u1E10': 'D',
+    '\u1E12': 'D',
+    '\u1E0E': 'D',
+    '\u0110': 'D',
+    '\u018B': 'D',
+    '\u018A': 'D',
+    '\u0189': 'D',
+    '\uA779': 'D',
+    '\u01F1': 'DZ',
+    '\u01C4': 'DZ',
+    '\u01F2': 'Dz',
+    '\u01C5': 'Dz',
+    '\u24BA': 'E',
+    '\uFF25': 'E',
+    '\u00C8': 'E',
+    '\u00C9': 'E',
+    '\u00CA': 'E',
+    '\u1EC0': 'E',
+    '\u1EBE': 'E',
+    '\u1EC4': 'E',
+    '\u1EC2': 'E',
+    '\u1EBC': 'E',
+    '\u0112': 'E',
+    '\u1E14': 'E',
+    '\u1E16': 'E',
+    '\u0114': 'E',
+    '\u0116': 'E',
+    '\u00CB': 'E',
+    '\u1EBA': 'E',
+    '\u011A': 'E',
+    '\u0204': 'E',
+    '\u0206': 'E',
+    '\u1EB8': 'E',
+    '\u1EC6': 'E',
+    '\u0228': 'E',
+    '\u1E1C': 'E',
+    '\u0118': 'E',
+    '\u1E18': 'E',
+    '\u1E1A': 'E',
+    '\u0190': 'E',
+    '\u018E': 'E',
+    '\u24BB': 'F',
+    '\uFF26': 'F',
+    '\u1E1E': 'F',
+    '\u0191': 'F',
+    '\uA77B': 'F',
+    '\u24BC': 'G',
+    '\uFF27': 'G',
+    '\u01F4': 'G',
+    '\u011C': 'G',
+    '\u1E20': 'G',
+    '\u011E': 'G',
+    '\u0120': 'G',
+    '\u01E6': 'G',
+    '\u0122': 'G',
+    '\u01E4': 'G',
+    '\u0193': 'G',
+    '\uA7A0': 'G',
+    '\uA77D': 'G',
+    '\uA77E': 'G',
+    '\u24BD': 'H',
+    '\uFF28': 'H',
+    '\u0124': 'H',
+    '\u1E22': 'H',
+    '\u1E26': 'H',
+    '\u021E': 'H',
+    '\u1E24': 'H',
+    '\u1E28': 'H',
+    '\u1E2A': 'H',
+    '\u0126': 'H',
+    '\u2C67': 'H',
+    '\u2C75': 'H',
+    '\uA78D': 'H',
+    '\u24BE': 'I',
+    '\uFF29': 'I',
+    '\u00CC': 'I',
+    '\u00CD': 'I',
+    '\u00CE': 'I',
+    '\u0128': 'I',
+    '\u012A': 'I',
+    '\u012C': 'I',
+    '\u0130': 'I',
+    '\u00CF': 'I',
+    '\u1E2E': 'I',
+    '\u1EC8': 'I',
+    '\u01CF': 'I',
+    '\u0208': 'I',
+    '\u020A': 'I',
+    '\u1ECA': 'I',
+    '\u012E': 'I',
+    '\u1E2C': 'I',
+    '\u0197': 'I',
+    '\u24BF': 'J',
+    '\uFF2A': 'J',
+    '\u0134': 'J',
+    '\u0248': 'J',
+    '\u24C0': 'K',
+    '\uFF2B': 'K',
+    '\u1E30': 'K',
+    '\u01E8': 'K',
+    '\u1E32': 'K',
+    '\u0136': 'K',
+    '\u1E34': 'K',
+    '\u0198': 'K',
+    '\u2C69': 'K',
+    '\uA740': 'K',
+    '\uA742': 'K',
+    '\uA744': 'K',
+    '\uA7A2': 'K',
+    '\u24C1': 'L',
+    '\uFF2C': 'L',
+    '\u013F': 'L',
+    '\u0139': 'L',
+    '\u013D': 'L',
+    '\u1E36': 'L',
+    '\u1E38': 'L',
+    '\u013B': 'L',
+    '\u1E3C': 'L',
+    '\u1E3A': 'L',
+    '\u0141': 'L',
+    '\u023D': 'L',
+    '\u2C62': 'L',
+    '\u2C60': 'L',
+    '\uA748': 'L',
+    '\uA746': 'L',
+    '\uA780': 'L',
+    '\u01C7': 'LJ',
+    '\u01C8': 'Lj',
+    '\u24C2': 'M',
+    '\uFF2D': 'M',
+    '\u1E3E': 'M',
+    '\u1E40': 'M',
+    '\u1E42': 'M',
+    '\u2C6E': 'M',
+    '\u019C': 'M',
+    '\u24C3': 'N',
+    '\uFF2E': 'N',
+    '\u01F8': 'N',
+    '\u0143': 'N',
+    '\u00D1': 'N',
+    '\u1E44': 'N',
+    '\u0147': 'N',
+    '\u1E46': 'N',
+    '\u0145': 'N',
+    '\u1E4A': 'N',
+    '\u1E48': 'N',
+    '\u0220': 'N',
+    '\u019D': 'N',
+    '\uA790': 'N',
+    '\uA7A4': 'N',
+    '\u01CA': 'NJ',
+    '\u01CB': 'Nj',
+    '\u24C4': 'O',
+    '\uFF2F': 'O',
+    '\u00D2': 'O',
+    '\u00D3': 'O',
+    '\u00D4': 'O',
+    '\u1ED2': 'O',
+    '\u1ED0': 'O',
+    '\u1ED6': 'O',
+    '\u1ED4': 'O',
+    '\u00D5': 'O',
+    '\u1E4C': 'O',
+    '\u022C': 'O',
+    '\u1E4E': 'O',
+    '\u014C': 'O',
+    '\u1E50': 'O',
+    '\u1E52': 'O',
+    '\u014E': 'O',
+    '\u022E': 'O',
+    '\u0230': 'O',
+    '\u00D6': 'O',
+    '\u022A': 'O',
+    '\u1ECE': 'O',
+    '\u0150': 'O',
+    '\u01D1': 'O',
+    '\u020C': 'O',
+    '\u020E': 'O',
+    '\u01A0': 'O',
+    '\u1EDC': 'O',
+    '\u1EDA': 'O',
+    '\u1EE0': 'O',
+    '\u1EDE': 'O',
+    '\u1EE2': 'O',
+    '\u1ECC': 'O',
+    '\u1ED8': 'O',
+    '\u01EA': 'O',
+    '\u01EC': 'O',
+    '\u00D8': 'O',
+    '\u01FE': 'O',
+    '\u0186': 'O',
+    '\u019F': 'O',
+    '\uA74A': 'O',
+    '\uA74C': 'O',
+    '\u01A2': 'OI',
+    '\uA74E': 'OO',
+    '\u0222': 'OU',
+    '\u24C5': 'P',
+    '\uFF30': 'P',
+    '\u1E54': 'P',
+    '\u1E56': 'P',
+    '\u01A4': 'P',
+    '\u2C63': 'P',
+    '\uA750': 'P',
+    '\uA752': 'P',
+    '\uA754': 'P',
+    '\u24C6': 'Q',
+    '\uFF31': 'Q',
+    '\uA756': 'Q',
+    '\uA758': 'Q',
+    '\u024A': 'Q',
+    '\u24C7': 'R',
+    '\uFF32': 'R',
+    '\u0154': 'R',
+    '\u1E58': 'R',
+    '\u0158': 'R',
+    '\u0210': 'R',
+    '\u0212': 'R',
+    '\u1E5A': 'R',
+    '\u1E5C': 'R',
+    '\u0156': 'R',
+    '\u1E5E': 'R',
+    '\u024C': 'R',
+    '\u2C64': 'R',
+    '\uA75A': 'R',
+    '\uA7A6': 'R',
+    '\uA782': 'R',
+    '\u24C8': 'S',
+    '\uFF33': 'S',
+    '\u1E9E': 'S',
+    '\u015A': 'S',
+    '\u1E64': 'S',
+    '\u015C': 'S',
+    '\u1E60': 'S',
+    '\u0160': 'S',
+    '\u1E66': 'S',
+    '\u1E62': 'S',
+    '\u1E68': 'S',
+    '\u0218': 'S',
+    '\u015E': 'S',
+    '\u2C7E': 'S',
+    '\uA7A8': 'S',
+    '\uA784': 'S',
+    '\u24C9': 'T',
+    '\uFF34': 'T',
+    '\u1E6A': 'T',
+    '\u0164': 'T',
+    '\u1E6C': 'T',
+    '\u021A': 'T',
+    '\u0162': 'T',
+    '\u1E70': 'T',
+    '\u1E6E': 'T',
+    '\u0166': 'T',
+    '\u01AC': 'T',
+    '\u01AE': 'T',
+    '\u023E': 'T',
+    '\uA786': 'T',
+    '\uA728': 'TZ',
+    '\u24CA': 'U',
+    '\uFF35': 'U',
+    '\u00D9': 'U',
+    '\u00DA': 'U',
+    '\u00DB': 'U',
+    '\u0168': 'U',
+    '\u1E78': 'U',
+    '\u016A': 'U',
+    '\u1E7A': 'U',
+    '\u016C': 'U',
+    '\u00DC': 'U',
+    '\u01DB': 'U',
+    '\u01D7': 'U',
+    '\u01D5': 'U',
+    '\u01D9': 'U',
+    '\u1EE6': 'U',
+    '\u016E': 'U',
+    '\u0170': 'U',
+    '\u01D3': 'U',
+    '\u0214': 'U',
+    '\u0216': 'U',
+    '\u01AF': 'U',
+    '\u1EEA': 'U',
+    '\u1EE8': 'U',
+    '\u1EEE': 'U',
+    '\u1EEC': 'U',
+    '\u1EF0': 'U',
+    '\u1EE4': 'U',
+    '\u1E72': 'U',
+    '\u0172': 'U',
+    '\u1E76': 'U',
+    '\u1E74': 'U',
+    '\u0244': 'U',
+    '\u24CB': 'V',
+    '\uFF36': 'V',
+    '\u1E7C': 'V',
+    '\u1E7E': 'V',
+    '\u01B2': 'V',
+    '\uA75E': 'V',
+    '\u0245': 'V',
+    '\uA760': 'VY',
+    '\u24CC': 'W',
+    '\uFF37': 'W',
+    '\u1E80': 'W',
+    '\u1E82': 'W',
+    '\u0174': 'W',
+    '\u1E86': 'W',
+    '\u1E84': 'W',
+    '\u1E88': 'W',
+    '\u2C72': 'W',
+    '\u24CD': 'X',
+    '\uFF38': 'X',
+    '\u1E8A': 'X',
+    '\u1E8C': 'X',
+    '\u24CE': 'Y',
+    '\uFF39': 'Y',
+    '\u1EF2': 'Y',
+    '\u00DD': 'Y',
+    '\u0176': 'Y',
+    '\u1EF8': 'Y',
+    '\u0232': 'Y',
+    '\u1E8E': 'Y',
+    '\u0178': 'Y',
+    '\u1EF6': 'Y',
+    '\u1EF4': 'Y',
+    '\u01B3': 'Y',
+    '\u024E': 'Y',
+    '\u1EFE': 'Y',
+    '\u24CF': 'Z',
+    '\uFF3A': 'Z',
+    '\u0179': 'Z',
+    '\u1E90': 'Z',
+    '\u017B': 'Z',
+    '\u017D': 'Z',
+    '\u1E92': 'Z',
+    '\u1E94': 'Z',
+    '\u01B5': 'Z',
+    '\u0224': 'Z',
+    '\u2C7F': 'Z',
+    '\u2C6B': 'Z',
+    '\uA762': 'Z',
+    '\u24D0': 'a',
+    '\uFF41': 'a',
+    '\u1E9A': 'a',
+    '\u00E0': 'a',
+    '\u00E1': 'a',
+    '\u00E2': 'a',
+    '\u1EA7': 'a',
+    '\u1EA5': 'a',
+    '\u1EAB': 'a',
+    '\u1EA9': 'a',
+    '\u00E3': 'a',
+    '\u0101': 'a',
+    '\u0103': 'a',
+    '\u1EB1': 'a',
+    '\u1EAF': 'a',
+    '\u1EB5': 'a',
+    '\u1EB3': 'a',
+    '\u0227': 'a',
+    '\u01E1': 'a',
+    '\u00E4': 'a',
+    '\u01DF': 'a',
+    '\u1EA3': 'a',
+    '\u00E5': 'a',
+    '\u01FB': 'a',
+    '\u01CE': 'a',
+    '\u0201': 'a',
+    '\u0203': 'a',
+    '\u1EA1': 'a',
+    '\u1EAD': 'a',
+    '\u1EB7': 'a',
+    '\u1E01': 'a',
+    '\u0105': 'a',
+    '\u2C65': 'a',
+    '\u0250': 'a',
+    '\uA733': 'aa',
+    '\u00E6': 'ae',
+    '\u01FD': 'ae',
+    '\u01E3': 'ae',
+    '\uA735': 'ao',
+    '\uA737': 'au',
+    '\uA739': 'av',
+    '\uA73B': 'av',
+    '\uA73D': 'ay',
+    '\u24D1': 'b',
+    '\uFF42': 'b',
+    '\u1E03': 'b',
+    '\u1E05': 'b',
+    '\u1E07': 'b',
+    '\u0180': 'b',
+    '\u0183': 'b',
+    '\u0253': 'b',
+    '\u24D2': 'c',
+    '\uFF43': 'c',
+    '\u0107': 'c',
+    '\u0109': 'c',
+    '\u010B': 'c',
+    '\u010D': 'c',
+    '\u00E7': 'c',
+    '\u1E09': 'c',
+    '\u0188': 'c',
+    '\u023C': 'c',
+    '\uA73F': 'c',
+    '\u2184': 'c',
+    '\u24D3': 'd',
+    '\uFF44': 'd',
+    '\u1E0B': 'd',
+    '\u010F': 'd',
+    '\u1E0D': 'd',
+    '\u1E11': 'd',
+    '\u1E13': 'd',
+    '\u1E0F': 'd',
+    '\u0111': 'd',
+    '\u018C': 'd',
+    '\u0256': 'd',
+    '\u0257': 'd',
+    '\uA77A': 'd',
+    '\u01F3': 'dz',
+    '\u01C6': 'dz',
+    '\u24D4': 'e',
+    '\uFF45': 'e',
+    '\u00E8': 'e',
+    '\u00E9': 'e',
+    '\u00EA': 'e',
+    '\u1EC1': 'e',
+    '\u1EBF': 'e',
+    '\u1EC5': 'e',
+    '\u1EC3': 'e',
+    '\u1EBD': 'e',
+    '\u0113': 'e',
+    '\u1E15': 'e',
+    '\u1E17': 'e',
+    '\u0115': 'e',
+    '\u0117': 'e',
+    '\u00EB': 'e',
+    '\u1EBB': 'e',
+    '\u011B': 'e',
+    '\u0205': 'e',
+    '\u0207': 'e',
+    '\u1EB9': 'e',
+    '\u1EC7': 'e',
+    '\u0229': 'e',
+    '\u1E1D': 'e',
+    '\u0119': 'e',
+    '\u1E19': 'e',
+    '\u1E1B': 'e',
+    '\u0247': 'e',
+    '\u025B': 'e',
+    '\u01DD': 'e',
+    '\u24D5': 'f',
+    '\uFF46': 'f',
+    '\u1E1F': 'f',
+    '\u0192': 'f',
+    '\uA77C': 'f',
+    '\u24D6': 'g',
+    '\uFF47': 'g',
+    '\u01F5': 'g',
+    '\u011D': 'g',
+    '\u1E21': 'g',
+    '\u011F': 'g',
+    '\u0121': 'g',
+    '\u01E7': 'g',
+    '\u0123': 'g',
+    '\u01E5': 'g',
+    '\u0260': 'g',
+    '\uA7A1': 'g',
+    '\u1D79': 'g',
+    '\uA77F': 'g',
+    '\u24D7': 'h',
+    '\uFF48': 'h',
+    '\u0125': 'h',
+    '\u1E23': 'h',
+    '\u1E27': 'h',
+    '\u021F': 'h',
+    '\u1E25': 'h',
+    '\u1E29': 'h',
+    '\u1E2B': 'h',
+    '\u1E96': 'h',
+    '\u0127': 'h',
+    '\u2C68': 'h',
+    '\u2C76': 'h',
+    '\u0265': 'h',
+    '\u0195': 'hv',
+    '\u24D8': 'i',
+    '\uFF49': 'i',
+    '\u00EC': 'i',
+    '\u00ED': 'i',
+    '\u00EE': 'i',
+    '\u0129': 'i',
+    '\u012B': 'i',
+    '\u012D': 'i',
+    '\u00EF': 'i',
+    '\u1E2F': 'i',
+    '\u1EC9': 'i',
+    '\u01D0': 'i',
+    '\u0209': 'i',
+    '\u020B': 'i',
+    '\u1ECB': 'i',
+    '\u012F': 'i',
+    '\u1E2D': 'i',
+    '\u0268': 'i',
+    '\u0131': 'i',
+    '\u24D9': 'j',
+    '\uFF4A': 'j',
+    '\u0135': 'j',
+    '\u01F0': 'j',
+    '\u0249': 'j',
+    '\u24DA': 'k',
+    '\uFF4B': 'k',
+    '\u1E31': 'k',
+    '\u01E9': 'k',
+    '\u1E33': 'k',
+    '\u0137': 'k',
+    '\u1E35': 'k',
+    '\u0199': 'k',
+    '\u2C6A': 'k',
+    '\uA741': 'k',
+    '\uA743': 'k',
+    '\uA745': 'k',
+    '\uA7A3': 'k',
+    '\u24DB': 'l',
+    '\uFF4C': 'l',
+    '\u0140': 'l',
+    '\u013A': 'l',
+    '\u013E': 'l',
+    '\u1E37': 'l',
+    '\u1E39': 'l',
+    '\u013C': 'l',
+    '\u1E3D': 'l',
+    '\u1E3B': 'l',
+    '\u017F': 'l',
+    '\u0142': 'l',
+    '\u019A': 'l',
+    '\u026B': 'l',
+    '\u2C61': 'l',
+    '\uA749': 'l',
+    '\uA781': 'l',
+    '\uA747': 'l',
+    '\u01C9': 'lj',
+    '\u24DC': 'm',
+    '\uFF4D': 'm',
+    '\u1E3F': 'm',
+    '\u1E41': 'm',
+    '\u1E43': 'm',
+    '\u0271': 'm',
+    '\u026F': 'm',
+    '\u24DD': 'n',
+    '\uFF4E': 'n',
+    '\u01F9': 'n',
+    '\u0144': 'n',
+    '\u00F1': 'n',
+    '\u1E45': 'n',
+    '\u0148': 'n',
+    '\u1E47': 'n',
+    '\u0146': 'n',
+    '\u1E4B': 'n',
+    '\u1E49': 'n',
+    '\u019E': 'n',
+    '\u0272': 'n',
+    '\u0149': 'n',
+    '\uA791': 'n',
+    '\uA7A5': 'n',
+    '\u01CC': 'nj',
+    '\u24DE': 'o',
+    '\uFF4F': 'o',
+    '\u00F2': 'o',
+    '\u00F3': 'o',
+    '\u00F4': 'o',
+    '\u1ED3': 'o',
+    '\u1ED1': 'o',
+    '\u1ED7': 'o',
+    '\u1ED5': 'o',
+    '\u00F5': 'o',
+    '\u1E4D': 'o',
+    '\u022D': 'o',
+    '\u1E4F': 'o',
+    '\u014D': 'o',
+    '\u1E51': 'o',
+    '\u1E53': 'o',
+    '\u014F': 'o',
+    '\u022F': 'o',
+    '\u0231': 'o',
+    '\u00F6': 'o',
+    '\u022B': 'o',
+    '\u1ECF': 'o',
+    '\u0151': 'o',
+    '\u01D2': 'o',
+    '\u020D': 'o',
+    '\u020F': 'o',
+    '\u01A1': 'o',
+    '\u1EDD': 'o',
+    '\u1EDB': 'o',
+    '\u1EE1': 'o',
+    '\u1EDF': 'o',
+    '\u1EE3': 'o',
+    '\u1ECD': 'o',
+    '\u1ED9': 'o',
+    '\u01EB': 'o',
+    '\u01ED': 'o',
+    '\u00F8': 'o',
+    '\u01FF': 'o',
+    '\u0254': 'o',
+    '\uA74B': 'o',
+    '\uA74D': 'o',
+    '\u0275': 'o',
+    '\u01A3': 'oi',
+    '\u0223': 'ou',
+    '\uA74F': 'oo',
+    '\u24DF': 'p',
+    '\uFF50': 'p',
+    '\u1E55': 'p',
+    '\u1E57': 'p',
+    '\u01A5': 'p',
+    '\u1D7D': 'p',
+    '\uA751': 'p',
+    '\uA753': 'p',
+    '\uA755': 'p',
+    '\u24E0': 'q',
+    '\uFF51': 'q',
+    '\u024B': 'q',
+    '\uA757': 'q',
+    '\uA759': 'q',
+    '\u24E1': 'r',
+    '\uFF52': 'r',
+    '\u0155': 'r',
+    '\u1E59': 'r',
+    '\u0159': 'r',
+    '\u0211': 'r',
+    '\u0213': 'r',
+    '\u1E5B': 'r',
+    '\u1E5D': 'r',
+    '\u0157': 'r',
+    '\u1E5F': 'r',
+    '\u024D': 'r',
+    '\u027D': 'r',
+    '\uA75B': 'r',
+    '\uA7A7': 'r',
+    '\uA783': 'r',
+    '\u24E2': 's',
+    '\uFF53': 's',
+    '\u00DF': 's',
+    '\u015B': 's',
+    '\u1E65': 's',
+    '\u015D': 's',
+    '\u1E61': 's',
+    '\u0161': 's',
+    '\u1E67': 's',
+    '\u1E63': 's',
+    '\u1E69': 's',
+    '\u0219': 's',
+    '\u015F': 's',
+    '\u023F': 's',
+    '\uA7A9': 's',
+    '\uA785': 's',
+    '\u1E9B': 's',
+    '\u24E3': 't',
+    '\uFF54': 't',
+    '\u1E6B': 't',
+    '\u1E97': 't',
+    '\u0165': 't',
+    '\u1E6D': 't',
+    '\u021B': 't',
+    '\u0163': 't',
+    '\u1E71': 't',
+    '\u1E6F': 't',
+    '\u0167': 't',
+    '\u01AD': 't',
+    '\u0288': 't',
+    '\u2C66': 't',
+    '\uA787': 't',
+    '\uA729': 'tz',
+    '\u24E4': 'u',
+    '\uFF55': 'u',
+    '\u00F9': 'u',
+    '\u00FA': 'u',
+    '\u00FB': 'u',
+    '\u0169': 'u',
+    '\u1E79': 'u',
+    '\u016B': 'u',
+    '\u1E7B': 'u',
+    '\u016D': 'u',
+    '\u00FC': 'u',
+    '\u01DC': 'u',
+    '\u01D8': 'u',
+    '\u01D6': 'u',
+    '\u01DA': 'u',
+    '\u1EE7': 'u',
+    '\u016F': 'u',
+    '\u0171': 'u',
+    '\u01D4': 'u',
+    '\u0215': 'u',
+    '\u0217': 'u',
+    '\u01B0': 'u',
+    '\u1EEB': 'u',
+    '\u1EE9': 'u',
+    '\u1EEF': 'u',
+    '\u1EED': 'u',
+    '\u1EF1': 'u',
+    '\u1EE5': 'u',
+    '\u1E73': 'u',
+    '\u0173': 'u',
+    '\u1E77': 'u',
+    '\u1E75': 'u',
+    '\u0289': 'u',
+    '\u24E5': 'v',
+    '\uFF56': 'v',
+    '\u1E7D': 'v',
+    '\u1E7F': 'v',
+    '\u028B': 'v',
+    '\uA75F': 'v',
+    '\u028C': 'v',
+    '\uA761': 'vy',
+    '\u24E6': 'w',
+    '\uFF57': 'w',
+    '\u1E81': 'w',
+    '\u1E83': 'w',
+    '\u0175': 'w',
+    '\u1E87': 'w',
+    '\u1E85': 'w',
+    '\u1E98': 'w',
+    '\u1E89': 'w',
+    '\u2C73': 'w',
+    '\u24E7': 'x',
+    '\uFF58': 'x',
+    '\u1E8B': 'x',
+    '\u1E8D': 'x',
+    '\u24E8': 'y',
+    '\uFF59': 'y',
+    '\u1EF3': 'y',
+    '\u00FD': 'y',
+    '\u0177': 'y',
+    '\u1EF9': 'y',
+    '\u0233': 'y',
+    '\u1E8F': 'y',
+    '\u00FF': 'y',
+    '\u1EF7': 'y',
+    '\u1E99': 'y',
+    '\u1EF5': 'y',
+    '\u01B4': 'y',
+    '\u024F': 'y',
+    '\u1EFF': 'y',
+    '\u24E9': 'z',
+    '\uFF5A': 'z',
+    '\u017A': 'z',
+    '\u1E91': 'z',
+    '\u017C': 'z',
+    '\u017E': 'z',
+    '\u1E93': 'z',
+    '\u1E95': 'z',
+    '\u01B6': 'z',
+    '\u0225': 'z',
+    '\u0240': 'z',
+    '\u2C6C': 'z',
+    '\uA763': 'z',
+    '\u0386': '\u0391',
+    '\u0388': '\u0395',
+    '\u0389': '\u0397',
+    '\u038A': '\u0399',
+    '\u03AA': '\u0399',
+    '\u038C': '\u039F',
+    '\u038E': '\u03A5',
+    '\u03AB': '\u03A5',
+    '\u038F': '\u03A9',
+    '\u03AC': '\u03B1',
+    '\u03AD': '\u03B5',
+    '\u03AE': '\u03B7',
+    '\u03AF': '\u03B9',
+    '\u03CA': '\u03B9',
+    '\u0390': '\u03B9',
+    '\u03CC': '\u03BF',
+    '\u03CD': '\u03C5',
+    '\u03CB': '\u03C5',
+    '\u03B0': '\u03C5',
+    '\u03C9': '\u03C9',
+    '\u03C2': '\u03C3'
+  };
+
+  return diacritics;
+});
+
+S2.define('select2/data/base',[
+  '../utils'
+], function (Utils) {
+  function BaseAdapter ($element, options) {
+    BaseAdapter.__super__.constructor.call(this);
+  }
+
+  Utils.Extend(BaseAdapter, Utils.Observable);
+
+  BaseAdapter.prototype.current = function (callback) {
+    throw new Error('The `current` method must be defined in child classes.');
+  };
+
+  BaseAdapter.prototype.query = function (params, callback) {
+    throw new Error('The `query` method must be defined in child classes.');
+  };
+
+  BaseAdapter.prototype.bind = function (container, $container) {
+    // Can be implemented in subclasses
+  };
+
+  BaseAdapter.prototype.destroy = function () {
+    // Can be implemented in subclasses
+  };
+
+  BaseAdapter.prototype.generateResultId = function (container, data) {
+    var id = container.id + '-result-';
+
+    id += Utils.generateChars(4);
+
+    if (data.id != null) {
+      id += '-' + data.id.toString();
+    } else {
+      id += '-' + Utils.generateChars(4);
+    }
+    return id;
+  };
+
+  return BaseAdapter;
+});
+
+S2.define('select2/data/select',[
+  './base',
+  '../utils',
+  'jquery'
+], function (BaseAdapter, Utils, $) {
+  function SelectAdapter ($element, options) {
+    this.$element = $element;
+    this.options = options;
+
+    SelectAdapter.__super__.constructor.call(this);
+  }
+
+  Utils.Extend(SelectAdapter, BaseAdapter);
+
+  SelectAdapter.prototype.current = function (callback) {
+    var data = [];
+    var self = this;
+
+    this.$element.find(':selected').each(function () {
+      var $option = $(this);
+
+      var option = self.item($option);
+
+      data.push(option);
+    });
+
+    callback(data);
+  };
+
+  SelectAdapter.prototype.select = function (data) {
+    var self = this;
+
+    data.selected = true;
+
+    // If data.element is a DOM node, use it instead
+    if ($(data.element).is('option')) {
+      data.element.selected = true;
+
+      this.$element.trigger('change');
+
+      return;
+    }
+
+    if (this.$element.prop('multiple')) {
+      this.current(function (currentData) {
+        var val = [];
+
+        data = [data];
+        data.push.apply(data, currentData);
+
+        for (var d = 0; d < data.length; d++) {
+          var id = data[d].id;
+
+          if ($.inArray(id, val) === -1) {
+            val.push(id);
+          }
+        }
+
+        self.$element.val(val);
+        self.$element.trigger('change');
+      });
+    } else {
+      var val = data.id;
+
+      this.$element.val(val);
+      this.$element.trigger('change');
+    }
+  };
+
+  SelectAdapter.prototype.unselect = function (data) {
+    var self = this;
+
+    if (!this.$element.prop('multiple')) {
+      return;
+    }
+
+    data.selected = false;
+
+    if ($(data.element).is('option')) {
+      data.element.selected = false;
+
+      this.$element.trigger('change');
+
+      return;
+    }
+
+    this.current(function (currentData) {
+      var val = [];
+
+      for (var d = 0; d < currentData.length; d++) {
+        var id = currentData[d].id;
+
+        if (id !== data.id && $.inArray(id, val) === -1) {
+          val.push(id);
+        }
+      }
+
+      self.$element.val(val);
+
+      self.$element.trigger('change');
+    });
+  };
+
+  SelectAdapter.prototype.bind = function (container, $container) {
+    var self = this;
+
+    this.container = container;
+
+    container.on('select', function (params) {
+      self.select(params.data);
+    });
+
+    container.on('unselect', function (params) {
+      self.unselect(params.data);
+    });
+  };
+
+  SelectAdapter.prototype.destroy = function () {
+    // Remove anything added to child elements
+    this.$element.find('*').each(function () {
+      // Remove any custom data set by Select2
+      $.removeData(this, 'data');
+    });
+  };
+
+  SelectAdapter.prototype.query = function (params, callback) {
+    var data = [];
+    var self = this;
+
+    var $options = this.$element.children();
+
+    $options.each(function () {
+      var $option = $(this);
+
+      if (!$option.is('option') && !$option.is('optgroup')) {
+        return;
+      }
+
+      var option = self.item($option);
+
+      var matches = self.matches(params, option);
+
+      if (matches !== null) {
+        data.push(matches);
+      }
+    });
+
+    callback({
+      results: data
+    });
+  };
+
+  SelectAdapter.prototype.addOptions = function ($options) {
+    Utils.appendMany(this.$element, $options);
+  };
+
+  SelectAdapter.prototype.option = function (data) {
+    var option;
+
+    if (data.children) {
+      option = document.createElement('optgroup');
+      option.label = data.text;
+    } else {
+      option = document.createElement('option');
+
+      if (option.textContent !== undefined) {
+        option.textContent = data.text;
+      } else {
+        option.innerText = data.text;
+      }
+    }
+
+    if (data.id !== undefined) {
+      option.value = data.id;
+    }
+
+    if (data.disabled) {
+      option.disabled = true;
+    }
+
+    if (data.selected) {
+      option.selected = true;
+    }
+
+    if (data.title) {
+      option.title = data.title;
+    }
+
+    var $option = $(option);
+
+    var normalizedData = this._normalizeItem(data);
+    normalizedData.element = option;
+
+    // Override the option's data with the combined data
+    $.data(option, 'data', normalizedData);
+
+    return $option;
+  };
+
+  SelectAdapter.prototype.item = function ($option) {
+    var data = {};
+
+    data = $.data($option[0], 'data');
+
+    if (data != null) {
+      return data;
+    }
+
+    if ($option.is('option')) {
+      data = {
+        id: $option.val(),
+        text: $option.text(),
+        disabled: $option.prop('disabled'),
+        selected: $option.prop('selected'),
+        title: $option.prop('title')
+      };
+    } else if ($option.is('optgroup')) {
+      data = {
+        text: $option.prop('label'),
+        children: [],
+        title: $option.prop('title')
+      };
+
+      var $children = $option.children('option');
+      var children = [];
+
+      for (var c = 0; c < $children.length; c++) {
+        var $child = $($children[c]);
+
+        var child = this.item($child);
+
+        children.push(child);
+      }
+
+      data.children = children;
+    }
+
+    data = this._normalizeItem(data);
+    data.element = $option[0];
+
+    $.data($option[0], 'data', data);
+
+    return data;
+  };
+
+  SelectAdapter.prototype._normalizeItem = function (item) {
+    if (!$.isPlainObject(item)) {
+      item = {
+        id: item,
+        text: item
+      };
+    }
+
+    item = $.extend({}, {
+      text: ''
+    }, item);
+
+    var defaults = {
+      selected: false,
+      disabled: false
+    };
+
+    if (item.id != null) {
+      item.id = item.id.toString();
+    }
+
+    if (item.text != null) {
+      item.text = item.text.toString();
+    }
+
+    if (item._resultId == null && item.id && this.container != null) {
+      item._resultId = this.generateResultId(this.container, item);
+    }
+
+    return $.extend({}, defaults, item);
+  };
+
+  SelectAdapter.prototype.matches = function (params, data) {
+    var matcher = this.options.get('matcher');
+
+    return matcher(params, data);
+  };
+
+  return SelectAdapter;
+});
+
+S2.define('select2/data/array',[
+  './select',
+  '../utils',
+  'jquery'
+], function (SelectAdapter, Utils, $) {
+  function ArrayAdapter ($element, options) {
+    var data = options.get('data') || [];
+
+    ArrayAdapter.__super__.constructor.call(this, $element, options);
+
+    this.addOptions(this.convertToOptions(data));
+  }
+
+  Utils.Extend(ArrayAdapter, SelectAdapter);
+
+  ArrayAdapter.prototype.select = function (data) {
+    var $option = this.$element.find('option').filter(function (i, elm) {
+      return elm.value == data.id.toString();
+    });
+
+    if ($option.length === 0) {
+      $option = this.option(data);
+
+      this.addOptions($option);
+    }
+
+    ArrayAdapter.__super__.select.call(this, data);
+  };
+
+  ArrayAdapter.prototype.convertToOptions = function (data) {
+    var self = this;
+
+    var $existing = this.$element.find('option');
+    var existingIds = $existing.map(function () {
+      return self.item($(this)).id;
+    }).get();
+
+    var $options = [];
+
+    // Filter out all items except for the one passed in the argument
+    function onlyItem (item) {
+      return function () {
+        return $(this).val() == item.id;
+      };
+    }
+
+    for (var d = 0; d < data.length; d++) {
+      var item = this._normalizeItem(data[d]);
+
+      // Skip items which were pre-loaded, only merge the data
+      if ($.inArray(item.id, existingIds) >= 0) {
+        var $existingOption = $existing.filter(onlyItem(item));
+
+        var existingData = this.item($existingOption);
+        var newData = $.extend(true, {}, item, existingData);
+
+        var $newOption = this.option(newData);
+
+        $existingOption.replaceWith($newOption);
+
+        continue;
+      }
+
+      var $option = this.option(item);
+
+      if (item.children) {
+        var $children = this.convertToOptions(item.children);
+
+        Utils.appendMany($option, $children);
+      }
+
+      $options.push($option);
+    }
+
+    return $options;
+  };
+
+  return ArrayAdapter;
+});
+
+S2.define('select2/data/ajax',[
+  './array',
+  '../utils',
+  'jquery'
+], function (ArrayAdapter, Utils, $) {
+  function AjaxAdapter ($element, options) {
+    this.ajaxOptions = this._applyDefaults(options.get('ajax'));
+
+    if (this.ajaxOptions.processResults != null) {
+      this.processResults = this.ajaxOptions.processResults;
+    }
+
+    AjaxAdapter.__super__.constructor.call(this, $element, options);
+  }
+
+  Utils.Extend(AjaxAdapter, ArrayAdapter);
+
+  AjaxAdapter.prototype._applyDefaults = function (options) {
+    var defaults = {
+      data: function (params) {
+        return $.extend({}, params, {
+          q: params.term
+        });
+      },
+      transport: function (params, success, failure) {
+        var $request = $.ajax(params);
+
+        $request.then(success);
+        $request.fail(failure);
+
+        return $request;
+      }
+    };
+
+    return $.extend({}, defaults, options, true);
+  };
+
+  AjaxAdapter.prototype.processResults = function (results) {
+    return results;
+  };
+
+  AjaxAdapter.prototype.query = function (params, callback) {
+    var matches = [];
+    var self = this;
+
+    if (this._request != null) {
+      // JSONP requests cannot always be aborted
+      if ($.isFunction(this._request.abort)) {
+        this._request.abort();
+      }
+
+      this._request = null;
+    }
+
+    var options = $.extend({
+      type: 'GET'
+    }, this.ajaxOptions);
+
+    if (typeof options.url === 'function') {
+      options.url = options.url.call(this.$element, params);
+    }
+
+    if (typeof options.data === 'function') {
+      options.data = options.data.call(this.$element, params);
+    }
+
+    function request () {
+      var $request = options.transport(options, function (data) {
+        var results = self.processResults(data, params);
+
+        if (self.options.get('debug') && window.console && console.error) {
+          // Check to make sure that the response included a `results` key.
+          if (!results || !results.results || !$.isArray(results.results)) {
+            console.error(
+              'Select2: The AJAX results did not return an array in the ' +
+              '`results` key of the response.'
+            );
+          }
+        }
+
+        callback(results);
+      }, function () {
+        // Attempt to detect if a request was aborted
+        // Only works if the transport exposes a status property
+        if ($request.status && $request.status === '0') {
+          return;
+        }
+
+        self.trigger('results:message', {
+          message: 'errorLoading'
+        });
+      });
+
+      self._request = $request;
+    }
+
+    if (this.ajaxOptions.delay && params.term != null) {
+      if (this._queryTimeout) {
+        window.clearTimeout(this._queryTimeout);
+      }
+
+      this._queryTimeout = window.setTimeout(request, this.ajaxOptions.delay);
+    } else {
+      request();
+    }
+  };
+
+  return AjaxAdapter;
+});
+
+S2.define('select2/data/tags',[
+  'jquery'
+], function ($) {
+  function Tags (decorated, $element, options) {
+    var tags = options.get('tags');
+
+    var createTag = options.get('createTag');
+
+    if (createTag !== undefined) {
+      this.createTag = createTag;
+    }
+
+    var insertTag = options.get('insertTag');
+
+    if (insertTag !== undefined) {
+        this.insertTag = insertTag;
+    }
+
+    decorated.call(this, $element, options);
+
+    if ($.isArray(tags)) {
+      for (var t = 0; t < tags.length; t++) {
+        var tag = tags[t];
+        var item = this._normalizeItem(tag);
+
+        var $option = this.option(item);
+
+        this.$element.append($option);
+      }
+    }
+  }
+
+  Tags.prototype.query = function (decorated, params, callback) {
+    var self = this;
+
+    this._removeOldTags();
+
+    if (params.term == null || params.page != null) {
+      decorated.call(this, params, callback);
+      return;
+    }
+
+    function wrapper (obj, child) {
+      var data = obj.results;
+
+      for (var i = 0; i < data.length; i++) {
+        var option = data[i];
+
+        var checkChildren = (
+          option.children != null &&
+          !wrapper({
+            results: option.children
+          }, true)
+        );
+
+        var optionText = (option.text || '').toUpperCase();
+        var paramsTerm = (params.term || '').toUpperCase();
+
+        var checkText = optionText === paramsTerm;
+
+        if (checkText || checkChildren) {
+          if (child) {
+            return false;
+          }
+
+          obj.data = data;
+          callback(obj);
+
+          return;
+        }
+      }
+
+      if (child) {
+        return true;
+      }
+
+      var tag = self.createTag(params);
+
+      if (tag != null) {
+        var $option = self.option(tag);
+        $option.attr('data-select2-tag', true);
+
+        self.addOptions([$option]);
+
+        self.insertTag(data, tag);
+      }
+
+      obj.results = data;
+
+      callback(obj);
+    }
+
+    decorated.call(this, params, wrapper);
+  };
+
+  Tags.prototype.createTag = function (decorated, params) {
+    var term = $.trim(params.term);
+
+    if (term === '') {
+      return null;
+    }
+
+    return {
+      id: term,
+      text: term
+    };
+  };
+
+  Tags.prototype.insertTag = function (_, data, tag) {
+    data.unshift(tag);
+  };
+
+  Tags.prototype._removeOldTags = function (_) {
+    var tag = this._lastTag;
+
+    var $options = this.$element.find('option[data-select2-tag]');
+
+    $options.each(function () {
+      if (this.selected) {
+        return;
+      }
+
+      $(this).remove();
+    });
+  };
+
+  return Tags;
+});
+
+S2.define('select2/data/tokenizer',[
+  'jquery'
+], function ($) {
+  function Tokenizer (decorated, $element, options) {
+    var tokenizer = options.get('tokenizer');
+
+    if (tokenizer !== undefined) {
+      this.tokenizer = tokenizer;
+    }
+
+    decorated.call(this, $element, options);
+  }
+
+  Tokenizer.prototype.bind = function (decorated, container, $container) {
+    decorated.call(this, container, $container);
+
+    this.$search =  container.dropdown.$search || container.selection.$search ||
+      $container.find('.select2-search__field');
+  };
+
+  Tokenizer.prototype.query = function (decorated, params, callback) {
+    var self = this;
+
+    function createAndSelect (data) {
+      // Normalize the data object so we can use it for checks
+      var item = self._normalizeItem(data);
+
+      // Check if the data object already exists as a tag
+      // Select it if it doesn't
+      var $existingOptions = self.$element.find('option').filter(function () {
+        return $(this).val() === item.id;
+      });
+
+      // If an existing option wasn't found for it, create the option
+      if (!$existingOptions.length) {
+        var $option = self.option(item);
+        $option.attr('data-select2-tag', true);
+
+        self._removeOldTags();
+        self.addOptions([$option]);
+      }
+
+      // Select the item, now that we know there is an option for it
+      select(item);
+    }
+
+    function select (data) {
+      self.trigger('select', {
+        data: data
+      });
+    }
+
+    params.term = params.term || '';
+
+    var tokenData = this.tokenizer(params, this.options, createAndSelect);
+
+    if (tokenData.term !== params.term) {
+      // Replace the search term if we have the search box
+      if (this.$search.length) {
+        this.$search.val(tokenData.term);
+        this.$search.focus();
+      }
+
+      params.term = tokenData.term;
+    }
+
+    decorated.call(this, params, callback);
+  };
+
+  Tokenizer.prototype.tokenizer = function (_, params, options, callback) {
+    var separators = options.get('tokenSeparators') || [];
+    var term = params.term;
+    var i = 0;
+
+    var createTag = this.createTag || function (params) {
+      return {
+        id: params.term,
+        text: params.term
+      };
+    };
+
+    while (i < term.length) {
+      var termChar = term[i];
+
+      if ($.inArray(termChar, separators) === -1) {
+        i++;
+
+        continue;
+      }
+
+      var part = term.substr(0, i);
+      var partParams = $.extend({}, params, {
+        term: part
+      });
+
+      var data = createTag(partParams);
+
+      if (data == null) {
+        i++;
+        continue;
+      }
+
+      callback(data);
+
+      // Reset the term to not include the tokenized portion
+      term = term.substr(i + 1) || '';
+      i = 0;
+    }
+
+    return {
+      term: term
+    };
+  };
+
+  return Tokenizer;
+});
+
+S2.define('select2/data/minimumInputLength',[
+
+], function () {
+  function MinimumInputLength (decorated, $e, options) {
+    this.minimumInputLength = options.get('minimumInputLength');
+
+    decorated.call(this, $e, options);
+  }
+
+  MinimumInputLength.prototype.query = function (decorated, params, callback) {
+    params.term = params.term || '';
+
+    if (params.term.length < this.minimumInputLength) {
+      this.trigger('results:message', {
+        message: 'inputTooShort',
+        args: {
+          minimum: this.minimumInputLength,
+          input: params.term,
+          params: params
+        }
+      });
+
+      return;
+    }
+
+    decorated.call(this, params, callback);
+  };
+
+  return MinimumInputLength;
+});
+
+S2.define('select2/data/maximumInputLength',[
+
+], function () {
+  function MaximumInputLength (decorated, $e, options) {
+    this.maximumInputLength = options.get('maximumInputLength');
+
+    decorated.call(this, $e, options);
+  }
+
+  MaximumInputLength.prototype.query = function (decorated, params, callback) {
+    params.term = params.term || '';
+
+    if (this.maximumInputLength > 0 &&
+        params.term.length > this.maximumInputLength) {
+      this.trigger('results:message', {
+        message: 'inputTooLong',
+        args: {
+          maximum: this.maximumInputLength,
+          input: params.term,
+          params: params
+        }
+      });
+
+      return;
+    }
+
+    decorated.call(this, params, callback);
+  };
+
+  return MaximumInputLength;
+});
+
+S2.define('select2/data/maximumSelectionLength',[
+
+], function (){
+  function MaximumSelectionLength (decorated, $e, options) {
+    this.maximumSelectionLength = options.get('maximumSelectionLength');
+
+    decorated.call(this, $e, options);
+  }
+
+  MaximumSelectionLength.prototype.query =
+    function (decorated, params, callback) {
+      var self = this;
+
+      this.current(function (currentData) {
+        var count = currentData != null ? currentData.length : 0;
+        if (self.maximumSelectionLength > 0 &&
+          count >= self.maximumSelectionLength) {
+          self.trigger('results:message', {
+            message: 'maximumSelected',
+            args: {
+              maximum: self.maximumSelectionLength
+            }
+          });
+          return;
+        }
+        decorated.call(self, params, callback);
+      });
+  };
+
+  return MaximumSelectionLength;
+});
+
+S2.define('select2/dropdown',[
+  'jquery',
+  './utils'
+], function ($, Utils) {
+  function Dropdown ($element, options) {
+    this.$element = $element;
+    this.options = options;
+
+    Dropdown.__super__.constructor.call(this);
+  }
+
+  Utils.Extend(Dropdown, Utils.Observable);
+
+  Dropdown.prototype.render = function () {
+    var $dropdown = $(
+      '<span class="select2-dropdown">' +
+        '<span class="select2-results"></span>' +
+      '</span>'
+    );
+
+    $dropdown.attr('dir', this.options.get('dir'));
+
+    this.$dropdown = $dropdown;
+
+    return $dropdown;
+  };
+
+  Dropdown.prototype.bind = function () {
+    // Should be implemented in subclasses
+  };
+
+  Dropdown.prototype.position = function ($dropdown, $container) {
+    // Should be implmented in subclasses
+  };
+
+  Dropdown.prototype.destroy = function () {
+    // Remove the dropdown from the DOM
+    this.$dropdown.remove();
+  };
+
+  return Dropdown;
+});
+
+S2.define('select2/dropdown/search',[
+  'jquery',
+  '../utils'
+], function ($, Utils) {
+  function Search () { }
+
+  Search.prototype.render = function (decorated) {
+    var $rendered = decorated.call(this);
+
+    var $search = $(
+      '<span class="select2-search select2-search--dropdown">' +
+        '<input class="select2-search__field" type="search" tabindex="-1"' +
+        ' autocomplete="off" autocorrect="off" autocapitalize="off"' +
+        ' spellcheck="false" role="textbox" />' +
+      '</span>'
+    );
+
+    this.$searchContainer = $search;
+    this.$search = $search.find('input');
+
+    $rendered.prepend($search);
+
+    return $rendered;
+  };
+
+  Search.prototype.bind = function (decorated, container, $container) {
+    var self = this;
+
+    decorated.call(this, container, $container);
+
+    this.$search.on('keydown', function (evt) {
+      self.trigger('keypress', evt);
+
+      self._keyUpPrevented = evt.isDefaultPrevented();
+    });
+
+    // Workaround for browsers which do not support the `input` event
+    // This will prevent double-triggering of events for browsers which support
+    // both the `keyup` and `input` events.
+    this.$search.on('input', function (evt) {
+      // Unbind the duplicated `keyup` event
+      $(this).off('keyup');
+    });
+
+    this.$search.on('keyup input', function (evt) {
+      self.handleSearch(evt);
+    });
+
+    container.on('open', function () {
+      self.$search.attr('tabindex', 0);
+
+      self.$search.focus();
+
+      window.setTimeout(function () {
+        self.$search.focus();
+      }, 0);
+    });
+
+    container.on('close', function () {
+      self.$search.attr('tabindex', -1);
+
+      self.$search.val('');
+    });
+
+    container.on('focus', function () {
+      if (!container.isOpen()) {
+        self.$search.focus();
+      }
+    });
+
+    container.on('results:all', function (params) {
+      if (params.query.term == null || params.query.term === '') {
+        var showSearch = self.showSearch(params);
+
+        if (showSearch) {
+          self.$searchContainer.removeClass('select2-search--hide');
+        } else {
+          self.$searchContainer.addClass('select2-search--hide');
+        }
+      }
+    });
+  };
+
+  Search.prototype.handleSearch = function (evt) {
+    if (!this._keyUpPrevented) {
+      var input = this.$search.val();
+
+      this.trigger('query', {
+        term: input
+      });
+    }
+
+    this._keyUpPrevented = false;
+  };
+
+  Search.prototype.showSearch = function (_, params) {
+    return true;
+  };
+
+  return Search;
+});
+
+S2.define('select2/dropdown/hidePlaceholder',[
+
+], function () {
+  function HidePlaceholder (decorated, $element, options, dataAdapter) {
+    this.placeholder = this.normalizePlaceholder(options.get('placeholder'));
+
+    decorated.call(this, $element, options, dataAdapter);
+  }
+
+  HidePlaceholder.prototype.append = function (decorated, data) {
+    data.results = this.removePlaceholder(data.results);
+
+    decorated.call(this, data);
+  };
+
+  HidePlaceholder.prototype.normalizePlaceholder = function (_, placeholder) {
+    if (typeof placeholder === 'string') {
+      placeholder = {
+        id: '',
+        text: placeholder
+      };
+    }
+
+    return placeholder;
+  };
+
+  HidePlaceholder.prototype.removePlaceholder = function (_, data) {
+    var modifiedData = data.slice(0);
+
+    for (var d = data.length - 1; d >= 0; d--) {
+      var item = data[d];
+
+      if (this.placeholder.id === item.id) {
+        modifiedData.splice(d, 1);
+      }
+    }
+
+    return modifiedData;
+  };
+
+  return HidePlaceholder;
+});
+
+S2.define('select2/dropdown/infiniteScroll',[
+  'jquery'
+], function ($) {
+  function InfiniteScroll (decorated, $element, options, dataAdapter) {
+    this.lastParams = {};
+
+    decorated.call(this, $element, options, dataAdapter);
+
+    this.$loadingMore = this.createLoadingMore();
+    this.loading = false;
+  }
+
+  InfiniteScroll.prototype.append = function (decorated, data) {
+    this.$loadingMore.remove();
+    this.loading = false;
+
+    decorated.call(this, data);
+
+    if (this.showLoadingMore(data)) {
+      this.$results.append(this.$loadingMore);
+    }
+  };
+
+  InfiniteScroll.prototype.bind = function (decorated, container, $container) {
+    var self = this;
+
+    decorated.call(this, container, $container);
+
+    container.on('query', function (params) {
+      self.lastParams = params;
+      self.loading = true;
+    });
+
+    container.on('query:append', function (params) {
+      self.lastParams = params;
+      self.loading = true;
+    });
+
+    this.$results.on('scroll', function () {
+      var isLoadMoreVisible = $.contains(
+        document.documentElement,
+        self.$loadingMore[0]
+      );
+
+      if (self.loading || !isLoadMoreVisible) {
+        return;
+      }
+
+      var currentOffset = self.$results.offset().top +
+        self.$results.outerHeight(false);
+      var loadingMoreOffset = self.$loadingMore.offset().top +
+        self.$loadingMore.outerHeight(false);
+
+      if (currentOffset + 50 >= loadingMoreOffset) {
+        self.loadMore();
+      }
+    });
+  };
+
+  InfiniteScroll.prototype.loadMore = function () {
+    this.loading = true;
+
+    var params = $.extend({}, {page: 1}, this.lastParams);
+
+    params.page++;
+
+    this.trigger('query:append', params);
+  };
+
+  InfiniteScroll.prototype.showLoadingMore = function (_, data) {
+    return data.pagination && data.pagination.more;
+  };
+
+  InfiniteScroll.prototype.createLoadingMore = function () {
+    var $option = $(
+      '<li ' +
+      'class="select2-results__option select2-results__option--load-more"' +
+      'role="treeitem" aria-disabled="true"></li>'
+    );
+
+    var message = this.options.get('translations').get('loadingMore');
+
+    $option.html(message(this.lastParams));
+
+    return $option;
+  };
+
+  return InfiniteScroll;
+});
+
+S2.define('select2/dropdown/attachBody',[
+  'jquery',
+  '../utils'
+], function ($, Utils) {
+  function AttachBody (decorated, $element, options) {
+    this.$dropdownParent = options.get('dropdownParent') || $(document.body);
+
+    decorated.call(this, $element, options);
+  }
+
+  AttachBody.prototype.bind = function (decorated, container, $container) {
+    var self = this;
+
+    var setupResultsEvents = false;
+
+    decorated.call(this, container, $container);
+
+    container.on('open', function () {
+      self._showDropdown();
+      self._attachPositioningHandler(container);
+
+      if (!setupResultsEvents) {
+        setupResultsEvents = true;
+
+        container.on('results:all', function () {
+          self._positionDropdown();
+          self._resizeDropdown();
+        });
+
+        container.on('results:append', function () {
+          self._positionDropdown();
+          self._resizeDropdown();
+        });
+      }
+    });
+
+    container.on('close', function () {
+      self._hideDropdown();
+      self._detachPositioningHandler(container);
+    });
+
+    this.$dropdownContainer.on('mousedown', function (evt) {
+      evt.stopPropagation();
+    });
+  };
+
+  AttachBody.prototype.destroy = function (decorated) {
+    decorated.call(this);
+
+    this.$dropdownContainer.remove();
+  };
+
+  AttachBody.prototype.position = function (decorated, $dropdown, $container) {
+    // Clone all of the container classes
+    $dropdown.attr('class', $container.attr('class'));
+
+    $dropdown.removeClass('select2');
+    $dropdown.addClass('select2-container--open');
+
+    $dropdown.css({
+      position: 'absolute',
+      top: -999999
+    });
+
+    this.$container = $container;
+  };
+
+  AttachBody.prototype.render = function (decorated) {
+    var $container = $('<span></span>');
+
+    var $dropdown = decorated.call(this);
+    $container.append($dropdown);
+
+    this.$dropdownContainer = $container;
+
+    return $container;
+  };
+
+  AttachBody.prototype._hideDropdown = function (decorated) {
+    this.$dropdownContainer.detach();
+  };
+
+  AttachBody.prototype._attachPositioningHandler =
+      function (decorated, container) {
+    var self = this;
+
+    var scrollEvent = 'scroll.select2.' + container.id;
+    var resizeEvent = 'resize.select2.' + container.id;
+    var orientationEvent = 'orientationchange.select2.' + container.id;
+
+    var $watchers = this.$container.parents().filter(Utils.hasScroll);
+    $watchers.each(function () {
+      $(this).data('select2-scroll-position', {
+        x: $(this).scrollLeft(),
+        y: $(this).scrollTop()
+      });
+    });
+
+    $watchers.on(scrollEvent, function (ev) {
+      var position = $(this).data('select2-scroll-position');
+      $(this).scrollTop(position.y);
+    });
+
+    $(window).on(scrollEvent + ' ' + resizeEvent + ' ' + orientationEvent,
+      function (e) {
+      self._positionDropdown();
+      self._resizeDropdown();
+    });
+  };
+
+  AttachBody.prototype._detachPositioningHandler =
+      function (decorated, container) {
+    var scrollEvent = 'scroll.select2.' + container.id;
+    var resizeEvent = 'resize.select2.' + container.id;
+    var orientationEvent = 'orientationchange.select2.' + container.id;
+
+    var $watchers = this.$container.parents().filter(Utils.hasScroll);
+    $watchers.off(scrollEvent);
+
+    $(window).off(scrollEvent + ' ' + resizeEvent + ' ' + orientationEvent);
+  };
+
+  AttachBody.prototype._positionDropdown = function () {
+    var $window = $(window);
+
+    var isCurrentlyAbove = this.$dropdown.hasClass('select2-dropdown--above');
+    var isCurrentlyBelow = this.$dropdown.hasClass('select2-dropdown--below');
+
+    var newDirection = null;
+
+    var offset = this.$container.offset();
+
+    offset.bottom = offset.top + this.$container.outerHeight(false);
+
+    var container = {
+      height: this.$container.outerHeight(false)
+    };
+
+    container.top = offset.top;
+    container.bottom = offset.top + container.height;
+
+    var dropdown = {
+      height: this.$dropdown.outerHeight(false)
+    };
+
+    var viewport = {
+      top: $window.scrollTop(),
+      bottom: $window.scrollTop() + $window.height()
+    };
+
+    var enoughRoomAbove = viewport.top < (offset.top - dropdown.height);
+    var enoughRoomBelow = viewport.bottom > (offset.bottom + dropdown.height);
+
+    var css = {
+      left: offset.left,
+      top: container.bottom
+    };
+
+    // Determine what the parent element is to use for calciulating the offset
+    var $offsetParent = this.$dropdownParent;
+
+    // For statically positoned elements, we need to get the element
+    // that is determining the offset
+    if ($offsetParent.css('position') === 'static') {
+      $offsetParent = $offsetParent.offsetParent();
+    }
+
+    var parentOffset = $offsetParent.offset();
+
+    css.top -= parentOffset.top;
+    css.left -= parentOffset.left;
+
+    if (!isCurrentlyAbove && !isCurrentlyBelow) {
+      newDirection = 'below';
+    }
+
+    if (!enoughRoomBelow && enoughRoomAbove && !isCurrentlyAbove) {
+      newDirection = 'above';
+    } else if (!enoughRoomAbove && enoughRoomBelow && isCurrentlyAbove) {
+      newDirection = 'below';
+    }
+
+    if (newDirection == 'above' ||
+      (isCurrentlyAbove && newDirection !== 'below')) {
+      css.top = container.top - parentOffset.top - dropdown.height;
+    }
+
+    if (newDirection != null) {
+      this.$dropdown
+        .removeClass('select2-dropdown--below select2-dropdown--above')
+        .addClass('select2-dropdown--' + newDirection);
+      this.$container
+        .removeClass('select2-container--below select2-container--above')
+        .addClass('select2-container--' + newDirection);
+    }
+
+    this.$dropdownContainer.css(css);
+  };
+
+  AttachBody.prototype._resizeDropdown = function () {
+    var css = {
+      width: this.$container.outerWidth(false) + 'px'
+    };
+
+    if (this.options.get('dropdownAutoWidth')) {
+      css.minWidth = css.width;
+      css.position = 'relative';
+      css.width = 'auto';
+    }
+
+    this.$dropdown.css(css);
+  };
+
+  AttachBody.prototype._showDropdown = function (decorated) {
+    this.$dropdownContainer.appendTo(this.$dropdownParent);
+
+    this._positionDropdown();
+    this._resizeDropdown();
+  };
+
+  return AttachBody;
+});
+
+S2.define('select2/dropdown/minimumResultsForSearch',[
+
+], function () {
+  function countResults (data) {
+    var count = 0;
+
+    for (var d = 0; d < data.length; d++) {
+      var item = data[d];
+
+      if (item.children) {
+        count += countResults(item.children);
+      } else {
+        count++;
+      }
+    }
+
+    return count;
+  }
+
+  function MinimumResultsForSearch (decorated, $element, options, dataAdapter) {
+    this.minimumResultsForSearch = options.get('minimumResultsForSearch');
+
+    if (this.minimumResultsForSearch < 0) {
+      this.minimumResultsForSearch = Infinity;
+    }
+
+    decorated.call(this, $element, options, dataAdapter);
+  }
+
+  MinimumResultsForSearch.prototype.showSearch = function (decorated, params) {
+    if (countResults(params.data.results) < this.minimumResultsForSearch) {
+      return false;
+    }
+
+    return decorated.call(this, params);
+  };
+
+  return MinimumResultsForSearch;
+});
+
+S2.define('select2/dropdown/selectOnClose',[
+
+], function () {
+  function SelectOnClose () { }
+
+  SelectOnClose.prototype.bind = function (decorated, container, $container) {
+    var self = this;
+
+    decorated.call(this, container, $container);
+
+    container.on('close', function (params) {
+      self._handleSelectOnClose(params);
+    });
+  };
+
+  SelectOnClose.prototype._handleSelectOnClose = function (_, params) {
+    if (params && params.originalSelect2Event != null) {
+      var event = params.originalSelect2Event;
+
+      // Don't select an item if the close event was triggered from a select or
+      // unselect event
+      if (event._type === 'select' || event._type === 'unselect') {
+        return;
+      }
+    }
+
+    var $highlightedResults = this.getHighlightedResults();
+
+    // Only select highlighted results
+    if ($highlightedResults.length < 1) {
+      return;
+    }
+
+    var data = $highlightedResults.data('data');
+
+    // Don't re-select already selected resulte
+    if (
+      (data.element != null && data.element.selected) ||
+      (data.element == null && data.selected)
+    ) {
+      return;
+    }
+
+    this.trigger('select', {
+        data: data
+    });
+  };
+
+  return SelectOnClose;
+});
+
+S2.define('select2/dropdown/closeOnSelect',[
+
+], function () {
+  function CloseOnSelect () { }
+
+  CloseOnSelect.prototype.bind = function (decorated, container, $container) {
+    var self = this;
+
+    decorated.call(this, container, $container);
+
+    container.on('select', function (evt) {
+      self._selectTriggered(evt);
+    });
+
+    container.on('unselect', function (evt) {
+      self._selectTriggered(evt);
+    });
+  };
+
+  CloseOnSelect.prototype._selectTriggered = function (_, evt) {
+    var originalEvent = evt.originalEvent;
+
+    // Don't close if the control key is being held
+    if (originalEvent && originalEvent.ctrlKey) {
+      return;
+    }
+
+    this.trigger('close', {
+      originalEvent: originalEvent,
+      originalSelect2Event: evt
+    });
+  };
+
+  return CloseOnSelect;
+});
+
+S2.define('select2/i18n/en',[],function () {
+  // English
+  return {
+    errorLoading: function () {
+      return 'The results could not be loaded.';
+    },
+    inputTooLong: function (args) {
+      var overChars = args.input.length - args.maximum;
+
+      var message = 'Please delete ' + overChars + ' character';
+
+      if (overChars != 1) {
+        message += 's';
+      }
+
+      return message;
+    },
+    inputTooShort: function (args) {
+      var remainingChars = args.minimum - args.input.length;
+
+      var message = 'Please enter ' + remainingChars + ' or more characters';
+
+      return message;
+    },
+    loadingMore: function () {
+      return 'Loading more results…';
+    },
+    maximumSelected: function (args) {
+      var message = 'You can only select ' + args.maximum + ' item';
+
+      if (args.maximum != 1) {
+        message += 's';
+      }
+
+      return message;
+    },
+    noResults: function () {
+      return 'No results found';
+    },
+    searching: function () {
+      return 'Searching…';
+    }
+  };
+});
+
+S2.define('select2/defaults',[
+  'jquery',
+  'require',
+
+  './results',
+
+  './selection/single',
+  './selection/multiple',
+  './selection/placeholder',
+  './selection/allowClear',
+  './selection/search',
+  './selection/eventRelay',
+
+  './utils',
+  './translation',
+  './diacritics',
+
+  './data/select',
+  './data/array',
+  './data/ajax',
+  './data/tags',
+  './data/tokenizer',
+  './data/minimumInputLength',
+  './data/maximumInputLength',
+  './data/maximumSelectionLength',
+
+  './dropdown',
+  './dropdown/search',
+  './dropdown/hidePlaceholder',
+  './dropdown/infiniteScroll',
+  './dropdown/attachBody',
+  './dropdown/minimumResultsForSearch',
+  './dropdown/selectOnClose',
+  './dropdown/closeOnSelect',
+
+  './i18n/en'
+], function ($, require,
+
+             ResultsList,
+
+             SingleSelection, MultipleSelection, Placeholder, AllowClear,
+             SelectionSearch, EventRelay,
+
+             Utils, Translation, DIACRITICS,
+
+             SelectData, ArrayData, AjaxData, Tags, Tokenizer,
+             MinimumInputLength, MaximumInputLength, MaximumSelectionLength,
+
+             Dropdown, DropdownSearch, HidePlaceholder, InfiniteScroll,
+             AttachBody, MinimumResultsForSearch, SelectOnClose, CloseOnSelect,
+
+             EnglishTranslation) {
+  function Defaults () {
+    this.reset();
+  }
+
+  Defaults.prototype.apply = function (options) {
+    options = $.extend(true, {}, this.defaults, options);
+
+    if (options.dataAdapter == null) {
+      if (options.ajax != null) {
+        options.dataAdapter = AjaxData;
+      } else if (options.data != null) {
+        options.dataAdapter = ArrayData;
+      } else {
+        options.dataAdapter = SelectData;
+      }
+
+      if (options.minimumInputLength > 0) {
+        options.dataAdapter = Utils.Decorate(
+          options.dataAdapter,
+          MinimumInputLength
+        );
+      }
+
+      if (options.maximumInputLength > 0) {
+        options.dataAdapter = Utils.Decorate(
+          options.dataAdapter,
+          MaximumInputLength
+        );
+      }
+
+      if (options.maximumSelectionLength > 0) {
+        options.dataAdapter = Utils.Decorate(
+          options.dataAdapter,
+          MaximumSelectionLength
+        );
+      }
+
+      if (options.tags) {
+        options.dataAdapter = Utils.Decorate(options.dataAdapter, Tags);
+      }
+
+      if (options.tokenSeparators != null || options.tokenizer != null) {
+        options.dataAdapter = Utils.Decorate(
+          options.dataAdapter,
+          Tokenizer
+        );
+      }
+
+      if (options.query != null) {
+        var Query = require(options.amdBase + 'compat/query');
+
+        options.dataAdapter = Utils.Decorate(
+          options.dataAdapter,
+          Query
+        );
+      }
+
+      if (options.initSelection != null) {
+        var InitSelection = require(options.amdBase + 'compat/initSelection');
+
+        options.dataAdapter = Utils.Decorate(
+          options.dataAdapter,
+          InitSelection
+        );
+      }
+    }
+
+    if (options.resultsAdapter == null) {
+      options.resultsAdapter = ResultsList;
+
+      if (options.ajax != null) {
+        options.resultsAdapter = Utils.Decorate(
+          options.resultsAdapter,
+          InfiniteScroll
+        );
+      }
+
+      if (options.placeholder != null) {
+        options.resultsAdapter = Utils.Decorate(
+          options.resultsAdapter,
+          HidePlaceholder
+        );
+      }
+
+      if (options.selectOnClose) {
+        options.resultsAdapter = Utils.Decorate(
+          options.resultsAdapter,
+          SelectOnClose
+        );
+      }
+    }
+
+    if (options.dropdownAdapter == null) {
+      if (options.multiple) {
+        options.dropdownAdapter = Dropdown;
+      } else {
+        var SearchableDropdown = Utils.Decorate(Dropdown, DropdownSearch);
+
+        options.dropdownAdapter = SearchableDropdown;
+      }
+
+      if (options.minimumResultsForSearch !== 0) {
+        options.dropdownAdapter = Utils.Decorate(
+          options.dropdownAdapter,
+          MinimumResultsForSearch
+        );
+      }
+
+      if (options.closeOnSelect) {
+        options.dropdownAdapter = Utils.Decorate(
+          options.dropdownAdapter,
+          CloseOnSelect
+        );
+      }
+
+      if (
+        options.dropdownCssClass != null ||
+        options.dropdownCss != null ||
+        options.adaptDropdownCssClass != null
+      ) {
+        var DropdownCSS = require(options.amdBase + 'compat/dropdownCss');
+
+        options.dropdownAdapter = Utils.Decorate(
+          options.dropdownAdapter,
+          DropdownCSS
+        );
+      }
+
+      options.dropdownAdapter = Utils.Decorate(
+        options.dropdownAdapter,
+        AttachBody
+      );
+    }
+
+    if (options.selectionAdapter == null) {
+      if (options.multiple) {
+        options.selectionAdapter = MultipleSelection;
+      } else {
+        options.selectionAdapter = SingleSelection;
+      }
+
+      // Add the placeholder mixin if a placeholder was specified
+      if (options.placeholder != null) {
+        options.selectionAdapter = Utils.Decorate(
+          options.selectionAdapter,
+          Placeholder
+        );
+      }
+
+      if (options.allowClear) {
+        options.selectionAdapter = Utils.Decorate(
+          options.selectionAdapter,
+          AllowClear
+        );
+      }
+
+      if (options.multiple) {
+        options.selectionAdapter = Utils.Decorate(
+          options.selectionAdapter,
+          SelectionSearch
+        );
+      }
+
+      if (
+        options.containerCssClass != null ||
+        options.containerCss != null ||
+        options.adaptContainerCssClass != null
+      ) {
+        var ContainerCSS = require(options.amdBase + 'compat/containerCss');
+
+        options.selectionAdapter = Utils.Decorate(
+          options.selectionAdapter,
+          ContainerCSS
+        );
+      }
+
+      options.selectionAdapter = Utils.Decorate(
+        options.selectionAdapter,
+        EventRelay
+      );
+    }
+
+    if (typeof options.language === 'string') {
+      // Check if the language is specified with a region
+      if (options.language.indexOf('-') > 0) {
+        // Extract the region information if it is included
+        var languageParts = options.language.split('-');
+        var baseLanguage = languageParts[0];
+
+        options.language = [options.language, baseLanguage];
+      } else {
+        options.language = [options.language];
+      }
+    }
+
+    if ($.isArray(options.language)) {
+      var languages = new Translation();
+      options.language.push('en');
+
+      var languageNames = options.language;
+
+      for (var l = 0; l < languageNames.length; l++) {
+        var name = languageNames[l];
+        var language = {};
+
+        try {
+          // Try to load it with the original name
+          language = Translation.loadPath(name);
+        } catch (e) {
+          try {
+            // If we couldn't load it, check if it wasn't the full path
+            name = this.defaults.amdLanguageBase + name;
+            language = Translation.loadPath(name);
+          } catch (ex) {
+            // The translation could not be loaded at all. Sometimes this is
+            // because of a configuration problem, other times this can be
+            // because of how Select2 helps load all possible translation files.
+            if (options.debug && window.console && console.warn) {
+              console.warn(
+                'Select2: The language file for "' + name + '" could not be ' +
+                'automatically loaded. A fallback will be used instead.'
+              );
+            }
+
+            continue;
+          }
+        }
+
+        languages.extend(language);
+      }
+
+      options.translations = languages;
+    } else {
+      var baseTranslation = Translation.loadPath(
+        this.defaults.amdLanguageBase + 'en'
+      );
+      var customTranslation = new Translation(options.language);
+
+      customTranslation.extend(baseTranslation);
+
+      options.translations = customTranslation;
+    }
+
+    return options;
+  };
+
+  Defaults.prototype.reset = function () {
+    function stripDiacritics (text) {
+      // Used 'uni range + named function' from http://jsperf.com/diacritics/18
+      function match(a) {
+        return DIACRITICS[a] || a;
+      }
+
+      return text.replace(/[^\u0000-\u007E]/g, match);
+    }
+
+    function matcher (params, data) {
+      // Always return the object if there is nothing to compare
+      if ($.trim(params.term) === '') {
+        return data;
+      }
+
+      // Do a recursive check for options with children
+      if (data.children && data.children.length > 0) {
+        // Clone the data object if there are children
+        // This is required as we modify the object to remove any non-matches
+        var match = $.extend(true, {}, data);
+
+        // Check each child of the option
+        for (var c = data.children.length - 1; c >= 0; c--) {
+          var child = data.children[c];
+
+          var matches = matcher(params, child);
+
+          // If there wasn't a match, remove the object in the array
+          if (matches == null) {
+            match.children.splice(c, 1);
+          }
+        }
+
+        // If any children matched, return the new object
+        if (match.children.length > 0) {
+          return match;
+        }
+
+        // If there were no matching children, check just the plain object
+        return matcher(params, match);
+      }
+
+      var original = stripDiacritics(data.text).toUpperCase();
+      var term = stripDiacritics(params.term).toUpperCase();
+
+      // Check if the text contains the term
+      if (original.indexOf(term) > -1) {
+        return data;
+      }
+
+      // If it doesn't contain the term, don't return anything
+      return null;
+    }
+
+    this.defaults = {
+      amdBase: './',
+      amdLanguageBase: './i18n/',
+      closeOnSelect: true,
+      debug: false,
+      dropdownAutoWidth: false,
+      escapeMarkup: Utils.escapeMarkup,
+      language: EnglishTranslation,
+      matcher: matcher,
+      minimumInputLength: 0,
+      maximumInputLength: 0,
+      maximumSelectionLength: 0,
+      minimumResultsForSearch: 0,
+      selectOnClose: false,
+      sorter: function (data) {
+        return data;
+      },
+      templateResult: function (result) {
+        return result.text;
+      },
+      templateSelection: function (selection) {
+        return selection.text;
+      },
+      theme: 'default',
+      width: 'resolve'
+    };
+  };
+
+  Defaults.prototype.set = function (key, value) {
+    var camelKey = $.camelCase(key);
+
+    var data = {};
+    data[camelKey] = value;
+
+    var convertedData = Utils._convertData(data);
+
+    $.extend(this.defaults, convertedData);
+  };
+
+  var defaults = new Defaults();
+
+  return defaults;
+});
+
+S2.define('select2/options',[
+  'require',
+  'jquery',
+  './defaults',
+  './utils'
+], function (require, $, Defaults, Utils) {
+  function Options (options, $element) {
+    this.options = options;
+
+    if ($element != null) {
+      this.fromElement($element);
+    }
+
+    this.options = Defaults.apply(this.options);
+
+    if ($element && $element.is('input')) {
+      var InputCompat = require(this.get('amdBase') + 'compat/inputData');
+
+      this.options.dataAdapter = Utils.Decorate(
+        this.options.dataAdapter,
+        InputCompat
+      );
+    }
+  }
+
+  Options.prototype.fromElement = function ($e) {
+    var excludedData = ['select2'];
+
+    if (this.options.multiple == null) {
+      this.options.multiple = $e.prop('multiple');
+    }
+
+    if (this.options.disabled == null) {
+      this.options.disabled = $e.prop('disabled');
+    }
+
+    if (this.options.language == null) {
+      if ($e.prop('lang')) {
+        this.options.language = $e.prop('lang').toLowerCase();
+      } else if ($e.closest('[lang]').prop('lang')) {
+        this.options.language = $e.closest('[lang]').prop('lang');
+      }
+    }
+
+    if (this.options.dir == null) {
+      if ($e.prop('dir')) {
+        this.options.dir = $e.prop('dir');
+      } else if ($e.closest('[dir]').prop('dir')) {
+        this.options.dir = $e.closest('[dir]').prop('dir');
+      } else {
+        this.options.dir = 'ltr';
+      }
+    }
+
+    $e.prop('disabled', this.options.disabled);
+    $e.prop('multiple', this.options.multiple);
+
+    if ($e.data('select2Tags')) {
+      if (this.options.debug && window.console && console.warn) {
+        console.warn(
+          'Select2: The `data-select2-tags` attribute has been changed to ' +
+          'use the `data-data` and `data-tags="true"` attributes and will be ' +
+          'removed in future versions of Select2.'
+        );
+      }
+
+      $e.data('data', $e.data('select2Tags'));
+      $e.data('tags', true);
+    }
+
+    if ($e.data('ajaxUrl')) {
+      if (this.options.debug && window.console && console.warn) {
+        console.warn(
+          'Select2: The `data-ajax-url` attribute has been changed to ' +
+          '`data-ajax--url` and support for the old attribute will be removed' +
+          ' in future versions of Select2.'
+        );
+      }
+
+      $e.attr('ajax--url', $e.data('ajaxUrl'));
+      $e.data('ajax--url', $e.data('ajaxUrl'));
+    }
+
+    var dataset = {};
+
+    // Prefer the element's `dataset` attribute if it exists
+    // jQuery 1.x does not correctly handle data attributes with multiple dashes
+    if ($.fn.jquery && $.fn.jquery.substr(0, 2) == '1.' && $e[0].dataset) {
+      dataset = $.extend(true, {}, $e[0].dataset, $e.data());
+    } else {
+      dataset = $e.data();
+    }
+
+    var data = $.extend(true, {}, dataset);
+
+    data = Utils._convertData(data);
+
+    for (var key in data) {
+      if ($.inArray(key, excludedData) > -1) {
+        continue;
+      }
+
+      if ($.isPlainObject(this.options[key])) {
+        $.extend(this.options[key], data[key]);
+      } else {
+        this.options[key] = data[key];
+      }
+    }
+
+    return this;
+  };
+
+  Options.prototype.get = function (key) {
+    return this.options[key];
+  };
+
+  Options.prototype.set = function (key, val) {
+    this.options[key] = val;
+  };
+
+  return Options;
+});
+
+S2.define('select2/core',[
+  'jquery',
+  './options',
+  './utils',
+  './keys'
+], function ($, Options, Utils, KEYS) {
+  var Select2 = function ($element, options) {
+    if ($element.data('select2') != null) {
+      $element.data('select2').destroy();
+    }
+
+    this.$element = $element;
+
+    this.id = this._generateId($element);
+
+    options = options || {};
+
+    this.options = new Options(options, $element);
+
+    Select2.__super__.constructor.call(this);
+
+    // Set up the tabindex
+
+    var tabindex = $element.attr('tabindex') || 0;
+    $element.data('old-tabindex', tabindex);
+    $element.attr('tabindex', '-1');
+
+    // Set up containers and adapters
+
+    var DataAdapter = this.options.get('dataAdapter');
+    this.dataAdapter = new DataAdapter($element, this.options);
+
+    var $container = this.render();
+
+    this._placeContainer($container);
+
+    var SelectionAdapter = this.options.get('selectionAdapter');
+    this.selection = new SelectionAdapter($element, this.options);
+    this.$selection = this.selection.render();
+
+    this.selection.position(this.$selection, $container);
+
+    var DropdownAdapter = this.options.get('dropdownAdapter');
+    this.dropdown = new DropdownAdapter($element, this.options);
+    this.$dropdown = this.dropdown.render();
+
+    this.dropdown.position(this.$dropdown, $container);
+
+    var ResultsAdapter = this.options.get('resultsAdapter');
+    this.results = new ResultsAdapter($element, this.options, this.dataAdapter);
+    this.$results = this.results.render();
+
+    this.results.position(this.$results, this.$dropdown);
+
+    // Bind events
+
+    var self = this;
+
+    // Bind the container to all of the adapters
+    this._bindAdapters();
+
+    // Register any DOM event handlers
+    this._registerDomEvents();
+
+    // Register any internal event handlers
+    this._registerDataEvents();
+    this._registerSelectionEvents();
+    this._registerDropdownEvents();
+    this._registerResultsEvents();
+    this._registerEvents();
+
+    // Set the initial state
+    this.dataAdapter.current(function (initialData) {
+      self.trigger('selection:update', {
+        data: initialData
+      });
+    });
+
+    // Hide the original select
+    $element.addClass('select2-hidden-accessible');
+    $element.attr('aria-hidden', 'true');
+
+    // Synchronize any monitored attributes
+    this._syncAttributes();
+
+    $element.data('select2', this);
+  };
+
+  Utils.Extend(Select2, Utils.Observable);
+
+  Select2.prototype._generateId = function ($element) {
+    var id = '';
+
+    if ($element.attr('id') != null) {
+      id = $element.attr('id');
+    } else if ($element.attr('name') != null) {
+      id = $element.attr('name') + '-' + Utils.generateChars(2);
+    } else {
+      id = Utils.generateChars(4);
+    }
+
+    id = id.replace(/(:|\.|\[|\]|,)/g, '');
+    id = 'select2-' + id;
+
+    return id;
+  };
+
+  Select2.prototype._placeContainer = function ($container) {
+    $container.insertAfter(this.$element);
+
+    var width = this._resolveWidth(this.$element, this.options.get('width'));
+
+    if (width != null) {
+      $container.css('width', width);
+    }
+  };
+
+  Select2.prototype._resolveWidth = function ($element, method) {
+    var WIDTH = /^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i;
+
+    if (method == 'resolve') {
+      var styleWidth = this._resolveWidth($element, 'style');
+
+      if (styleWidth != null) {
+        return styleWidth;
+      }
+
+      return this._resolveWidth($element, 'element');
+    }
+
+    if (method == 'element') {
+      var elementWidth = $element.outerWidth(false);
+
+      if (elementWidth <= 0) {
+        return 'auto';
+      }
+
+      return elementWidth + 'px';
+    }
+
+    if (method == 'style') {
+      var style = $element.attr('style');
+
+      if (typeof(style) !== 'string') {
+        return null;
+      }
+
+      var attrs = style.split(';');
+
+      for (var i = 0, l = attrs.length; i < l; i = i + 1) {
+        var attr = attrs[i].replace(/\s/g, '');
+        var matches = attr.match(WIDTH);
+
+        if (matches !== null && matches.length >= 1) {
+          return matches[1];
+        }
+      }
+
+      return null;
+    }
+
+    return method;
+  };
+
+  Select2.prototype._bindAdapters = function () {
+    this.dataAdapter.bind(this, this.$container);
+    this.selection.bind(this, this.$container);
+
+    this.dropdown.bind(this, this.$container);
+    this.results.bind(this, this.$container);
+  };
+
+  Select2.prototype._registerDomEvents = function () {
+    var self = this;
+
+    this.$element.on('change.select2', function () {
+      self.dataAdapter.current(function (data) {
+        self.trigger('selection:update', {
+          data: data
+        });
+      });
+    });
+
+    this.$element.on('focus.select2', function (evt) {
+      self.trigger('focus', evt);
+    });
+
+    this._syncA = Utils.bind(this._syncAttributes, this);
+    this._syncS = Utils.bind(this._syncSubtree, this);
+
+    if (this.$element[0].attachEvent) {
+      this.$element[0].attachEvent('onpropertychange', this._syncA);
+    }
+
+    var observer = window.MutationObserver ||
+      window.WebKitMutationObserver ||
+      window.MozMutationObserver
+    ;
+
+    if (observer != null) {
+      this._observer = new observer(function (mutations) {
+        $.each(mutations, self._syncA);
+        $.each(mutations, self._syncS);
+      });
+      this._observer.observe(this.$element[0], {
+        attributes: true,
+        childList: true,
+        subtree: false
+      });
+    } else if (this.$element[0].addEventListener) {
+      this.$element[0].addEventListener(
+        'DOMAttrModified',
+        self._syncA,
+        false
+      );
+      this.$element[0].addEventListener(
+        'DOMNodeInserted',
+        self._syncS,
+        false
+      );
+      this.$element[0].addEventListener(
+        'DOMNodeRemoved',
+        self._syncS,
+        false
+      );
+    }
+  };
+
+  Select2.prototype._registerDataEvents = function () {
+    var self = this;
+
+    this.dataAdapter.on('*', function (name, params) {
+      self.trigger(name, params);
+    });
+  };
+
+  Select2.prototype._registerSelectionEvents = function () {
+    var self = this;
+    var nonRelayEvents = ['toggle', 'focus'];
+
+    this.selection.on('toggle', function () {
+      self.toggleDropdown();
+    });
+
+    this.selection.on('focus', function (params) {
+      self.focus(params);
+    });
+
+    this.selection.on('*', function (name, params) {
+      if ($.inArray(name, nonRelayEvents) !== -1) {
+        return;
+      }
+
+      self.trigger(name, params);
+    });
+  };
+
+  Select2.prototype._registerDropdownEvents = function () {
+    var self = this;
+
+    this.dropdown.on('*', function (name, params) {
+      self.trigger(name, params);
+    });
+  };
+
+  Select2.prototype._registerResultsEvents = function () {
+    var self = this;
+
+    this.results.on('*', function (name, params) {
+      self.trigger(name, params);
+    });
+  };
+
+  Select2.prototype._registerEvents = function () {
+    var self = this;
+
+    this.on('open', function () {
+      self.$container.addClass('select2-container--open');
+    });
+
+    this.on('close', function () {
+      self.$container.removeClass('select2-container--open');
+    });
+
+    this.on('enable', function () {
+      self.$container.removeClass('select2-container--disabled');
+    });
+
+    this.on('disable', function () {
+      self.$container.addClass('select2-container--disabled');
+    });
+
+    this.on('blur', function () {
+      self.$container.removeClass('select2-container--focus');
+    });
+
+    this.on('query', function (params) {
+      if (!self.isOpen()) {
+        self.trigger('open', {});
+      }
+
+      this.dataAdapter.query(params, function (data) {
+        self.trigger('results:all', {
+          data: data,
+          query: params
+        });
+      });
+    });
+
+    this.on('query:append', function (params) {
+      this.dataAdapter.query(params, function (data) {
+        self.trigger('results:append', {
+          data: data,
+          query: params
+        });
+      });
+    });
+
+    this.on('keypress', function (evt) {
+      var key = evt.which;
+
+      if (self.isOpen()) {
+        if (key === KEYS.ESC || key === KEYS.TAB ||
+            (key === KEYS.UP && evt.altKey)) {
+          self.close();
+
+          evt.preventDefault();
+        } else if (key === KEYS.ENTER) {
+          self.trigger('results:select', {});
+
+          evt.preventDefault();
+        } else if ((key === KEYS.SPACE && evt.ctrlKey)) {
+          self.trigger('results:toggle', {});
+
+          evt.preventDefault();
+        } else if (key === KEYS.UP) {
+          self.trigger('results:previous', {});
+
+          evt.preventDefault();
+        } else if (key === KEYS.DOWN) {
+          self.trigger('results:next', {});
+
+          evt.preventDefault();
+        }
+      } else {
+        if (key === KEYS.ENTER || key === KEYS.SPACE ||
+            (key === KEYS.DOWN && evt.altKey)) {
+          self.open();
+
+          evt.preventDefault();
+        }
+      }
+    });
+  };
+
+  Select2.prototype._syncAttributes = function () {
+    this.options.set('disabled', this.$element.prop('disabled'));
+
+    if (this.options.get('disabled')) {
+      if (this.isOpen()) {
+        this.close();
+      }
+
+      this.trigger('disable', {});
+    } else {
+      this.trigger('enable', {});
+    }
+  };
+
+  Select2.prototype._syncSubtree = function (evt, mutations) {
+    var changed = false;
+    var self = this;
+
+    // Ignore any mutation events raised for elements that aren't options or
+    // optgroups. This handles the case when the select element is destroyed
+    if (
+      evt && evt.target && (
+        evt.target.nodeName !== 'OPTION' && evt.target.nodeName !== 'OPTGROUP'
+      )
+    ) {
+      return;
+    }
+
+    if (!mutations) {
+      // If mutation events aren't supported, then we can only assume that the
+      // change affected the selections
+      changed = true;
+    } else if (mutations.addedNodes && mutations.addedNodes.length > 0) {
+      for (var n = 0; n < mutations.addedNodes.length; n++) {
+        var node = mutations.addedNodes[n];
+
+        if (node.selected) {
+          changed = true;
+        }
+      }
+    } else if (mutations.removedNodes && mutations.removedNodes.length > 0) {
+      changed = true;
+    }
+
+    // Only re-pull the data if we think there is a change
+    if (changed) {
+      this.dataAdapter.current(function (currentData) {
+        self.trigger('selection:update', {
+          data: currentData
+        });
+      });
+    }
+  };
+
+  /**
+   * Override the trigger method to automatically trigger pre-events when
+   * there are events that can be prevented.
+   */
+  Select2.prototype.trigger = function (name, args) {
+    var actualTrigger = Select2.__super__.trigger;
+    var preTriggerMap = {
+      'open': 'opening',
+      'close': 'closing',
+      'select': 'selecting',
+      'unselect': 'unselecting'
+    };
+
+    if (args === undefined) {
+      args = {};
+    }
+
+    if (name in preTriggerMap) {
+      var preTriggerName = preTriggerMap[name];
+      var preTriggerArgs = {
+        prevented: false,
+        name: name,
+        args: args
+      };
+
+      actualTrigger.call(this, preTriggerName, preTriggerArgs);
+
+      if (preTriggerArgs.prevented) {
+        args.prevented = true;
+
+        return;
+      }
+    }
+
+    actualTrigger.call(this, name, args);
+  };
+
+  Select2.prototype.toggleDropdown = function () {
+    if (this.options.get('disabled')) {
+      return;
+    }
+
+    if (this.isOpen()) {
+      this.close();
+    } else {
+      this.open();
+    }
+  };
+
+  Select2.prototype.open = function () {
+    if (this.isOpen()) {
+      return;
+    }
+
+    this.trigger('query', {});
+  };
+
+  Select2.prototype.close = function () {
+    if (!this.isOpen()) {
+      return;
+    }
+
+    this.trigger('close', {});
+  };
+
+  Select2.prototype.isOpen = function () {
+    return this.$container.hasClass('select2-container--open');
+  };
+
+  Select2.prototype.hasFocus = function () {
+    return this.$container.hasClass('select2-container--focus');
+  };
+
+  Select2.prototype.focus = function (data) {
+    // No need to re-trigger focus events if we are already focused
+    if (this.hasFocus()) {
+      return;
+    }
+
+    this.$container.addClass('select2-container--focus');
+    this.trigger('focus', {});
+  };
+
+  Select2.prototype.enable = function (args) {
+    if (this.options.get('debug') && window.console && console.warn) {
+      console.warn(
+        'Select2: The `select2("enable")` method has been deprecated and will' +
+        ' be removed in later Select2 versions. Use $element.prop("disabled")' +
+        ' instead.'
+      );
+    }
+
+    if (args == null || args.length === 0) {
+      args = [true];
+    }
+
+    var disabled = !args[0];
+
+    this.$element.prop('disabled', disabled);
+  };
+
+  Select2.prototype.data = function () {
+    if (this.options.get('debug') &&
+        arguments.length > 0 && window.console && console.warn) {
+      console.warn(
+        'Select2: Data can no longer be set using `select2("data")`. You ' +
+        'should consider setting the value instead using `$element.val()`.'
+      );
+    }
+
+    var data = [];
+
+    this.dataAdapter.current(function (currentData) {
+      data = currentData;
+    });
+
+    return data;
+  };
+
+  Select2.prototype.val = function (args) {
+    if (this.options.get('debug') && window.console && console.warn) {
+      console.warn(
+        'Select2: The `select2("val")` method has been deprecated and will be' +
+        ' removed in later Select2 versions. Use $element.val() instead.'
+      );
+    }
+
+    if (args == null || args.length === 0) {
+      return this.$element.val();
+    }
+
+    var newVal = args[0];
+
+    if ($.isArray(newVal)) {
+      newVal = $.map(newVal, function (obj) {
+        return obj.toString();
+      });
+    }
+
+    this.$element.val(newVal).trigger('change');
+  };
+
+  Select2.prototype.destroy = function () {
+    this.$container.remove();
+
+    if (this.$element[0].detachEvent) {
+      this.$element[0].detachEvent('onpropertychange', this._syncA);
+    }
+
+    if (this._observer != null) {
+      this._observer.disconnect();
+      this._observer = null;
+    } else if (this.$element[0].removeEventListener) {
+      this.$element[0]
+        .removeEventListener('DOMAttrModified', this._syncA, false);
+      this.$element[0]
+        .removeEventListener('DOMNodeInserted', this._syncS, false);
+      this.$element[0]
+        .removeEventListener('DOMNodeRemoved', this._syncS, false);
+    }
+
+    this._syncA = null;
+    this._syncS = null;
+
+    this.$element.off('.select2');
+    this.$element.attr('tabindex', this.$element.data('old-tabindex'));
+
+    this.$element.removeClass('select2-hidden-accessible');
+    this.$element.attr('aria-hidden', 'false');
+    this.$element.removeData('select2');
+
+    this.dataAdapter.destroy();
+    this.selection.destroy();
+    this.dropdown.destroy();
+    this.results.destroy();
+
+    this.dataAdapter = null;
+    this.selection = null;
+    this.dropdown = null;
+    this.results = null;
+  };
+
+  Select2.prototype.render = function () {
+    var $container = $(
+      '<span class="select2 select2-container">' +
+        '<span class="selection"></span>' +
+        '<span class="dropdown-wrapper" aria-hidden="true"></span>' +
+      '</span>'
+    );
+
+    $container.attr('dir', this.options.get('dir'));
+
+    this.$container = $container;
+
+    this.$container.addClass('select2-container--' + this.options.get('theme'));
+
+    $container.data('element', this.$element);
+
+    return $container;
+  };
+
+  return Select2;
+});
+
+S2.define('jquery-mousewheel',[
+  'jquery'
+], function ($) {
+  // Used to shim jQuery.mousewheel for non-full builds.
+  return $;
+});
+
+S2.define('jquery.select2',[
+  'jquery',
+  'jquery-mousewheel',
+
+  './select2/core',
+  './select2/defaults'
+], function ($, _, Select2, Defaults) {
+  if ($.fn.select2 == null) {
+    // All methods that should return the element
+    var thisMethods = ['open', 'close', 'destroy'];
+
+    $.fn.select2 = function (options) {
+      options = options || {};
+
+      if (typeof options === 'object') {
+        this.each(function () {
+          var instanceOptions = $.extend(true, {}, options);
+
+          var instance = new Select2($(this), instanceOptions);
+        });
+
+        return this;
+      } else if (typeof options === 'string') {
+        var ret;
+        var args = Array.prototype.slice.call(arguments, 1);
+
+        this.each(function () {
+          var instance = $(this).data('select2');
+
+          if (instance == null && window.console && console.error) {
+            console.error(
+              'The select2(\'' + options + '\') method was called on an ' +
+              'element that is not using Select2.'
+            );
+          }
+
+          ret = instance[options].apply(instance, args);
+        });
+
+        // Check if we should be returning `this`
+        if ($.inArray(options, thisMethods) > -1) {
+          return this;
+        }
+
+        return ret;
+      } else {
+        throw new Error('Invalid arguments for Select2: ' + options);
+      }
+    };
+  }
+
+  if ($.fn.select2.defaults == null) {
+    $.fn.select2.defaults = Defaults;
+  }
+
+  return Select2;
+});
+
+  // Return the AMD loader configuration so it can be used outside of this file
+  return {
+    define: S2.define,
+    require: S2.require
+  };
+}());
+
+  // Autoload the jQuery bindings
+  // We know that all of the modules exist above this, so we're safe
+  var select2 = S2.require('jquery.select2');
+
+  // Hold the AMD module references on the jQuery function that was just loaded
+  // This allows Select2 to use the internal loader outside of this file, such
+  // as in the language files.
+  jQuery.fn.select2.amd = S2;
+
+  // Return the Select2 instance for anyone who is importing it.
+  return select2;
+}));
diff --git a/htdocs/includes/jquery/plugins/select2/dist/js/select2.min.js b/htdocs/includes/jquery/plugins/select2/dist/js/select2.min.js
new file mode 100644
index 00000000000..991b8fcd791
--- /dev/null
+++ b/htdocs/includes/jquery/plugins/select2/dist/js/select2.min.js
@@ -0,0 +1 @@
+/*! Select2 4.0.4 | https://github.com/select2/select2/blob/master/LICENSE.md */!function(a){"function"==typeof define&&define.amd?define(["jquery"],a):"object"==typeof module&&module.exports?module.exports=function(b,c){return void 0===c&&(c="undefined"!=typeof window?require("jquery"):require("jquery")(b)),a(c),c}:a(jQuery)}(function(a){var b=function(){if(a&&a.fn&&a.fn.select2&&a.fn.select2.amd)var b=a.fn.select2.amd;var b;return function(){if(!b||!b.requirejs){b?c=b:b={};var a,c,d;!function(b){function e(a,b){return v.call(a,b)}function f(a,b){var c,d,e,f,g,h,i,j,k,l,m,n,o=b&&b.split("/"),p=t.map,q=p&&p["*"]||{};if(a){for(a=a.split("/"),g=a.length-1,t.nodeIdCompat&&x.test(a[g])&&(a[g]=a[g].replace(x,"")),"."===a[0].charAt(0)&&o&&(n=o.slice(0,o.length-1),a=n.concat(a)),k=0;k<a.length;k++)if("."===(m=a[k]))a.splice(k,1),k-=1;else if(".."===m){if(0===k||1===k&&".."===a[2]||".."===a[k-1])continue;k>0&&(a.splice(k-1,2),k-=2)}a=a.join("/")}if((o||q)&&p){for(c=a.split("/"),k=c.length;k>0;k-=1){if(d=c.slice(0,k).join("/"),o)for(l=o.length;l>0;l-=1)if((e=p[o.slice(0,l).join("/")])&&(e=e[d])){f=e,h=k;break}if(f)break;!i&&q&&q[d]&&(i=q[d],j=k)}!f&&i&&(f=i,h=j),f&&(c.splice(0,h,f),a=c.join("/"))}return a}function g(a,c){return function(){var d=w.call(arguments,0);return"string"!=typeof d[0]&&1===d.length&&d.push(null),o.apply(b,d.concat([a,c]))}}function h(a){return function(b){return f(b,a)}}function i(a){return function(b){r[a]=b}}function j(a){if(e(s,a)){var c=s[a];delete s[a],u[a]=!0,n.apply(b,c)}if(!e(r,a)&&!e(u,a))throw new Error("No "+a);return r[a]}function k(a){var b,c=a?a.indexOf("!"):-1;return c>-1&&(b=a.substring(0,c),a=a.substring(c+1,a.length)),[b,a]}function l(a){return a?k(a):[]}function m(a){return function(){return t&&t.config&&t.config[a]||{}}}var n,o,p,q,r={},s={},t={},u={},v=Object.prototype.hasOwnProperty,w=[].slice,x=/\.js$/;p=function(a,b){var c,d=k(a),e=d[0],g=b[1];return a=d[1],e&&(e=f(e,g),c=j(e)),e?a=c&&c.normalize?c.normalize(a,h(g)):f(a,g):(a=f(a,g),d=k(a),e=d[0],a=d[1],e&&(c=j(e))),{f:e?e+"!"+a:a,n:a,pr:e,p:c}},q={require:function(a){return g(a)},exports:function(a){var b=r[a];return void 0!==b?b:r[a]={}},module:function(a){return{id:a,uri:"",exports:r[a],config:m(a)}}},n=function(a,c,d,f){var h,k,m,n,o,t,v,w=[],x=typeof d;if(f=f||a,t=l(f),"undefined"===x||"function"===x){for(c=!c.length&&d.length?["require","exports","module"]:c,o=0;o<c.length;o+=1)if(n=p(c[o],t),"require"===(k=n.f))w[o]=q.require(a);else if("exports"===k)w[o]=q.exports(a),v=!0;else if("module"===k)h=w[o]=q.module(a);else if(e(r,k)||e(s,k)||e(u,k))w[o]=j(k);else{if(!n.p)throw new Error(a+" missing "+k);n.p.load(n.n,g(f,!0),i(k),{}),w[o]=r[k]}m=d?d.apply(r[a],w):void 0,a&&(h&&h.exports!==b&&h.exports!==r[a]?r[a]=h.exports:m===b&&v||(r[a]=m))}else a&&(r[a]=d)},a=c=o=function(a,c,d,e,f){if("string"==typeof a)return q[a]?q[a](c):j(p(a,l(c)).f);if(!a.splice){if(t=a,t.deps&&o(t.deps,t.callback),!c)return;c.splice?(a=c,c=d,d=null):a=b}return c=c||function(){},"function"==typeof d&&(d=e,e=f),e?n(b,a,c,d):setTimeout(function(){n(b,a,c,d)},4),o},o.config=function(a){return o(a)},a._defined=r,d=function(a,b,c){if("string"!=typeof a)throw new Error("See almond README: incorrect module build, no module name");b.splice||(c=b,b=[]),e(r,a)||e(s,a)||(s[a]=[a,b,c])},d.amd={jQuery:!0}}(),b.requirejs=a,b.require=c,b.define=d}}(),b.define("almond",function(){}),b.define("jquery",[],function(){var b=a||$;return null==b&&console&&console.error&&console.error("Select2: An instance of jQuery or a jQuery-compatible library was not found. Make sure that you are including jQuery before Select2 on your web page."),b}),b.define("select2/utils",["jquery"],function(a){function b(a){var b=a.prototype,c=[];for(var d in b){"function"==typeof b[d]&&("constructor"!==d&&c.push(d))}return c}var c={};c.Extend=function(a,b){function c(){this.constructor=a}var d={}.hasOwnProperty;for(var e in b)d.call(b,e)&&(a[e]=b[e]);return c.prototype=b.prototype,a.prototype=new c,a.__super__=b.prototype,a},c.Decorate=function(a,c){function d(){var b=Array.prototype.unshift,d=c.prototype.constructor.length,e=a.prototype.constructor;d>0&&(b.call(arguments,a.prototype.constructor),e=c.prototype.constructor),e.apply(this,arguments)}function e(){this.constructor=d}var f=b(c),g=b(a);c.displayName=a.displayName,d.prototype=new e;for(var h=0;h<g.length;h++){var i=g[h];d.prototype[i]=a.prototype[i]}for(var j=(function(a){var b=function(){};a in d.prototype&&(b=d.prototype[a]);var e=c.prototype[a];return function(){return Array.prototype.unshift.call(arguments,b),e.apply(this,arguments)}}),k=0;k<f.length;k++){var l=f[k];d.prototype[l]=j(l)}return d};var d=function(){this.listeners={}};return d.prototype.on=function(a,b){this.listeners=this.listeners||{},a in this.listeners?this.listeners[a].push(b):this.listeners[a]=[b]},d.prototype.trigger=function(a){var b=Array.prototype.slice,c=b.call(arguments,1);this.listeners=this.listeners||{},null==c&&(c=[]),0===c.length&&c.push({}),c[0]._type=a,a in this.listeners&&this.invoke(this.listeners[a],b.call(arguments,1)),"*"in this.listeners&&this.invoke(this.listeners["*"],arguments)},d.prototype.invoke=function(a,b){for(var c=0,d=a.length;c<d;c++)a[c].apply(this,b)},c.Observable=d,c.generateChars=function(a){for(var b="",c=0;c<a;c++){b+=Math.floor(36*Math.random()).toString(36)}return b},c.bind=function(a,b){return function(){a.apply(b,arguments)}},c._convertData=function(a){for(var b in a){var c=b.split("-"),d=a;if(1!==c.length){for(var e=0;e<c.length;e++){var f=c[e];f=f.substring(0,1).toLowerCase()+f.substring(1),f in d||(d[f]={}),e==c.length-1&&(d[f]=a[b]),d=d[f]}delete a[b]}}return a},c.hasScroll=function(b,c){var d=a(c),e=c.style.overflowX,f=c.style.overflowY;return(e!==f||"hidden"!==f&&"visible"!==f)&&("scroll"===e||"scroll"===f||(d.innerHeight()<c.scrollHeight||d.innerWidth()<c.scrollWidth))},c.escapeMarkup=function(a){var b={"\\":"&#92;","&":"&amp;","<":"&lt;",">":"&gt;",'"':"&quot;","'":"&#39;","/":"&#47;"};return"string"!=typeof a?a:String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})},c.appendMany=function(b,c){if("1.7"===a.fn.jquery.substr(0,3)){var d=a();a.map(c,function(a){d=d.add(a)}),c=d}b.append(c)},c}),b.define("select2/results",["jquery","./utils"],function(a,b){function c(a,b,d){this.$element=a,this.data=d,this.options=b,c.__super__.constructor.call(this)}return b.Extend(c,b.Observable),c.prototype.render=function(){var b=a('<ul class="select2-results__options" role="tree"></ul>');return this.options.get("multiple")&&b.attr("aria-multiselectable","true"),this.$results=b,b},c.prototype.clear=function(){this.$results.empty()},c.prototype.displayMessage=function(b){var c=this.options.get("escapeMarkup");this.clear(),this.hideLoading();var d=a('<li role="treeitem" aria-live="assertive" class="select2-results__option"></li>'),e=this.options.get("translations").get(b.message);d.append(c(e(b.args))),d[0].className+=" select2-results__message",this.$results.append(d)},c.prototype.hideMessages=function(){this.$results.find(".select2-results__message").remove()},c.prototype.append=function(a){this.hideLoading();var b=[];if(null==a.results||0===a.results.length)return void(0===this.$results.children().length&&this.trigger("results:message",{message:"noResults"}));a.results=this.sort(a.results);for(var c=0;c<a.results.length;c++){var d=a.results[c],e=this.option(d);b.push(e)}this.$results.append(b)},c.prototype.position=function(a,b){b.find(".select2-results").append(a)},c.prototype.sort=function(a){return this.options.get("sorter")(a)},c.prototype.highlightFirstItem=function(){var a=this.$results.find(".select2-results__option[aria-selected]"),b=a.filter("[aria-selected=true]");b.length>0?b.first().trigger("mouseenter"):a.first().trigger("mouseenter"),this.ensureHighlightVisible()},c.prototype.setClasses=function(){var b=this;this.data.current(function(c){var d=a.map(c,function(a){return a.id.toString()});b.$results.find(".select2-results__option[aria-selected]").each(function(){var b=a(this),c=a.data(this,"data"),e=""+c.id;null!=c.element&&c.element.selected||null==c.element&&a.inArray(e,d)>-1?b.attr("aria-selected","true"):b.attr("aria-selected","false")})})},c.prototype.showLoading=function(a){this.hideLoading();var b=this.options.get("translations").get("searching"),c={disabled:!0,loading:!0,text:b(a)},d=this.option(c);d.className+=" loading-results",this.$results.prepend(d)},c.prototype.hideLoading=function(){this.$results.find(".loading-results").remove()},c.prototype.option=function(b){var c=document.createElement("li");c.className="select2-results__option";var d={role:"treeitem","aria-selected":"false"};b.disabled&&(delete d["aria-selected"],d["aria-disabled"]="true"),null==b.id&&delete d["aria-selected"],null!=b._resultId&&(c.id=b._resultId),b.title&&(c.title=b.title),b.children&&(d.role="group",d["aria-label"]=b.text,delete d["aria-selected"]);for(var e in d){var f=d[e];c.setAttribute(e,f)}if(b.children){var g=a(c),h=document.createElement("strong");h.className="select2-results__group";a(h);this.template(b,h);for(var i=[],j=0;j<b.children.length;j++){var k=b.children[j],l=this.option(k);i.push(l)}var m=a("<ul></ul>",{class:"select2-results__options select2-results__options--nested"});m.append(i),g.append(h),g.append(m)}else this.template(b,c);return a.data(c,"data",b),c},c.prototype.bind=function(b,c){var d=this,e=b.id+"-results";this.$results.attr("id",e),b.on("results:all",function(a){d.clear(),d.append(a.data),b.isOpen()&&(d.setClasses(),d.highlightFirstItem())}),b.on("results:append",function(a){d.append(a.data),b.isOpen()&&d.setClasses()}),b.on("query",function(a){d.hideMessages(),d.showLoading(a)}),b.on("select",function(){b.isOpen()&&(d.setClasses(),d.highlightFirstItem())}),b.on("unselect",function(){b.isOpen()&&(d.setClasses(),d.highlightFirstItem())}),b.on("open",function(){d.$results.attr("aria-expanded","true"),d.$results.attr("aria-hidden","false"),d.setClasses(),d.ensureHighlightVisible()}),b.on("close",function(){d.$results.attr("aria-expanded","false"),d.$results.attr("aria-hidden","true"),d.$results.removeAttr("aria-activedescendant")}),b.on("results:toggle",function(){var a=d.getHighlightedResults();0!==a.length&&a.trigger("mouseup")}),b.on("results:select",function(){var a=d.getHighlightedResults();if(0!==a.length){var b=a.data("data");"true"==a.attr("aria-selected")?d.trigger("close",{}):d.trigger("select",{data:b})}}),b.on("results:previous",function(){var a=d.getHighlightedResults(),b=d.$results.find("[aria-selected]"),c=b.index(a);if(0!==c){var e=c-1;0===a.length&&(e=0);var f=b.eq(e);f.trigger("mouseenter");var g=d.$results.offset().top,h=f.offset().top,i=d.$results.scrollTop()+(h-g);0===e?d.$results.scrollTop(0):h-g<0&&d.$results.scrollTop(i)}}),b.on("results:next",function(){var a=d.getHighlightedResults(),b=d.$results.find("[aria-selected]"),c=b.index(a),e=c+1;if(!(e>=b.length)){var f=b.eq(e);f.trigger("mouseenter");var g=d.$results.offset().top+d.$results.outerHeight(!1),h=f.offset().top+f.outerHeight(!1),i=d.$results.scrollTop()+h-g;0===e?d.$results.scrollTop(0):h>g&&d.$results.scrollTop(i)}}),b.on("results:focus",function(a){a.element.addClass("select2-results__option--highlighted")}),b.on("results:message",function(a){d.displayMessage(a)}),a.fn.mousewheel&&this.$results.on("mousewheel",function(a){var b=d.$results.scrollTop(),c=d.$results.get(0).scrollHeight-b+a.deltaY,e=a.deltaY>0&&b-a.deltaY<=0,f=a.deltaY<0&&c<=d.$results.height();e?(d.$results.scrollTop(0),a.preventDefault(),a.stopPropagation()):f&&(d.$results.scrollTop(d.$results.get(0).scrollHeight-d.$results.height()),a.preventDefault(),a.stopPropagation())}),this.$results.on("mouseup",".select2-results__option[aria-selected]",function(b){var c=a(this),e=c.data("data");if("true"===c.attr("aria-selected"))return void(d.options.get("multiple")?d.trigger("unselect",{originalEvent:b,data:e}):d.trigger("close",{}));d.trigger("select",{originalEvent:b,data:e})}),this.$results.on("mouseenter",".select2-results__option[aria-selected]",function(b){var c=a(this).data("data");d.getHighlightedResults().removeClass("select2-results__option--highlighted"),d.trigger("results:focus",{data:c,element:a(this)})})},c.prototype.getHighlightedResults=function(){return this.$results.find(".select2-results__option--highlighted")},c.prototype.destroy=function(){this.$results.remove()},c.prototype.ensureHighlightVisible=function(){var a=this.getHighlightedResults();if(0!==a.length){var b=this.$results.find("[aria-selected]"),c=b.index(a),d=this.$results.offset().top,e=a.offset().top,f=this.$results.scrollTop()+(e-d),g=e-d;f-=2*a.outerHeight(!1),c<=2?this.$results.scrollTop(0):(g>this.$results.outerHeight()||g<0)&&this.$results.scrollTop(f)}},c.prototype.template=function(b,c){var d=this.options.get("templateResult"),e=this.options.get("escapeMarkup"),f=d(b,c);null==f?c.style.display="none":"string"==typeof f?c.innerHTML=e(f):a(c).append(f)},c}),b.define("select2/keys",[],function(){return{BACKSPACE:8,TAB:9,ENTER:13,SHIFT:16,CTRL:17,ALT:18,ESC:27,SPACE:32,PAGE_UP:33,PAGE_DOWN:34,END:35,HOME:36,LEFT:37,UP:38,RIGHT:39,DOWN:40,DELETE:46}}),b.define("select2/selection/base",["jquery","../utils","../keys"],function(a,b,c){function d(a,b){this.$element=a,this.options=b,d.__super__.constructor.call(this)}return b.Extend(d,b.Observable),d.prototype.render=function(){var b=a('<span class="select2-selection" role="combobox"  aria-haspopup="true" aria-expanded="false"></span>');return this._tabindex=0,null!=this.$element.data("old-tabindex")?this._tabindex=this.$element.data("old-tabindex"):null!=this.$element.attr("tabindex")&&(this._tabindex=this.$element.attr("tabindex")),b.attr("title",this.$element.attr("title")),b.attr("tabindex",this._tabindex),this.$selection=b,b},d.prototype.bind=function(a,b){var d=this,e=(a.id,a.id+"-results");this.container=a,this.$selection.on("focus",function(a){d.trigger("focus",a)}),this.$selection.on("blur",function(a){d._handleBlur(a)}),this.$selection.on("keydown",function(a){d.trigger("keypress",a),a.which===c.SPACE&&a.preventDefault()}),a.on("results:focus",function(a){d.$selection.attr("aria-activedescendant",a.data._resultId)}),a.on("selection:update",function(a){d.update(a.data)}),a.on("open",function(){d.$selection.attr("aria-expanded","true"),d.$selection.attr("aria-owns",e),d._attachCloseHandler(a)}),a.on("close",function(){d.$selection.attr("aria-expanded","false"),d.$selection.removeAttr("aria-activedescendant"),d.$selection.removeAttr("aria-owns"),d.$selection.focus(),d._detachCloseHandler(a)}),a.on("enable",function(){d.$selection.attr("tabindex",d._tabindex)}),a.on("disable",function(){d.$selection.attr("tabindex","-1")})},d.prototype._handleBlur=function(b){var c=this;window.setTimeout(function(){document.activeElement==c.$selection[0]||a.contains(c.$selection[0],document.activeElement)||c.trigger("blur",b)},1)},d.prototype._attachCloseHandler=function(b){a(document.body).on("mousedown.select2."+b.id,function(b){var c=a(b.target),d=c.closest(".select2");a(".select2.select2-container--open").each(function(){var b=a(this);this!=d[0]&&b.data("element").select2("close")})})},d.prototype._detachCloseHandler=function(b){a(document.body).off("mousedown.select2."+b.id)},d.prototype.position=function(a,b){b.find(".selection").append(a)},d.prototype.destroy=function(){this._detachCloseHandler(this.container)},d.prototype.update=function(a){throw new Error("The `update` method must be defined in child classes.")},d}),b.define("select2/selection/single",["jquery","./base","../utils","../keys"],function(a,b,c,d){function e(){e.__super__.constructor.apply(this,arguments)}return c.Extend(e,b),e.prototype.render=function(){var a=e.__super__.render.call(this);return a.addClass("select2-selection--single"),a.html('<span class="select2-selection__rendered"></span><span class="select2-selection__arrow" role="presentation"><b role="presentation"></b></span>'),a},e.prototype.bind=function(a,b){var c=this;e.__super__.bind.apply(this,arguments);var d=a.id+"-container";this.$selection.find(".select2-selection__rendered").attr("id",d),this.$selection.attr("aria-labelledby",d),this.$selection.on("mousedown",function(a){1===a.which&&c.trigger("toggle",{originalEvent:a})}),this.$selection.on("focus",function(a){}),this.$selection.on("blur",function(a){}),a.on("focus",function(b){a.isOpen()||c.$selection.focus()}),a.on("selection:update",function(a){c.update(a.data)})},e.prototype.clear=function(){this.$selection.find(".select2-selection__rendered").empty()},e.prototype.display=function(a,b){var c=this.options.get("templateSelection");return this.options.get("escapeMarkup")(c(a,b))},e.prototype.selectionContainer=function(){return a("<span></span>")},e.prototype.update=function(a){if(0===a.length)return void this.clear();var b=a[0],c=this.$selection.find(".select2-selection__rendered"),d=this.display(b,c);c.empty().append(d),c.prop("title",b.title||b.text)},e}),b.define("select2/selection/multiple",["jquery","./base","../utils"],function(a,b,c){function d(a,b){d.__super__.constructor.apply(this,arguments)}return c.Extend(d,b),d.prototype.render=function(){var a=d.__super__.render.call(this);return a.addClass("select2-selection--multiple"),a.html('<ul class="select2-selection__rendered"></ul>'),a},d.prototype.bind=function(b,c){var e=this;d.__super__.bind.apply(this,arguments),this.$selection.on("click",function(a){e.trigger("toggle",{originalEvent:a})}),this.$selection.on("click",".select2-selection__choice__remove",function(b){if(!e.options.get("disabled")){var c=a(this),d=c.parent(),f=d.data("data");e.trigger("unselect",{originalEvent:b,data:f})}})},d.prototype.clear=function(){this.$selection.find(".select2-selection__rendered").empty()},d.prototype.display=function(a,b){var c=this.options.get("templateSelection");return this.options.get("escapeMarkup")(c(a,b))},d.prototype.selectionContainer=function(){return a('<li class="select2-selection__choice"><span class="select2-selection__choice__remove" role="presentation">&times;</span></li>')},d.prototype.update=function(a){if(this.clear(),0!==a.length){for(var b=[],d=0;d<a.length;d++){var e=a[d],f=this.selectionContainer(),g=this.display(e,f);f.append(g),f.prop("title",e.title||e.text),f.data("data",e),b.push(f)}var h=this.$selection.find(".select2-selection__rendered");c.appendMany(h,b)}},d}),b.define("select2/selection/placeholder",["../utils"],function(a){function b(a,b,c){this.placeholder=this.normalizePlaceholder(c.get("placeholder")),a.call(this,b,c)}return b.prototype.normalizePlaceholder=function(a,b){return"string"==typeof b&&(b={id:"",text:b}),b},b.prototype.createPlaceholder=function(a,b){var c=this.selectionContainer();return c.html(this.display(b)),c.addClass("select2-selection__placeholder").removeClass("select2-selection__choice"),c},b.prototype.update=function(a,b){var c=1==b.length&&b[0].id!=this.placeholder.id;if(b.length>1||c)return a.call(this,b);this.clear();var d=this.createPlaceholder(this.placeholder);this.$selection.find(".select2-selection__rendered").append(d)},b}),b.define("select2/selection/allowClear",["jquery","../keys"],function(a,b){function c(){}return c.prototype.bind=function(a,b,c){var d=this;a.call(this,b,c),null==this.placeholder&&this.options.get("debug")&&window.console&&console.error&&console.error("Select2: The `allowClear` option should be used in combination with the `placeholder` option."),this.$selection.on("mousedown",".select2-selection__clear",function(a){d._handleClear(a)}),b.on("keypress",function(a){d._handleKeyboardClear(a,b)})},c.prototype._handleClear=function(a,b){if(!this.options.get("disabled")){var c=this.$selection.find(".select2-selection__clear");if(0!==c.length){b.stopPropagation();for(var d=c.data("data"),e=0;e<d.length;e++){var f={data:d[e]};if(this.trigger("unselect",f),f.prevented)return}this.$element.val(this.placeholder.id).trigger("change"),this.trigger("toggle",{})}}},c.prototype._handleKeyboardClear=function(a,c,d){d.isOpen()||c.which!=b.DELETE&&c.which!=b.BACKSPACE||this._handleClear(c)},c.prototype.update=function(b,c){if(b.call(this,c),!(this.$selection.find(".select2-selection__placeholder").length>0||0===c.length)){var d=a('<span class="select2-selection__clear">&times;</span>');d.data("data",c),this.$selection.find(".select2-selection__rendered").prepend(d)}},c}),b.define("select2/selection/search",["jquery","../utils","../keys"],function(a,b,c){function d(a,b,c){a.call(this,b,c)}return d.prototype.render=function(b){var c=a('<li class="select2-search select2-search--inline"><input class="select2-search__field" type="search" tabindex="-1" autocomplete="off" autocorrect="off" autocapitalize="off" spellcheck="false" role="textbox" aria-autocomplete="list" /></li>');this.$searchContainer=c,this.$search=c.find("input");var d=b.call(this);return this._transferTabIndex(),d},d.prototype.bind=function(a,b,d){var e=this;a.call(this,b,d),b.on("open",function(){e.$search.trigger("focus")}),b.on("close",function(){e.$search.val(""),e.$search.removeAttr("aria-activedescendant"),e.$search.trigger("focus")}),b.on("enable",function(){e.$search.prop("disabled",!1),e._transferTabIndex()}),b.on("disable",function(){e.$search.prop("disabled",!0)}),b.on("focus",function(a){e.$search.trigger("focus")}),b.on("results:focus",function(a){e.$search.attr("aria-activedescendant",a.id)}),this.$selection.on("focusin",".select2-search--inline",function(a){e.trigger("focus",a)}),this.$selection.on("focusout",".select2-search--inline",function(a){e._handleBlur(a)}),this.$selection.on("keydown",".select2-search--inline",function(a){if(a.stopPropagation(),e.trigger("keypress",a),e._keyUpPrevented=a.isDefaultPrevented(),a.which===c.BACKSPACE&&""===e.$search.val()){var b=e.$searchContainer.prev(".select2-selection__choice");if(b.length>0){var d=b.data("data");e.searchRemoveChoice(d),a.preventDefault()}}});var f=document.documentMode,g=f&&f<=11;this.$selection.on("input.searchcheck",".select2-search--inline",function(a){if(g)return void e.$selection.off("input.search input.searchcheck");e.$selection.off("keyup.search")}),this.$selection.on("keyup.search input.search",".select2-search--inline",function(a){if(g&&"input"===a.type)return void e.$selection.off("input.search input.searchcheck");var b=a.which;b!=c.SHIFT&&b!=c.CTRL&&b!=c.ALT&&b!=c.TAB&&e.handleSearch(a)})},d.prototype._transferTabIndex=function(a){this.$search.attr("tabindex",this.$selection.attr("tabindex")),this.$selection.attr("tabindex","-1")},d.prototype.createPlaceholder=function(a,b){this.$search.attr("placeholder",b.text)},d.prototype.update=function(a,b){var c=this.$search[0]==document.activeElement;this.$search.attr("placeholder",""),a.call(this,b),this.$selection.find(".select2-selection__rendered").append(this.$searchContainer),this.resizeSearch(),c&&this.$search.focus()},d.prototype.handleSearch=function(){if(this.resizeSearch(),!this._keyUpPrevented){var a=this.$search.val();this.trigger("query",{term:a})}this._keyUpPrevented=!1},d.prototype.searchRemoveChoice=function(a,b){this.trigger("unselect",{data:b}),this.$search.val(b.text),this.handleSearch()},d.prototype.resizeSearch=function(){this.$search.css("width","25px");var a="";if(""!==this.$search.attr("placeholder"))a=this.$selection.find(".select2-selection__rendered").innerWidth();else{a=.75*(this.$search.val().length+1)+"em"}this.$search.css("width",a)},d}),b.define("select2/selection/eventRelay",["jquery"],function(a){function b(){}return b.prototype.bind=function(b,c,d){var e=this,f=["open","opening","close","closing","select","selecting","unselect","unselecting"],g=["opening","closing","selecting","unselecting"];b.call(this,c,d),c.on("*",function(b,c){if(-1!==a.inArray(b,f)){c=c||{};var d=a.Event("select2:"+b,{params:c});e.$element.trigger(d),-1!==a.inArray(b,g)&&(c.prevented=d.isDefaultPrevented())}})},b}),b.define("select2/translation",["jquery","require"],function(a,b){function c(a){this.dict=a||{}}return c.prototype.all=function(){return this.dict},c.prototype.get=function(a){return this.dict[a]},c.prototype.extend=function(b){this.dict=a.extend({},b.all(),this.dict)},c._cache={},c.loadPath=function(a){if(!(a in c._cache)){var d=b(a);c._cache[a]=d}return new c(c._cache[a])},c}),b.define("select2/diacritics",[],function(){return{"Ⓐ":"A","Ａ":"A","À":"A","Á":"A","Â":"A","Ầ":"A","Ấ":"A","Ẫ":"A","Ẩ":"A","Ã":"A","Ā":"A","Ă":"A","Ằ":"A","Ắ":"A","Ẵ":"A","Ẳ":"A","Ȧ":"A","Ǡ":"A","Ä":"A","Ǟ":"A","Ả":"A","Å":"A","Ǻ":"A","Ǎ":"A","Ȁ":"A","Ȃ":"A","Ạ":"A","Ậ":"A","Ặ":"A","Ḁ":"A","Ą":"A","Ⱥ":"A","Ɐ":"A","Ꜳ":"AA","Æ":"AE","Ǽ":"AE","Ǣ":"AE","Ꜵ":"AO","Ꜷ":"AU","Ꜹ":"AV","Ꜻ":"AV","Ꜽ":"AY","Ⓑ":"B","Ｂ":"B","Ḃ":"B","Ḅ":"B","Ḇ":"B","Ƀ":"B","Ƃ":"B","Ɓ":"B","Ⓒ":"C","Ｃ":"C","Ć":"C","Ĉ":"C","Ċ":"C","Č":"C","Ç":"C","Ḉ":"C","Ƈ":"C","Ȼ":"C","Ꜿ":"C","Ⓓ":"D","Ｄ":"D","Ḋ":"D","Ď":"D","Ḍ":"D","Ḑ":"D","Ḓ":"D","Ḏ":"D","Đ":"D","Ƌ":"D","Ɗ":"D","Ɖ":"D","Ꝺ":"D","DZ":"DZ","DŽ":"DZ","Dz":"Dz","Dž":"Dz","Ⓔ":"E","Ｅ":"E","È":"E","É":"E","Ê":"E","Ề":"E","Ế":"E","Ễ":"E","Ể":"E","Ẽ":"E","Ē":"E","Ḕ":"E","Ḗ":"E","Ĕ":"E","Ė":"E","Ë":"E","Ẻ":"E","Ě":"E","Ȅ":"E","Ȇ":"E","Ẹ":"E","Ệ":"E","Ȩ":"E","Ḝ":"E","Ę":"E","Ḙ":"E","Ḛ":"E","Ɛ":"E","Ǝ":"E","Ⓕ":"F","Ｆ":"F","Ḟ":"F","Ƒ":"F","Ꝼ":"F","Ⓖ":"G","Ｇ":"G","Ǵ":"G","Ĝ":"G","Ḡ":"G","Ğ":"G","Ġ":"G","Ǧ":"G","Ģ":"G","Ǥ":"G","Ɠ":"G","Ꞡ":"G","Ᵹ":"G","Ꝿ":"G","Ⓗ":"H","Ｈ":"H","Ĥ":"H","Ḣ":"H","Ḧ":"H","Ȟ":"H","Ḥ":"H","Ḩ":"H","Ḫ":"H","Ħ":"H","Ⱨ":"H","Ⱶ":"H","Ɥ":"H","Ⓘ":"I","Ｉ":"I","Ì":"I","Í":"I","Î":"I","Ĩ":"I","Ī":"I","Ĭ":"I","İ":"I","Ï":"I","Ḯ":"I","Ỉ":"I","Ǐ":"I","Ȉ":"I","Ȋ":"I","Ị":"I","Į":"I","Ḭ":"I","Ɨ":"I","Ⓙ":"J","Ｊ":"J","Ĵ":"J","Ɉ":"J","Ⓚ":"K","Ｋ":"K","Ḱ":"K","Ǩ":"K","Ḳ":"K","Ķ":"K","Ḵ":"K","Ƙ":"K","Ⱪ":"K","Ꝁ":"K","Ꝃ":"K","Ꝅ":"K","Ꞣ":"K","Ⓛ":"L","Ｌ":"L","Ŀ":"L","Ĺ":"L","Ľ":"L","Ḷ":"L","Ḹ":"L","Ļ":"L","Ḽ":"L","Ḻ":"L","Ł":"L","Ƚ":"L","Ɫ":"L","Ⱡ":"L","Ꝉ":"L","Ꝇ":"L","Ꞁ":"L","LJ":"LJ","Lj":"Lj","Ⓜ":"M","Ｍ":"M","Ḿ":"M","Ṁ":"M","Ṃ":"M","Ɱ":"M","Ɯ":"M","Ⓝ":"N","Ｎ":"N","Ǹ":"N","Ń":"N","Ñ":"N","Ṅ":"N","Ň":"N","Ṇ":"N","Ņ":"N","Ṋ":"N","Ṉ":"N","Ƞ":"N","Ɲ":"N","Ꞑ":"N","Ꞥ":"N","NJ":"NJ","Nj":"Nj","Ⓞ":"O","Ｏ":"O","Ò":"O","Ó":"O","Ô":"O","Ồ":"O","Ố":"O","Ỗ":"O","Ổ":"O","Õ":"O","Ṍ":"O","Ȭ":"O","Ṏ":"O","Ō":"O","Ṑ":"O","Ṓ":"O","Ŏ":"O","Ȯ":"O","Ȱ":"O","Ö":"O","Ȫ":"O","Ỏ":"O","Ő":"O","Ǒ":"O","Ȍ":"O","Ȏ":"O","Ơ":"O","Ờ":"O","Ớ":"O","Ỡ":"O","Ở":"O","Ợ":"O","Ọ":"O","Ộ":"O","Ǫ":"O","Ǭ":"O","Ø":"O","Ǿ":"O","Ɔ":"O","Ɵ":"O","Ꝋ":"O","Ꝍ":"O","Ƣ":"OI","Ꝏ":"OO","Ȣ":"OU","Ⓟ":"P","Ｐ":"P","Ṕ":"P","Ṗ":"P","Ƥ":"P","Ᵽ":"P","Ꝑ":"P","Ꝓ":"P","Ꝕ":"P","Ⓠ":"Q","Ｑ":"Q","Ꝗ":"Q","Ꝙ":"Q","Ɋ":"Q","Ⓡ":"R","Ｒ":"R","Ŕ":"R","Ṙ":"R","Ř":"R","Ȑ":"R","Ȓ":"R","Ṛ":"R","Ṝ":"R","Ŗ":"R","Ṟ":"R","Ɍ":"R","Ɽ":"R","Ꝛ":"R","Ꞧ":"R","Ꞃ":"R","Ⓢ":"S","Ｓ":"S","ẞ":"S","Ś":"S","Ṥ":"S","Ŝ":"S","Ṡ":"S","Š":"S","Ṧ":"S","Ṣ":"S","Ṩ":"S","Ș":"S","Ş":"S","Ȿ":"S","Ꞩ":"S","Ꞅ":"S","Ⓣ":"T","Ｔ":"T","Ṫ":"T","Ť":"T","Ṭ":"T","Ț":"T","Ţ":"T","Ṱ":"T","Ṯ":"T","Ŧ":"T","Ƭ":"T","Ʈ":"T","Ⱦ":"T","Ꞇ":"T","Ꜩ":"TZ","Ⓤ":"U","Ｕ":"U","Ù":"U","Ú":"U","Û":"U","Ũ":"U","Ṹ":"U","Ū":"U","Ṻ":"U","Ŭ":"U","Ü":"U","Ǜ":"U","Ǘ":"U","Ǖ":"U","Ǚ":"U","Ủ":"U","Ů":"U","Ű":"U","Ǔ":"U","Ȕ":"U","Ȗ":"U","Ư":"U","Ừ":"U","Ứ":"U","Ữ":"U","Ử":"U","Ự":"U","Ụ":"U","Ṳ":"U","Ų":"U","Ṷ":"U","Ṵ":"U","Ʉ":"U","Ⓥ":"V","Ｖ":"V","Ṽ":"V","Ṿ":"V","Ʋ":"V","Ꝟ":"V","Ʌ":"V","Ꝡ":"VY","Ⓦ":"W","Ｗ":"W","Ẁ":"W","Ẃ":"W","Ŵ":"W","Ẇ":"W","Ẅ":"W","Ẉ":"W","Ⱳ":"W","Ⓧ":"X","Ｘ":"X","Ẋ":"X","Ẍ":"X","Ⓨ":"Y","Ｙ":"Y","Ỳ":"Y","Ý":"Y","Ŷ":"Y","Ỹ":"Y","Ȳ":"Y","Ẏ":"Y","Ÿ":"Y","Ỷ":"Y","Ỵ":"Y","Ƴ":"Y","Ɏ":"Y","Ỿ":"Y","Ⓩ":"Z","Ｚ":"Z","Ź":"Z","Ẑ":"Z","Ż":"Z","Ž":"Z","Ẓ":"Z","Ẕ":"Z","Ƶ":"Z","Ȥ":"Z","Ɀ":"Z","Ⱬ":"Z","Ꝣ":"Z","ⓐ":"a","ａ":"a","ẚ":"a","à":"a","á":"a","â":"a","ầ":"a","ấ":"a","ẫ":"a","ẩ":"a","ã":"a","ā":"a","ă":"a","ằ":"a","ắ":"a","ẵ":"a","ẳ":"a","ȧ":"a","ǡ":"a","ä":"a","ǟ":"a","ả":"a","å":"a","ǻ":"a","ǎ":"a","ȁ":"a","ȃ":"a","ạ":"a","ậ":"a","ặ":"a","ḁ":"a","ą":"a","ⱥ":"a","ɐ":"a","ꜳ":"aa","æ":"ae","ǽ":"ae","ǣ":"ae","ꜵ":"ao","ꜷ":"au","ꜹ":"av","ꜻ":"av","ꜽ":"ay","ⓑ":"b","ｂ":"b","ḃ":"b","ḅ":"b","ḇ":"b","ƀ":"b","ƃ":"b","ɓ":"b","ⓒ":"c","ｃ":"c","ć":"c","ĉ":"c","ċ":"c","č":"c","ç":"c","ḉ":"c","ƈ":"c","ȼ":"c","ꜿ":"c","ↄ":"c","ⓓ":"d","ｄ":"d","ḋ":"d","ď":"d","ḍ":"d","ḑ":"d","ḓ":"d","ḏ":"d","đ":"d","ƌ":"d","ɖ":"d","ɗ":"d","ꝺ":"d","dz":"dz","dž":"dz","ⓔ":"e","ｅ":"e","è":"e","é":"e","ê":"e","ề":"e","ế":"e","ễ":"e","ể":"e","ẽ":"e","ē":"e","ḕ":"e","ḗ":"e","ĕ":"e","ė":"e","ë":"e","ẻ":"e","ě":"e","ȅ":"e","ȇ":"e","ẹ":"e","ệ":"e","ȩ":"e","ḝ":"e","ę":"e","ḙ":"e","ḛ":"e","ɇ":"e","ɛ":"e","ǝ":"e","ⓕ":"f","ｆ":"f","ḟ":"f","ƒ":"f","ꝼ":"f","ⓖ":"g","ｇ":"g","ǵ":"g","ĝ":"g","ḡ":"g","ğ":"g","ġ":"g","ǧ":"g","ģ":"g","ǥ":"g","ɠ":"g","ꞡ":"g","ᵹ":"g","ꝿ":"g","ⓗ":"h","ｈ":"h","ĥ":"h","ḣ":"h","ḧ":"h","ȟ":"h","ḥ":"h","ḩ":"h","ḫ":"h","ẖ":"h","ħ":"h","ⱨ":"h","ⱶ":"h","ɥ":"h","ƕ":"hv","ⓘ":"i","ｉ":"i","ì":"i","í":"i","î":"i","ĩ":"i","ī":"i","ĭ":"i","ï":"i","ḯ":"i","ỉ":"i","ǐ":"i","ȉ":"i","ȋ":"i","ị":"i","į":"i","ḭ":"i","ɨ":"i","ı":"i","ⓙ":"j","ｊ":"j","ĵ":"j","ǰ":"j","ɉ":"j","ⓚ":"k","ｋ":"k","ḱ":"k","ǩ":"k","ḳ":"k","ķ":"k","ḵ":"k","ƙ":"k","ⱪ":"k","ꝁ":"k","ꝃ":"k","ꝅ":"k","ꞣ":"k","ⓛ":"l","ｌ":"l","ŀ":"l","ĺ":"l","ľ":"l","ḷ":"l","ḹ":"l","ļ":"l","ḽ":"l","ḻ":"l","ſ":"l","ł":"l","ƚ":"l","ɫ":"l","ⱡ":"l","ꝉ":"l","ꞁ":"l","ꝇ":"l","lj":"lj","ⓜ":"m","ｍ":"m","ḿ":"m","ṁ":"m","ṃ":"m","ɱ":"m","ɯ":"m","ⓝ":"n","ｎ":"n","ǹ":"n","ń":"n","ñ":"n","ṅ":"n","ň":"n","ṇ":"n","ņ":"n","ṋ":"n","ṉ":"n","ƞ":"n","ɲ":"n","ʼn":"n","ꞑ":"n","ꞥ":"n","nj":"nj","ⓞ":"o","ｏ":"o","ò":"o","ó":"o","ô":"o","ồ":"o","ố":"o","ỗ":"o","ổ":"o","õ":"o","ṍ":"o","ȭ":"o","ṏ":"o","ō":"o","ṑ":"o","ṓ":"o","ŏ":"o","ȯ":"o","ȱ":"o","ö":"o","ȫ":"o","ỏ":"o","ő":"o","ǒ":"o","ȍ":"o","ȏ":"o","ơ":"o","ờ":"o","ớ":"o","ỡ":"o","ở":"o","ợ":"o","ọ":"o","ộ":"o","ǫ":"o","ǭ":"o","ø":"o","ǿ":"o","ɔ":"o","ꝋ":"o","ꝍ":"o","ɵ":"o","ƣ":"oi","ȣ":"ou","ꝏ":"oo","ⓟ":"p","ｐ":"p","ṕ":"p","ṗ":"p","ƥ":"p","ᵽ":"p","ꝑ":"p","ꝓ":"p","ꝕ":"p","ⓠ":"q","ｑ":"q","ɋ":"q","ꝗ":"q","ꝙ":"q","ⓡ":"r","ｒ":"r","ŕ":"r","ṙ":"r","ř":"r","ȑ":"r","ȓ":"r","ṛ":"r","ṝ":"r","ŗ":"r","ṟ":"r","ɍ":"r","ɽ":"r","ꝛ":"r","ꞧ":"r","ꞃ":"r","ⓢ":"s","ｓ":"s","ß":"s","ś":"s","ṥ":"s","ŝ":"s","ṡ":"s","š":"s","ṧ":"s","ṣ":"s","ṩ":"s","ș":"s","ş":"s","ȿ":"s","ꞩ":"s","ꞅ":"s","ẛ":"s","ⓣ":"t","ｔ":"t","ṫ":"t","ẗ":"t","ť":"t","ṭ":"t","ț":"t","ţ":"t","ṱ":"t","ṯ":"t","ŧ":"t","ƭ":"t","ʈ":"t","ⱦ":"t","ꞇ":"t","ꜩ":"tz","ⓤ":"u","ｕ":"u","ù":"u","ú":"u","û":"u","ũ":"u","ṹ":"u","ū":"u","ṻ":"u","ŭ":"u","ü":"u","ǜ":"u","ǘ":"u","ǖ":"u","ǚ":"u","ủ":"u","ů":"u","ű":"u","ǔ":"u","ȕ":"u","ȗ":"u","ư":"u","ừ":"u","ứ":"u","ữ":"u","ử":"u","ự":"u","ụ":"u","ṳ":"u","ų":"u","ṷ":"u","ṵ":"u","ʉ":"u","ⓥ":"v","ｖ":"v","ṽ":"v","ṿ":"v","ʋ":"v","ꝟ":"v","ʌ":"v","ꝡ":"vy","ⓦ":"w","ｗ":"w","ẁ":"w","ẃ":"w","ŵ":"w","ẇ":"w","ẅ":"w","ẘ":"w","ẉ":"w","ⱳ":"w","ⓧ":"x","ｘ":"x","ẋ":"x","ẍ":"x","ⓨ":"y","ｙ":"y","ỳ":"y","ý":"y","ŷ":"y","ỹ":"y","ȳ":"y","ẏ":"y","ÿ":"y","ỷ":"y","ẙ":"y","ỵ":"y","ƴ":"y","ɏ":"y","ỿ":"y","ⓩ":"z","ｚ":"z","ź":"z","ẑ":"z","ż":"z","ž":"z","ẓ":"z","ẕ":"z","ƶ":"z","ȥ":"z","ɀ":"z","ⱬ":"z","ꝣ":"z","Ά":"Α","Έ":"Ε","Ή":"Η","Ί":"Ι","Ϊ":"Ι","Ό":"Ο","Ύ":"Υ","Ϋ":"Υ","Ώ":"Ω","ά":"α","έ":"ε","ή":"η","ί":"ι","ϊ":"ι","ΐ":"ι","ό":"ο","ύ":"υ","ϋ":"υ","ΰ":"υ","ω":"ω","ς":"σ"}}),b.define("select2/data/base",["../utils"],function(a){function b(a,c){b.__super__.constructor.call(this)}return a.Extend(b,a.Observable),b.prototype.current=function(a){throw new Error("The `current` method must be defined in child classes.")},b.prototype.query=function(a,b){throw new Error("The `query` method must be defined in child classes.")},b.prototype.bind=function(a,b){},b.prototype.destroy=function(){},b.prototype.generateResultId=function(b,c){var d=b.id+"-result-";return d+=a.generateChars(4),null!=c.id?d+="-"+c.id.toString():d+="-"+a.generateChars(4),d},b}),b.define("select2/data/select",["./base","../utils","jquery"],function(a,b,c){function d(a,b){this.$element=a,this.options=b,d.__super__.constructor.call(this)}return b.Extend(d,a),d.prototype.current=function(a){var b=[],d=this;this.$element.find(":selected").each(function(){var a=c(this),e=d.item(a);b.push(e)}),a(b)},d.prototype.select=function(a){var b=this;if(a.selected=!0,c(a.element).is("option"))return a.element.selected=!0,void this.$element.trigger("change");if(this.$element.prop("multiple"))this.current(function(d){var e=[];a=[a],a.push.apply(a,d);for(var f=0;f<a.length;f++){var g=a[f].id;-1===c.inArray(g,e)&&e.push(g)}b.$element.val(e),b.$element.trigger("change")});else{var d=a.id;this.$element.val(d),this.$element.trigger("change")}},d.prototype.unselect=function(a){var b=this;if(this.$element.prop("multiple")){if(a.selected=!1,c(a.element).is("option"))return a.element.selected=!1,void this.$element.trigger("change");this.current(function(d){for(var e=[],f=0;f<d.length;f++){var g=d[f].id;g!==a.id&&-1===c.inArray(g,e)&&e.push(g)}b.$element.val(e),b.$element.trigger("change")})}},d.prototype.bind=function(a,b){var c=this;this.container=a,a.on("select",function(a){c.select(a.data)}),a.on("unselect",function(a){c.unselect(a.data)})},d.prototype.destroy=function(){this.$element.find("*").each(function(){c.removeData(this,"data")})},d.prototype.query=function(a,b){var d=[],e=this;this.$element.children().each(function(){var b=c(this);if(b.is("option")||b.is("optgroup")){var f=e.item(b),g=e.matches(a,f);null!==g&&d.push(g)}}),b({results:d})},d.prototype.addOptions=function(a){b.appendMany(this.$element,a)},d.prototype.option=function(a){var b;a.children?(b=document.createElement("optgroup"),b.label=a.text):(b=document.createElement("option"),void 0!==b.textContent?b.textContent=a.text:b.innerText=a.text),void 0!==a.id&&(b.value=a.id),a.disabled&&(b.disabled=!0),a.selected&&(b.selected=!0),a.title&&(b.title=a.title);var d=c(b),e=this._normalizeItem(a);return e.element=b,c.data(b,"data",e),d},d.prototype.item=function(a){var b={};if(null!=(b=c.data(a[0],"data")))return b;if(a.is("option"))b={id:a.val(),text:a.text(),disabled:a.prop("disabled"),selected:a.prop("selected"),title:a.prop("title")};else if(a.is("optgroup")){b={text:a.prop("label"),children:[],title:a.prop("title")};for(var d=a.children("option"),e=[],f=0;f<d.length;f++){var g=c(d[f]),h=this.item(g);e.push(h)}b.children=e}return b=this._normalizeItem(b),b.element=a[0],c.data(a[0],"data",b),b},d.prototype._normalizeItem=function(a){c.isPlainObject(a)||(a={id:a,text:a}),a=c.extend({},{text:""},a);var b={selected:!1,disabled:!1};return null!=a.id&&(a.id=a.id.toString()),null!=a.text&&(a.text=a.text.toString()),null==a._resultId&&a.id&&null!=this.container&&(a._resultId=this.generateResultId(this.container,a)),c.extend({},b,a)},d.prototype.matches=function(a,b){return this.options.get("matcher")(a,b)},d}),b.define("select2/data/array",["./select","../utils","jquery"],function(a,b,c){function d(a,b){var c=b.get("data")||[];d.__super__.constructor.call(this,a,b),this.addOptions(this.convertToOptions(c))}return b.Extend(d,a),d.prototype.select=function(a){var b=this.$element.find("option").filter(function(b,c){return c.value==a.id.toString()});0===b.length&&(b=this.option(a),this.addOptions(b)),d.__super__.select.call(this,a)},d.prototype.convertToOptions=function(a){function d(a){return function(){return c(this).val()==a.id}}for(var e=this,f=this.$element.find("option"),g=f.map(function(){return e.item(c(this)).id}).get(),h=[],i=0;i<a.length;i++){var j=this._normalizeItem(a[i]);if(c.inArray(j.id,g)>=0){var k=f.filter(d(j)),l=this.item(k),m=c.extend(!0,{},j,l),n=this.option(m);k.replaceWith(n)}else{var o=this.option(j);if(j.children){var p=this.convertToOptions(j.children);b.appendMany(o,p)}h.push(o)}}return h},d}),b.define("select2/data/ajax",["./array","../utils","jquery"],function(a,b,c){function d(a,b){this.ajaxOptions=this._applyDefaults(b.get("ajax")),null!=this.ajaxOptions.processResults&&(this.processResults=this.ajaxOptions.processResults),d.__super__.constructor.call(this,a,b)}return b.Extend(d,a),d.prototype._applyDefaults=function(a){var b={data:function(a){return c.extend({},a,{q:a.term})},transport:function(a,b,d){var e=c.ajax(a);return e.then(b),e.fail(d),e}};return c.extend({},b,a,!0)},d.prototype.processResults=function(a){return a},d.prototype.query=function(a,b){function d(){var d=f.transport(f,function(d){var f=e.processResults(d,a);e.options.get("debug")&&window.console&&console.error&&(f&&f.results&&c.isArray(f.results)||console.error("Select2: The AJAX results did not return an array in the `results` key of the response.")),b(f)},function(){d.status&&"0"===d.status||e.trigger("results:message",{message:"errorLoading"})});e._request=d}var e=this;null!=this._request&&(c.isFunction(this._request.abort)&&this._request.abort(),this._request=null);var f=c.extend({type:"GET"},this.ajaxOptions);"function"==typeof f.url&&(f.url=f.url.call(this.$element,a)),"function"==typeof f.data&&(f.data=f.data.call(this.$element,a)),this.ajaxOptions.delay&&null!=a.term?(this._queryTimeout&&window.clearTimeout(this._queryTimeout),this._queryTimeout=window.setTimeout(d,this.ajaxOptions.delay)):d()},d}),b.define("select2/data/tags",["jquery"],function(a){function b(b,c,d){var e=d.get("tags"),f=d.get("createTag");void 0!==f&&(this.createTag=f);var g=d.get("insertTag");if(void 0!==g&&(this.insertTag=g),b.call(this,c,d),a.isArray(e))for(var h=0;h<e.length;h++){var i=e[h],j=this._normalizeItem(i),k=this.option(j);this.$element.append(k)}}return b.prototype.query=function(a,b,c){function d(a,f){for(var g=a.results,h=0;h<g.length;h++){var i=g[h],j=null!=i.children&&!d({results:i.children},!0);if((i.text||"").toUpperCase()===(b.term||"").toUpperCase()||j)return!f&&(a.data=g,void c(a))}if(f)return!0;var k=e.createTag(b);if(null!=k){var l=e.option(k);l.attr("data-select2-tag",!0),e.addOptions([l]),e.insertTag(g,k)}a.results=g,c(a)}var e=this;if(this._removeOldTags(),null==b.term||null!=b.page)return void a.call(this,b,c);a.call(this,b,d)},b.prototype.createTag=function(b,c){var d=a.trim(c.term);return""===d?null:{id:d,text:d}},b.prototype.insertTag=function(a,b,c){b.unshift(c)},b.prototype._removeOldTags=function(b){this._lastTag;this.$element.find("option[data-select2-tag]").each(function(){this.selected||a(this).remove()})},b}),b.define("select2/data/tokenizer",["jquery"],function(a){function b(a,b,c){var d=c.get("tokenizer");void 0!==d&&(this.tokenizer=d),a.call(this,b,c)}return b.prototype.bind=function(a,b,c){a.call(this,b,c),this.$search=b.dropdown.$search||b.selection.$search||c.find(".select2-search__field")},b.prototype.query=function(b,c,d){function e(b){var c=g._normalizeItem(b);if(!g.$element.find("option").filter(function(){return a(this).val()===c.id}).length){var d=g.option(c);d.attr("data-select2-tag",!0),g._removeOldTags(),g.addOptions([d])}f(c)}function f(a){g.trigger("select",{data:a})}var g=this;c.term=c.term||"";var h=this.tokenizer(c,this.options,e);h.term!==c.term&&(this.$search.length&&(this.$search.val(h.term),this.$search.focus()),c.term=h.term),b.call(this,c,d)},b.prototype.tokenizer=function(b,c,d,e){for(var f=d.get("tokenSeparators")||[],g=c.term,h=0,i=this.createTag||function(a){return{id:a.term,text:a.term}};h<g.length;){var j=g[h];if(-1!==a.inArray(j,f)){var k=g.substr(0,h),l=a.extend({},c,{term:k}),m=i(l);null!=m?(e(m),g=g.substr(h+1)||"",h=0):h++}else h++}return{term:g}},b}),b.define("select2/data/minimumInputLength",[],function(){function a(a,b,c){this.minimumInputLength=c.get("minimumInputLength"),a.call(this,b,c)}return a.prototype.query=function(a,b,c){if(b.term=b.term||"",b.term.length<this.minimumInputLength)return void this.trigger("results:message",{message:"inputTooShort",args:{minimum:this.minimumInputLength,input:b.term,params:b}});a.call(this,b,c)},a}),b.define("select2/data/maximumInputLength",[],function(){function a(a,b,c){this.maximumInputLength=c.get("maximumInputLength"),a.call(this,b,c)}return a.prototype.query=function(a,b,c){if(b.term=b.term||"",this.maximumInputLength>0&&b.term.length>this.maximumInputLength)return void this.trigger("results:message",{message:"inputTooLong",args:{maximum:this.maximumInputLength,input:b.term,params:b}});a.call(this,b,c)},a}),b.define("select2/data/maximumSelectionLength",[],function(){function a(a,b,c){this.maximumSelectionLength=c.get("maximumSelectionLength"),a.call(this,b,c)}return a.prototype.query=function(a,b,c){var d=this;this.current(function(e){var f=null!=e?e.length:0;if(d.maximumSelectionLength>0&&f>=d.maximumSelectionLength)return void d.trigger("results:message",{message:"maximumSelected",args:{maximum:d.maximumSelectionLength}});a.call(d,b,c)})},a}),b.define("select2/dropdown",["jquery","./utils"],function(a,b){function c(a,b){this.$element=a,this.options=b,c.__super__.constructor.call(this)}return b.Extend(c,b.Observable),c.prototype.render=function(){var b=a('<span class="select2-dropdown"><span class="select2-results"></span></span>');return b.attr("dir",this.options.get("dir")),this.$dropdown=b,b},c.prototype.bind=function(){},c.prototype.position=function(a,b){},c.prototype.destroy=function(){this.$dropdown.remove()},c}),b.define("select2/dropdown/search",["jquery","../utils"],function(a,b){function c(){}return c.prototype.render=function(b){var c=b.call(this),d=a('<span class="select2-search select2-search--dropdown"><input class="select2-search__field" type="search" tabindex="-1" autocomplete="off" autocorrect="off" autocapitalize="off" spellcheck="false" role="textbox" /></span>');return this.$searchContainer=d,this.$search=d.find("input"),c.prepend(d),c},c.prototype.bind=function(b,c,d){var e=this;b.call(this,c,d),this.$search.on("keydown",function(a){e.trigger("keypress",a),e._keyUpPrevented=a.isDefaultPrevented()}),this.$search.on("input",function(b){a(this).off("keyup")}),this.$search.on("keyup input",function(a){e.handleSearch(a)}),c.on("open",function(){e.$search.attr("tabindex",0),e.$search.focus(),window.setTimeout(function(){e.$search.focus()},0)}),c.on("close",function(){e.$search.attr("tabindex",-1),e.$search.val("")}),c.on("focus",function(){c.isOpen()||e.$search.focus()}),c.on("results:all",function(a){if(null==a.query.term||""===a.query.term){e.showSearch(a)?e.$searchContainer.removeClass("select2-search--hide"):e.$searchContainer.addClass("select2-search--hide")}})},c.prototype.handleSearch=function(a){if(!this._keyUpPrevented){var b=this.$search.val();this.trigger("query",{term:b})}this._keyUpPrevented=!1},c.prototype.showSearch=function(a,b){return!0},c}),b.define("select2/dropdown/hidePlaceholder",[],function(){function a(a,b,c,d){this.placeholder=this.normalizePlaceholder(c.get("placeholder")),a.call(this,b,c,d)}return a.prototype.append=function(a,b){b.results=this.removePlaceholder(b.results),a.call(this,b)},a.prototype.normalizePlaceholder=function(a,b){return"string"==typeof b&&(b={id:"",text:b}),b},a.prototype.removePlaceholder=function(a,b){for(var c=b.slice(0),d=b.length-1;d>=0;d--){var e=b[d];this.placeholder.id===e.id&&c.splice(d,1)}return c},a}),b.define("select2/dropdown/infiniteScroll",["jquery"],function(a){function b(a,b,c,d){this.lastParams={},a.call(this,b,c,d),this.$loadingMore=this.createLoadingMore(),this.loading=!1}return b.prototype.append=function(a,b){this.$loadingMore.remove(),this.loading=!1,a.call(this,b),this.showLoadingMore(b)&&this.$results.append(this.$loadingMore)},b.prototype.bind=function(b,c,d){var e=this;b.call(this,c,d),c.on("query",function(a){e.lastParams=a,e.loading=!0}),c.on("query:append",function(a){e.lastParams=a,e.loading=!0}),this.$results.on("scroll",function(){var b=a.contains(document.documentElement,e.$loadingMore[0]);if(!e.loading&&b){e.$results.offset().top+e.$results.outerHeight(!1)+50>=e.$loadingMore.offset().top+e.$loadingMore.outerHeight(!1)&&e.loadMore()}})},b.prototype.loadMore=function(){this.loading=!0;var b=a.extend({},{page:1},this.lastParams);b.page++,this.trigger("query:append",b)},b.prototype.showLoadingMore=function(a,b){return b.pagination&&b.pagination.more},b.prototype.createLoadingMore=function(){var b=a('<li class="select2-results__option select2-results__option--load-more"role="treeitem" aria-disabled="true"></li>'),c=this.options.get("translations").get("loadingMore");return b.html(c(this.lastParams)),b},b}),b.define("select2/dropdown/attachBody",["jquery","../utils"],function(a,b){function c(b,c,d){this.$dropdownParent=d.get("dropdownParent")||a(document.body),b.call(this,c,d)}return c.prototype.bind=function(a,b,c){var d=this,e=!1;a.call(this,b,c),b.on("open",function(){d._showDropdown(),d._attachPositioningHandler(b),e||(e=!0,b.on("results:all",function(){d._positionDropdown(),d._resizeDropdown()}),b.on("results:append",function(){d._positionDropdown(),d._resizeDropdown()}))}),b.on("close",function(){d._hideDropdown(),d._detachPositioningHandler(b)}),this.$dropdownContainer.on("mousedown",function(a){a.stopPropagation()})},c.prototype.destroy=function(a){a.call(this),this.$dropdownContainer.remove()},c.prototype.position=function(a,b,c){b.attr("class",c.attr("class")),b.removeClass("select2"),b.addClass("select2-container--open"),b.css({position:"absolute",top:-999999}),this.$container=c},c.prototype.render=function(b){var c=a("<span></span>"),d=b.call(this);return c.append(d),this.$dropdownContainer=c,c},c.prototype._hideDropdown=function(a){this.$dropdownContainer.detach()},c.prototype._attachPositioningHandler=function(c,d){var e=this,f="scroll.select2."+d.id,g="resize.select2."+d.id,h="orientationchange.select2."+d.id,i=this.$container.parents().filter(b.hasScroll);i.each(function(){a(this).data("select2-scroll-position",{x:a(this).scrollLeft(),y:a(this).scrollTop()})}),i.on(f,function(b){var c=a(this).data("select2-scroll-position");a(this).scrollTop(c.y)}),a(window).on(f+" "+g+" "+h,function(a){e._positionDropdown(),e._resizeDropdown()})},c.prototype._detachPositioningHandler=function(c,d){var e="scroll.select2."+d.id,f="resize.select2."+d.id,g="orientationchange.select2."+d.id;this.$container.parents().filter(b.hasScroll).off(e),a(window).off(e+" "+f+" "+g)},c.prototype._positionDropdown=function(){var b=a(window),c=this.$dropdown.hasClass("select2-dropdown--above"),d=this.$dropdown.hasClass("select2-dropdown--below"),e=null,f=this.$container.offset();f.bottom=f.top+this.$container.outerHeight(!1);var g={height:this.$container.outerHeight(!1)};g.top=f.top,g.bottom=f.top+g.height;var h={height:this.$dropdown.outerHeight(!1)},i={top:b.scrollTop(),bottom:b.scrollTop()+b.height()},j=i.top<f.top-h.height,k=i.bottom>f.bottom+h.height,l={left:f.left,top:g.bottom},m=this.$dropdownParent;"static"===m.css("position")&&(m=m.offsetParent());var n=m.offset();l.top-=n.top,l.left-=n.left,c||d||(e="below"),k||!j||c?!j&&k&&c&&(e="below"):e="above",("above"==e||c&&"below"!==e)&&(l.top=g.top-n.top-h.height),null!=e&&(this.$dropdown.removeClass("select2-dropdown--below select2-dropdown--above").addClass("select2-dropdown--"+e),this.$container.removeClass("select2-container--below select2-container--above").addClass("select2-container--"+e)),this.$dropdownContainer.css(l)},c.prototype._resizeDropdown=function(){var a={width:this.$container.outerWidth(!1)+"px"};this.options.get("dropdownAutoWidth")&&(a.minWidth=a.width,a.position="relative",a.width="auto"),this.$dropdown.css(a)},c.prototype._showDropdown=function(a){this.$dropdownContainer.appendTo(this.$dropdownParent),this._positionDropdown(),this._resizeDropdown()},c}),b.define("select2/dropdown/minimumResultsForSearch",[],function(){function a(b){for(var c=0,d=0;d<b.length;d++){var e=b[d];e.children?c+=a(e.children):c++}return c}function b(a,b,c,d){this.minimumResultsForSearch=c.get("minimumResultsForSearch"),this.minimumResultsForSearch<0&&(this.minimumResultsForSearch=1/0),a.call(this,b,c,d)}return b.prototype.showSearch=function(b,c){return!(a(c.data.results)<this.minimumResultsForSearch)&&b.call(this,c)},b}),b.define("select2/dropdown/selectOnClose",[],function(){function a(){}return a.prototype.bind=function(a,b,c){var d=this;a.call(this,b,c),b.on("close",function(a){d._handleSelectOnClose(a)})},a.prototype._handleSelectOnClose=function(a,b){if(b&&null!=b.originalSelect2Event){var c=b.originalSelect2Event;if("select"===c._type||"unselect"===c._type)return}var d=this.getHighlightedResults();if(!(d.length<1)){var e=d.data("data");null!=e.element&&e.element.selected||null==e.element&&e.selected||this.trigger("select",{data:e})}},a}),b.define("select2/dropdown/closeOnSelect",[],function(){function a(){}return a.prototype.bind=function(a,b,c){var d=this;a.call(this,b,c),b.on("select",function(a){d._selectTriggered(a)}),b.on("unselect",function(a){d._selectTriggered(a)})},a.prototype._selectTriggered=function(a,b){var c=b.originalEvent;c&&c.ctrlKey||this.trigger("close",{originalEvent:c,originalSelect2Event:b})},a}),b.define("select2/i18n/en",[],function(){return{errorLoading:function(){return"The results could not be loaded."},inputTooLong:function(a){var b=a.input.length-a.maximum,c="Please delete "+b+" character";return 1!=b&&(c+="s"),c},inputTooShort:function(a){return"Please enter "+(a.minimum-a.input.length)+" or more characters"},loadingMore:function(){return"Loading more results…"},maximumSelected:function(a){var b="You can only select "+a.maximum+" item";return 1!=a.maximum&&(b+="s"),b},noResults:function(){return"No results found"},searching:function(){return"Searching…"}}}),b.define("select2/defaults",["jquery","require","./results","./selection/single","./selection/multiple","./selection/placeholder","./selection/allowClear","./selection/search","./selection/eventRelay","./utils","./translation","./diacritics","./data/select","./data/array","./data/ajax","./data/tags","./data/tokenizer","./data/minimumInputLength","./data/maximumInputLength","./data/maximumSelectionLength","./dropdown","./dropdown/search","./dropdown/hidePlaceholder","./dropdown/infiniteScroll","./dropdown/attachBody","./dropdown/minimumResultsForSearch","./dropdown/selectOnClose","./dropdown/closeOnSelect","./i18n/en"],function(a,b,c,d,e,f,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u,v,w,x,y,z,A,B,C){function D(){this.reset()}return D.prototype.apply=function(l){if(l=a.extend(!0,{},this.defaults,l),null==l.dataAdapter){if(null!=l.ajax?l.dataAdapter=o:null!=l.data?l.dataAdapter=n:l.dataAdapter=m,l.minimumInputLength>0&&(l.dataAdapter=j.Decorate(l.dataAdapter,r)),l.maximumInputLength>0&&(l.dataAdapter=j.Decorate(l.dataAdapter,s)),l.maximumSelectionLength>0&&(l.dataAdapter=j.Decorate(l.dataAdapter,t)),l.tags&&(l.dataAdapter=j.Decorate(l.dataAdapter,p)),null==l.tokenSeparators&&null==l.tokenizer||(l.dataAdapter=j.Decorate(l.dataAdapter,q)),null!=l.query){var C=b(l.amdBase+"compat/query");l.dataAdapter=j.Decorate(l.dataAdapter,C)}if(null!=l.initSelection){var D=b(l.amdBase+"compat/initSelection");l.dataAdapter=j.Decorate(l.dataAdapter,D)}}if(null==l.resultsAdapter&&(l.resultsAdapter=c,null!=l.ajax&&(l.resultsAdapter=j.Decorate(l.resultsAdapter,x)),null!=l.placeholder&&(l.resultsAdapter=j.Decorate(l.resultsAdapter,w)),l.selectOnClose&&(l.resultsAdapter=j.Decorate(l.resultsAdapter,A))),null==l.dropdownAdapter){if(l.multiple)l.dropdownAdapter=u;else{var E=j.Decorate(u,v);l.dropdownAdapter=E}if(0!==l.minimumResultsForSearch&&(l.dropdownAdapter=j.Decorate(l.dropdownAdapter,z)),l.closeOnSelect&&(l.dropdownAdapter=j.Decorate(l.dropdownAdapter,B)),null!=l.dropdownCssClass||null!=l.dropdownCss||null!=l.adaptDropdownCssClass){var F=b(l.amdBase+"compat/dropdownCss");l.dropdownAdapter=j.Decorate(l.dropdownAdapter,F)}l.dropdownAdapter=j.Decorate(l.dropdownAdapter,y)}if(null==l.selectionAdapter){if(l.multiple?l.selectionAdapter=e:l.selectionAdapter=d,null!=l.placeholder&&(l.selectionAdapter=j.Decorate(l.selectionAdapter,f)),l.allowClear&&(l.selectionAdapter=j.Decorate(l.selectionAdapter,g)),l.multiple&&(l.selectionAdapter=j.Decorate(l.selectionAdapter,h)),null!=l.containerCssClass||null!=l.containerCss||null!=l.adaptContainerCssClass){var G=b(l.amdBase+"compat/containerCss");l.selectionAdapter=j.Decorate(l.selectionAdapter,G)}l.selectionAdapter=j.Decorate(l.selectionAdapter,i)}if("string"==typeof l.language)if(l.language.indexOf("-")>0){var H=l.language.split("-"),I=H[0];l.language=[l.language,I]}else l.language=[l.language];if(a.isArray(l.language)){var J=new k;l.language.push("en");for(var K=l.language,L=0;L<K.length;L++){var M=K[L],N={};try{N=k.loadPath(M)}catch(a){try{M=this.defaults.amdLanguageBase+M,N=k.loadPath(M)}catch(a){l.debug&&window.console&&console.warn&&console.warn('Select2: The language file for "'+M+'" could not be automatically loaded. A fallback will be used instead.');continue}}J.extend(N)}l.translations=J}else{var O=k.loadPath(this.defaults.amdLanguageBase+"en"),P=new k(l.language);P.extend(O),l.translations=P}return l},D.prototype.reset=function(){function b(a){function b(a){return l[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function c(d,e){if(""===a.trim(d.term))return e;if(e.children&&e.children.length>0){for(var f=a.extend(!0,{},e),g=e.children.length-1;g>=0;g--){null==c(d,e.children[g])&&f.children.splice(g,1)}return f.children.length>0?f:c(d,f)}var h=b(e.text).toUpperCase(),i=b(d.term).toUpperCase();return h.indexOf(i)>-1?e:null}this.defaults={amdBase:"./",amdLanguageBase:"./i18n/",closeOnSelect:!0,debug:!1,dropdownAutoWidth:!1,escapeMarkup:j.escapeMarkup,language:C,matcher:c,minimumInputLength:0,maximumInputLength:0,maximumSelectionLength:0,minimumResultsForSearch:0,selectOnClose:!1,sorter:function(a){return a},templateResult:function(a){return a.text},templateSelection:function(a){return a.text},theme:"default",width:"resolve"}},D.prototype.set=function(b,c){var d=a.camelCase(b),e={};e[d]=c;var f=j._convertData(e);a.extend(this.defaults,f)},new D}),b.define("select2/options",["require","jquery","./defaults","./utils"],function(a,b,c,d){function e(b,e){if(this.options=b,null!=e&&this.fromElement(e),this.options=c.apply(this.options),e&&e.is("input")){var f=a(this.get("amdBase")+"compat/inputData");this.options.dataAdapter=d.Decorate(this.options.dataAdapter,f)}}return e.prototype.fromElement=function(a){var c=["select2"];null==this.options.multiple&&(this.options.multiple=a.prop("multiple")),null==this.options.disabled&&(this.options.disabled=a.prop("disabled")),null==this.options.language&&(a.prop("lang")?this.options.language=a.prop("lang").toLowerCase():a.closest("[lang]").prop("lang")&&(this.options.language=a.closest("[lang]").prop("lang"))),null==this.options.dir&&(a.prop("dir")?this.options.dir=a.prop("dir"):a.closest("[dir]").prop("dir")?this.options.dir=a.closest("[dir]").prop("dir"):this.options.dir="ltr"),a.prop("disabled",this.options.disabled),a.prop("multiple",this.options.multiple),a.data("select2Tags")&&(this.options.debug&&window.console&&console.warn&&console.warn('Select2: The `data-select2-tags` attribute has been changed to use the `data-data` and `data-tags="true"` attributes and will be removed in future versions of Select2.'),a.data("data",a.data("select2Tags")),a.data("tags",!0)),a.data("ajaxUrl")&&(this.options.debug&&window.console&&console.warn&&console.warn("Select2: The `data-ajax-url` attribute has been changed to `data-ajax--url` and support for the old attribute will be removed in future versions of Select2."),a.attr("ajax--url",a.data("ajaxUrl")),a.data("ajax--url",a.data("ajaxUrl")));var e={};e=b.fn.jquery&&"1."==b.fn.jquery.substr(0,2)&&a[0].dataset?b.extend(!0,{},a[0].dataset,a.data()):a.data();var f=b.extend(!0,{},e);f=d._convertData(f);for(var g in f)b.inArray(g,c)>-1||(b.isPlainObject(this.options[g])?b.extend(this.options[g],f[g]):this.options[g]=f[g]);return this},e.prototype.get=function(a){return this.options[a]},e.prototype.set=function(a,b){this.options[a]=b},e}),b.define("select2/core",["jquery","./options","./utils","./keys"],function(a,b,c,d){var e=function(a,c){null!=a.data("select2")&&a.data("select2").destroy(),this.$element=a,this.id=this._generateId(a),c=c||{},this.options=new b(c,a),e.__super__.constructor.call(this);var d=a.attr("tabindex")||0;a.data("old-tabindex",d),a.attr("tabindex","-1");var f=this.options.get("dataAdapter");this.dataAdapter=new f(a,this.options);var g=this.render();this._placeContainer(g);var h=this.options.get("selectionAdapter");this.selection=new h(a,this.options),this.$selection=this.selection.render(),this.selection.position(this.$selection,g);var i=this.options.get("dropdownAdapter");this.dropdown=new i(a,this.options),this.$dropdown=this.dropdown.render(),this.dropdown.position(this.$dropdown,g);var j=this.options.get("resultsAdapter");this.results=new j(a,this.options,this.dataAdapter),this.$results=this.results.render(),this.results.position(this.$results,this.$dropdown);var k=this;this._bindAdapters(),this._registerDomEvents(),this._registerDataEvents(),this._registerSelectionEvents(),this._registerDropdownEvents(),this._registerResultsEvents(),this._registerEvents(),this.dataAdapter.current(function(a){k.trigger("selection:update",{data:a})}),a.addClass("select2-hidden-accessible"),a.attr("aria-hidden","true"),this._syncAttributes(),a.data("select2",this)};return c.Extend(e,c.Observable),e.prototype._generateId=function(a){var b="";return b=null!=a.attr("id")?a.attr("id"):null!=a.attr("name")?a.attr("name")+"-"+c.generateChars(2):c.generateChars(4),b=b.replace(/(:|\.|\[|\]|,)/g,""),b="select2-"+b},e.prototype._placeContainer=function(a){a.insertAfter(this.$element);var b=this._resolveWidth(this.$element,this.options.get("width"));null!=b&&a.css("width",b)},e.prototype._resolveWidth=function(a,b){var c=/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i;if("resolve"==b){var d=this._resolveWidth(a,"style");return null!=d?d:this._resolveWidth(a,"element")}if("element"==b){var e=a.outerWidth(!1);return e<=0?"auto":e+"px"}if("style"==b){var f=a.attr("style");if("string"!=typeof f)return null;for(var g=f.split(";"),h=0,i=g.length;h<i;h+=1){var j=g[h].replace(/\s/g,""),k=j.match(c);if(null!==k&&k.length>=1)return k[1]}return null}return b},e.prototype._bindAdapters=function(){this.dataAdapter.bind(this,this.$container),this.selection.bind(this,this.$container),this.dropdown.bind(this,this.$container),this.results.bind(this,this.$container)},e.prototype._registerDomEvents=function(){var b=this;this.$element.on("change.select2",function(){b.dataAdapter.current(function(a){b.trigger("selection:update",{data:a})})}),this.$element.on("focus.select2",function(a){b.trigger("focus",a)}),this._syncA=c.bind(this._syncAttributes,this),this._syncS=c.bind(this._syncSubtree,this),this.$element[0].attachEvent&&this.$element[0].attachEvent("onpropertychange",this._syncA);var d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver;null!=d?(this._observer=new d(function(c){a.each(c,b._syncA),a.each(c,b._syncS)}),this._observer.observe(this.$element[0],{attributes:!0,childList:!0,subtree:!1})):this.$element[0].addEventListener&&(this.$element[0].addEventListener("DOMAttrModified",b._syncA,!1),this.$element[0].addEventListener("DOMNodeInserted",b._syncS,!1),this.$element[0].addEventListener("DOMNodeRemoved",b._syncS,!1))},e.prototype._registerDataEvents=function(){var a=this;this.dataAdapter.on("*",function(b,c){a.trigger(b,c)})},e.prototype._registerSelectionEvents=function(){var b=this,c=["toggle","focus"];this.selection.on("toggle",function(){b.toggleDropdown()}),this.selection.on("focus",function(a){b.focus(a)}),this.selection.on("*",function(d,e){-1===a.inArray(d,c)&&b.trigger(d,e)})},e.prototype._registerDropdownEvents=function(){var a=this;this.dropdown.on("*",function(b,c){a.trigger(b,c)})},e.prototype._registerResultsEvents=function(){var a=this;this.results.on("*",function(b,c){a.trigger(b,c)})},e.prototype._registerEvents=function(){var a=this;this.on("open",function(){a.$container.addClass("select2-container--open")}),this.on("close",function(){a.$container.removeClass("select2-container--open")}),this.on("enable",function(){a.$container.removeClass("select2-container--disabled")}),this.on("disable",function(){a.$container.addClass("select2-container--disabled")}),this.on("blur",function(){a.$container.removeClass("select2-container--focus")}),this.on("query",function(b){a.isOpen()||a.trigger("open",{}),this.dataAdapter.query(b,function(c){a.trigger("results:all",{data:c,query:b})})}),this.on("query:append",function(b){this.dataAdapter.query(b,function(c){a.trigger("results:append",{data:c,query:b})})}),this.on("keypress",function(b){var c=b.which;a.isOpen()?c===d.ESC||c===d.TAB||c===d.UP&&b.altKey?(a.close(),b.preventDefault()):c===d.ENTER?(a.trigger("results:select",{}),b.preventDefault()):c===d.SPACE&&b.ctrlKey?(a.trigger("results:toggle",{}),b.preventDefault()):c===d.UP?(a.trigger("results:previous",{}),b.preventDefault()):c===d.DOWN&&(a.trigger("results:next",{}),b.preventDefault()):(c===d.ENTER||c===d.SPACE||c===d.DOWN&&b.altKey)&&(a.open(),b.preventDefault())})},e.prototype._syncAttributes=function(){this.options.set("disabled",this.$element.prop("disabled")),this.options.get("disabled")?(this.isOpen()&&this.close(),this.trigger("disable",{})):this.trigger("enable",{})},e.prototype._syncSubtree=function(a,b){var c=!1,d=this;if(!a||!a.target||"OPTION"===a.target.nodeName||"OPTGROUP"===a.target.nodeName){if(b)if(b.addedNodes&&b.addedNodes.length>0)for(var e=0;e<b.addedNodes.length;e++){var f=b.addedNodes[e];f.selected&&(c=!0)}else b.removedNodes&&b.removedNodes.length>0&&(c=!0);else c=!0;c&&this.dataAdapter.current(function(a){d.trigger("selection:update",{data:a})})}},e.prototype.trigger=function(a,b){var c=e.__super__.trigger,d={open:"opening",close:"closing",select:"selecting",unselect:"unselecting"};if(void 0===b&&(b={}),a in d){var f=d[a],g={prevented:!1,name:a,args:b};if(c.call(this,f,g),g.prevented)return void(b.prevented=!0)}c.call(this,a,b)},e.prototype.toggleDropdown=function(){this.options.get("disabled")||(this.isOpen()?this.close():this.open())},e.prototype.open=function(){this.isOpen()||this.trigger("query",{})},e.prototype.close=function(){this.isOpen()&&this.trigger("close",{})},e.prototype.isOpen=function(){return this.$container.hasClass("select2-container--open")},e.prototype.hasFocus=function(){return this.$container.hasClass("select2-container--focus")},e.prototype.focus=function(a){this.hasFocus()||(this.$container.addClass("select2-container--focus"),this.trigger("focus",{}))},e.prototype.enable=function(a){this.options.get("debug")&&window.console&&console.warn&&console.warn('Select2: The `select2("enable")` method has been deprecated and will be removed in later Select2 versions. Use $element.prop("disabled") instead.'),null!=a&&0!==a.length||(a=[!0]);var b=!a[0];this.$element.prop("disabled",b)},e.prototype.data=function(){this.options.get("debug")&&arguments.length>0&&window.console&&console.warn&&console.warn('Select2: Data can no longer be set using `select2("data")`. You should consider setting the value instead using `$element.val()`.');var a=[];return this.dataAdapter.current(function(b){a=b}),a},e.prototype.val=function(b){if(this.options.get("debug")&&window.console&&console.warn&&console.warn('Select2: The `select2("val")` method has been deprecated and will be removed in later Select2 versions. Use $element.val() instead.'),null==b||0===b.length)return this.$element.val();var c=b[0];a.isArray(c)&&(c=a.map(c,function(a){return a.toString()})),this.$element.val(c).trigger("change")},e.prototype.destroy=function(){this.$container.remove(),this.$element[0].detachEvent&&this.$element[0].detachEvent("onpropertychange",this._syncA),null!=this._observer?(this._observer.disconnect(),this._observer=null):this.$element[0].removeEventListener&&(this.$element[0].removeEventListener("DOMAttrModified",this._syncA,!1),this.$element[0].removeEventListener("DOMNodeInserted",this._syncS,!1),this.$element[0].removeEventListener("DOMNodeRemoved",this._syncS,!1)),this._syncA=null,this._syncS=null,this.$element.off(".select2"),this.$element.attr("tabindex",this.$element.data("old-tabindex")),this.$element.removeClass("select2-hidden-accessible"),this.$element.attr("aria-hidden","false"),this.$element.removeData("select2"),this.dataAdapter.destroy(),this.selection.destroy(),this.dropdown.destroy(),this.results.destroy(),this.dataAdapter=null,this.selection=null,this.dropdown=null,this.results=null},e.prototype.render=function(){var b=a('<span class="select2 select2-container"><span class="selection"></span><span class="dropdown-wrapper" aria-hidden="true"></span></span>');return b.attr("dir",this.options.get("dir")),this.$container=b,this.$container.addClass("select2-container--"+this.options.get("theme")),b.data("element",this.$element),b},e}),b.define("jquery-mousewheel",["jquery"],function(a){return a}),b.define("jquery.select2",["jquery","jquery-mousewheel","./select2/core","./select2/defaults"],function(a,b,c,d){if(null==a.fn.select2){var e=["open","close","destroy"];a.fn.select2=function(b){if("object"==typeof(b=b||{}))return this.each(function(){var d=a.extend(!0,{},b);new c(a(this),d)}),this;if("string"==typeof b){var d,f=Array.prototype.slice.call(arguments,1);return this.each(function(){var c=a(this).data("select2");null==c&&window.console&&console.error&&console.error("The select2('"+b+"') method was called on an element that is not using Select2."),d=c[b].apply(c,f)}),a.inArray(b,e)>-1?this:d}throw new Error("Invalid arguments for Select2: "+b)}}return null==a.fn.select2.defaults&&(a.fn.select2.defaults=d),c}),{define:b.define,require:b.require}}(),c=b.require("jquery.select2");return a.fn.select2.amd=b,c});
\ No newline at end of file
diff --git a/htdocs/includes/jquery/plugins/select2/package.json b/htdocs/includes/jquery/plugins/select2/package.json
index 709cb1c66b4..69423b397dd 100644
--- a/htdocs/includes/jquery/plugins/select2/package.json
+++ b/htdocs/includes/jquery/plugins/select2/package.json
@@ -1,20 +1,73 @@
 {
-  "name" : "Select2",
+  "name": "select2",
   "description": "Select2 is a jQuery based replacement for select boxes. It supports searching, remote data sets, and infinite scrolling of results.",
-  "homepage": "http://ivaynberg.github.io/select2",
-  "author": "Igor Vaynberg",
-  "repository": {"type": "git", "url": "git://github.com/ivaynberg/select2.git"},
-  "main": "select2.js",
-  "version": "3.5.2",
-  "jspm": {
-    "main": "select2",
-    "files": ["select2.js", "select2.png", "select2.css", "select2-spinner.gif"],
-    "shim": {
-        "select2": {
-            "imports": ["jquery", "./select2.css!"],
-            "exports": "$"
-        }
+  "homepage": "https://select2.org",
+  "author": {
+    "name": "Kevin Brown",
+    "url": "https://github.com/kevin-brown"
+  },
+  "contributors": [
+    {
+      "name": "Igor Vaynberg",
+      "url": "https://github.com/ivaynberg"
     },
-    "buildConfig": { "uglify": true }
+    {
+      "name": "Alex Weissman",
+      "url": "https://github.com/alexweissman"
+    }
+  ],
+  "repository": {
+    "type": "git",
+    "url": "git://github.com/select2/select2.git"
+  },
+  "bugs": {
+    "url": "https://github.com/select2/select2/issues"
+  },
+  "keywords": [
+    "select",
+    "autocomplete",
+    "typeahead",
+    "dropdown",
+    "multiselect",
+    "tag",
+    "tagging"
+  ],
+  "license": "MIT",
+  "main": "dist/js/select2.js",
+  "files": [
+    "src",
+    "dist"
+  ],
+  "version": "4.0.4",
+  "jspm": {
+    "main": "js/select2",
+    "directories": {
+      "lib": "dist"
+    }
+  },
+  "devDependencies": {
+    "grunt": "^0.4.5",
+    "grunt-cli": "^0.1.13",
+    "grunt-contrib-clean": "^0.6.0",
+    "grunt-contrib-concat": "^0.4.0",
+    "grunt-contrib-connect": "^0.9.0",
+    "grunt-contrib-jshint": "^0.10.0",
+    "grunt-contrib-nodeunit": "~0.3.3",
+    "grunt-contrib-qunit": "~0.4.0",
+    "grunt-contrib-requirejs": "^0.4.4",
+    "grunt-contrib-symlink": "^0.3.0",
+    "grunt-contrib-uglify": "~0.4.0",
+    "grunt-contrib-watch": "~0.6.0",
+    "grunt-gh-pages": "^0.9.1",
+    "grunt-jekyll": "^0.4.2",
+    "grunt-sass": "^1.0.0",
+    "grunt-saucelabs": "^9.0.0",
+    "node-sass": "^4.5.3",
+    "request": "<=2.81.0",
+    "shrinkwrap": "^0.4.0"
+  },
+  "dependencies": {
+    "almond": "~0.3.1",
+    "jquery-mousewheel": "~3.1.13"
   }
 }
diff --git a/htdocs/includes/jquery/plugins/select2/release.sh b/htdocs/includes/jquery/plugins/select2/release.sh
deleted file mode 100755
index 3b63f96621e..00000000000
--- a/htdocs/includes/jquery/plugins/select2/release.sh
+++ /dev/null
@@ -1,79 +0,0 @@
-#!/bin/bash
-set -e
-
-echo -n "Enter the version for this release: "
-
-read ver
-
-if [ ! $ver ]; then
-	echo "Invalid version."
-	exit
-fi
-
-name="select2"
-js="$name.js"
-mini="$name.min.js"
-css="$name.css"
-release="$name-$ver"
-tag="$ver"
-branch="build-$ver"
-curbranch=`git branch | grep "*" | sed "s/* //"`
-timestamp=$(date)
-tokens="s/@@ver@@/$ver/g;s/\@@timestamp@@/$timestamp/g"
-remote="origin"
-
-echo "Pulling from origin"
-
-git pull
-
-echo "Updating Version Identifiers"
-
-sed -E -e "s/\"version\": \"([0-9\.]+)\",/\"version\": \"$ver\",/g" -i -- bower.json select2.jquery.json component.json composer.json package.json
-
-git add bower.json
-git add select2.jquery.json
-git add component.json
-git add composer.json
-git add package.json
-
-git commit -m "modified version identifiers in descriptors for release $ver"
-git push
-
-git branch "$branch"
-git checkout "$branch"
-
-echo "Tokenizing..."
-
-find . -name "$js" | xargs -I{} sed -e "$tokens" -i -- {}
-find . -name "$css" | xargs -I{} sed -e "$tokens" -i -- {}
-
-sed -e "s/latest/$ver/g" -i -- bower.json
-
-git add "$js"
-git add "$css"
-
-echo "Minifying..."
-
-echo "/*" > "$mini"
-cat LICENSE | sed "$tokens" >> "$mini"
-echo "*/" >> "$mini"
-
-curl -s \
-	--data-urlencode "js_code@$js" \
-	http://marijnhaverbeke.nl/uglifyjs \
-	>> "$mini"
-
-git add "$mini"
-
-git commit -m "release $ver"
-
-echo "Tagging..."
-git tag -a "$tag" -m "tagged version $ver"
-git push "$remote" --tags
-
-echo "Cleaning Up..."
-
-git checkout "$curbranch"
-git branch -D "$branch"
-
-echo "Done"
diff --git a/htdocs/includes/jquery/plugins/select2/select2-bootstrap.css b/htdocs/includes/jquery/plugins/select2/select2-bootstrap.css
deleted file mode 100644
index 3b83f0a2297..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2-bootstrap.css
+++ /dev/null
@@ -1,87 +0,0 @@
-.form-control .select2-choice {
-    border: 0;
-    border-radius: 2px;
-}
-
-.form-control .select2-choice .select2-arrow {
-    border-radius: 0 2px 2px 0;   
-}
-
-.form-control.select2-container {
-    height: auto !important;
-    padding: 0;
-}
-
-.form-control.select2-container.select2-dropdown-open {
-    border-color: #5897FB;
-    border-radius: 3px 3px 0 0;
-}
-
-.form-control .select2-container.select2-dropdown-open .select2-choices {
-    border-radius: 3px 3px 0 0;
-}
-
-.form-control.select2-container .select2-choices {
-    border: 0 !important;
-    border-radius: 3px;
-}
-
-.control-group.warning .select2-container .select2-choice,
-.control-group.warning .select2-container .select2-choices,
-.control-group.warning .select2-container-active .select2-choice,
-.control-group.warning .select2-container-active .select2-choices,
-.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choice,
-.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choices,
-.control-group.warning .select2-container-multi.select2-container-active .select2-choices {
-    border: 1px solid #C09853 !important;
-}
-
-.control-group.warning .select2-container .select2-choice div {
-    border-left: 1px solid #C09853 !important;
-    background: #FCF8E3 !important;
-}
-
-.control-group.error .select2-container .select2-choice,
-.control-group.error .select2-container .select2-choices,
-.control-group.error .select2-container-active .select2-choice,
-.control-group.error .select2-container-active .select2-choices,
-.control-group.error .select2-dropdown-open.select2-drop-above .select2-choice,
-.control-group.error .select2-dropdown-open.select2-drop-above .select2-choices,
-.control-group.error .select2-container-multi.select2-container-active .select2-choices {
-    border: 1px solid #B94A48 !important;
-}
-
-.control-group.error .select2-container .select2-choice div {
-    border-left: 1px solid #B94A48 !important;
-    background: #F2DEDE !important;
-}
-
-.control-group.info .select2-container .select2-choice,
-.control-group.info .select2-container .select2-choices,
-.control-group.info .select2-container-active .select2-choice,
-.control-group.info .select2-container-active .select2-choices,
-.control-group.info .select2-dropdown-open.select2-drop-above .select2-choice,
-.control-group.info .select2-dropdown-open.select2-drop-above .select2-choices,
-.control-group.info .select2-container-multi.select2-container-active .select2-choices {
-    border: 1px solid #3A87AD !important;
-}
-
-.control-group.info .select2-container .select2-choice div {
-    border-left: 1px solid #3A87AD !important;
-    background: #D9EDF7 !important;
-}
-
-.control-group.success .select2-container .select2-choice,
-.control-group.success .select2-container .select2-choices,
-.control-group.success .select2-container-active .select2-choice,
-.control-group.success .select2-container-active .select2-choices,
-.control-group.success .select2-dropdown-open.select2-drop-above .select2-choice,
-.control-group.success .select2-dropdown-open.select2-drop-above .select2-choices,
-.control-group.success .select2-container-multi.select2-container-active .select2-choices {
-    border: 1px solid #468847 !important;
-}
-
-.control-group.success .select2-container .select2-choice div {
-    border-left: 1px solid #468847 !important;
-    background: #DFF0D8 !important;
-}
diff --git a/htdocs/includes/jquery/plugins/select2/select2-spinner.gif b/htdocs/includes/jquery/plugins/select2/select2-spinner.gif
deleted file mode 100644
index 5b33f7e54f4e55b6b8774d86d96895db9af044b4..0000000000000000000000000000000000000000
GIT binary patch
literal 0
HcmV?d00001

literal 1849
zcma*odr(tX9tZI2z31lM+(&YVk%mZ}5P~KlG2s=WSbGzm0!x7^P##Mnh7t-jP!X0Q
zk_SQ}Po-L1tlDK;6l?(>v)e5ZBQx4|Y-Q?nr@Px3?9h(3ZWr3^tj=`TP57gKr87N$
zp2wWee1GRRCwo_xahnw)5cxNPJbCg2L6DV|6`#+yw6v6!mDS$f9-JvFD^n;GQ&UrZ
zzh5jCkByB101O60U0q#p_1BM>Cv-vP?&s4@g_((4_1L=L$(a91)0=J91Gas#R{McE
znYG^9*0A5YZ>#;~+Wkn(W5B0^yELIYLP!K}mB~<)AM@1&nqekynuaEGqP<JE0#l+(
z*R9joTN$nZ{F;;f_Nv(QpzP65;W)SYC;1+?>rzoH|KodRXJy)%+w_fu3nE5>@Bd_b
zqC$EQ;{c`T&?EsNO|igL9gC7Ygxv?aQUEXMq?~>wg{EyW;VcJ37CUF#HjrT=KQO_*
zS>M9yydXk18D(+QDJ1>r);Lav_uYKp$T?4vr{Q$lTo&pKv^?(>L-)G2*lwH!Ah7k?
z7oH<8h-(KTKt5V6$8gF)C7Io&P5=SjTh)=zV=E2EUhQZ<Wjvi)ks6lL7NUI41Suec
z%#@RZvp$b|KCxLd`PA8_!Ub^;+J%TE^_K&d6(i&k---epB#nC`b3_`MdhtuWMEe%I
z(wJ2$`EGgJTz=trW>P##L8S{d%UK>>+y82>+FV+#^BzW7u3F)Bb>=lYQ%%j`F>ASe
zo*cw@V#u6T`A2He;70mR(V&iV&-7{qP~=SRf&jm9-T{*ZeZ}$rd0#6c&fLG^xJcf5
z+p<`wJYgW+_s*V{uI$nMB;%8`S_3>PfGOj3Rq}@Cx^+j?rk92fANSFDBYnOqQ>Vdj
z)(|$AhP4t&Lb=Gvo2#3Gl%9<=Gv`Mz?Po@P4iLF!x}GUWJICDlFk-hS^Whyh7x~VH
z@0vD1>HYD4&e+~yzS*-sFR{9`{QEEZO1zg7>R&7cHts-6j!xHVdA8eI+ZlVzd%`es
zJT@$#GX(gvCJ1oJN%yLBK}{V=V;seo;!w|Yte!W1%5qLNFWqvZW>h&IiH+oPT=b@E
zPhGzv5=(Un*X>v`><w7vN-j#h05gB-F9AZf<&Z~SLlC&Nz^-G6DuPj|`n3d!<l7n!
z^9j1qeh2{s+i0tZ4@>%8h_nj^NdY<en;#4d>cE6NHS_ifkCV$*D)Tqrbu`s;<=t<4
zAHNqNV?6(g<1PY-w@#I-WYFViz?9TrkMr)u0g`O`u|>T;k|2sV*YF^pun<C(O34ry
z@yg-q+#%4rv$|41Y!PHPrjmV%@S3%TUelmz%~6?hLG4%mWKO9NB}mrI%KlhB`{^!g
zT?{Y#<ON%sq<!{buD;iH%`hL}N;>vT;$SuTy{j3Gv)yqD!R_CF>yR)MzmmYS5v+~R
zXAdD<Jm>%ng9?df;wd8GxR#%3O+gz};Vo;)sK%Bj-q>Oq%R7JU-KD?vYu>#2UjaDo
z&8$>5xW~?KPD_#XFToU1hIb*VOMidUr6iYiO0N|i-7s`T8!cFT`rN!^1Pt78J93i6
z5HI1wIM$94m{3SLDvISDe6$ZG1;eq_D9RTaaC>=cO{@Bs>$IlP<c+8wUtK_tPUz3j
z)>CPJJ$h$)-3vzNUQ6<Wm&Z5JfeG_o#I^S?ZP9*QGjsiJM3jH{?94}z{@d%97nOVw
zacge+X&InNUL3U(BUlor87ff?2qEf2c|yCI=Id~LI~<KyVA#R%nwHS3S<^IBTu|Jj
zW^-Xv#UBDqOwy>OsN#_zWxey!_9%hxwH2_dEJi=yY|1c7nDm2_Lm!Cof8-R_+9UkS
zcBE(o47yE)oMR(Q=dp1a2wTX5Kv<M)VDKP@wb$5DNEX!VTUn1Pd`taYrL9bpe}d9v
zqx3tu5NTGv8=X63WXPWMm1T8=ujh#QvSw5|(EZJ3$quU9*?0NxQKGsTrnFNF-ygOt
zYWPggi66%$nuj|v6!Ow2)>vGyLqlWTa7V&!A*|w|)ax~1_~aJ0=_Lilg*0iQk7#ZD
EAHN$8j{pDw

diff --git a/htdocs/includes/jquery/plugins/select2/select2.css b/htdocs/includes/jquery/plugins/select2/select2.css
deleted file mode 100644
index 16da8373f6f..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2.css
+++ /dev/null
@@ -1,704 +0,0 @@
-/*
-Version: 3.5.2 Timestamp: Sat Nov  1 14:43:36 EDT 2014
-*/
-.select2-container {
-    margin: 0;
-    position: relative;
-    display: inline-block;
-    /* inline-block for ie7 */
-    zoom: 1;
-    *display: inline;
-    vertical-align: middle;
-}
-
-.select2-container,
-.select2-drop,
-.select2-search,
-.select2-search input {
-  /*
-    Force border-box so that % widths fit the parent
-    container without overlap because of margin/padding.
-    More Info : http://www.quirksmode.org/css/box.html
-  */
-  -webkit-box-sizing: border-box; /* webkit */
-     -moz-box-sizing: border-box; /* firefox */
-          box-sizing: border-box; /* css3 */
-}
-
-.select2-container .select2-choice {
-    display: block;
-    height: 26px;
-    padding: 0 0 0 5px;
-    overflow: hidden;
-    position: relative;
-
-    border: 1px solid #aaa;
-    white-space: nowrap;
-    line-height: 26px;
-    color: #444;
-    text-decoration: none;
-
-    border-radius: 4px;
-
-    background-clip: padding-box;
-
-    -webkit-touch-callout: none;
-      -webkit-user-select: none;
-         -moz-user-select: none;
-          -ms-user-select: none;
-              user-select: none;
-
-    background-color: #fff;
-    background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff));
-    background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%);
-    background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%);
-    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0);
-    background-image: linear-gradient(to top, #eee 0%, #fff 50%);
-}
-
-html[dir="rtl"] .select2-container .select2-choice {
-    padding: 0 8px 0 0;
-}
-
-.select2-container.select2-drop-above .select2-choice {
-    border-bottom-color: #aaa;
-
-    border-radius: 0 0 4px 4px;
-
-    background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff));
-    background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%);
-    background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%);
-    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0);
-    background-image: linear-gradient(to bottom, #eee 0%, #fff 90%);
-}
-
-.select2-container.select2-allowclear .select2-choice .select2-chosen {
-    margin-right: 42px;
-}
-
-.select2-container .select2-choice > .select2-chosen {
-    margin-right: 26px;
-    display: block;
-    overflow: hidden;
-
-    white-space: nowrap;
-
-    text-overflow: ellipsis;
-    float: none;
-    width: auto;
-}
-
-html[dir="rtl"] .select2-container .select2-choice > .select2-chosen {
-    margin-left: 26px;
-    margin-right: 0;
-}
-
-.select2-container .select2-choice abbr {
-    display: none;
-    width: 12px;
-    height: 12px;
-    position: absolute;
-    right: 24px;
-    top: 8px;
-
-    font-size: 1px;
-    text-decoration: none;
-
-    border: 0;
-    background: url('select2.png') right top no-repeat;
-    cursor: pointer;
-    outline: 0;
-}
-
-.select2-container.select2-allowclear .select2-choice abbr {
-    display: inline-block;
-}
-
-.select2-container .select2-choice abbr:hover {
-    background-position: right -11px;
-    cursor: pointer;
-}
-
-.select2-drop-mask {
-    border: 0;
-    margin: 0;
-    padding: 0;
-    position: fixed;
-    left: 0;
-    top: 0;
-    min-height: 100%;
-    min-width: 100%;
-    height: auto;
-    width: auto;
-    opacity: 0;
-    z-index: 9998;
-    /* styles required for IE to work */
-    background-color: #fff;
-    filter: alpha(opacity=0);
-}
-
-.select2-drop {
-    width: 100%;
-    margin-top: -1px;
-    position: absolute;
-    z-index: 9999;
-    top: 100%;
-
-    background: #fff;
-    color: #000;
-    border: 1px solid #aaa;
-    border-top: 0;
-
-    border-radius: 0 0 4px 4px;
-
-    -webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
-            box-shadow: 0 4px 5px rgba(0, 0, 0, .15);
-}
-
-.select2-drop.select2-drop-above {
-    margin-top: 1px;
-    border-top: 1px solid #aaa;
-    border-bottom: 0;
-
-    border-radius: 4px 4px 0 0;
-
-    -webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
-            box-shadow: 0 -4px 5px rgba(0, 0, 0, .15);
-}
-
-.select2-drop-active {
-    border: 1px solid #5897fb;
-    border-top: none;
-}
-
-.select2-drop.select2-drop-above.select2-drop-active {
-    border-top: 1px solid #5897fb;
-}
-
-.select2-drop-auto-width {
-    border-top: 1px solid #aaa;
-    width: auto;
-}
-
-.select2-drop-auto-width .select2-search {
-    padding-top: 4px;
-}
-
-.select2-container .select2-choice .select2-arrow {
-    display: inline-block;
-    width: 18px;
-    height: 100%;
-    position: absolute;
-    right: 0;
-    top: 0;
-
-    border-left: 1px solid #aaa;
-    border-radius: 0 4px 4px 0;
-
-    background-clip: padding-box;
-
-    background: #ccc;
-    background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee));
-    background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%);
-    background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%);
-    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0);
-    background-image: linear-gradient(to top, #ccc 0%, #eee 60%);
-}
-
-html[dir="rtl"] .select2-container .select2-choice .select2-arrow {
-    left: 0;
-    right: auto;
-
-    border-left: none;
-    border-right: 1px solid #aaa;
-    border-radius: 4px 0 0 4px;
-}
-
-.select2-container .select2-choice .select2-arrow b {
-    display: block;
-    width: 100%;
-    height: 100%;
-    background: url('select2.png') no-repeat 0 1px;
-}
-
-html[dir="rtl"] .select2-container .select2-choice .select2-arrow b {
-    background-position: 2px 1px;
-}
-
-.select2-search {
-    display: inline-block;
-    width: 100%;
-    min-height: 26px;
-    margin: 0;
-    padding-left: 4px;
-    padding-right: 4px;
-
-    position: relative;
-    z-index: 10000;
-
-    white-space: nowrap;
-}
-
-.select2-search input {
-    width: 100%;
-    height: auto !important;
-    min-height: 26px;
-    padding: 4px 20px 4px 5px;
-    margin: 0;
-
-    outline: 0;
-    font-family: sans-serif;
-    font-size: 1em;
-
-    border: 1px solid #aaa;
-    border-radius: 0;
-
-    -webkit-box-shadow: none;
-            box-shadow: none;
-
-    background: #fff url('select2.png') no-repeat 100% -22px;
-    background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
-    background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
-    background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
-    background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
-}
-
-html[dir="rtl"] .select2-search input {
-    padding: 4px 5px 4px 20px;
-
-    background: #fff url('select2.png') no-repeat -37px -22px;
-    background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
-    background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
-    background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
-    background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
-}
-
-.select2-drop.select2-drop-above .select2-search input {
-    margin-top: 4px;
-}
-
-.select2-search input.select2-active {
-    background: #fff url('select2-spinner.gif') no-repeat 100%;
-    background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee));
-    background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%);
-    background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%);
-    background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0;
-}
-
-.select2-container-active .select2-choice,
-.select2-container-active .select2-choices {
-    border: 1px solid #5897fb;
-    outline: none;
-
-    -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
-            box-shadow: 0 0 5px rgba(0, 0, 0, .3);
-}
-
-.select2-dropdown-open .select2-choice {
-    border-bottom-color: transparent;
-    -webkit-box-shadow: 0 1px 0 #fff inset;
-            box-shadow: 0 1px 0 #fff inset;
-
-    border-bottom-left-radius: 0;
-    border-bottom-right-radius: 0;
-
-    background-color: #eee;
-    background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee));
-    background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%);
-    background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%);
-    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
-    background-image: linear-gradient(to top, #fff 0%, #eee 50%);
-}
-
-.select2-dropdown-open.select2-drop-above .select2-choice,
-.select2-dropdown-open.select2-drop-above .select2-choices {
-    border: 1px solid #5897fb;
-    border-top-color: transparent;
-
-    background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee));
-    background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%);
-    background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%);
-    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0);
-    background-image: linear-gradient(to bottom, #fff 0%, #eee 50%);
-}
-
-.select2-dropdown-open .select2-choice .select2-arrow {
-    background: transparent;
-    border-left: none;
-    filter: none;
-}
-html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow {
-    border-right: none;
-}
-
-.select2-dropdown-open .select2-choice .select2-arrow b {
-    background-position: -18px 1px;
-}
-
-html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b {
-    background-position: -16px 1px;
-}
-
-.select2-hidden-accessible {
-    border: 0;
-    clip: rect(0 0 0 0);
-    height: 1px;
-    margin: -1px;
-    overflow: hidden;
-    padding: 0;
-    position: absolute;
-    width: 1px;
-}
-
-/* results */
-.select2-results {
-    max-height: 200px;
-    padding: 0 0 0 4px;
-    margin: 4px 4px 4px 0;
-    position: relative;
-    overflow-x: hidden;
-    overflow-y: auto;
-    -webkit-tap-highlight-color: rgba(0, 0, 0, 0);
-}
-
-html[dir="rtl"] .select2-results {
-    padding: 0 4px 0 0;
-    margin: 4px 0 4px 4px;
-}
-
-.select2-results ul.select2-result-sub {
-    margin: 0;
-    padding-left: 0;
-}
-
-.select2-results li {
-    list-style: none;
-    display: list-item;
-    background-image: none;
-}
-
-.select2-results li.select2-result-with-children > .select2-result-label {
-    font-weight: bold;
-}
-
-.select2-results .select2-result-label {
-    padding: 3px 7px 4px;
-    margin: 0;
-    cursor: pointer;
-
-    min-height: 1em;
-
-    -webkit-touch-callout: none;
-      -webkit-user-select: none;
-         -moz-user-select: none;
-          -ms-user-select: none;
-              user-select: none;
-}
-
-.select2-results-dept-1 .select2-result-label { padding-left: 20px }
-.select2-results-dept-2 .select2-result-label { padding-left: 40px }
-.select2-results-dept-3 .select2-result-label { padding-left: 60px }
-.select2-results-dept-4 .select2-result-label { padding-left: 80px }
-.select2-results-dept-5 .select2-result-label { padding-left: 100px }
-.select2-results-dept-6 .select2-result-label { padding-left: 110px }
-.select2-results-dept-7 .select2-result-label { padding-left: 120px }
-
-.select2-results .select2-highlighted {
-    background: #3875d7;
-    color: #fff;
-}
-
-.select2-results li em {
-    background: #feffde;
-    font-style: normal;
-}
-
-.select2-results .select2-highlighted em {
-    background: transparent;
-}
-
-.select2-results .select2-highlighted ul {
-    background: #fff;
-    color: #000;
-}
-
-.select2-results .select2-no-results,
-.select2-results .select2-searching,
-.select2-results .select2-ajax-error,
-.select2-results .select2-selection-limit {
-    background: #f4f4f4;
-    display: list-item;
-    padding-left: 5px;
-}
-
-/*
-disabled look for disabled choices in the results dropdown
-*/
-.select2-results .select2-disabled.select2-highlighted {
-    color: #666;
-    background: #f4f4f4;
-    display: list-item;
-    cursor: default;
-}
-.select2-results .select2-disabled {
-  background: #f4f4f4;
-  display: list-item;
-  cursor: default;
-}
-
-.select2-results .select2-selected {
-    display: none;
-}
-
-.select2-more-results.select2-active {
-    background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%;
-}
-
-.select2-results .select2-ajax-error {
-    background: rgba(255, 50, 50, .2);
-}
-
-.select2-more-results {
-    background: #f4f4f4;
-    display: list-item;
-}
-
-/* disabled styles */
-
-.select2-container.select2-container-disabled .select2-choice {
-    background-color: #f4f4f4;
-    background-image: none;
-    border: 1px solid #ddd;
-    cursor: default;
-}
-
-.select2-container.select2-container-disabled .select2-choice .select2-arrow {
-    background-color: #f4f4f4;
-    background-image: none;
-    border-left: 0;
-}
-
-.select2-container.select2-container-disabled .select2-choice abbr {
-    display: none;
-}
-
-
-/* multiselect */
-
-.select2-container-multi .select2-choices {
-    height: auto !important;
-    height: 1%;
-    margin: 0;
-    padding: 0 5px 0 0;
-    position: relative;
-
-    border: 1px solid #aaa;
-    cursor: text;
-    overflow: hidden;
-
-    background-color: #fff;
-    background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff));
-    background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%);
-    background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%);
-    background-image: linear-gradient(to bottom, #eee 1%, #fff 15%);
-}
-
-html[dir="rtl"] .select2-container-multi .select2-choices {
-    padding: 0 0 0 5px;
-}
-
-.select2-locked {
-  padding: 3px 5px 3px 5px !important;
-}
-
-.select2-container-multi .select2-choices {
-    min-height: 26px;
-}
-
-.select2-container-multi.select2-container-active .select2-choices {
-    border: 1px solid #5897fb;
-    outline: none;
-
-    -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3);
-            box-shadow: 0 0 5px rgba(0, 0, 0, .3);
-}
-.select2-container-multi .select2-choices li {
-    float: left;
-    list-style: none;
-}
-html[dir="rtl"] .select2-container-multi .select2-choices li
-{
-    float: right;
-}
-.select2-container-multi .select2-choices .select2-search-field {
-    margin: 0;
-    padding: 0;
-    white-space: nowrap;
-}
-
-.select2-container-multi .select2-choices .select2-search-field input {
-    padding: 5px;
-    margin: 1px 0;
-
-    font-family: sans-serif;
-    font-size: 100%;
-    color: #666;
-    outline: 0;
-    border: 0;
-    -webkit-box-shadow: none;
-            box-shadow: none;
-    background: transparent !important;
-}
-
-.select2-container-multi .select2-choices .select2-search-field input.select2-active {
-    background: #fff url('select2-spinner.gif') no-repeat 100% !important;
-}
-
-.select2-default {
-    color: #999 !important;
-}
-
-.select2-container-multi .select2-choices .select2-search-choice {
-    padding: 3px 5px 3px 18px;
-    margin: 3px 0 3px 5px;
-    position: relative;
-
-    line-height: 13px;
-    color: #333;
-    cursor: default;
-    border: 1px solid #aaaaaa;
-
-    border-radius: 3px;
-
-    -webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
-            box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05);
-
-    background-clip: padding-box;
-
-    -webkit-touch-callout: none;
-      -webkit-user-select: none;
-         -moz-user-select: none;
-          -ms-user-select: none;
-              user-select: none;
-
-    background-color: #e4e4e4;
-    filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0);
-    background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee));
-    background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
-    background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
-    background-image: linear-gradient(to bottom, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%);
-}
-html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice
-{
-    margin: 3px 5px 3px 0;
-    padding: 3px 18px 3px 5px;
-}
-.select2-container-multi .select2-choices .select2-search-choice .select2-chosen {
-    cursor: default;
-}
-.select2-container-multi .select2-choices .select2-search-choice-focus {
-    background: #d4d4d4;
-}
-
-.select2-search-choice-close {
-    display: block;
-    width: 12px;
-    height: 13px;
-    position: absolute;
-    right: 3px;
-    top: 4px;
-
-    font-size: 1px;
-    outline: none;
-    background: url('select2.png') right top no-repeat;
-}
-html[dir="rtl"] .select2-search-choice-close {
-    right: auto;
-    left: 3px;
-}
-
-.select2-container-multi .select2-search-choice-close {
-    left: 3px;
-}
-
-html[dir="rtl"] .select2-container-multi .select2-search-choice-close {
-    left: auto;
-    right: 2px;
-}
-
-.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover {
-  background-position: right -11px;
-}
-.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close {
-    background-position: right -11px;
-}
-
-/* disabled styles */
-.select2-container-multi.select2-container-disabled .select2-choices {
-    background-color: #f4f4f4;
-    background-image: none;
-    border: 1px solid #ddd;
-    cursor: default;
-}
-
-.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice {
-    padding: 3px 5px 3px 5px;
-    border: 1px solid #ddd;
-    background-image: none;
-    background-color: #f4f4f4;
-}
-
-.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close {    display: none;
-    background: none;
-}
-/* end multiselect */
-
-
-.select2-result-selectable .select2-match,
-.select2-result-unselectable .select2-match {
-    text-decoration: underline;
-}
-
-.select2-offscreen, .select2-offscreen:focus {
-    clip: rect(0 0 0 0) !important;
-    width: 1px !important;
-    height: 1px !important;
-    border: 0 !important;
-    margin: 0 !important;
-    padding: 0 !important;
-    overflow: hidden !important;
-    position: absolute !important;
-    outline: 0 !important;
-    left: 0px !important;
-    top: 0px !important;
-}
-
-.select2-display-none {
-    display: none;
-}
-
-.select2-measure-scrollbar {
-    position: absolute;
-    top: -10000px;
-    left: -10000px;
-    width: 100px;
-    height: 100px;
-    overflow: scroll;
-}
-
-/* Retina-ize icons */
-
-@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx)  {
-    .select2-search input,
-    .select2-search-choice-close,
-    .select2-container .select2-choice abbr,
-    .select2-container .select2-choice .select2-arrow b {
-        background-image: url('select2x2.png') !important;
-        background-repeat: no-repeat !important;
-        background-size: 60px 40px !important;
-    }
-
-    .select2-search input {
-        background-position: 100% -21px !important;
-    }
-}
diff --git a/htdocs/includes/jquery/plugins/select2/select2.jquery.json b/htdocs/includes/jquery/plugins/select2/select2.jquery.json
index b005d8a2017..92b7c057a59 100644
--- a/htdocs/includes/jquery/plugins/select2/select2.jquery.json
+++ b/htdocs/includes/jquery/plugins/select2/select2.jquery.json
@@ -11,26 +11,22 @@
         "tag",
         "tagging"
     ],
-    "version": "3.5.2",
+    "version": "4.0.4",
     "author": {
-        "name": "Igor Vaynberg",
-        "url": "https://github.com/ivaynberg"
+        "name": "Kevin Brown",
+        "url": "https://github.com/kevin-brown"
     },
     "licenses": [
         {
-            "type": "Apache",
-            "url": "http://www.apache.org/licenses/LICENSE-2.0"
-        },
-        {
-            "type": "GPL v2",
-            "url": "http://www.gnu.org/licenses/gpl-2.0.html"
+            "type": "MIT",
+            "url": "http://opensource.org/licenses/MIT"
         }
     ],
-    "bugs": "https://github.com/ivaynberg/select2/issues",
-    "homepage": "http://ivaynberg.github.com/select2",
-    "docs": "http://ivaynberg.github.com/select2/",
-    "download": "https://github.com/ivaynberg/select2/tags",
+    "bugs": "https://github.com/select2/select2/issues",
+    "homepage": "https://select2.org",
+    "docs": "https://select2.org",
+    "download": "https://github.com/select2/select2/releases",
     "dependencies": {
-        "jquery": ">=1.7.1"
+        "jquery": ">=1.7.2"
     }
 }
diff --git a/htdocs/includes/jquery/plugins/select2/select2.js b/htdocs/includes/jquery/plugins/select2/select2.js
deleted file mode 100644
index a7a7c044497..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2.js
+++ /dev/null
@@ -1,3541 +0,0 @@
-/*
-Copyright 2012 Igor Vaynberg
-
-Version: 3.5.2 Timestamp: Sat Nov  1 14:43:36 EDT 2014
-
-This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
-General Public License version 2 (the "GPL License"). You may choose either license to govern your
-use of this software only upon the condition that you accept all of the terms of either the Apache
-License or the GPL License.
-
-You may obtain a copy of the Apache License and the GPL License at:
-
-    http://www.apache.org/licenses/LICENSE-2.0
-    http://www.gnu.org/licenses/gpl-2.0.html
-
-Unless required by applicable law or agreed to in writing, software distributed under the
-Apache License or the GPL License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
-CONDITIONS OF ANY KIND, either express or implied. See the Apache License and the GPL License for
-the specific language governing permissions and limitations under the Apache License and the GPL License.
-*/
-(function ($) {
-    if(typeof $.fn.each2 == "undefined") {
-        $.extend($.fn, {
-            /*
-            * 4-10 times faster .each replacement
-            * use it carefully, as it overrides jQuery context of element on each iteration
-            */
-            each2 : function (c) {
-                var j = $([0]), i = -1, l = this.length;
-                while (
-                    ++i < l
-                    && (j.context = j[0] = this[i])
-                    && c.call(j[0], i, j) !== false //"this"=DOM, i=index, j=jQuery object
-                );
-                return this;
-            }
-        });
-    }
-})(jQuery);
-
-(function ($, undefined) {
-    "use strict";
-    /*global document, window, jQuery, console */
-
-    if (window.Select2 !== undefined) {
-        return;
-    }
-
-    var AbstractSelect2, SingleSelect2, MultiSelect2, nextUid, sizer,
-        lastMousePosition={x:0,y:0}, $document, scrollBarDimensions,
-
-    KEY = {
-        TAB: 9,
-        ENTER: 13,
-        ESC: 27,
-        SPACE: 32,
-        LEFT: 37,
-        UP: 38,
-        RIGHT: 39,
-        DOWN: 40,
-        SHIFT: 16,
-        CTRL: 17,
-        ALT: 18,
-        PAGE_UP: 33,
-        PAGE_DOWN: 34,
-        HOME: 36,
-        END: 35,
-        BACKSPACE: 8,
-        DELETE: 46,
-        isArrow: function (k) {
-            k = k.which ? k.which : k;
-            switch (k) {
-            case KEY.LEFT:
-            case KEY.RIGHT:
-            case KEY.UP:
-            case KEY.DOWN:
-                return true;
-            }
-            return false;
-        },
-        isControl: function (e) {
-            var k = e.which;
-            switch (k) {
-            case KEY.SHIFT:
-            case KEY.CTRL:
-            case KEY.ALT:
-                return true;
-            }
-
-            if (e.metaKey) return true;
-
-            return false;
-        },
-        isFunctionKey: function (k) {
-            k = k.which ? k.which : k;
-            return k >= 112 && k <= 123;
-        }
-    },
-    MEASURE_SCROLLBAR_TEMPLATE = "<div class='select2-measure-scrollbar'></div>",
-
-    DIACRITICS = {"\u24B6":"A","\uFF21":"A","\u00C0":"A","\u00C1":"A","\u00C2":"A","\u1EA6":"A","\u1EA4":"A","\u1EAA":"A","\u1EA8":"A","\u00C3":"A","\u0100":"A","\u0102":"A","\u1EB0":"A","\u1EAE":"A","\u1EB4":"A","\u1EB2":"A","\u0226":"A","\u01E0":"A","\u00C4":"A","\u01DE":"A","\u1EA2":"A","\u00C5":"A","\u01FA":"A","\u01CD":"A","\u0200":"A","\u0202":"A","\u1EA0":"A","\u1EAC":"A","\u1EB6":"A","\u1E00":"A","\u0104":"A","\u023A":"A","\u2C6F":"A","\uA732":"AA","\u00C6":"AE","\u01FC":"AE","\u01E2":"AE","\uA734":"AO","\uA736":"AU","\uA738":"AV","\uA73A":"AV","\uA73C":"AY","\u24B7":"B","\uFF22":"B","\u1E02":"B","\u1E04":"B","\u1E06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24B8":"C","\uFF23":"C","\u0106":"C","\u0108":"C","\u010A":"C","\u010C":"C","\u00C7":"C","\u1E08":"C","\u0187":"C","\u023B":"C","\uA73E":"C","\u24B9":"D","\uFF24":"D","\u1E0A":"D","\u010E":"D","\u1E0C":"D","\u1E10":"D","\u1E12":"D","\u1E0E":"D","\u0110":"D","\u018B":"D","\u018A":"D","\u0189":"D","\uA779":"D","\u01F1":"DZ","\u01C4":"DZ","\u01F2":"Dz","\u01C5":"Dz","\u24BA":"E","\uFF25":"E","\u00C8":"E","\u00C9":"E","\u00CA":"E","\u1EC0":"E","\u1EBE":"E","\u1EC4":"E","\u1EC2":"E","\u1EBC":"E","\u0112":"E","\u1E14":"E","\u1E16":"E","\u0114":"E","\u0116":"E","\u00CB":"E","\u1EBA":"E","\u011A":"E","\u0204":"E","\u0206":"E","\u1EB8":"E","\u1EC6":"E","\u0228":"E","\u1E1C":"E","\u0118":"E","\u1E18":"E","\u1E1A":"E","\u0190":"E","\u018E":"E","\u24BB":"F","\uFF26":"F","\u1E1E":"F","\u0191":"F","\uA77B":"F","\u24BC":"G","\uFF27":"G","\u01F4":"G","\u011C":"G","\u1E20":"G","\u011E":"G","\u0120":"G","\u01E6":"G","\u0122":"G","\u01E4":"G","\u0193":"G","\uA7A0":"G","\uA77D":"G","\uA77E":"G","\u24BD":"H","\uFF28":"H","\u0124":"H","\u1E22":"H","\u1E26":"H","\u021E":"H","\u1E24":"H","\u1E28":"H","\u1E2A":"H","\u0126":"H","\u2C67":"H","\u2C75":"H","\uA78D":"H","\u24BE":"I","\uFF29":"I","\u00CC":"I","\u00CD":"I","\u00CE":"I","\u0128":"I","\u012A":"I","\u012C":"I","\u0130":"I","\u00CF":"I","\u1E2E":"I","\u1EC8":"I","\u01CF":"I","\u0208":"I","\u020A":"I","\u1ECA":"I","\u012E":"I","\u1E2C":"I","\u0197":"I","\u24BF":"J","\uFF2A":"J","\u0134":"J","\u0248":"J","\u24C0":"K","\uFF2B":"K","\u1E30":"K","\u01E8":"K","\u1E32":"K","\u0136":"K","\u1E34":"K","\u0198":"K","\u2C69":"K","\uA740":"K","\uA742":"K","\uA744":"K","\uA7A2":"K","\u24C1":"L","\uFF2C":"L","\u013F":"L","\u0139":"L","\u013D":"L","\u1E36":"L","\u1E38":"L","\u013B":"L","\u1E3C":"L","\u1E3A":"L","\u0141":"L","\u023D":"L","\u2C62":"L","\u2C60":"L","\uA748":"L","\uA746":"L","\uA780":"L","\u01C7":"LJ","\u01C8":"Lj","\u24C2":"M","\uFF2D":"M","\u1E3E":"M","\u1E40":"M","\u1E42":"M","\u2C6E":"M","\u019C":"M","\u24C3":"N","\uFF2E":"N","\u01F8":"N","\u0143":"N","\u00D1":"N","\u1E44":"N","\u0147":"N","\u1E46":"N","\u0145":"N","\u1E4A":"N","\u1E48":"N","\u0220":"N","\u019D":"N","\uA790":"N","\uA7A4":"N","\u01CA":"NJ","\u01CB":"Nj","\u24C4":"O","\uFF2F":"O","\u00D2":"O","\u00D3":"O","\u00D4":"O","\u1ED2":"O","\u1ED0":"O","\u1ED6":"O","\u1ED4":"O","\u00D5":"O","\u1E4C":"O","\u022C":"O","\u1E4E":"O","\u014C":"O","\u1E50":"O","\u1E52":"O","\u014E":"O","\u022E":"O","\u0230":"O","\u00D6":"O","\u022A":"O","\u1ECE":"O","\u0150":"O","\u01D1":"O","\u020C":"O","\u020E":"O","\u01A0":"O","\u1EDC":"O","\u1EDA":"O","\u1EE0":"O","\u1EDE":"O","\u1EE2":"O","\u1ECC":"O","\u1ED8":"O","\u01EA":"O","\u01EC":"O","\u00D8":"O","\u01FE":"O","\u0186":"O","\u019F":"O","\uA74A":"O","\uA74C":"O","\u01A2":"OI","\uA74E":"OO","\u0222":"OU","\u24C5":"P","\uFF30":"P","\u1E54":"P","\u1E56":"P","\u01A4":"P","\u2C63":"P","\uA750":"P","\uA752":"P","\uA754":"P","\u24C6":"Q","\uFF31":"Q","\uA756":"Q","\uA758":"Q","\u024A":"Q","\u24C7":"R","\uFF32":"R","\u0154":"R","\u1E58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1E5A":"R","\u1E5C":"R","\u0156":"R","\u1E5E":"R","\u024C":"R","\u2C64":"R","\uA75A":"R","\uA7A6":"R","\uA782":"R","\u24C8":"S","\uFF33":"S","\u1E9E":"S","\u015A":"S","\u1E64":"S","\u015C":"S","\u1E60":"S","\u0160":"S","\u1E66":"S","\u1E62":"S","\u1E68":"S","\u0218":"S","\u015E":"S","\u2C7E":"S","\uA7A8":"S","\uA784":"S","\u24C9":"T","\uFF34":"T","\u1E6A":"T","\u0164":"T","\u1E6C":"T","\u021A":"T","\u0162":"T","\u1E70":"T","\u1E6E":"T","\u0166":"T","\u01AC":"T","\u01AE":"T","\u023E":"T","\uA786":"T","\uA728":"TZ","\u24CA":"U","\uFF35":"U","\u00D9":"U","\u00DA":"U","\u00DB":"U","\u0168":"U","\u1E78":"U","\u016A":"U","\u1E7A":"U","\u016C":"U","\u00DC":"U","\u01DB":"U","\u01D7":"U","\u01D5":"U","\u01D9":"U","\u1EE6":"U","\u016E":"U","\u0170":"U","\u01D3":"U","\u0214":"U","\u0216":"U","\u01AF":"U","\u1EEA":"U","\u1EE8":"U","\u1EEE":"U","\u1EEC":"U","\u1EF0":"U","\u1EE4":"U","\u1E72":"U","\u0172":"U","\u1E76":"U","\u1E74":"U","\u0244":"U","\u24CB":"V","\uFF36":"V","\u1E7C":"V","\u1E7E":"V","\u01B2":"V","\uA75E":"V","\u0245":"V","\uA760":"VY","\u24CC":"W","\uFF37":"W","\u1E80":"W","\u1E82":"W","\u0174":"W","\u1E86":"W","\u1E84":"W","\u1E88":"W","\u2C72":"W","\u24CD":"X","\uFF38":"X","\u1E8A":"X","\u1E8C":"X","\u24CE":"Y","\uFF39":"Y","\u1EF2":"Y","\u00DD":"Y","\u0176":"Y","\u1EF8":"Y","\u0232":"Y","\u1E8E":"Y","\u0178":"Y","\u1EF6":"Y","\u1EF4":"Y","\u01B3":"Y","\u024E":"Y","\u1EFE":"Y","\u24CF":"Z","\uFF3A":"Z","\u0179":"Z","\u1E90":"Z","\u017B":"Z","\u017D":"Z","\u1E92":"Z","\u1E94":"Z","\u01B5":"Z","\u0224":"Z","\u2C7F":"Z","\u2C6B":"Z","\uA762":"Z","\u24D0":"a","\uFF41":"a","\u1E9A":"a","\u00E0":"a","\u00E1":"a","\u00E2":"a","\u1EA7":"a","\u1EA5":"a","\u1EAB":"a","\u1EA9":"a","\u00E3":"a","\u0101":"a","\u0103":"a","\u1EB1":"a","\u1EAF":"a","\u1EB5":"a","\u1EB3":"a","\u0227":"a","\u01E1":"a","\u00E4":"a","\u01DF":"a","\u1EA3":"a","\u00E5":"a","\u01FB":"a","\u01CE":"a","\u0201":"a","\u0203":"a","\u1EA1":"a","\u1EAD":"a","\u1EB7":"a","\u1E01":"a","\u0105":"a","\u2C65":"a","\u0250":"a","\uA733":"aa","\u00E6":"ae","\u01FD":"ae","\u01E3":"ae","\uA735":"ao","\uA737":"au","\uA739":"av","\uA73B":"av","\uA73D":"ay","\u24D1":"b","\uFF42":"b","\u1E03":"b","\u1E05":"b","\u1E07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24D2":"c","\uFF43":"c","\u0107":"c","\u0109":"c","\u010B":"c","\u010D":"c","\u00E7":"c","\u1E09":"c","\u0188":"c","\u023C":"c","\uA73F":"c","\u2184":"c","\u24D3":"d","\uFF44":"d","\u1E0B":"d","\u010F":"d","\u1E0D":"d","\u1E11":"d","\u1E13":"d","\u1E0F":"d","\u0111":"d","\u018C":"d","\u0256":"d","\u0257":"d","\uA77A":"d","\u01F3":"dz","\u01C6":"dz","\u24D4":"e","\uFF45":"e","\u00E8":"e","\u00E9":"e","\u00EA":"e","\u1EC1":"e","\u1EBF":"e","\u1EC5":"e","\u1EC3":"e","\u1EBD":"e","\u0113":"e","\u1E15":"e","\u1E17":"e","\u0115":"e","\u0117":"e","\u00EB":"e","\u1EBB":"e","\u011B":"e","\u0205":"e","\u0207":"e","\u1EB9":"e","\u1EC7":"e","\u0229":"e","\u1E1D":"e","\u0119":"e","\u1E19":"e","\u1E1B":"e","\u0247":"e","\u025B":"e","\u01DD":"e","\u24D5":"f","\uFF46":"f","\u1E1F":"f","\u0192":"f","\uA77C":"f","\u24D6":"g","\uFF47":"g","\u01F5":"g","\u011D":"g","\u1E21":"g","\u011F":"g","\u0121":"g","\u01E7":"g","\u0123":"g","\u01E5":"g","\u0260":"g","\uA7A1":"g","\u1D79":"g","\uA77F":"g","\u24D7":"h","\uFF48":"h","\u0125":"h","\u1E23":"h","\u1E27":"h","\u021F":"h","\u1E25":"h","\u1E29":"h","\u1E2B":"h","\u1E96":"h","\u0127":"h","\u2C68":"h","\u2C76":"h","\u0265":"h","\u0195":"hv","\u24D8":"i","\uFF49":"i","\u00EC":"i","\u00ED":"i","\u00EE":"i","\u0129":"i","\u012B":"i","\u012D":"i","\u00EF":"i","\u1E2F":"i","\u1EC9":"i","\u01D0":"i","\u0209":"i","\u020B":"i","\u1ECB":"i","\u012F":"i","\u1E2D":"i","\u0268":"i","\u0131":"i","\u24D9":"j","\uFF4A":"j","\u0135":"j","\u01F0":"j","\u0249":"j","\u24DA":"k","\uFF4B":"k","\u1E31":"k","\u01E9":"k","\u1E33":"k","\u0137":"k","\u1E35":"k","\u0199":"k","\u2C6A":"k","\uA741":"k","\uA743":"k","\uA745":"k","\uA7A3":"k","\u24DB":"l","\uFF4C":"l","\u0140":"l","\u013A":"l","\u013E":"l","\u1E37":"l","\u1E39":"l","\u013C":"l","\u1E3D":"l","\u1E3B":"l","\u017F":"l","\u0142":"l","\u019A":"l","\u026B":"l","\u2C61":"l","\uA749":"l","\uA781":"l","\uA747":"l","\u01C9":"lj","\u24DC":"m","\uFF4D":"m","\u1E3F":"m","\u1E41":"m","\u1E43":"m","\u0271":"m","\u026F":"m","\u24DD":"n","\uFF4E":"n","\u01F9":"n","\u0144":"n","\u00F1":"n","\u1E45":"n","\u0148":"n","\u1E47":"n","\u0146":"n","\u1E4B":"n","\u1E49":"n","\u019E":"n","\u0272":"n","\u0149":"n","\uA791":"n","\uA7A5":"n","\u01CC":"nj","\u24DE":"o","\uFF4F":"o","\u00F2":"o","\u00F3":"o","\u00F4":"o","\u1ED3":"o","\u1ED1":"o","\u1ED7":"o","\u1ED5":"o","\u00F5":"o","\u1E4D":"o","\u022D":"o","\u1E4F":"o","\u014D":"o","\u1E51":"o","\u1E53":"o","\u014F":"o","\u022F":"o","\u0231":"o","\u00F6":"o","\u022B":"o","\u1ECF":"o","\u0151":"o","\u01D2":"o","\u020D":"o","\u020F":"o","\u01A1":"o","\u1EDD":"o","\u1EDB":"o","\u1EE1":"o","\u1EDF":"o","\u1EE3":"o","\u1ECD":"o","\u1ED9":"o","\u01EB":"o","\u01ED":"o","\u00F8":"o","\u01FF":"o","\u0254":"o","\uA74B":"o","\uA74D":"o","\u0275":"o","\u01A3":"oi","\u0223":"ou","\uA74F":"oo","\u24DF":"p","\uFF50":"p","\u1E55":"p","\u1E57":"p","\u01A5":"p","\u1D7D":"p","\uA751":"p","\uA753":"p","\uA755":"p","\u24E0":"q","\uFF51":"q","\u024B":"q","\uA757":"q","\uA759":"q","\u24E1":"r","\uFF52":"r","\u0155":"r","\u1E59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1E5B":"r","\u1E5D":"r","\u0157":"r","\u1E5F":"r","\u024D":"r","\u027D":"r","\uA75B":"r","\uA7A7":"r","\uA783":"r","\u24E2":"s","\uFF53":"s","\u00DF":"s","\u015B":"s","\u1E65":"s","\u015D":"s","\u1E61":"s","\u0161":"s","\u1E67":"s","\u1E63":"s","\u1E69":"s","\u0219":"s","\u015F":"s","\u023F":"s","\uA7A9":"s","\uA785":"s","\u1E9B":"s","\u24E3":"t","\uFF54":"t","\u1E6B":"t","\u1E97":"t","\u0165":"t","\u1E6D":"t","\u021B":"t","\u0163":"t","\u1E71":"t","\u1E6F":"t","\u0167":"t","\u01AD":"t","\u0288":"t","\u2C66":"t","\uA787":"t","\uA729":"tz","\u24E4":"u","\uFF55":"u","\u00F9":"u","\u00FA":"u","\u00FB":"u","\u0169":"u","\u1E79":"u","\u016B":"u","\u1E7B":"u","\u016D":"u","\u00FC":"u","\u01DC":"u","\u01D8":"u","\u01D6":"u","\u01DA":"u","\u1EE7":"u","\u016F":"u","\u0171":"u","\u01D4":"u","\u0215":"u","\u0217":"u","\u01B0":"u","\u1EEB":"u","\u1EE9":"u","\u1EEF":"u","\u1EED":"u","\u1EF1":"u","\u1EE5":"u","\u1E73":"u","\u0173":"u","\u1E77":"u","\u1E75":"u","\u0289":"u","\u24E5":"v","\uFF56":"v","\u1E7D":"v","\u1E7F":"v","\u028B":"v","\uA75F":"v","\u028C":"v","\uA761":"vy","\u24E6":"w","\uFF57":"w","\u1E81":"w","\u1E83":"w","\u0175":"w","\u1E87":"w","\u1E85":"w","\u1E98":"w","\u1E89":"w","\u2C73":"w","\u24E7":"x","\uFF58":"x","\u1E8B":"x","\u1E8D":"x","\u24E8":"y","\uFF59":"y","\u1EF3":"y","\u00FD":"y","\u0177":"y","\u1EF9":"y","\u0233":"y","\u1E8F":"y","\u00FF":"y","\u1EF7":"y","\u1E99":"y","\u1EF5":"y","\u01B4":"y","\u024F":"y","\u1EFF":"y","\u24E9":"z","\uFF5A":"z","\u017A":"z","\u1E91":"z","\u017C":"z","\u017E":"z","\u1E93":"z","\u1E95":"z","\u01B6":"z","\u0225":"z","\u0240":"z","\u2C6C":"z","\uA763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038A":"\u0399","\u03AA":"\u0399","\u038C":"\u039F","\u038E":"\u03A5","\u03AB":"\u03A5","\u038F":"\u03A9","\u03AC":"\u03B1","\u03AD":"\u03B5","\u03AE":"\u03B7","\u03AF":"\u03B9","\u03CA":"\u03B9","\u0390":"\u03B9","\u03CC":"\u03BF","\u03CD":"\u03C5","\u03CB":"\u03C5","\u03B0":"\u03C5","\u03C9":"\u03C9","\u03C2":"\u03C3"};
-
-    $document = $(document);
-
-    nextUid=(function() { var counter=1; return function() { return counter++; }; }());
-
-
-    function reinsertElement(element) {
-        var placeholder = $(document.createTextNode(''));
-
-        element.before(placeholder);
-        placeholder.before(element);
-        placeholder.remove();
-    }
-
-    function stripDiacritics(str) {
-        // Used 'uni range + named function' from http://jsperf.com/diacritics/18
-        function match(a) {
-            return DIACRITICS[a] || a;
-        }
-
-        return str.replace(/[^\u0000-\u007E]/g, match);
-    }
-
-    function indexOf(value, array) {
-        var i = 0, l = array.length;
-        for (; i < l; i = i + 1) {
-            if (equal(value, array[i])) return i;
-        }
-        return -1;
-    }
-
-    function measureScrollbar () {
-        var $template = $( MEASURE_SCROLLBAR_TEMPLATE );
-        $template.appendTo(document.body);
-
-        var dim = {
-            width: $template.width() - $template[0].clientWidth,
-            height: $template.height() - $template[0].clientHeight
-        };
-        $template.remove();
-
-        return dim;
-    }
-
-    /**
-     * Compares equality of a and b
-     * @param a
-     * @param b
-     */
-    function equal(a, b) {
-        if (a === b) return true;
-        if (a === undefined || b === undefined) return false;
-        if (a === null || b === null) return false;
-        // Check whether 'a' or 'b' is a string (primitive or object).
-        // The concatenation of an empty string (+'') converts its argument to a string's primitive.
-        if (a.constructor === String) return a+'' === b+''; // a+'' - in case 'a' is a String object
-        if (b.constructor === String) return b+'' === a+''; // b+'' - in case 'b' is a String object
-        return false;
-    }
-
-    /**
-     * Splits the string into an array of values, transforming each value. An empty array is returned for nulls or empty
-     * strings
-     * @param string
-     * @param separator
-     */
-    function splitVal(string, separator, transform) {
-        var val, i, l;
-        if (string === null || string.length < 1) return [];
-        val = string.split(separator);
-        for (i = 0, l = val.length; i < l; i = i + 1) val[i] = transform(val[i]);
-        return val;
-    }
-
-    function getSideBorderPadding(element) {
-        return element.outerWidth(false) - element.width();
-    }
-
-    function installKeyUpChangeEvent(element) {
-        var key="keyup-change-value";
-        element.on("keydown", function () {
-            if ($.data(element, key) === undefined) {
-                $.data(element, key, element.val());
-            }
-        });
-        element.on("keyup", function () {
-            var val= $.data(element, key);
-            if (val !== undefined && element.val() !== val) {
-                $.removeData(element, key);
-                element.trigger("keyup-change");
-            }
-        });
-    }
-
-
-    /**
-     * filters mouse events so an event is fired only if the mouse moved.
-     *
-     * filters out mouse events that occur when mouse is stationary but
-     * the elements under the pointer are scrolled.
-     */
-    function installFilteredMouseMove(element) {
-        element.on("mousemove", function (e) {
-            var lastpos = lastMousePosition;
-            if (lastpos === undefined || lastpos.x !== e.pageX || lastpos.y !== e.pageY) {
-                $(e.target).trigger("mousemove-filtered", e);
-            }
-        });
-    }
-
-    /**
-     * Debounces a function. Returns a function that calls the original fn function only if no invocations have been made
-     * within the last quietMillis milliseconds.
-     *
-     * @param quietMillis number of milliseconds to wait before invoking fn
-     * @param fn function to be debounced
-     * @param ctx object to be used as this reference within fn
-     * @return debounced version of fn
-     */
-    function debounce(quietMillis, fn, ctx) {
-        ctx = ctx || undefined;
-        var timeout;
-        return function () {
-            var args = arguments;
-            window.clearTimeout(timeout);
-            timeout = window.setTimeout(function() {
-                fn.apply(ctx, args);
-            }, quietMillis);
-        };
-    }
-
-    function installDebouncedScroll(threshold, element) {
-        var notify = debounce(threshold, function (e) { element.trigger("scroll-debounced", e);});
-        element.on("scroll", function (e) {
-            if (indexOf(e.target, element.get()) >= 0) notify(e);
-        });
-    }
-
-    function focus($el) {
-        if ($el[0] === document.activeElement) return;
-
-        /* set the focus in a 0 timeout - that way the focus is set after the processing
-            of the current event has finished - which seems like the only reliable way
-            to set focus */
-        window.setTimeout(function() {
-            var el=$el[0], pos=$el.val().length, range;
-
-            $el.focus();
-
-            /* make sure el received focus so we do not error out when trying to manipulate the caret.
-                sometimes modals or others listeners may steal it after its set */
-            var isVisible = (el.offsetWidth > 0 || el.offsetHeight > 0);
-            if (isVisible && el === document.activeElement) {
-
-                /* after the focus is set move the caret to the end, necessary when we val()
-                    just before setting focus */
-                if(el.setSelectionRange)
-                {
-                    el.setSelectionRange(pos, pos);
-                }
-                else if (el.createTextRange) {
-                    range = el.createTextRange();
-                    range.collapse(false);
-                    range.select();
-                }
-            }
-        }, 0);
-    }
-
-    function getCursorInfo(el) {
-        el = $(el)[0];
-        var offset = 0;
-        var length = 0;
-        if ('selectionStart' in el) {
-            offset = el.selectionStart;
-            length = el.selectionEnd - offset;
-        } else if ('selection' in document) {
-            el.focus();
-            var sel = document.selection.createRange();
-            length = document.selection.createRange().text.length;
-            sel.moveStart('character', -el.value.length);
-            offset = sel.text.length - length;
-        }
-        return { offset: offset, length: length };
-    }
-
-    function killEvent(event) {
-        event.preventDefault();
-        event.stopPropagation();
-    }
-    function killEventImmediately(event) {
-        event.preventDefault();
-        event.stopImmediatePropagation();
-    }
-
-    function measureTextWidth(e) {
-        if (!sizer){
-            var style = e[0].currentStyle || window.getComputedStyle(e[0], null);
-            sizer = $(document.createElement("div")).css({
-                position: "absolute",
-                left: "-10000px",
-                top: "-10000px",
-                display: "none",
-                fontSize: style.fontSize,
-                fontFamily: style.fontFamily,
-                fontStyle: style.fontStyle,
-                fontWeight: style.fontWeight,
-                letterSpacing: style.letterSpacing,
-                textTransform: style.textTransform,
-                whiteSpace: "nowrap"
-            });
-            sizer.attr("class","select2-sizer");
-            $(document.body).append(sizer);
-        }
-        sizer.text(e.val());
-        return sizer.width();
-    }
-
-    function syncCssClasses(dest, src, adapter) {
-        var classes, replacements = [], adapted;
-
-        classes = $.trim(dest.attr("class"));
-
-        if (classes) {
-            classes = '' + classes; // for IE which returns object
-
-            $(classes.split(/\s+/)).each2(function() {
-                if (this.indexOf("select2-") === 0) {
-                    replacements.push(this);
-                }
-            });
-        }
-
-        classes = $.trim(src.attr("class"));
-
-        if (classes) {
-            classes = '' + classes; // for IE which returns object
-
-            $(classes.split(/\s+/)).each2(function() {
-                if (this.indexOf("select2-") !== 0) {
-                    adapted = adapter(this);
-
-                    if (adapted) {
-                        replacements.push(adapted);
-                    }
-                }
-            });
-        }
-
-        dest.attr("class", replacements.join(" "));
-    }
-
-
-    function markMatch(text, term, markup, escapeMarkup) {
-        var match=stripDiacritics(text.toUpperCase()).indexOf(stripDiacritics(term.toUpperCase())),
-            tl=term.length;
-
-        if (match<0) {
-            markup.push(escapeMarkup(text));
-            return;
-        }
-
-        markup.push(escapeMarkup(text.substring(0, match)));
-        markup.push("<span class='select2-match'>");
-        markup.push(escapeMarkup(text.substring(match, match + tl)));
-        markup.push("</span>");
-        markup.push(escapeMarkup(text.substring(match + tl, text.length)));
-    }
-
-    function defaultEscapeMarkup(markup) {
-        var replace_map = {
-            '\\': '&#92;',
-            '&': '&amp;',
-            '<': '&lt;',
-            '>': '&gt;',
-            '"': '&quot;',
-            "'": '&#39;',
-            "/": '&#47;'
-        };
-
-        return String(markup).replace(/[&<>"'\/\\]/g, function (match) {
-            return replace_map[match];
-        });
-    }
-
-    /**
-     * Produces an ajax-based query function
-     *
-     * @param options object containing configuration parameters
-     * @param options.params parameter map for the transport ajax call, can contain such options as cache, jsonpCallback, etc. see $.ajax
-     * @param options.transport function that will be used to execute the ajax request. must be compatible with parameters supported by $.ajax
-     * @param options.url url for the data
-     * @param options.data a function(searchTerm, pageNumber, context) that should return an object containing query string parameters for the above url.
-     * @param options.dataType request data type: ajax, jsonp, other datatypes supported by jQuery's $.ajax function or the transport function if specified
-     * @param options.quietMillis (optional) milliseconds to wait before making the ajaxRequest, helps debounce the ajax function if invoked too often
-     * @param options.results a function(remoteData, pageNumber, query) that converts data returned form the remote request to the format expected by Select2.
-     *      The expected format is an object containing the following keys:
-     *      results array of objects that will be used as choices
-     *      more (optional) boolean indicating whether there are more results available
-     *      Example: {results:[{id:1, text:'Red'},{id:2, text:'Blue'}], more:true}
-     */
-    function ajax(options) {
-        var timeout, // current scheduled but not yet executed request
-            handler = null,
-            quietMillis = options.quietMillis || 100,
-            ajaxUrl = options.url,
-            self = this;
-
-        return function (query) {
-            window.clearTimeout(timeout);
-            timeout = window.setTimeout(function () {
-                var data = options.data, // ajax data function
-                    url = ajaxUrl, // ajax url string or function
-                    transport = options.transport || $.fn.select2.ajaxDefaults.transport,
-                    // deprecated - to be removed in 4.0  - use params instead
-                    deprecated = {
-                        type: options.type || 'GET', // set type of request (GET or POST)
-                        cache: options.cache || false,
-                        jsonpCallback: options.jsonpCallback||undefined,
-                        dataType: options.dataType||"json"
-                    },
-                    params = $.extend({}, $.fn.select2.ajaxDefaults.params, deprecated);
-
-                data = data ? data.call(self, query.term, query.page, query.context) : null;
-                url = (typeof url === 'function') ? url.call(self, query.term, query.page, query.context) : url;
-
-                if (handler && typeof handler.abort === "function") { handler.abort(); }
-
-                if (options.params) {
-                    if ($.isFunction(options.params)) {
-                        $.extend(params, options.params.call(self));
-                    } else {
-                        $.extend(params, options.params);
-                    }
-                }
-
-                $.extend(params, {
-                    url: url,
-                    dataType: options.dataType,
-                    data: data,
-                    success: function (data) {
-                        // TODO - replace query.page with query so users have access to term, page, etc.
-                        // added query as third paramter to keep backwards compatibility
-                        var results = options.results(data, query.page, query);
-                        query.callback(results);
-                    },
-                    error: function(jqXHR, textStatus, errorThrown){
-                        var results = {
-                            hasError: true,
-                            jqXHR: jqXHR,
-                            textStatus: textStatus,
-                            errorThrown: errorThrown
-                        };
-
-                        query.callback(results);
-                    }
-                });
-                handler = transport.call(self, params);
-            }, quietMillis);
-        };
-    }
-
-    /**
-     * Produces a query function that works with a local array
-     *
-     * @param options object containing configuration parameters. The options parameter can either be an array or an
-     * object.
-     *
-     * If the array form is used it is assumed that it contains objects with 'id' and 'text' keys.
-     *
-     * If the object form is used it is assumed that it contains 'data' and 'text' keys. The 'data' key should contain
-     * an array of objects that will be used as choices. These objects must contain at least an 'id' key. The 'text'
-     * key can either be a String in which case it is expected that each element in the 'data' array has a key with the
-     * value of 'text' which will be used to match choices. Alternatively, text can be a function(item) that can extract
-     * the text.
-     */
-    function local(options) {
-        var data = options, // data elements
-            dataText,
-            tmp,
-            text = function (item) { return ""+item.text; }; // function used to retrieve the text portion of a data item that is matched against the search
-
-         if ($.isArray(data)) {
-            tmp = data;
-            data = { results: tmp };
-        }
-
-         if ($.isFunction(data) === false) {
-            tmp = data;
-            data = function() { return tmp; };
-        }
-
-        var dataItem = data();
-        if (dataItem.text) {
-            text = dataItem.text;
-            // if text is not a function we assume it to be a key name
-            if (!$.isFunction(text)) {
-                dataText = dataItem.text; // we need to store this in a separate variable because in the next step data gets reset and data.text is no longer available
-                text = function (item) { return item[dataText]; };
-            }
-        }
-
-        return function (query) {
-            var t = query.term, filtered = { results: [] }, process;
-            if (t === "") {
-                query.callback(data());
-                return;
-            }
-
-            process = function(datum, collection) {
-                var group, attr;
-                datum = datum[0];
-                if (datum.children) {
-                    group = {};
-                    for (attr in datum) {
-                        if (datum.hasOwnProperty(attr)) group[attr]=datum[attr];
-                    }
-                    group.children=[];
-                    $(datum.children).each2(function(i, childDatum) { process(childDatum, group.children); });
-                    if (group.children.length || query.matcher(t, text(group), datum)) {
-                        collection.push(group);
-                    }
-                } else {
-                    if (query.matcher(t, text(datum), datum)) {
-                        collection.push(datum);
-                    }
-                }
-            };
-
-            $(data().results).each2(function(i, datum) { process(datum, filtered.results); });
-            query.callback(filtered);
-        };
-    }
-
-    // TODO javadoc
-    function tags(data) {
-        var isFunc = $.isFunction(data);
-        return function (query) {
-            var t = query.term, filtered = {results: []};
-            var result = isFunc ? data(query) : data;
-            if ($.isArray(result)) {
-                $(result).each(function () {
-                    var isObject = this.text !== undefined,
-                        text = isObject ? this.text : this;
-                    if (t === "" || query.matcher(t, text)) {
-                        filtered.results.push(isObject ? this : {id: this, text: this});
-                    }
-                });
-                query.callback(filtered);
-            }
-        };
-    }
-
-    /**
-     * Checks if the formatter function should be used.
-     *
-     * Throws an error if it is not a function. Returns true if it should be used,
-     * false if no formatting should be performed.
-     *
-     * @param formatter
-     */
-    function checkFormatter(formatter, formatterName) {
-        if ($.isFunction(formatter)) return true;
-        if (!formatter) return false;
-        if (typeof(formatter) === 'string') return true;
-        throw new Error(formatterName +" must be a string, function, or falsy value");
-    }
-
-  /**
-   * Returns a given value
-   * If given a function, returns its output
-   *
-   * @param val string|function
-   * @param context value of "this" to be passed to function
-   * @returns {*}
-   */
-    function evaluate(val, context) {
-        if ($.isFunction(val)) {
-            var args = Array.prototype.slice.call(arguments, 2);
-            return val.apply(context, args);
-        }
-        return val;
-    }
-
-    function countResults(results) {
-        var count = 0;
-        $.each(results, function(i, item) {
-            if (item.children) {
-                count += countResults(item.children);
-            } else {
-                count++;
-            }
-        });
-        return count;
-    }
-
-    /**
-     * Default tokenizer. This function uses breaks the input on substring match of any string from the
-     * opts.tokenSeparators array and uses opts.createSearchChoice to create the choice object. Both of those
-     * two options have to be defined in order for the tokenizer to work.
-     *
-     * @param input text user has typed so far or pasted into the search field
-     * @param selection currently selected choices
-     * @param selectCallback function(choice) callback tho add the choice to selection
-     * @param opts select2's opts
-     * @return undefined/null to leave the current input unchanged, or a string to change the input to the returned value
-     */
-    function defaultTokenizer(input, selection, selectCallback, opts) {
-        var original = input, // store the original so we can compare and know if we need to tell the search to update its text
-            dupe = false, // check for whether a token we extracted represents a duplicate selected choice
-            token, // token
-            index, // position at which the separator was found
-            i, l, // looping variables
-            separator; // the matched separator
-
-        if (!opts.createSearchChoice || !opts.tokenSeparators || opts.tokenSeparators.length < 1) return undefined;
-
-        while (true) {
-            index = -1;
-
-            for (i = 0, l = opts.tokenSeparators.length; i < l; i++) {
-                separator = opts.tokenSeparators[i];
-                index = input.indexOf(separator);
-                if (index >= 0) break;
-            }
-
-            if (index < 0) break; // did not find any token separator in the input string, bail
-
-            token = input.substring(0, index);
-            input = input.substring(index + separator.length);
-
-            if (token.length > 0) {
-                token = opts.createSearchChoice.call(this, token, selection);
-                if (token !== undefined && token !== null && opts.id(token) !== undefined && opts.id(token) !== null) {
-                    dupe = false;
-                    for (i = 0, l = selection.length; i < l; i++) {
-                        if (equal(opts.id(token), opts.id(selection[i]))) {
-                            dupe = true; break;
-                        }
-                    }
-
-                    if (!dupe) selectCallback(token);
-                }
-            }
-        }
-
-        if (original!==input) return input;
-    }
-
-    function cleanupJQueryElements() {
-        var self = this;
-
-        $.each(arguments, function (i, element) {
-            self[element].remove();
-            self[element] = null;
-        });
-    }
-
-    /**
-     * Creates a new class
-     *
-     * @param superClass
-     * @param methods
-     */
-    function clazz(SuperClass, methods) {
-        var constructor = function () {};
-        constructor.prototype = new SuperClass;
-        constructor.prototype.constructor = constructor;
-        constructor.prototype.parent = SuperClass.prototype;
-        constructor.prototype = $.extend(constructor.prototype, methods);
-        return constructor;
-    }
-
-    AbstractSelect2 = clazz(Object, {
-
-        // abstract
-        bind: function (func) {
-            var self = this;
-            return function () {
-                func.apply(self, arguments);
-            };
-        },
-
-        // abstract
-        init: function (opts) {
-            var results, search, resultsSelector = ".select2-results";
-
-            // prepare options
-            this.opts = opts = this.prepareOpts(opts);
-
-            this.id=opts.id;
-
-            // destroy if called on an existing component
-            if (opts.element.data("select2") !== undefined &&
-                opts.element.data("select2") !== null) {
-                opts.element.data("select2").destroy();
-            }
-
-            this.container = this.createContainer();
-
-            this.liveRegion = $('.select2-hidden-accessible');
-            if (this.liveRegion.length == 0) {
-                this.liveRegion = $("<span>", {
-                        role: "status",
-                        "aria-live": "polite"
-                    })
-                    .addClass("select2-hidden-accessible")
-                    .appendTo(document.body);
-            }
-
-            this.containerId="s2id_"+(opts.element.attr("id") || "autogen"+nextUid());
-            this.containerEventName= this.containerId
-                .replace(/([.])/g, '_')
-                .replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g, '\\$1');
-            this.container.attr("id", this.containerId);
-
-            this.container.attr("title", opts.element.attr("title"));
-
-            this.body = $(document.body);
-
-            syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
-
-            this.container.attr("style", opts.element.attr("style"));
-            this.container.css(evaluate(opts.containerCss, this.opts.element));
-            this.container.addClass(evaluate(opts.containerCssClass, this.opts.element));
-
-            this.elementTabIndex = this.opts.element.attr("tabindex");
-
-            // swap container for the element
-            this.opts.element
-                .data("select2", this)
-                .attr("tabindex", "-1")
-                .before(this.container)
-                .on("click.select2", killEvent); // do not leak click events
-
-            this.container.data("select2", this);
-
-            this.dropdown = this.container.find(".select2-drop");
-
-            syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
-
-            this.dropdown.addClass(evaluate(opts.dropdownCssClass, this.opts.element));
-            this.dropdown.data("select2", this);
-            this.dropdown.on("click", killEvent);
-
-            this.results = results = this.container.find(resultsSelector);
-            this.search = search = this.container.find("input.select2-input");
-
-            this.queryCount = 0;
-            this.resultsPage = 0;
-            this.context = null;
-
-            // initialize the container
-            this.initContainer();
-
-            this.container.on("click", killEvent);
-
-            installFilteredMouseMove(this.results);
-
-            this.dropdown.on("mousemove-filtered", resultsSelector, this.bind(this.highlightUnderEvent));
-            this.dropdown.on("touchstart touchmove touchend", resultsSelector, this.bind(function (event) {
-                this._touchEvent = true;
-                this.highlightUnderEvent(event);
-            }));
-            this.dropdown.on("touchmove", resultsSelector, this.bind(this.touchMoved));
-            this.dropdown.on("touchstart touchend", resultsSelector, this.bind(this.clearTouchMoved));
-
-            // Waiting for a click event on touch devices to select option and hide dropdown
-            // otherwise click will be triggered on an underlying element
-            this.dropdown.on('click', this.bind(function (event) {
-                if (this._touchEvent) {
-                    this._touchEvent = false;
-                    this.selectHighlighted();
-                }
-            }));
-
-            installDebouncedScroll(80, this.results);
-            this.dropdown.on("scroll-debounced", resultsSelector, this.bind(this.loadMoreIfNeeded));
-
-            // do not propagate change event from the search field out of the component
-            $(this.container).on("change", ".select2-input", function(e) {e.stopPropagation();});
-            $(this.dropdown).on("change", ".select2-input", function(e) {e.stopPropagation();});
-
-            // if jquery.mousewheel plugin is installed we can prevent out-of-bounds scrolling of results via mousewheel
-            if ($.fn.mousewheel) {
-                results.mousewheel(function (e, delta, deltaX, deltaY) {
-                    var top = results.scrollTop();
-                    if (deltaY > 0 && top - deltaY <= 0) {
-                        results.scrollTop(0);
-                        killEvent(e);
-                    } else if (deltaY < 0 && results.get(0).scrollHeight - results.scrollTop() + deltaY <= results.height()) {
-                        results.scrollTop(results.get(0).scrollHeight - results.height());
-                        killEvent(e);
-                    }
-                });
-            }
-
-            installKeyUpChangeEvent(search);
-            search.on("keyup-change input paste", this.bind(this.updateResults));
-            search.on("focus", function () { search.addClass("select2-focused"); });
-            search.on("blur", function () { search.removeClass("select2-focused");});
-
-            this.dropdown.on("mouseup", resultsSelector, this.bind(function (e) {
-                if ($(e.target).closest(".select2-result-selectable").length > 0) {
-                    this.highlightUnderEvent(e);
-                    this.selectHighlighted(e);
-                }
-            }));
-
-            // trap all mouse events from leaving the dropdown. sometimes there may be a modal that is listening
-            // for mouse events outside of itself so it can close itself. since the dropdown is now outside the select2's
-            // dom it will trigger the popup close, which is not what we want
-            // focusin can cause focus wars between modals and select2 since the dropdown is outside the modal.
-            this.dropdown.on("click mouseup mousedown touchstart touchend focusin", function (e) { e.stopPropagation(); });
-
-            this.nextSearchTerm = undefined;
-
-            if ($.isFunction(this.opts.initSelection)) {
-                // initialize selection based on the current value of the source element
-                this.initSelection();
-
-                // if the user has provided a function that can set selection based on the value of the source element
-                // we monitor the change event on the element and trigger it, allowing for two way synchronization
-                this.monitorSource();
-            }
-
-            if (opts.maximumInputLength !== null) {
-                this.search.attr("maxlength", opts.maximumInputLength);
-            }
-
-            var disabled = opts.element.prop("disabled");
-            if (disabled === undefined) disabled = false;
-            this.enable(!disabled);
-
-            var readonly = opts.element.prop("readonly");
-            if (readonly === undefined) readonly = false;
-            this.readonly(readonly);
-
-            // Calculate size of scrollbar
-            scrollBarDimensions = scrollBarDimensions || measureScrollbar();
-
-            this.autofocus = opts.element.prop("autofocus");
-            opts.element.prop("autofocus", false);
-            if (this.autofocus) this.focus();
-
-            this.search.attr("placeholder", opts.searchInputPlaceholder);
-        },
-
-        // abstract
-        destroy: function () {
-            var element=this.opts.element, select2 = element.data("select2"), self = this;
-
-            this.close();
-
-            if (element.length && element[0].detachEvent && self._sync) {
-                element.each(function () {
-                    if (self._sync) {
-                        this.detachEvent("onpropertychange", self._sync);
-                    }
-                });
-            }
-            if (this.propertyObserver) {
-                this.propertyObserver.disconnect();
-                this.propertyObserver = null;
-            }
-            this._sync = null;
-
-            if (select2 !== undefined) {
-                select2.container.remove();
-                select2.liveRegion.remove();
-                select2.dropdown.remove();
-                element
-                    .show()
-                    .removeData("select2")
-                    .off(".select2")
-                    .prop("autofocus", this.autofocus || false);
-                if (this.elementTabIndex) {
-                    element.attr({tabindex: this.elementTabIndex});
-                } else {
-                    element.removeAttr("tabindex");
-                }
-                element.show();
-            }
-
-            cleanupJQueryElements.call(this,
-                "container",
-                "liveRegion",
-                "dropdown",
-                "results",
-                "search"
-            );
-        },
-
-        // abstract
-        optionToData: function(element) {
-            if (element.is("option")) {
-                return {
-                    id:element.prop("value"),
-                    text:element.text(),
-                    element: element.get(),
-                    css: element.attr("class"),
-                    disabled: element.prop("disabled"),
-                    locked: equal(element.attr("locked"), "locked") || equal(element.data("locked"), true)
-                };
-            } else if (element.is("optgroup")) {
-                return {
-                    text:element.attr("label"),
-                    children:[],
-                    element: element.get(),
-                    css: element.attr("class")
-                };
-            }
-        },
-
-        // abstract
-        prepareOpts: function (opts) {
-            var element, select, idKey, ajaxUrl, self = this;
-
-            element = opts.element;
-
-            if (element.get(0).tagName.toLowerCase() === "select") {
-                this.select = select = opts.element;
-            }
-
-            if (select) {
-                // these options are not allowed when attached to a select because they are picked up off the element itself
-                $.each(["id", "multiple", "ajax", "query", "createSearchChoice", "initSelection", "data", "tags"], function () {
-                    if (this in opts) {
-                        throw new Error("Option '" + this + "' is not allowed for Select2 when attached to a <select> element.");
-                    }
-                });
-            }
-
-            opts = $.extend({}, {
-                populateResults: function(container, results, query) {
-                    var populate, id=this.opts.id, liveRegion=this.liveRegion;
-
-                    populate=function(results, container, depth) {
-
-                        var i, l, result, selectable, disabled, compound, node, label, innerContainer, formatted;
-
-                        results = opts.sortResults(results, container, query);
-
-                        // collect the created nodes for bulk append
-                        var nodes = [];
-                        for (i = 0, l = results.length; i < l; i = i + 1) {
-
-                            result=results[i];
-
-                            disabled = (result.disabled === true);
-                            selectable = (!disabled) && (id(result) !== undefined);
-
-                            compound=result.children && result.children.length > 0;
-
-                            node=$("<li></li>");
-                            node.addClass("select2-results-dept-"+depth);
-                            node.addClass("select2-result");
-                            node.addClass(selectable ? "select2-result-selectable" : "select2-result-unselectable");
-                            if (disabled) { node.addClass("select2-disabled"); }
-                            if (compound) { node.addClass("select2-result-with-children"); }
-                            node.addClass(self.opts.formatResultCssClass(result));
-                            node.attr("role", "presentation");
-
-                            label=$(document.createElement("div"));
-                            label.addClass("select2-result-label");
-                            label.attr("id", "select2-result-label-" + nextUid());
-                            label.attr("role", "option");
-
-                            formatted=opts.formatResult(result, label, query, self.opts.escapeMarkup);
-                            if (formatted!==undefined) {
-                                label.html(formatted);
-                                node.append(label);
-                            }
-
-
-                            if (compound) {
-
-                                innerContainer=$("<ul></ul>");
-                                innerContainer.addClass("select2-result-sub");
-                                populate(result.children, innerContainer, depth+1);
-                                node.append(innerContainer);
-                            }
-
-                            node.data("select2-data", result);
-                            nodes.push(node[0]);
-                        }
-
-                        // bulk append the created nodes
-                        container.append(nodes);
-                        liveRegion.text(opts.formatMatches(results.length));
-                    };
-
-                    populate(results, container, 0);
-                }
-            }, $.fn.select2.defaults, opts);
-
-            if (typeof(opts.id) !== "function") {
-                idKey = opts.id;
-                opts.id = function (e) { return e[idKey]; };
-            }
-
-            if ($.isArray(opts.element.data("select2Tags"))) {
-                if ("tags" in opts) {
-                    throw "tags specified as both an attribute 'data-select2-tags' and in options of Select2 " + opts.element.attr("id");
-                }
-                opts.tags=opts.element.data("select2Tags");
-            }
-
-            if (select) {
-                opts.query = this.bind(function (query) {
-                    var data = { results: [], more: false },
-                        term = query.term,
-                        children, placeholderOption, process;
-
-                    process=function(element, collection) {
-                        var group;
-                        if (element.is("option")) {
-                            if (query.matcher(term, element.text(), element)) {
-                                collection.push(self.optionToData(element));
-                            }
-                        } else if (element.is("optgroup")) {
-                            group=self.optionToData(element);
-                            element.children().each2(function(i, elm) { process(elm, group.children); });
-                            if (group.children.length>0) {
-                                collection.push(group);
-                            }
-                        }
-                    };
-
-                    children=element.children();
-
-                    // ignore the placeholder option if there is one
-                    if (this.getPlaceholder() !== undefined && children.length > 0) {
-                        placeholderOption = this.getPlaceholderOption();
-                        if (placeholderOption) {
-                            children=children.not(placeholderOption);
-                        }
-                    }
-
-                    children.each2(function(i, elm) { process(elm, data.results); });
-
-                    query.callback(data);
-                });
-                // this is needed because inside val() we construct choices from options and their id is hardcoded
-                opts.id=function(e) { return e.id; };
-            } else {
-                if (!("query" in opts)) {
-
-                    if ("ajax" in opts) {
-                        ajaxUrl = opts.element.data("ajax-url");
-                        if (ajaxUrl && ajaxUrl.length > 0) {
-                            opts.ajax.url = ajaxUrl;
-                        }
-                        opts.query = ajax.call(opts.element, opts.ajax);
-                    } else if ("data" in opts) {
-                        opts.query = local(opts.data);
-                    } else if ("tags" in opts) {
-                        opts.query = tags(opts.tags);
-                        if (opts.createSearchChoice === undefined) {
-                            opts.createSearchChoice = function (term) { return {id: $.trim(term), text: $.trim(term)}; };
-                        }
-                        if (opts.initSelection === undefined) {
-                            opts.initSelection = function (element, callback) {
-                                var data = [];
-                                $(splitVal(element.val(), opts.separator, opts.transformVal)).each(function () {
-                                    var obj = { id: this, text: this },
-                                        tags = opts.tags;
-                                    if ($.isFunction(tags)) tags=tags();
-                                    $(tags).each(function() { if (equal(this.id, obj.id)) { obj = this; return false; } });
-                                    data.push(obj);
-                                });
-
-                                callback(data);
-                            };
-                        }
-                    }
-                }
-            }
-            if (typeof(opts.query) !== "function") {
-                throw "query function not defined for Select2 " + opts.element.attr("id");
-            }
-
-            if (opts.createSearchChoicePosition === 'top') {
-                opts.createSearchChoicePosition = function(list, item) { list.unshift(item); };
-            }
-            else if (opts.createSearchChoicePosition === 'bottom') {
-                opts.createSearchChoicePosition = function(list, item) { list.push(item); };
-            }
-            else if (typeof(opts.createSearchChoicePosition) !== "function")  {
-                throw "invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";
-            }
-
-            return opts;
-        },
-
-        /**
-         * Monitor the original element for changes and update select2 accordingly
-         */
-        // abstract
-        monitorSource: function () {
-            var el = this.opts.element, observer, self = this;
-
-            el.on("change.select2", this.bind(function (e) {
-                if (this.opts.element.data("select2-change-triggered") !== true) {
-                    this.initSelection();
-                }
-            }));
-
-            this._sync = this.bind(function () {
-
-                // sync enabled state
-                var disabled = el.prop("disabled");
-                if (disabled === undefined) disabled = false;
-                this.enable(!disabled);
-
-                var readonly = el.prop("readonly");
-                if (readonly === undefined) readonly = false;
-                this.readonly(readonly);
-
-                if (this.container) {
-                    syncCssClasses(this.container, this.opts.element, this.opts.adaptContainerCssClass);
-                    this.container.addClass(evaluate(this.opts.containerCssClass, this.opts.element));
-                }
-
-                if (this.dropdown) {
-                    syncCssClasses(this.dropdown, this.opts.element, this.opts.adaptDropdownCssClass);
-                    this.dropdown.addClass(evaluate(this.opts.dropdownCssClass, this.opts.element));
-                }
-
-            });
-
-            // IE8-10 (IE9/10 won't fire propertyChange via attachEventListener)
-            if (el.length && el[0].attachEvent) {
-                el.each(function() {
-                    this.attachEvent("onpropertychange", self._sync);
-                });
-            }
-
-            // safari, chrome, firefox, IE11
-            observer = window.MutationObserver || window.WebKitMutationObserver|| window.MozMutationObserver;
-            if (observer !== undefined) {
-                if (this.propertyObserver) { delete this.propertyObserver; this.propertyObserver = null; }
-                this.propertyObserver = new observer(function (mutations) {
-                    $.each(mutations, self._sync);
-                });
-                this.propertyObserver.observe(el.get(0), { attributes:true, subtree:false });
-            }
-        },
-
-        // abstract
-        triggerSelect: function(data) {
-            var evt = $.Event("select2-selecting", { val: this.id(data), object: data, choice: data });
-            this.opts.element.trigger(evt);
-            return !evt.isDefaultPrevented();
-        },
-
-        /**
-         * Triggers the change event on the source element
-         */
-        // abstract
-        triggerChange: function (details) {
-
-            details = details || {};
-            details= $.extend({}, details, { type: "change", val: this.val() });
-            // prevents recursive triggering
-            this.opts.element.data("select2-change-triggered", true);
-            this.opts.element.trigger(details);
-            this.opts.element.data("select2-change-triggered", false);
-
-            // some validation frameworks ignore the change event and listen instead to keyup, click for selects
-            // so here we trigger the click event manually
-            this.opts.element.click();
-
-            // ValidationEngine ignores the change event and listens instead to blur
-            // so here we trigger the blur event manually if so desired
-            if (this.opts.blurOnChange)
-                this.opts.element.blur();
-        },
-
-        //abstract
-        isInterfaceEnabled: function()
-        {
-            return this.enabledInterface === true;
-        },
-
-        // abstract
-        enableInterface: function() {
-            var enabled = this._enabled && !this._readonly,
-                disabled = !enabled;
-
-            if (enabled === this.enabledInterface) return false;
-
-            this.container.toggleClass("select2-container-disabled", disabled);
-            this.close();
-            this.enabledInterface = enabled;
-
-            return true;
-        },
-
-        // abstract
-        enable: function(enabled) {
-            if (enabled === undefined) enabled = true;
-            if (this._enabled === enabled) return;
-            this._enabled = enabled;
-
-            this.opts.element.prop("disabled", !enabled);
-            this.enableInterface();
-        },
-
-        // abstract
-        disable: function() {
-            this.enable(false);
-        },
-
-        // abstract
-        readonly: function(enabled) {
-            if (enabled === undefined) enabled = false;
-            if (this._readonly === enabled) return;
-            this._readonly = enabled;
-
-            this.opts.element.prop("readonly", enabled);
-            this.enableInterface();
-        },
-
-        // abstract
-        opened: function () {
-            return (this.container) ? this.container.hasClass("select2-dropdown-open") : false;
-        },
-
-        // abstract
-        positionDropdown: function() {
-            var $dropdown = this.dropdown,
-                container = this.container,
-                offset = container.offset(),
-                height = container.outerHeight(false),
-                width = container.outerWidth(false),
-                dropHeight = $dropdown.outerHeight(false),
-                $window = $(window),
-                windowWidth = $window.width(),
-                windowHeight = $window.height(),
-                viewPortRight = $window.scrollLeft() + windowWidth,
-                viewportBottom = $window.scrollTop() + windowHeight,
-                dropTop = offset.top + height,
-                dropLeft = offset.left,
-                enoughRoomBelow = dropTop + dropHeight <= viewportBottom,
-                enoughRoomAbove = (offset.top - dropHeight) >= $window.scrollTop(),
-                dropWidth = $dropdown.outerWidth(false),
-                enoughRoomOnRight = function() {
-                    return dropLeft + dropWidth <= viewPortRight;
-                },
-                enoughRoomOnLeft = function() {
-                    return offset.left + viewPortRight + container.outerWidth(false)  > dropWidth;
-                },
-                aboveNow = $dropdown.hasClass("select2-drop-above"),
-                bodyOffset,
-                above,
-                changeDirection,
-                css,
-                resultsListNode;
-
-            // always prefer the current above/below alignment, unless there is not enough room
-            if (aboveNow) {
-                above = true;
-                if (!enoughRoomAbove && enoughRoomBelow) {
-                    changeDirection = true;
-                    above = false;
-                }
-            } else {
-                above = false;
-                if (!enoughRoomBelow && enoughRoomAbove) {
-                    changeDirection = true;
-                    above = true;
-                }
-            }
-
-            //if we are changing direction we need to get positions when dropdown is hidden;
-            if (changeDirection) {
-                $dropdown.hide();
-                offset = this.container.offset();
-                height = this.container.outerHeight(false);
-                width = this.container.outerWidth(false);
-                dropHeight = $dropdown.outerHeight(false);
-                viewPortRight = $window.scrollLeft() + windowWidth;
-                viewportBottom = $window.scrollTop() + windowHeight;
-                dropTop = offset.top + height;
-                dropLeft = offset.left;
-                dropWidth = $dropdown.outerWidth(false);
-                $dropdown.show();
-
-                // fix so the cursor does not move to the left within the search-textbox in IE
-                this.focusSearch();
-            }
-
-            if (this.opts.dropdownAutoWidth) {
-                resultsListNode = $('.select2-results', $dropdown)[0];
-                $dropdown.addClass('select2-drop-auto-width');
-                $dropdown.css('width', '');
-                // Add scrollbar width to dropdown if vertical scrollbar is present
-                dropWidth = $dropdown.outerWidth(false) + (resultsListNode.scrollHeight === resultsListNode.clientHeight ? 0 : scrollBarDimensions.width);
-                dropWidth > width ? width = dropWidth : dropWidth = width;
-                dropHeight = $dropdown.outerHeight(false);
-            }
-            else {
-                this.container.removeClass('select2-drop-auto-width');
-            }
-
-            //console.log("below/ droptop:", dropTop, "dropHeight", dropHeight, "sum", (dropTop+dropHeight)+" viewport bottom", viewportBottom, "enough?", enoughRoomBelow);
-            //console.log("above/ offset.top", offset.top, "dropHeight", dropHeight, "top", (offset.top-dropHeight), "scrollTop", this.body.scrollTop(), "enough?", enoughRoomAbove);
-
-            // fix positioning when body has an offset and is not position: static
-            if (this.body.css('position') !== 'static') {
-                bodyOffset = this.body.offset();
-                dropTop -= bodyOffset.top;
-                dropLeft -= bodyOffset.left;
-            }
-
-            if (!enoughRoomOnRight() && enoughRoomOnLeft()) {
-                dropLeft = offset.left + this.container.outerWidth(false) - dropWidth;
-            }
-
-            css =  {
-                left: dropLeft,
-                width: width
-            };
-
-            if (above) {
-                css.top = offset.top - dropHeight;
-                css.bottom = 'auto';
-                this.container.addClass("select2-drop-above");
-                $dropdown.addClass("select2-drop-above");
-            }
-            else {
-                css.top = dropTop;
-                css.bottom = 'auto';
-                this.container.removeClass("select2-drop-above");
-                $dropdown.removeClass("select2-drop-above");
-            }
-            css = $.extend(css, evaluate(this.opts.dropdownCss, this.opts.element));
-
-            $dropdown.css(css);
-        },
-
-        // abstract
-        shouldOpen: function() {
-            var event;
-
-            if (this.opened()) return false;
-
-            if (this._enabled === false || this._readonly === true) return false;
-
-            event = $.Event("select2-opening");
-            this.opts.element.trigger(event);
-            return !event.isDefaultPrevented();
-        },
-
-        // abstract
-        clearDropdownAlignmentPreference: function() {
-            // clear the classes used to figure out the preference of where the dropdown should be opened
-            this.container.removeClass("select2-drop-above");
-            this.dropdown.removeClass("select2-drop-above");
-        },
-
-        /**
-         * Opens the dropdown
-         *
-         * @return {Boolean} whether or not dropdown was opened. This method will return false if, for example,
-         * the dropdown is already open, or if the 'open' event listener on the element called preventDefault().
-         */
-        // abstract
-        open: function () {
-
-            if (!this.shouldOpen()) return false;
-
-            this.opening();
-
-            // Only bind the document mousemove when the dropdown is visible
-            $document.on("mousemove.select2Event", function (e) {
-                lastMousePosition.x = e.pageX;
-                lastMousePosition.y = e.pageY;
-            });
-
-            return true;
-        },
-
-        /**
-         * Performs the opening of the dropdown
-         */
-        // abstract
-        opening: function() {
-            var cid = this.containerEventName,
-                scroll = "scroll." + cid,
-                resize = "resize."+cid,
-                orient = "orientationchange."+cid,
-                mask;
-
-            this.container.addClass("select2-dropdown-open").addClass("select2-container-active");
-
-            this.clearDropdownAlignmentPreference();
-
-            if(this.dropdown[0] !== this.body.children().last()[0]) {
-                this.dropdown.detach().appendTo(this.body);
-            }
-
-            // create the dropdown mask if doesn't already exist
-            mask = $("#select2-drop-mask");
-            if (mask.length === 0) {
-                mask = $(document.createElement("div"));
-                mask.attr("id","select2-drop-mask").attr("class","select2-drop-mask");
-                mask.hide();
-                mask.appendTo(this.body);
-                mask.on("mousedown touchstart click", function (e) {
-                    // Prevent IE from generating a click event on the body
-                    reinsertElement(mask);
-
-                    var dropdown = $("#select2-drop"), self;
-                    if (dropdown.length > 0) {
-                        self=dropdown.data("select2");
-                        if (self.opts.selectOnBlur) {
-                            self.selectHighlighted({noFocus: true});
-                        }
-                        self.close();
-                        e.preventDefault();
-                        e.stopPropagation();
-                    }
-                });
-            }
-
-            // ensure the mask is always right before the dropdown
-            if (this.dropdown.prev()[0] !== mask[0]) {
-                this.dropdown.before(mask);
-            }
-
-            // move the global id to the correct dropdown
-            $("#select2-drop").removeAttr("id");
-            this.dropdown.attr("id", "select2-drop");
-
-            // show the elements
-            mask.show();
-
-            this.positionDropdown();
-            this.dropdown.show();
-            this.positionDropdown();
-
-            this.dropdown.addClass("select2-drop-active");
-
-            // attach listeners to events that can change the position of the container and thus require
-            // the position of the dropdown to be updated as well so it does not come unglued from the container
-            var that = this;
-            this.container.parents().add(window).each(function () {
-                $(this).on(resize+" "+scroll+" "+orient, function (e) {
-                    if (that.opened()) that.positionDropdown();
-                });
-            });
-
-
-        },
-
-        // abstract
-        close: function () {
-            if (!this.opened()) return;
-
-            var cid = this.containerEventName,
-                scroll = "scroll." + cid,
-                resize = "resize."+cid,
-                orient = "orientationchange."+cid;
-
-            // unbind event listeners
-            this.container.parents().add(window).each(function () { $(this).off(scroll).off(resize).off(orient); });
-
-            this.clearDropdownAlignmentPreference();
-
-            $("#select2-drop-mask").hide();
-            this.dropdown.removeAttr("id"); // only the active dropdown has the select2-drop id
-            this.dropdown.hide();
-            this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active");
-            this.results.empty();
-
-            // Now that the dropdown is closed, unbind the global document mousemove event
-            $document.off("mousemove.select2Event");
-
-            this.clearSearch();
-            this.search.removeClass("select2-active");
-            this.opts.element.trigger($.Event("select2-close"));
-        },
-
-        /**
-         * Opens control, sets input value, and updates results.
-         */
-        // abstract
-        externalSearch: function (term) {
-            this.open();
-            this.search.val(term);
-            this.updateResults(false);
-        },
-
-        // abstract
-        clearSearch: function () {
-
-        },
-
-        //abstract
-        getMaximumSelectionSize: function() {
-            return evaluate(this.opts.maximumSelectionSize, this.opts.element);
-        },
-
-        // abstract
-        ensureHighlightVisible: function () {
-            var results = this.results, children, index, child, hb, rb, y, more, topOffset;
-
-            index = this.highlight();
-
-            if (index < 0) return;
-
-            if (index == 0) {
-
-                // if the first element is highlighted scroll all the way to the top,
-                // that way any unselectable headers above it will also be scrolled
-                // into view
-
-                results.scrollTop(0);
-                return;
-            }
-
-            children = this.findHighlightableChoices().find('.select2-result-label');
-
-            child = $(children[index]);
-
-            topOffset = (child.offset() || {}).top || 0;
-
-            hb = topOffset + child.outerHeight(true);
-
-            // if this is the last child lets also make sure select2-more-results is visible
-            if (index === children.length - 1) {
-                more = results.find("li.select2-more-results");
-                if (more.length > 0) {
-                    hb = more.offset().top + more.outerHeight(true);
-                }
-            }
-
-            rb = results.offset().top + results.outerHeight(false);
-            if (hb > rb) {
-                results.scrollTop(results.scrollTop() + (hb - rb));
-            }
-            y = topOffset - results.offset().top;
-
-            // make sure the top of the element is visible
-            if (y < 0 && child.css('display') != 'none' ) {
-                results.scrollTop(results.scrollTop() + y); // y is negative
-            }
-        },
-
-        // abstract
-        findHighlightableChoices: function() {
-            return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)");
-        },
-
-        // abstract
-        moveHighlight: function (delta) {
-            var choices = this.findHighlightableChoices(),
-                index = this.highlight();
-
-            while (index > -1 && index < choices.length) {
-                index += delta;
-                var choice = $(choices[index]);
-                if (choice.hasClass("select2-result-selectable") && !choice.hasClass("select2-disabled") && !choice.hasClass("select2-selected")) {
-                    this.highlight(index);
-                    break;
-                }
-            }
-        },
-
-        // abstract
-        highlight: function (index) {
-            var choices = this.findHighlightableChoices(),
-                choice,
-                data;
-
-            if (arguments.length === 0) {
-                return indexOf(choices.filter(".select2-highlighted")[0], choices.get());
-            }
-
-            if (index >= choices.length) index = choices.length - 1;
-            if (index < 0) index = 0;
-
-            this.removeHighlight();
-
-            choice = $(choices[index]);
-            choice.addClass("select2-highlighted");
-
-            // ensure assistive technology can determine the active choice
-            this.search.attr("aria-activedescendant", choice.find(".select2-result-label").attr("id"));
-
-            this.ensureHighlightVisible();
-
-            this.liveRegion.text(choice.text());
-
-            data = choice.data("select2-data");
-            if (data) {
-                this.opts.element.trigger({ type: "select2-highlight", val: this.id(data), choice: data });
-            }
-        },
-
-        removeHighlight: function() {
-            this.results.find(".select2-highlighted").removeClass("select2-highlighted");
-        },
-
-        touchMoved: function() {
-            this._touchMoved = true;
-        },
-
-        clearTouchMoved: function() {
-          this._touchMoved = false;
-        },
-
-        // abstract
-        countSelectableResults: function() {
-            return this.findHighlightableChoices().length;
-        },
-
-        // abstract
-        highlightUnderEvent: function (event) {
-            var el = $(event.target).closest(".select2-result-selectable");
-            if (el.length > 0 && !el.is(".select2-highlighted")) {
-                var choices = this.findHighlightableChoices();
-                this.highlight(choices.index(el));
-            } else if (el.length == 0) {
-                // if we are over an unselectable item remove all highlights
-                this.removeHighlight();
-            }
-        },
-
-        // abstract
-        loadMoreIfNeeded: function () {
-            var results = this.results,
-                more = results.find("li.select2-more-results"),
-                below, // pixels the element is below the scroll fold, below==0 is when the element is starting to be visible
-                page = this.resultsPage + 1,
-                self=this,
-                term=this.search.val(),
-                context=this.context;
-
-            if (more.length === 0) return;
-            below = more.offset().top - results.offset().top - results.height();
-
-            if (below <= this.opts.loadMorePadding) {
-                more.addClass("select2-active");
-                this.opts.query({
-                        element: this.opts.element,
-                        term: term,
-                        page: page,
-                        context: context,
-                        matcher: this.opts.matcher,
-                        callback: this.bind(function (data) {
-
-                    // ignore a response if the select2 has been closed before it was received
-                    if (!self.opened()) return;
-
-
-                    self.opts.populateResults.call(this, results, data.results, {term: term, page: page, context:context});
-                    self.postprocessResults(data, false, false);
-
-                    if (data.more===true) {
-                        more.detach().appendTo(results).html(self.opts.escapeMarkup(evaluate(self.opts.formatLoadMore, self.opts.element, page+1)));
-                        window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
-                    } else {
-                        more.remove();
-                    }
-                    self.positionDropdown();
-                    self.resultsPage = page;
-                    self.context = data.context;
-                    this.opts.element.trigger({ type: "select2-loaded", items: data });
-                })});
-            }
-        },
-
-        /**
-         * Default tokenizer function which does nothing
-         */
-        tokenize: function() {
-
-        },
-
-        /**
-         * @param initial whether or not this is the call to this method right after the dropdown has been opened
-         */
-        // abstract
-        updateResults: function (initial) {
-            var search = this.search,
-                results = this.results,
-                opts = this.opts,
-                data,
-                self = this,
-                input,
-                term = search.val(),
-                lastTerm = $.data(this.container, "select2-last-term"),
-                // sequence number used to drop out-of-order responses
-                queryNumber;
-
-            // prevent duplicate queries against the same term
-            if (initial !== true && lastTerm && equal(term, lastTerm)) return;
-
-            $.data(this.container, "select2-last-term", term);
-
-            // if the search is currently hidden we do not alter the results
-            if (initial !== true && (this.showSearchInput === false || !this.opened())) {
-                return;
-            }
-
-            function postRender() {
-                search.removeClass("select2-active");
-                self.positionDropdown();
-                if (results.find('.select2-no-results,.select2-selection-limit,.select2-searching').length) {
-                    self.liveRegion.text(results.text());
-                }
-                else {
-                    self.liveRegion.text(self.opts.formatMatches(results.find('.select2-result-selectable:not(".select2-selected")').length));
-                }
-            }
-
-            function render(html) {
-                results.html(html);
-                postRender();
-            }
-
-            queryNumber = ++this.queryCount;
-
-            var maxSelSize = this.getMaximumSelectionSize();
-            if (maxSelSize >=1) {
-                data = this.data();
-                if ($.isArray(data) && data.length >= maxSelSize && checkFormatter(opts.formatSelectionTooBig, "formatSelectionTooBig")) {
-                    render("<li class='select2-selection-limit'>" + evaluate(opts.formatSelectionTooBig, opts.element, maxSelSize) + "</li>");
-                    return;
-                }
-            }
-
-            if (search.val().length < opts.minimumInputLength) {
-                if (checkFormatter(opts.formatInputTooShort, "formatInputTooShort")) {
-                    render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooShort, opts.element, search.val(), opts.minimumInputLength) + "</li>");
-                } else {
-                    render("");
-                }
-                if (initial && this.showSearch) this.showSearch(true);
-                return;
-            }
-
-            if (opts.maximumInputLength && search.val().length > opts.maximumInputLength) {
-                if (checkFormatter(opts.formatInputTooLong, "formatInputTooLong")) {
-                    render("<li class='select2-no-results'>" + evaluate(opts.formatInputTooLong, opts.element, search.val(), opts.maximumInputLength) + "</li>");
-                } else {
-                    render("");
-                }
-                return;
-            }
-
-            if (opts.formatSearching && this.findHighlightableChoices().length === 0) {
-                render("<li class='select2-searching'>" + evaluate(opts.formatSearching, opts.element) + "</li>");
-            }
-
-            search.addClass("select2-active");
-
-            this.removeHighlight();
-
-            // give the tokenizer a chance to pre-process the input
-            input = this.tokenize();
-            if (input != undefined && input != null) {
-                search.val(input);
-            }
-
-            this.resultsPage = 1;
-
-            opts.query({
-                element: opts.element,
-                    term: search.val(),
-                    page: this.resultsPage,
-                    context: null,
-                    matcher: opts.matcher,
-                    callback: this.bind(function (data) {
-                var def; // default choice
-
-                // ignore old responses
-                if (queryNumber != this.queryCount) {
-                  return;
-                }
-
-                // ignore a response if the select2 has been closed before it was received
-                if (!this.opened()) {
-                    this.search.removeClass("select2-active");
-                    return;
-                }
-
-                // handle ajax error
-                if(data.hasError !== undefined && checkFormatter(opts.formatAjaxError, "formatAjaxError")) {
-                    render("<li class='select2-ajax-error'>" + evaluate(opts.formatAjaxError, opts.element, data.jqXHR, data.textStatus, data.errorThrown) + "</li>");
-                    return;
-                }
-
-                // save context, if any
-                this.context = (data.context===undefined) ? null : data.context;
-                // create a default choice and prepend it to the list
-                if (this.opts.createSearchChoice && search.val() !== "") {
-                    def = this.opts.createSearchChoice.call(self, search.val(), data.results);
-                    if (def !== undefined && def !== null && self.id(def) !== undefined && self.id(def) !== null) {
-                        if ($(data.results).filter(
-                            function () {
-                                return equal(self.id(this), self.id(def));
-                            }).length === 0) {
-                            this.opts.createSearchChoicePosition(data.results, def);
-                        }
-                    }
-                }
-
-                if (data.results.length === 0 && checkFormatter(opts.formatNoMatches, "formatNoMatches")) {
-                    render("<li class='select2-no-results'>" + evaluate(opts.formatNoMatches, opts.element, search.val()) + "</li>");
-                    return;
-                }
-
-                results.empty();
-                self.opts.populateResults.call(this, results, data.results, {term: search.val(), page: this.resultsPage, context:null});
-
-                if (data.more === true && checkFormatter(opts.formatLoadMore, "formatLoadMore")) {
-                    results.append("<li class='select2-more-results'>" + opts.escapeMarkup(evaluate(opts.formatLoadMore, opts.element, this.resultsPage)) + "</li>");
-                    window.setTimeout(function() { self.loadMoreIfNeeded(); }, 10);
-                }
-
-                this.postprocessResults(data, initial);
-
-                postRender();
-
-                this.opts.element.trigger({ type: "select2-loaded", items: data });
-            })});
-        },
-
-        // abstract
-        cancel: function () {
-            this.close();
-        },
-
-        // abstract
-        blur: function () {
-            // if selectOnBlur == true, select the currently highlighted option
-            if (this.opts.selectOnBlur)
-                this.selectHighlighted({noFocus: true});
-
-            this.close();
-            this.container.removeClass("select2-container-active");
-            // synonymous to .is(':focus'), which is available in jquery >= 1.6
-            if (this.search[0] === document.activeElement) { this.search.blur(); }
-            this.clearSearch();
-            this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
-        },
-
-        // abstract
-        focusSearch: function () {
-            focus(this.search);
-        },
-
-        // abstract
-        selectHighlighted: function (options) {
-            if (this._touchMoved) {
-              this.clearTouchMoved();
-              return;
-            }
-            var index=this.highlight(),
-                highlighted=this.results.find(".select2-highlighted"),
-                data = highlighted.closest('.select2-result').data("select2-data");
-
-            if (data) {
-                this.highlight(index);
-                this.onSelect(data, options);
-            } else if (options && options.noFocus) {
-                this.close();
-            }
-        },
-
-        // abstract
-        getPlaceholder: function () {
-            var placeholderOption;
-            return this.opts.element.attr("placeholder") ||
-                this.opts.element.attr("data-placeholder") || // jquery 1.4 compat
-                this.opts.element.data("placeholder") ||
-                this.opts.placeholder ||
-                ((placeholderOption = this.getPlaceholderOption()) !== undefined ? placeholderOption.text() : undefined);
-        },
-
-        // abstract
-        getPlaceholderOption: function() {
-            if (this.select) {
-                var firstOption = this.select.children('option').first();
-                if (this.opts.placeholderOption !== undefined ) {
-                    //Determine the placeholder option based on the specified placeholderOption setting
-                    return (this.opts.placeholderOption === "first" && firstOption) ||
-                           (typeof this.opts.placeholderOption === "function" && this.opts.placeholderOption(this.select));
-                } else if ($.trim(firstOption.text()) === "" && firstOption.val() === "") {
-                    //No explicit placeholder option specified, use the first if it's blank
-                    return firstOption;
-                }
-            }
-        },
-
-        /**
-         * Get the desired width for the container element.  This is
-         * derived first from option `width` passed to select2, then
-         * the inline 'style' on the original element, and finally
-         * falls back to the jQuery calculated element width.
-         */
-        // abstract
-        initContainerWidth: function () {
-            function resolveContainerWidth() {
-                var style, attrs, matches, i, l, attr;
-
-                if (this.opts.width === "off") {
-                    return null;
-                } else if (this.opts.width === "element"){
-                    return this.opts.element.outerWidth(false) === 0 ? 'auto' : 20+this.opts.element.outerWidth(false) + 'px';
-                } else if (this.opts.width === "copy" || this.opts.width === "resolve") {
-                    // check if there is inline style on the element that contains width
-                    style = this.opts.element.attr('style');
-                    if (style !== undefined) {
-                        attrs = style.split(';');
-                        for (i = 0, l = attrs.length; i < l; i = i + 1) {
-                            attr = attrs[i].replace(/\s/g, '');
-                            matches = attr.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i);
-                            if (matches !== null && matches.length >= 1)
-                                return matches[1];
-                        }
-                    }
-
-                    if (this.opts.width === "resolve") {
-                        // next check if css('width') can resolve a width that is percent based, this is sometimes possible
-                        // when attached to input type=hidden or elements hidden via css
-                        style = this.opts.element.css('width');
-                        if (style.indexOf("%") > 0) return style;
-
-                        // finally, fallback on the calculated width of the element
-                        return (this.opts.element.outerWidth(false) === 0 ? 'auto' : 20+this.opts.element.outerWidth(false) + 'px');
-                    }
-
-                    return null;
-                } else if ($.isFunction(this.opts.width)) {
-                    return this.opts.width();
-                } else {
-                    return this.opts.width;
-               }
-            };
-
-            var width = resolveContainerWidth.call(this);
-            if (width !== null) {
-                this.container.css("width", width);
-            }
-        }
-    });
-
-    SingleSelect2 = clazz(AbstractSelect2, {
-
-        // single
-
-        createContainer: function () {
-            var container = $(document.createElement("div")).attr({
-                "class": "select2-container"
-            }).html([
-                "<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>",
-                "   <span class='select2-chosen'>&#160;</span><abbr class='select2-search-choice-close'></abbr>",
-                "   <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>",
-                "</a>",
-                "<label for='' class='select2-offscreen'></label>",
-                "<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />",
-                "<div class='select2-drop select2-display-none'>",
-                "   <div class='select2-search'>",
-                "       <label for='' class='select2-offscreen'></label>",
-                "       <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'",
-                "       aria-autocomplete='list' />",
-                "   </div>",
-                "   <ul class='select2-results' role='listbox'>",
-                "   </ul>",
-                "</div>"].join(""));
-            return container;
-        },
-
-        // single
-        enableInterface: function() {
-            if (this.parent.enableInterface.apply(this, arguments)) {
-                this.focusser.prop("disabled", !this.isInterfaceEnabled());
-            }
-        },
-
-        // single
-        opening: function () {
-            var el, range, len;
-
-            if (this.opts.minimumResultsForSearch >= 0) {
-                this.showSearch(true);
-            }
-
-            this.parent.opening.apply(this, arguments);
-
-            if (this.showSearchInput !== false) {
-                // IE appends focusser.val() at the end of field :/ so we manually insert it at the beginning using a range
-                // all other browsers handle this just fine
-
-                this.search.val(this.focusser.val());
-            }
-            if (this.opts.shouldFocusInput(this)) {
-                this.search.focus();
-                // move the cursor to the end after focussing, otherwise it will be at the beginning and
-                // new text will appear *before* focusser.val()
-                el = this.search.get(0);
-                if (el.createTextRange) {
-                    range = el.createTextRange();
-                    range.collapse(false);
-                    range.select();
-                } else if (el.setSelectionRange) {
-                    len = this.search.val().length;
-                    el.setSelectionRange(len, len);
-                }
-            }
-
-            // initializes search's value with nextSearchTerm (if defined by user)
-            // ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
-            if(this.search.val() === "") {
-                if(this.nextSearchTerm != undefined){
-                    this.search.val(this.nextSearchTerm);
-                    this.search.select();
-                }
-            }
-
-            this.focusser.prop("disabled", true).val("");
-            this.updateResults(true);
-            this.opts.element.trigger($.Event("select2-open"));
-        },
-
-        // single
-        close: function () {
-            if (!this.opened()) return;
-            this.parent.close.apply(this, arguments);
-
-            this.focusser.prop("disabled", false);
-
-            if (this.opts.shouldFocusInput(this)) {
-                this.focusser.focus();
-            }
-        },
-
-        // single
-        focus: function () {
-            if (this.opened()) {
-                this.close();
-            } else {
-                this.focusser.prop("disabled", false);
-                if (this.opts.shouldFocusInput(this)) {
-                    this.focusser.focus();
-                }
-            }
-        },
-
-        // single
-        isFocused: function () {
-            return this.container.hasClass("select2-container-active");
-        },
-
-        // single
-        cancel: function () {
-            this.parent.cancel.apply(this, arguments);
-            this.focusser.prop("disabled", false);
-
-            if (this.opts.shouldFocusInput(this)) {
-                this.focusser.focus();
-            }
-        },
-
-        // single
-        destroy: function() {
-            $("label[for='" + this.focusser.attr('id') + "']")
-                .attr('for', this.opts.element.attr("id"));
-            this.parent.destroy.apply(this, arguments);
-
-            cleanupJQueryElements.call(this,
-                "selection",
-                "focusser"
-            );
-        },
-
-        // single
-        initContainer: function () {
-
-            var selection,
-                container = this.container,
-                dropdown = this.dropdown,
-                idSuffix = nextUid(),
-                elementLabel;
-
-            if (this.opts.minimumResultsForSearch < 0) {
-                this.showSearch(false);
-            } else {
-                this.showSearch(true);
-            }
-
-            this.selection = selection = container.find(".select2-choice");
-
-            this.focusser = container.find(".select2-focusser");
-
-            // add aria associations
-            selection.find(".select2-chosen").attr("id", "select2-chosen-"+idSuffix);
-            this.focusser.attr("aria-labelledby", "select2-chosen-"+idSuffix);
-            this.results.attr("id", "select2-results-"+idSuffix);
-            this.search.attr("aria-owns", "select2-results-"+idSuffix);
-
-            // rewrite labels from original element to focusser
-            this.focusser.attr("id", "s2id_autogen"+idSuffix);
-
-            elementLabel = $("label[for='" + this.opts.element.attr("id") + "']");
-            this.opts.element.focus(this.bind(function () { this.focus(); }));
-
-            this.focusser.prev()
-                .text(elementLabel.text())
-                .attr('for', this.focusser.attr('id'));
-
-            // Ensure the original element retains an accessible name
-            var originalTitle = this.opts.element.attr("title");
-            this.opts.element.attr("title", (originalTitle || elementLabel.text()));
-
-            this.focusser.attr("tabindex", this.elementTabIndex);
-
-            // write label for search field using the label from the focusser element
-            this.search.attr("id", this.focusser.attr('id') + '_search');
-
-            this.search.prev()
-                .text($("label[for='" + this.focusser.attr('id') + "']").text())
-                .attr('for', this.search.attr('id'));
-
-            this.search.on("keydown", this.bind(function (e) {
-                if (!this.isInterfaceEnabled()) return;
-
-                // filter 229 keyCodes (input method editor is processing key input)
-                if (229 == e.keyCode) return;
-
-                if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
-                    // prevent the page from scrolling
-                    killEvent(e);
-                    return;
-                }
-
-                switch (e.which) {
-                    case KEY.UP:
-                    case KEY.DOWN:
-                        this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
-                        killEvent(e);
-                        return;
-                    case KEY.ENTER:
-                        this.selectHighlighted();
-                        killEvent(e);
-                        return;
-                    case KEY.TAB:
-                        this.selectHighlighted({noFocus: true});
-                        return;
-                    case KEY.ESC:
-                        this.cancel(e);
-                        killEvent(e);
-                        return;
-                }
-            }));
-
-            this.search.on("blur", this.bind(function(e) {
-                // a workaround for chrome to keep the search field focussed when the scroll bar is used to scroll the dropdown.
-                // without this the search field loses focus which is annoying
-                if (document.activeElement === this.body.get(0)) {
-                    window.setTimeout(this.bind(function() {
-                        if (this.opened()) {
-                            this.search.focus();
-                        }
-                    }), 0);
-                }
-            }));
-
-            this.focusser.on("keydown", this.bind(function (e) {
-                if (!this.isInterfaceEnabled()) return;
-
-                if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e) || e.which === KEY.ESC) {
-                    return;
-                }
-
-                if (this.opts.openOnEnter === false && e.which === KEY.ENTER) {
-                    killEvent(e);
-                    return;
-                }
-
-                if (e.which == KEY.DOWN || e.which == KEY.UP
-                    || (e.which == KEY.ENTER && this.opts.openOnEnter)) {
-
-                    if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) return;
-
-                    this.open();
-                    killEvent(e);
-                    return;
-                }
-
-                if (e.which == KEY.DELETE || e.which == KEY.BACKSPACE) {
-                    if (this.opts.allowClear) {
-                        this.clear();
-                    }
-                    killEvent(e);
-                    return;
-                }
-            }));
-
-
-            installKeyUpChangeEvent(this.focusser);
-            this.focusser.on("keyup-change input", this.bind(function(e) {
-                if (this.opts.minimumResultsForSearch >= 0) {
-                    e.stopPropagation();
-                    if (this.opened()) return;
-                    this.open();
-                }
-            }));
-
-            selection.on("mousedown touchstart", "abbr", this.bind(function (e) {
-                if (!this.isInterfaceEnabled()) {
-                    return;
-                }
-
-                this.clear();
-                killEventImmediately(e);
-                this.close();
-
-                if (this.selection) {
-                    this.selection.focus();
-                }
-            }));
-
-            selection.on("mousedown touchstart", this.bind(function (e) {
-                // Prevent IE from generating a click event on the body
-                reinsertElement(selection);
-
-                if (!this.container.hasClass("select2-container-active")) {
-                    this.opts.element.trigger($.Event("select2-focus"));
-                }
-
-                if (this.opened()) {
-                    this.close();
-                } else if (this.isInterfaceEnabled()) {
-                    this.open();
-                }
-
-                killEvent(e);
-            }));
-
-            dropdown.on("mousedown touchstart", this.bind(function() {
-                if (this.opts.shouldFocusInput(this)) {
-                    this.search.focus();
-                }
-            }));
-
-            selection.on("focus", this.bind(function(e) {
-                killEvent(e);
-            }));
-
-            this.focusser.on("focus", this.bind(function(){
-                if (!this.container.hasClass("select2-container-active")) {
-                    this.opts.element.trigger($.Event("select2-focus"));
-                }
-                this.container.addClass("select2-container-active");
-            })).on("blur", this.bind(function() {
-                if (!this.opened()) {
-                    this.container.removeClass("select2-container-active");
-                    this.opts.element.trigger($.Event("select2-blur"));
-                }
-            }));
-            this.search.on("focus", this.bind(function(){
-                if (!this.container.hasClass("select2-container-active")) {
-                    this.opts.element.trigger($.Event("select2-focus"));
-                }
-                this.container.addClass("select2-container-active");
-            }));
-
-            this.initContainerWidth();
-            this.opts.element.hide();
-            this.setPlaceholder();
-
-        },
-
-        // single
-        clear: function(triggerChange) {
-            var data=this.selection.data("select2-data");
-            if (data) { // guard against queued quick consecutive clicks
-                var evt = $.Event("select2-clearing");
-                this.opts.element.trigger(evt);
-                if (evt.isDefaultPrevented()) {
-                    return;
-                }
-                var placeholderOption = this.getPlaceholderOption();
-                this.opts.element.val(placeholderOption ? placeholderOption.val() : "");
-                this.selection.find(".select2-chosen").empty();
-                this.selection.removeData("select2-data");
-                this.setPlaceholder();
-
-                if (triggerChange !== false){
-                    this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
-                    this.triggerChange({removed:data});
-                }
-            }
-        },
-
-        /**
-         * Sets selection based on source element's value
-         */
-        // single
-        initSelection: function () {
-            var selected;
-            if (this.isPlaceholderOptionSelected()) {
-                this.updateSelection(null);
-                this.close();
-                this.setPlaceholder();
-            } else {
-                var self = this;
-                this.opts.initSelection.call(null, this.opts.element, function(selected){
-                    if (selected !== undefined && selected !== null) {
-                        self.updateSelection(selected);
-                        self.close();
-                        self.setPlaceholder();
-                        self.nextSearchTerm = self.opts.nextSearchTerm(selected, self.search.val());
-                    }
-                });
-            }
-        },
-
-        isPlaceholderOptionSelected: function() {
-            var placeholderOption;
-            if (this.getPlaceholder() === undefined) return false; // no placeholder specified so no option should be considered
-            return ((placeholderOption = this.getPlaceholderOption()) !== undefined && placeholderOption.prop("selected"))
-                || (this.opts.element.val() === "")
-                || (this.opts.element.val() === undefined)
-                || (this.opts.element.val() === null);
-        },
-
-        // single
-        prepareOpts: function () {
-            var opts = this.parent.prepareOpts.apply(this, arguments),
-                self=this;
-
-            if (opts.element.get(0).tagName.toLowerCase() === "select") {
-                // install the selection initializer
-                opts.initSelection = function (element, callback) {
-                    var selected = element.find("option").filter(function() { return this.selected && !this.disabled });
-                    // a single select box always has a value, no need to null check 'selected'
-                    callback(self.optionToData(selected));
-                };
-            } else if ("data" in opts) {
-                // install default initSelection when applied to hidden input and data is local
-                opts.initSelection = opts.initSelection || function (element, callback) {
-                    var id = element.val();
-                    //search in data by id, storing the actual matching item
-                    var match = null;
-                    opts.query({
-                        matcher: function(term, text, el){
-                            var is_match = equal(id, opts.id(el));
-                            if (is_match) {
-                                match = el;
-                            }
-                            return is_match;
-                        },
-                        callback: !$.isFunction(callback) ? $.noop : function() {
-                            callback(match);
-                        }
-                    });
-                };
-            }
-
-            return opts;
-        },
-
-        // single
-        getPlaceholder: function() {
-            // if a placeholder is specified on a single select without a valid placeholder option ignore it
-            if (this.select) {
-                if (this.getPlaceholderOption() === undefined) {
-                    return undefined;
-                }
-            }
-
-            return this.parent.getPlaceholder.apply(this, arguments);
-        },
-
-        // single
-        setPlaceholder: function () {
-            var placeholder = this.getPlaceholder();
-
-            if (this.isPlaceholderOptionSelected() && placeholder !== undefined) {
-
-                // check for a placeholder option if attached to a select
-                if (this.select && this.getPlaceholderOption() === undefined) return;
-
-                this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(placeholder));
-
-                this.selection.addClass("select2-default");
-
-                this.container.removeClass("select2-allowclear");
-            }
-        },
-
-        // single
-        postprocessResults: function (data, initial, noHighlightUpdate) {
-            var selected = 0, self = this, showSearchInput = true;
-
-            // find the selected element in the result list
-
-            this.findHighlightableChoices().each2(function (i, elm) {
-                if (equal(self.id(elm.data("select2-data")), self.opts.element.val())) {
-                    selected = i;
-                    return false;
-                }
-            });
-
-            // and highlight it
-            if (noHighlightUpdate !== false) {
-                if (initial === true && selected >= 0) {
-                    this.highlight(selected);
-                } else {
-                    this.highlight(0);
-                }
-            }
-
-            // hide the search box if this is the first we got the results and there are enough of them for search
-
-            if (initial === true) {
-                var min = this.opts.minimumResultsForSearch;
-                if (min >= 0) {
-                    this.showSearch(countResults(data.results) >= min);
-                }
-            }
-        },
-
-        // single
-        showSearch: function(showSearchInput) {
-            if (this.showSearchInput === showSearchInput) return;
-
-            this.showSearchInput = showSearchInput;
-
-            this.dropdown.find(".select2-search").toggleClass("select2-search-hidden", !showSearchInput);
-            this.dropdown.find(".select2-search").toggleClass("select2-offscreen", !showSearchInput);
-            //add "select2-with-searchbox" to the container if search box is shown
-            $(this.dropdown, this.container).toggleClass("select2-with-searchbox", showSearchInput);
-        },
-
-        // single
-        onSelect: function (data, options) {
-
-            if (!this.triggerSelect(data)) { return; }
-
-            var old = this.opts.element.val(),
-                oldData = this.data();
-
-            this.opts.element.val(this.id(data));
-            this.updateSelection(data);
-
-            this.opts.element.trigger({ type: "select2-selected", val: this.id(data), choice: data });
-
-            this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
-            this.close();
-
-            if ((!options || !options.noFocus) && this.opts.shouldFocusInput(this)) {
-                this.focusser.focus();
-            }
-
-            if (!equal(old, this.id(data))) {
-                this.triggerChange({ added: data, removed: oldData });
-            }
-        },
-
-        // single
-        updateSelection: function (data) {
-
-            var container=this.selection.find(".select2-chosen"), formatted, cssClass;
-
-            this.selection.data("select2-data", data);
-
-            container.empty();
-            if (data !== null) {
-                formatted=this.opts.formatSelection(data, container, this.opts.escapeMarkup);
-            }
-            if (formatted !== undefined) {
-                container.append(formatted);
-            }
-            cssClass=this.opts.formatSelectionCssClass(data, container);
-            if (cssClass !== undefined) {
-                container.addClass(cssClass);
-            }
-
-            this.selection.removeClass("select2-default");
-
-            if (this.opts.allowClear && this.getPlaceholder() !== undefined) {
-                this.container.addClass("select2-allowclear");
-            }
-        },
-
-        // single
-        val: function () {
-            var val,
-                triggerChange = false,
-                data = null,
-                self = this,
-                oldData = this.data();
-
-            if (arguments.length === 0) {
-                return this.opts.element.val();
-            }
-
-            val = arguments[0];
-
-            if (arguments.length > 1) {
-                triggerChange = arguments[1];
-            }
-
-            if (this.select) {
-                this.select
-                    .val(val)
-                    .find("option").filter(function() { return this.selected }).each2(function (i, elm) {
-                        data = self.optionToData(elm);
-                        return false;
-                    });
-                this.updateSelection(data);
-                this.setPlaceholder();
-                if (triggerChange) {
-                    this.triggerChange({added: data, removed:oldData});
-                }
-            } else {
-                // val is an id. !val is true for [undefined,null,'',0] - 0 is legal
-                if (!val && val !== 0) {
-                    this.clear(triggerChange);
-                    return;
-                }
-                if (this.opts.initSelection === undefined) {
-                    throw new Error("cannot call val() if initSelection() is not defined");
-                }
-                this.opts.element.val(val);
-                this.opts.initSelection(this.opts.element, function(data){
-                    self.opts.element.val(!data ? "" : self.id(data));
-                    self.updateSelection(data);
-                    self.setPlaceholder();
-                    if (triggerChange) {
-                        self.triggerChange({added: data, removed:oldData});
-                    }
-                });
-            }
-        },
-
-        // single
-        clearSearch: function () {
-            this.search.val("");
-            this.focusser.val("");
-        },
-
-        // single
-        data: function(value) {
-            var data,
-                triggerChange = false;
-
-            if (arguments.length === 0) {
-                data = this.selection.data("select2-data");
-                if (data == undefined) data = null;
-                return data;
-            } else {
-                if (arguments.length > 1) {
-                    triggerChange = arguments[1];
-                }
-                if (!value) {
-                    this.clear(triggerChange);
-                } else {
-                    data = this.data();
-                    this.opts.element.val(!value ? "" : this.id(value));
-                    this.updateSelection(value);
-                    if (triggerChange) {
-                        this.triggerChange({added: value, removed:data});
-                    }
-                }
-            }
-        }
-    });
-
-    MultiSelect2 = clazz(AbstractSelect2, {
-
-        // multi
-        createContainer: function () {
-            var container = $(document.createElement("div")).attr({
-                "class": "select2-container select2-container-multi"
-            }).html([
-                "<ul class='select2-choices'>",
-                "  <li class='select2-search-field'>",
-                "    <label for='' class='select2-offscreen'></label>",
-                "    <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>",
-                "  </li>",
-                "</ul>",
-                "<div class='select2-drop select2-drop-multi select2-display-none'>",
-                "   <ul class='select2-results'>",
-                "   </ul>",
-                "</div>"].join(""));
-            return container;
-        },
-
-        // multi
-        prepareOpts: function () {
-            var opts = this.parent.prepareOpts.apply(this, arguments),
-                self=this;
-
-            // TODO validate placeholder is a string if specified
-            if (opts.element.get(0).tagName.toLowerCase() === "select") {
-                // install the selection initializer
-                opts.initSelection = function (element, callback) {
-
-                    var data = [];
-
-                    element.find("option").filter(function() { return this.selected && !this.disabled }).each2(function (i, elm) {
-                        data.push(self.optionToData(elm));
-                    });
-                    callback(data);
-                };
-            } else if ("data" in opts) {
-                // install default initSelection when applied to hidden input and data is local
-                opts.initSelection = opts.initSelection || function (element, callback) {
-                    var ids = splitVal(element.val(), opts.separator, opts.transformVal);
-                    //search in data by array of ids, storing matching items in a list
-                    var matches = [];
-                    opts.query({
-                        matcher: function(term, text, el){
-                            var is_match = $.grep(ids, function(id) {
-                                return equal(id, opts.id(el));
-                            }).length;
-                            if (is_match) {
-                                matches.push(el);
-                            }
-                            return is_match;
-                        },
-                        callback: !$.isFunction(callback) ? $.noop : function() {
-                            // reorder matches based on the order they appear in the ids array because right now
-                            // they are in the order in which they appear in data array
-                            var ordered = [];
-                            for (var i = 0; i < ids.length; i++) {
-                                var id = ids[i];
-                                for (var j = 0; j < matches.length; j++) {
-                                    var match = matches[j];
-                                    if (equal(id, opts.id(match))) {
-                                        ordered.push(match);
-                                        matches.splice(j, 1);
-                                        break;
-                                    }
-                                }
-                            }
-                            callback(ordered);
-                        }
-                    });
-                };
-            }
-
-            return opts;
-        },
-
-        // multi
-        selectChoice: function (choice) {
-
-            var selected = this.container.find(".select2-search-choice-focus");
-            if (selected.length && choice && choice[0] == selected[0]) {
-
-            } else {
-                if (selected.length) {
-                    this.opts.element.trigger("choice-deselected", selected);
-                }
-                selected.removeClass("select2-search-choice-focus");
-                if (choice && choice.length) {
-                    this.close();
-                    choice.addClass("select2-search-choice-focus");
-                    this.opts.element.trigger("choice-selected", choice);
-                }
-            }
-        },
-
-        // multi
-        destroy: function() {
-            $("label[for='" + this.search.attr('id') + "']")
-                .attr('for', this.opts.element.attr("id"));
-            this.parent.destroy.apply(this, arguments);
-
-            cleanupJQueryElements.call(this,
-                "searchContainer",
-                "selection"
-            );
-        },
-
-        // multi
-        initContainer: function () {
-
-            var selector = ".select2-choices", selection;
-
-            this.searchContainer = this.container.find(".select2-search-field");
-            this.selection = selection = this.container.find(selector);
-
-            var _this = this;
-            this.selection.on("click", ".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)", function (e) {
-                _this.search[0].focus();
-                _this.selectChoice($(this));
-            });
-
-            // rewrite labels from original element to focusser
-            this.search.attr("id", "s2id_autogen"+nextUid());
-
-            this.search.prev()
-                .text($("label[for='" + this.opts.element.attr("id") + "']").text())
-                .attr('for', this.search.attr('id'));
-            this.opts.element.focus(this.bind(function () { this.focus(); }));
-
-            this.search.on("input paste", this.bind(function() {
-                if (this.search.attr('placeholder') && this.search.val().length == 0) return;
-                if (!this.isInterfaceEnabled()) return;
-                if (!this.opened()) {
-                    this.open();
-                }
-            }));
-
-            this.search.attr("tabindex", this.elementTabIndex);
-
-            this.keydowns = 0;
-            this.search.on("keydown", this.bind(function (e) {
-                if (!this.isInterfaceEnabled()) return;
-
-                ++this.keydowns;
-                var selected = selection.find(".select2-search-choice-focus");
-                var prev = selected.prev(".select2-search-choice:not(.select2-locked)");
-                var next = selected.next(".select2-search-choice:not(.select2-locked)");
-                var pos = getCursorInfo(this.search);
-
-                if (selected.length &&
-                    (e.which == KEY.LEFT || e.which == KEY.RIGHT || e.which == KEY.BACKSPACE || e.which == KEY.DELETE || e.which == KEY.ENTER)) {
-                    var selectedChoice = selected;
-                    if (e.which == KEY.LEFT && prev.length) {
-                        selectedChoice = prev;
-                    }
-                    else if (e.which == KEY.RIGHT) {
-                        selectedChoice = next.length ? next : null;
-                    }
-                    else if (e.which === KEY.BACKSPACE) {
-                        if (this.unselect(selected.first())) {
-                            this.search.width(10);
-                            selectedChoice = prev.length ? prev : next;
-                        }
-                    } else if (e.which == KEY.DELETE) {
-                        if (this.unselect(selected.first())) {
-                            this.search.width(10);
-                            selectedChoice = next.length ? next : null;
-                        }
-                    } else if (e.which == KEY.ENTER) {
-                        selectedChoice = null;
-                    }
-
-                    this.selectChoice(selectedChoice);
-                    killEvent(e);
-                    if (!selectedChoice || !selectedChoice.length) {
-                        this.open();
-                    }
-                    return;
-                } else if (((e.which === KEY.BACKSPACE && this.keydowns == 1)
-                    || e.which == KEY.LEFT) && (pos.offset == 0 && !pos.length)) {
-
-                    this.selectChoice(selection.find(".select2-search-choice:not(.select2-locked)").last());
-                    killEvent(e);
-                    return;
-                } else {
-                    this.selectChoice(null);
-                }
-
-                if (this.opened()) {
-                    switch (e.which) {
-                    case KEY.UP:
-                    case KEY.DOWN:
-                        this.moveHighlight((e.which === KEY.UP) ? -1 : 1);
-                        killEvent(e);
-                        return;
-                    case KEY.ENTER:
-                        this.selectHighlighted();
-                        killEvent(e);
-                        return;
-                    case KEY.TAB:
-                        this.selectHighlighted({noFocus:true});
-                        this.close();
-                        return;
-                    case KEY.ESC:
-                        this.cancel(e);
-                        killEvent(e);
-                        return;
-                    }
-                }
-
-                if (e.which === KEY.TAB || KEY.isControl(e) || KEY.isFunctionKey(e)
-                 || e.which === KEY.BACKSPACE || e.which === KEY.ESC) {
-                    return;
-                }
-
-                if (e.which === KEY.ENTER) {
-                    if (this.opts.openOnEnter === false) {
-                        return;
-                    } else if (e.altKey || e.ctrlKey || e.shiftKey || e.metaKey) {
-                        return;
-                    }
-                }
-
-                this.open();
-
-                if (e.which === KEY.PAGE_UP || e.which === KEY.PAGE_DOWN) {
-                    // prevent the page from scrolling
-                    killEvent(e);
-                }
-
-                if (e.which === KEY.ENTER) {
-                    // prevent form from being submitted
-                    killEvent(e);
-                }
-
-            }));
-
-            this.search.on("keyup", this.bind(function (e) {
-                this.keydowns = 0;
-                this.resizeSearch();
-            })
-            );
-
-            this.search.on("blur", this.bind(function(e) {
-                this.container.removeClass("select2-container-active");
-                this.search.removeClass("select2-focused");
-                this.selectChoice(null);
-                if (!this.opened()) this.clearSearch();
-                e.stopImmediatePropagation();
-                this.opts.element.trigger($.Event("select2-blur"));
-            }));
-
-            this.container.on("click", selector, this.bind(function (e) {
-                if (!this.isInterfaceEnabled()) return;
-                if ($(e.target).closest(".select2-search-choice").length > 0) {
-                    // clicked inside a select2 search choice, do not open
-                    return;
-                }
-                this.selectChoice(null);
-                this.clearPlaceholder();
-                if (!this.container.hasClass("select2-container-active")) {
-                    this.opts.element.trigger($.Event("select2-focus"));
-                }
-                this.open();
-                this.focusSearch();
-                e.preventDefault();
-            }));
-
-            this.container.on("focus", selector, this.bind(function () {
-                if (!this.isInterfaceEnabled()) return;
-                if (!this.container.hasClass("select2-container-active")) {
-                    this.opts.element.trigger($.Event("select2-focus"));
-                }
-                this.container.addClass("select2-container-active");
-                this.dropdown.addClass("select2-drop-active");
-                this.clearPlaceholder();
-            }));
-
-            this.initContainerWidth();
-            this.opts.element.hide();
-
-            // set the placeholder if necessary
-            this.clearSearch();
-        },
-
-        // multi
-        enableInterface: function() {
-            if (this.parent.enableInterface.apply(this, arguments)) {
-                this.search.prop("disabled", !this.isInterfaceEnabled());
-            }
-        },
-
-        // multi
-        initSelection: function () {
-            var data;
-            if (this.opts.element.val() === "" && this.opts.element.text() === "") {
-                this.updateSelection([]);
-                this.close();
-                // set the placeholder if necessary
-                this.clearSearch();
-            }
-            if (this.select || this.opts.element.val() !== "") {
-                var self = this;
-                this.opts.initSelection.call(null, this.opts.element, function(data){
-                    if (data !== undefined && data !== null) {
-                        self.updateSelection(data);
-                        self.close();
-                        // set the placeholder if necessary
-                        self.clearSearch();
-                    }
-                });
-            }
-        },
-
-        // multi
-        clearSearch: function () {
-            var placeholder = this.getPlaceholder(),
-                maxWidth = this.getMaxSearchWidth();
-
-            if (placeholder !== undefined  && this.getVal().length === 0 && this.search.hasClass("select2-focused") === false) {
-                this.search.val(placeholder).addClass("select2-default");
-                // stretch the search box to full width of the container so as much of the placeholder is visible as possible
-                // we could call this.resizeSearch(), but we do not because that requires a sizer and we do not want to create one so early because of a firefox bug, see #944
-                this.search.width(maxWidth > 0 ? maxWidth : this.container.css("width"));
-            } else {
-                this.search.val("").width(10);
-            }
-        },
-
-        // multi
-        clearPlaceholder: function () {
-            if (this.search.hasClass("select2-default")) {
-                this.search.val("").removeClass("select2-default");
-            }
-        },
-
-        // multi
-        opening: function () {
-            this.clearPlaceholder(); // should be done before super so placeholder is not used to search
-            this.resizeSearch();
-
-            this.parent.opening.apply(this, arguments);
-
-            this.focusSearch();
-
-            // initializes search's value with nextSearchTerm (if defined by user)
-            // ignore nextSearchTerm if the dropdown is opened by the user pressing a letter
-            if(this.search.val() === "") {
-                if(this.nextSearchTerm != undefined){
-                    this.search.val(this.nextSearchTerm);
-                    this.search.select();
-                }
-            }
-
-            this.updateResults(true);
-            if (this.opts.shouldFocusInput(this)) {
-                this.search.focus();
-            }
-            this.opts.element.trigger($.Event("select2-open"));
-        },
-
-        // multi
-        close: function () {
-            if (!this.opened()) return;
-            this.parent.close.apply(this, arguments);
-        },
-
-        // multi
-        focus: function () {
-            this.close();
-            this.search.focus();
-        },
-
-        // multi
-        isFocused: function () {
-            return this.search.hasClass("select2-focused");
-        },
-
-        // multi
-        updateSelection: function (data) {
-            var ids = [], filtered = [], self = this;
-
-            // filter out duplicates
-            $(data).each(function () {
-                if (indexOf(self.id(this), ids) < 0) {
-                    ids.push(self.id(this));
-                    filtered.push(this);
-                }
-            });
-            data = filtered;
-
-            this.selection.find(".select2-search-choice").remove();
-            $(data).each(function () {
-                self.addSelectedChoice(this);
-            });
-            self.postprocessResults();
-        },
-
-        // multi
-        tokenize: function() {
-            var input = this.search.val();
-            input = this.opts.tokenizer.call(this, input, this.data(), this.bind(this.onSelect), this.opts);
-            if (input != null && input != undefined) {
-                this.search.val(input);
-                if (input.length > 0) {
-                    this.open();
-                }
-            }
-
-        },
-
-        // multi
-        onSelect: function (data, options) {
-
-            if (!this.triggerSelect(data) || data.text === "") { return; }
-
-            this.addSelectedChoice(data);
-
-            this.opts.element.trigger({ type: "selected", val: this.id(data), choice: data });
-
-            // keep track of the search's value before it gets cleared
-            this.nextSearchTerm = this.opts.nextSearchTerm(data, this.search.val());
-
-            this.clearSearch();
-            this.updateResults();
-
-            if (this.select || !this.opts.closeOnSelect) this.postprocessResults(data, false, this.opts.closeOnSelect===true);
-
-            if (this.opts.closeOnSelect) {
-                this.close();
-                this.search.width(10);
-            } else {
-                if (this.countSelectableResults()>0) {
-                    this.search.width(10);
-                    this.resizeSearch();
-                    if (this.getMaximumSelectionSize() > 0 && this.val().length >= this.getMaximumSelectionSize()) {
-                        // if we reached max selection size repaint the results so choices
-                        // are replaced with the max selection reached message
-                        this.updateResults(true);
-                    } else {
-                        // initializes search's value with nextSearchTerm and update search result
-                        if(this.nextSearchTerm != undefined){
-                            this.search.val(this.nextSearchTerm);
-                            this.updateResults();
-                            this.search.select();
-                        }
-                    }
-                    this.positionDropdown();
-                } else {
-                    // if nothing left to select close
-                    this.close();
-                    this.search.width(10);
-                }
-            }
-
-            // since its not possible to select an element that has already been
-            // added we do not need to check if this is a new element before firing change
-            this.triggerChange({ added: data });
-
-            if (!options || !options.noFocus)
-                this.focusSearch();
-        },
-
-        // multi
-        cancel: function () {
-            this.close();
-            this.focusSearch();
-        },
-
-        addSelectedChoice: function (data) {
-            var enableChoice = !data.locked,
-                enabledItem = $(
-                    "<li class='select2-search-choice'>" +
-                    "    <div></div>" +
-                    "    <a href='#' class='select2-search-choice-close' tabindex='-1'></a>" +
-                    "</li>"),
-                disabledItem = $(
-                    "<li class='select2-search-choice select2-locked'>" +
-                    "<div></div>" +
-                    "</li>");
-            var choice = enableChoice ? enabledItem : disabledItem,
-                id = this.id(data),
-                val = this.getVal(),
-                formatted,
-                cssClass;
-
-            formatted=this.opts.formatSelection(data, choice.find("div"), this.opts.escapeMarkup);
-            if (formatted != undefined) {
-                choice.find("div").replaceWith($("<div></div>").html(formatted));
-            }
-            cssClass=this.opts.formatSelectionCssClass(data, choice.find("div"));
-            if (cssClass != undefined) {
-                choice.addClass(cssClass);
-            }
-
-            if(enableChoice){
-              choice.find(".select2-search-choice-close")
-                  .on("mousedown", killEvent)
-                  .on("click dblclick", this.bind(function (e) {
-                  if (!this.isInterfaceEnabled()) return;
-
-                  this.unselect($(e.target));
-                  this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus");
-                  killEvent(e);
-                  this.close();
-                  this.focusSearch();
-              })).on("focus", this.bind(function () {
-                  if (!this.isInterfaceEnabled()) return;
-                  this.container.addClass("select2-container-active");
-                  this.dropdown.addClass("select2-drop-active");
-              }));
-            }
-
-            choice.data("select2-data", data);
-            choice.insertBefore(this.searchContainer);
-
-            val.push(id);
-            this.setVal(val);
-        },
-
-        // multi
-        unselect: function (selected) {
-            var val = this.getVal(),
-                data,
-                index;
-            selected = selected.closest(".select2-search-choice");
-
-            if (selected.length === 0) {
-                throw "Invalid argument: " + selected + ". Must be .select2-search-choice";
-            }
-
-            data = selected.data("select2-data");
-
-            if (!data) {
-                // prevent a race condition when the 'x' is clicked really fast repeatedly the event can be queued
-                // and invoked on an element already removed
-                return;
-            }
-
-            var evt = $.Event("select2-removing");
-            evt.val = this.id(data);
-            evt.choice = data;
-            this.opts.element.trigger(evt);
-
-            if (evt.isDefaultPrevented()) {
-                return false;
-            }
-
-            while((index = indexOf(this.id(data), val)) >= 0) {
-                val.splice(index, 1);
-                this.setVal(val);
-                if (this.select) this.postprocessResults();
-            }
-
-            selected.remove();
-
-            this.opts.element.trigger({ type: "select2-removed", val: this.id(data), choice: data });
-            this.triggerChange({ removed: data });
-
-            return true;
-        },
-
-        // multi
-        postprocessResults: function (data, initial, noHighlightUpdate) {
-            var val = this.getVal(),
-                choices = this.results.find(".select2-result"),
-                compound = this.results.find(".select2-result-with-children"),
-                self = this;
-
-            choices.each2(function (i, choice) {
-                var id = self.id(choice.data("select2-data"));
-                if (indexOf(id, val) >= 0) {
-                    choice.addClass("select2-selected");
-                    // mark all children of the selected parent as selected
-                    choice.find(".select2-result-selectable").addClass("select2-selected");
-                }
-            });
-
-            compound.each2(function(i, choice) {
-                // hide an optgroup if it doesn't have any selectable children
-                if (!choice.is('.select2-result-selectable')
-                    && choice.find(".select2-result-selectable:not(.select2-selected)").length === 0) {
-                    choice.addClass("select2-selected");
-                }
-            });
-
-            if (this.highlight() == -1 && noHighlightUpdate !== false && this.opts.closeOnSelect === true){
-                self.highlight(0);
-            }
-
-            //If all results are chosen render formatNoMatches
-            if(!this.opts.createSearchChoice && !choices.filter('.select2-result:not(.select2-selected)').length > 0){
-                if(!data || data && !data.more && this.results.find(".select2-no-results").length === 0) {
-                    if (checkFormatter(self.opts.formatNoMatches, "formatNoMatches")) {
-                        this.results.append("<li class='select2-no-results'>" + evaluate(self.opts.formatNoMatches, self.opts.element, self.search.val()) + "</li>");
-                    }
-                }
-            }
-
-        },
-
-        // multi
-        getMaxSearchWidth: function() {
-            return this.selection.width() - getSideBorderPadding(this.search);
-        },
-
-        // multi
-        resizeSearch: function () {
-            var minimumWidth, left, maxWidth, containerLeft, searchWidth,
-                sideBorderPadding = getSideBorderPadding(this.search);
-
-            minimumWidth = measureTextWidth(this.search) + 10;
-
-            left = this.search.offset().left;
-
-            maxWidth = this.selection.width();
-            containerLeft = this.selection.offset().left;
-
-            searchWidth = maxWidth - (left - containerLeft) - sideBorderPadding;
-
-            if (searchWidth < minimumWidth) {
-                searchWidth = maxWidth - sideBorderPadding;
-            }
-
-            if (searchWidth < 40) {
-                searchWidth = maxWidth - sideBorderPadding;
-            }
-
-            if (searchWidth <= 0) {
-              searchWidth = minimumWidth;
-            }
-
-            this.search.width(Math.floor(searchWidth));
-        },
-
-        // multi
-        getVal: function () {
-            var val;
-            if (this.select) {
-                val = this.select.val();
-                return val === null ? [] : val;
-            } else {
-                val = this.opts.element.val();
-                return splitVal(val, this.opts.separator, this.opts.transformVal);
-            }
-        },
-
-        // multi
-        setVal: function (val) {
-            var unique;
-            if (this.select) {
-                this.select.val(val);
-            } else {
-                unique = [];
-                // filter out duplicates
-                $(val).each(function () {
-                    if (indexOf(this, unique) < 0) unique.push(this);
-                });
-                this.opts.element.val(unique.length === 0 ? "" : unique.join(this.opts.separator));
-            }
-        },
-
-        // multi
-        buildChangeDetails: function (old, current) {
-            var current = current.slice(0),
-                old = old.slice(0);
-
-            // remove intersection from each array
-            for (var i = 0; i < current.length; i++) {
-                for (var j = 0; j < old.length; j++) {
-                    if (equal(this.opts.id(current[i]), this.opts.id(old[j]))) {
-                        current.splice(i, 1);
-                        if(i>0){
-                            i--;
-                        }
-                        old.splice(j, 1);
-                        j--;
-                    }
-                }
-            }
-
-            return {added: current, removed: old};
-        },
-
-
-        // multi
-        val: function (val, triggerChange) {
-            var oldData, self=this;
-
-            if (arguments.length === 0) {
-                return this.getVal();
-            }
-
-            oldData=this.data();
-            if (!oldData.length) oldData=[];
-
-            // val is an id. !val is true for [undefined,null,'',0] - 0 is legal
-            if (!val && val !== 0) {
-                this.opts.element.val("");
-                this.updateSelection([]);
-                this.clearSearch();
-                if (triggerChange) {
-                    this.triggerChange({added: this.data(), removed: oldData});
-                }
-                return;
-            }
-
-            // val is a list of ids
-            this.setVal(val);
-
-            if (this.select) {
-                this.opts.initSelection(this.select, this.bind(this.updateSelection));
-                if (triggerChange) {
-                    this.triggerChange(this.buildChangeDetails(oldData, this.data()));
-                }
-            } else {
-                if (this.opts.initSelection === undefined) {
-                    throw new Error("val() cannot be called if initSelection() is not defined");
-                }
-
-                this.opts.initSelection(this.opts.element, function(data){
-                    var ids=$.map(data, self.id);
-                    self.setVal(ids);
-                    self.updateSelection(data);
-                    self.clearSearch();
-                    if (triggerChange) {
-                        self.triggerChange(self.buildChangeDetails(oldData, self.data()));
-                    }
-                });
-            }
-            this.clearSearch();
-        },
-
-        // multi
-        onSortStart: function() {
-            if (this.select) {
-                throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");
-            }
-
-            // collapse search field into 0 width so its container can be collapsed as well
-            this.search.width(0);
-            // hide the container
-            this.searchContainer.hide();
-        },
-
-        // multi
-        onSortEnd:function() {
-
-            var val=[], self=this;
-
-            // show search and move it to the end of the list
-            this.searchContainer.show();
-            // make sure the search container is the last item in the list
-            this.searchContainer.appendTo(this.searchContainer.parent());
-            // since we collapsed the width in dragStarted, we resize it here
-            this.resizeSearch();
-
-            // update selection
-            this.selection.find(".select2-search-choice").each(function() {
-                val.push(self.opts.id($(this).data("select2-data")));
-            });
-            this.setVal(val);
-            this.triggerChange();
-        },
-
-        // multi
-        data: function(values, triggerChange) {
-            var self=this, ids, old;
-            if (arguments.length === 0) {
-                 return this.selection
-                     .children(".select2-search-choice")
-                     .map(function() { return $(this).data("select2-data"); })
-                     .get();
-            } else {
-                old = this.data();
-                if (!values) { values = []; }
-                ids = $.map(values, function(e) { return self.opts.id(e); });
-                this.setVal(ids);
-                this.updateSelection(values);
-                this.clearSearch();
-                if (triggerChange) {
-                    this.triggerChange(this.buildChangeDetails(old, this.data()));
-                }
-            }
-        }
-    });
-
-    $.fn.select2 = function () {
-
-        var args = Array.prototype.slice.call(arguments, 0),
-            opts,
-            select2,
-            method, value, multiple,
-            allowedMethods = ["val", "destroy", "opened", "open", "close", "focus", "isFocused", "container", "dropdown", "onSortStart", "onSortEnd", "enable", "disable", "readonly", "positionDropdown", "data", "search"],
-            valueMethods = ["opened", "isFocused", "container", "dropdown"],
-            propertyMethods = ["val", "data"],
-            methodsMap = { search: "externalSearch" };
-
-        this.each(function () {
-            if (args.length === 0 || typeof(args[0]) === "object") {
-                opts = args.length === 0 ? {} : $.extend({}, args[0]);
-                opts.element = $(this);
-
-                if (opts.element.get(0).tagName.toLowerCase() === "select") {
-                    multiple = opts.element.prop("multiple");
-                } else {
-                    multiple = opts.multiple || false;
-                    if ("tags" in opts) {opts.multiple = multiple = true;}
-                }
-
-                select2 = multiple ? new window.Select2["class"].multi() : new window.Select2["class"].single();
-                select2.init(opts);
-            } else if (typeof(args[0]) === "string") {
-
-                if (indexOf(args[0], allowedMethods) < 0) {
-                    throw "Unknown method: " + args[0];
-                }
-
-                value = undefined;
-                select2 = $(this).data("select2");
-                if (select2 === undefined) return;
-
-                method=args[0];
-
-                if (method === "container") {
-                    value = select2.container;
-                } else if (method === "dropdown") {
-                    value = select2.dropdown;
-                } else {
-                    if (methodsMap[method]) method = methodsMap[method];
-
-                    value = select2[method].apply(select2, args.slice(1));
-                }
-                if (indexOf(args[0], valueMethods) >= 0
-                    || (indexOf(args[0], propertyMethods) >= 0 && args.length == 1)) {
-                    return false; // abort the iteration, ready to return first matched value
-                }
-            } else {
-                throw "Invalid arguments to select2 plugin: " + args;
-            }
-        });
-        return (value === undefined) ? this : value;
-    };
-
-    // plugin defaults, accessible to users
-    $.fn.select2.defaults = {
-        width: "copy",
-        loadMorePadding: 0,
-        closeOnSelect: true,
-        openOnEnter: true,
-        containerCss: {},
-        dropdownCss: {},
-        containerCssClass: "",
-        dropdownCssClass: "",
-        formatResult: function(result, container, query, escapeMarkup) {
-            var markup=[];
-            markMatch(this.text(result), query.term, markup, escapeMarkup);
-            return markup.join("");
-        },
-        transformVal: function(val) {
-            return $.trim(val);
-        },
-        formatSelection: function (data, container, escapeMarkup) {
-            return data ? escapeMarkup(this.text(data)) : undefined;
-        },
-        sortResults: function (results, container, query) {
-            return results;
-        },
-        formatResultCssClass: function(data) {return data.css;},
-        formatSelectionCssClass: function(data, container) {return undefined;},
-        minimumResultsForSearch: 0,
-        minimumInputLength: 0,
-        maximumInputLength: null,
-        maximumSelectionSize: 0,
-        id: function (e) { return e == undefined ? null : e.id; },
-        text: function (e) {
-          if (e && this.data && this.data.text) {
-            if ($.isFunction(this.data.text)) {
-              return this.data.text(e);
-            } else {
-              return e[this.data.text];
-            }
-          } else {
-            return e.text;
-          }
-        },
-        matcher: function(term, text) {
-            return stripDiacritics(''+text).toUpperCase().indexOf(stripDiacritics(''+term).toUpperCase()) >= 0;
-        },
-        separator: ",",
-        tokenSeparators: [],
-        tokenizer: defaultTokenizer,
-        escapeMarkup: defaultEscapeMarkup,
-        blurOnChange: false,
-        selectOnBlur: false,
-        adaptContainerCssClass: function(c) { return c; },
-        adaptDropdownCssClass: function(c) { return null; },
-        nextSearchTerm: function(selectedObject, currentSearchTerm) { return undefined; },
-        searchInputPlaceholder: '',
-        createSearchChoicePosition: 'top',
-        shouldFocusInput: function (instance) {
-            // Attempt to detect touch devices
-            var supportsTouchEvents = (('ontouchstart' in window) ||
-                                       (navigator.msMaxTouchPoints > 0));
-
-            // Only devices which support touch events should be special cased
-            if (!supportsTouchEvents) {
-                return true;
-            }
-
-            // Never focus the input if search is disabled
-            if (instance.opts.minimumResultsForSearch < 0) {
-                return false;
-            }
-
-            return true;
-        }
-    };
-
-    $.fn.select2.locales = [];
-
-    $.fn.select2.locales['en'] = {
-         formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
-         formatNoMatches: function () { return "No matches found"; },
-         formatAjaxError: function (jqXHR, textStatus, errorThrown) { return "Loading failed"; },
-         formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
-         formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
-         formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
-         formatLoadMore: function (pageNumber) { return "Loading more results…"; },
-         formatSearching: function () { return "Searching…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
-
-    $.fn.select2.ajaxDefaults = {
-        transport: $.ajax,
-        params: {
-            type: "GET",
-            cache: false,
-            dataType: "json"
-        }
-    };
-
-    // exports
-    window.Select2 = {
-        query: {
-            ajax: ajax,
-            local: local,
-            tags: tags
-        }, util: {
-            debounce: debounce,
-            markMatch: markMatch,
-            escapeMarkup: defaultEscapeMarkup,
-            stripDiacritics: stripDiacritics
-        }, "class": {
-            "abstract": AbstractSelect2,
-            "single": SingleSelect2,
-            "multi": MultiSelect2
-        }
-    };
-
-}(jQuery));
diff --git a/htdocs/includes/jquery/plugins/select2/select2.min.js b/htdocs/includes/jquery/plugins/select2/select2.min.js
deleted file mode 100644
index b56419e2e79..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2.min.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/*
-Copyright 2014 Igor Vaynberg
-
-Version: 3.5.2 Timestamp: Sat Nov  1 14:43:36 EDT 2014
-
-This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU
-General Public License version 2 (the "GPL License"). You may choose either license to govern your
-use of this software only upon the condition that you accept all of the terms of either the Apache
-License or the GPL License.
-
-You may obtain a copy of the Apache License and the GPL License at:
-
-http://www.apache.org/licenses/LICENSE-2.0
-http://www.gnu.org/licenses/gpl-2.0.html
-
-Unless required by applicable law or agreed to in writing, software distributed under the Apache License
-or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND,
-either express or implied. See the Apache License and the GPL License for the specific language governing
-permissions and limitations under the Apache License and the GPL License.
-*/
-!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a||a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","select2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"&#92;","&":"&amp;","<":"&lt;",">":"&gt;",'"':"&quot;","'":"&#39;","/":"&#47;"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".select2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.show().removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("select2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(y.top=d.top-g,y.bottom="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(y.top=n,y.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b;
-var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.select2-result-selectable:not(".select2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>","   <span class='select2-chosen'>&#160;</span><abbr class='select2-search-choice-close'></abbr>","   <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>","   <div class='select2-search'>","       <label for='' class='select2-offscreen'></label>","       <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'","       aria-autocomplete='list' />","   </div>","   <ul class='select2-results' role='listbox'>","   </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".select2-choice"),this.focusser=c.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+e),this.focusser.attr("aria-labelledby","select2-chosen-"+e),this.results.attr("id","select2-results-"+e),this.search.attr("aria-owns","select2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.focus(this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h||g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)return A(a),void 0;switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case k.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return A(a),void 0;if(a.which==k.DOWN||a.which==k.UP||a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==k.DELETE||a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>","  <li class='select2-search-field'>","    <label for='' class='select2-offscreen'></label>","    <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>","  </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>","   <ul class='select2-results'>","   </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var c,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=c=this.container.find(b);var d=this;this.selection.on("click",".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)",function(){d.search[0].focus(),d.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+f()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.opts.element.focus(this.bind(function(){this.focus()})),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length||this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=c.find(".select2-search-choice-focus"),d=b.prev(".select2-search-choice:not(.select2-locked)"),e=b.next(".select2-search-choice:not(.select2-locked)"),f=z(this.search);if(b.length&&(a.which==k.LEFT||a.which==k.RIGHT||a.which==k.BACKSPACE||a.which==k.DELETE||a.which==k.ENTER)){var g=b;return a.which==k.LEFT&&d.length?g=d:a.which==k.RIGHT?g=e.length?e:null:a.which===k.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),g=d.length?d:e):a.which==k.DELETE?this.unselect(b.first())&&(this.search.width(10),g=e.length?e:null):a.which==k.ENTER&&(g=null),this.selectChoice(g),A(a),g&&g.length||this.open(),void 0}if((a.which===k.BACKSPACE&&1==this.keydowns||a.which==k.LEFT)&&0==f.offset&&!f.length)return this.selectChoice(c.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case k.ESC:return this.cancel(a),A(a),void 0}if(a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.BACKSPACE&&a.which!==k.ESC){if(a.which===k.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)&&A(a),a.which===k.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'>    <div></div>    <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith(a("<div></div>").html(j)),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)r(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text
-},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery);
\ No newline at end of file
diff --git a/htdocs/includes/jquery/plugins/select2/select2.png b/htdocs/includes/jquery/plugins/select2/select2.png
deleted file mode 100644
index 1d804ffb99699b9e030f1010314de0970b5a000d..0000000000000000000000000000000000000000
GIT binary patch
literal 0
HcmV?d00001

literal 613
zcmV-r0-F7aP)<h;3K|Lk000e1NJLTq002Ay001Zm1^@s6qPv;@0006kNkl<Zc-rmR
z&r1|x9LMps2uh5F)-GaQDk#Z_4iR>#WY!I$JQV$)A5aAS1BM||2XVJl=+L1^1S1H%
zM-&lx?NZpUrHhn>fk<>POqf2sh40}xxGZfc+t+#Eb(q<Oecn6I%nq|DNy|zSyexzN
z$5AL0?&Dan9pN5UxC<ug5`<4^!bTJ!40{Z2#(M~pn1C$$pw}f`kJpeHM`McNHFyg?
zK;|>Hy9_3*1(U%t9t)QDnI#YAL(|ACV(>)>6WD-t!8tutHkdb^#3`HzoJG3A2@T`%
zA|K@o*b!`R#(7)PWrMFn2))Ca3MR4(zaT`Zr61*kZK5NPnZwQszxh$fyv3?&4c>$q
z2m=+yc0dRXRAsPDxF6sD;@rK4JGdR_``1S~o6Xi@2&aR6hcSrEp9HVRzEqVDqB<bN
zXhRETAUt&UJ4{pqo<W$!4+ziE?D9@4ilQ3gUO=XZ)oyPsiQA7akeNo#WiVk!@H1G(
zkAmgh?J@W$gqNtpN{mA2@w%j2(GYBBaKPD;E<cjsBsd99f~(<?&RR6i%jfeou7io}
z!W3j)q1|OLVRs>n<1%hR=D4e1f^ra^A|34Cjc=Gny{F(o#MrvPYgZuTJOz(n)-F<|
zj()qR;C={)N<0RRvDZ^@6ND+W*}gh-Lip(MDt!(zMSO)!j2j+*hxgzC-e3$@(O2p*
zu;+gddm(cZwXTCLx*Ky4THOa*^b^F`woveIeCK^0aR|TJ00000NkvXXu0mjfA#WC6

diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_ar.js b/htdocs/includes/jquery/plugins/select2/select2_locale_ar.js
deleted file mode 100644
index e991b726cff..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_ar.js
+++ /dev/null
@@ -1,19 +0,0 @@
-/**
- * Select2 Arabic translation.
- *
- * Author: Adel KEDJOUR <adel@kedjour.com>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['ar'] = {
-        formatNoMatches: function () { return "لم يتم العثور على مطابقات"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; if (n == 1){ return "الرجاء إدخال حرف واحد على الأكثر"; } return n == 2 ? "الرجاء إدخال حرفين على الأكثر" : "الرجاء إدخال " + n + " على الأكثر"; },
-        formatInputTooLong: function (input, max) { var n = input.length - max; if (n == 1){ return "الرجاء إدخال حرف واحد على الأقل"; } return n == 2 ? "الرجاء إدخال حرفين على الأقل" : "الرجاء إدخال " + n + " على الأقل "; },
-        formatSelectionTooBig: function (limit) { if (limit == 1){ return "يمكنك أن تختار إختيار واحد فقط"; } return limit == 2 ? "يمكنك أن تختار إختيارين فقط" : "يمكنك أن تختار " + limit + " إختيارات فقط"; },
-        formatLoadMore: function (pageNumber) { return "تحميل المزيد من النتائج…"; },
-        formatSearching: function () { return "البحث…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['ar']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_az.js b/htdocs/includes/jquery/plugins/select2/select2_locale_az.js
deleted file mode 100644
index 19fd95b7a5f..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_az.js
+++ /dev/null
@@ -1,20 +0,0 @@
-/**
- * Select2 Azerbaijani translation.
- *
- * Author: Farhad Safarov <farhad.safarov@gmail.com>
- */
-(function ($) {
-    "use strict";
-
-     $.fn.select2.locales['az'] = {
-        formatMatches: function (matches) { return matches + " nəticə mövcuddur, hərəkət etdirmək üçün yuxarı və aşağı düymələrindən istifadə edin."; },
-        formatNoMatches: function () { return "Nəticə tapılmadı"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return n + " simvol daxil edin"; },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return n + " simvol silin"; },
-        formatSelectionTooBig: function (limit) { return "Sadəcə " + limit + " element seçə bilərsiniz"; },
-        formatLoadMore: function (pageNumber) { return "Daha çox nəticə yüklənir…"; },
-        formatSearching: function () { return "Axtarılır…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['az']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_bg.js b/htdocs/includes/jquery/plugins/select2/select2_locale_bg.js
deleted file mode 100644
index 3283d0ae5d2..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_bg.js
+++ /dev/null
@@ -1,20 +0,0 @@
-/**
- * Select2 Bulgarian translation.
- * 
- * @author  Lubomir Vikev <lubomirvikev@gmail.com>
- * @author  Uriy Efremochkin <efremochkin@uriy.me>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['bg'] = {
-        formatNoMatches: function () { return "Няма намерени съвпадения"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Моля въведете още " + n + " символ" + (n > 1 ? "а" : ""); },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Моля въведете с " + n + " по-малко символ" + (n > 1 ? "а" : ""); },
-        formatSelectionTooBig: function (limit) { return "Можете да направите до " + limit + (limit > 1 ? " избора" : " избор"); },
-        formatLoadMore: function (pageNumber) { return "Зареждат се още…"; },
-        formatSearching: function () { return "Търсене…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['bg']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_ca.js b/htdocs/includes/jquery/plugins/select2/select2_locale_ca.js
deleted file mode 100644
index dbea39e930b..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_ca.js
+++ /dev/null
@@ -1,19 +0,0 @@
-/**
- * Select2 Catalan translation.
- * 
- * Author: David Planella <david.planella@gmail.com>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['ca'] = {
-        formatNoMatches: function () { return "No s'ha trobat cap coincidència"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduïu " + n + " caràcter" + (n == 1 ? "" : "s") + " més"; },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Introduïu " + n + " caràcter" + (n == 1? "" : "s") + "menys"; },
-        formatSelectionTooBig: function (limit) { return "Només podeu seleccionar " + limit + " element" + (limit == 1 ? "" : "s"); },
-        formatLoadMore: function (pageNumber) { return "S'estan carregant més resultats…"; },
-        formatSearching: function () { return "S'està cercant…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['ca']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_cs.js b/htdocs/includes/jquery/plugins/select2/select2_locale_cs.js
deleted file mode 100644
index ef121856485..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_cs.js
+++ /dev/null
@@ -1,51 +0,0 @@
-/**
- * Select2 Czech translation.
- * 
- * Author: Michal Marek <ahoj@michal-marek.cz>
- * Author - sklonovani: David Vallner <david@vallner.net>
- */
-(function ($) {
-    "use strict";
-    // use text for the numbers 2 through 4
-    var smallNumbers = {
-        2: function(masc) { return (masc ? "dva" : "dvě"); },
-        3: function() { return "tři"; },
-        4: function() { return "čtyři"; }
-    }
-    $.fn.select2.locales['cs'] = {
-        formatNoMatches: function () { return "Nenalezeny žádné položky"; },
-        formatInputTooShort: function (input, min) {
-            var n = min - input.length;
-            if (n == 1) {
-                return "Prosím zadejte ještě jeden znak";
-            } else if (n <= 4) {
-                return "Prosím zadejte ještě další "+smallNumbers[n](true)+" znaky";
-            } else {
-                return "Prosím zadejte ještě dalších "+n+" znaků";
-            }
-        },
-        formatInputTooLong: function (input, max) {
-            var n = input.length - max;
-            if (n == 1) {
-                return "Prosím zadejte o jeden znak méně";
-            } else if (n <= 4) {
-                return "Prosím zadejte o "+smallNumbers[n](true)+" znaky méně";
-            } else {
-                return "Prosím zadejte o "+n+" znaků méně";
-            }
-        },
-        formatSelectionTooBig: function (limit) {
-            if (limit == 1) {
-                return "Můžete zvolit jen jednu položku";
-            } else if (limit <= 4) {
-                return "Můžete zvolit maximálně "+smallNumbers[limit](false)+" položky";
-            } else {
-                return "Můžete zvolit maximálně "+limit+" položek";
-            }
-        },
-        formatLoadMore: function (pageNumber) { return "Načítají se další výsledky…"; },
-        formatSearching: function () { return "Vyhledávání…"; }
-    };
-
-	$.extend($.fn.select2.defaults, $.fn.select2.locales['cs']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_da.js b/htdocs/includes/jquery/plugins/select2/select2_locale_da.js
deleted file mode 100644
index 702238b9a09..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_da.js
+++ /dev/null
@@ -1,19 +0,0 @@
-/**
- * Select2 Danish translation.
- *
- * Author: Anders Jenbo <anders@jenbo.dk>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['da'] = {
-        formatNoMatches: function () { return "Ingen resultater fundet"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Angiv venligst " + n + " tegn mere"; },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Angiv venligst " + n + " tegn mindre"; },
-        formatSelectionTooBig: function (limit) { return "Du kan kun vælge " + limit + " emne" + (limit === 1 ? "" : "r"); },
-        formatLoadMore: function (pageNumber) { return "Indlæser flere resultater…"; },
-        formatSearching: function () { return "Søger…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['da']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_de.js b/htdocs/includes/jquery/plugins/select2/select2_locale_de.js
deleted file mode 100644
index e27541720c2..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_de.js
+++ /dev/null
@@ -1,18 +0,0 @@
-/**
- * Select2 German translation
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['de'] = {
-        formatNoMatches: function () { return "Keine Übereinstimmungen gefunden"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Bitte " + n + " Zeichen mehr eingeben"; },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Bitte " + n + " Zeichen weniger eingeben"; },
-        formatSelectionTooBig: function (limit) { return "Sie können nur " + limit + " Eintr" + (limit === 1 ? "ag" : "äge") + " auswählen"; },
-        formatLoadMore: function (pageNumber) { return "Lade mehr Ergebnisse…"; },
-        formatSearching: function () { return "Suche…"; },
-        formatMatches: function (matches) { return matches + " Ergebnis " + (matches > 1 ? "se" : "") + " verfügbar, zum Navigieren die Hoch-/Runter-Pfeiltasten verwenden."; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['de']);
-})(jQuery);
\ No newline at end of file
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_el.js b/htdocs/includes/jquery/plugins/select2/select2_locale_el.js
deleted file mode 100644
index d17459e1df3..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_el.js
+++ /dev/null
@@ -1,19 +0,0 @@
-/**
- * Select2 Greek translation.
- * 
- * @author  Uriy Efremochkin <efremochkin@uriy.me>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['el'] = {
-        formatNoMatches: function () { return "Δεν βρέθηκαν αποτελέσματα"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Παρακαλούμε εισάγετε " + n + " περισσότερο" + (n > 1 ? "υς" : "") + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Παρακαλούμε διαγράψτε " + n + " χαρακτήρ" + (n > 1 ? "ες" : "α"); },
-        formatSelectionTooBig: function (limit) { return "Μπορείτε να επιλέξετε μόνο " + limit + " αντικείμεν" + (limit > 1 ? "α" : "ο"); },
-        formatLoadMore: function (pageNumber) { return "Φόρτωση περισσότερων…"; },
-        formatSearching: function () { return "Αναζήτηση…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['el']);
-})(jQuery);
\ No newline at end of file
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_en.js.template b/htdocs/includes/jquery/plugins/select2/select2_locale_en.js.template
deleted file mode 100644
index f758b110079..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_en.js.template
+++ /dev/null
@@ -1,20 +0,0 @@
-/**
- * Select2 <Language> translation.
- *
- * Author: Your Name <your@email>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['en'] = {
-        formatMatches: function (matches) { if (matches === 1) { return "One result is available, press enter to select it."; } return matches + " results are available, use up and down arrow keys to navigate."; },
-        formatNoMatches: function () { return "No matches found"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Please enter " + n + " or more character" + (n == 1 ? "" : "s"); },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Please delete " + n + " character" + (n == 1 ? "" : "s"); },
-        formatSelectionTooBig: function (limit) { return "You can only select " + limit + " item" + (limit == 1 ? "" : "s"); },
-        formatLoadMore: function (pageNumber) { return "Loading more results…"; },
-        formatSearching: function () { return "Searching…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['en']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_es.js b/htdocs/includes/jquery/plugins/select2/select2_locale_es.js
deleted file mode 100644
index 92a19861e40..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_es.js
+++ /dev/null
@@ -1,19 +0,0 @@
-/**
- * Select2 Spanish translation
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['es'] = {
-    	formatMatches: function (matches) { if (matches === 1) { return "Un resultado disponible, presione enter para seleccionarlo."; } return matches + " resultados disponibles, use las teclas de dirección para navegar."; },
-        formatNoMatches: function () { return "No se encontraron resultados"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Por favor, introduzca " + n + " car" + (n == 1? "ácter" : "acteres"); },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Por favor, elimine " + n + " car" + (n == 1? "ácter" : "acteres"); },
-        formatSelectionTooBig: function (limit) { return "Sólo puede seleccionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
-        formatLoadMore: function (pageNumber) { return "Cargando más resultados…"; },
-        formatSearching: function () { return "Buscando…"; },
-        formatAjaxError: function() { return "La carga falló"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['es']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_et.js b/htdocs/includes/jquery/plugins/select2/select2_locale_et.js
deleted file mode 100644
index 4d69f55e3fb..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_et.js
+++ /dev/null
@@ -1,19 +0,0 @@
-/**
- * Select2 Estonian translation.
- *
- * Author: Kuldar Kalvik <kuldar@kalvik.ee>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['et'] = {
-        formatNoMatches: function () { return "Tulemused puuduvad"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Sisesta " + n + " täht" + (n == 1 ? "" : "e") + " rohkem"; },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Sisesta " + n + " täht" + (n == 1? "" : "e") + " vähem"; },
-        formatSelectionTooBig: function (limit) { return "Saad vaid " + limit + " tulemus" + (limit == 1 ? "e" : "t") + " valida"; },
-        formatLoadMore: function (pageNumber) { return "Laen tulemusi.."; },
-        formatSearching: function () { return "Otsin.."; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['et']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_eu.js b/htdocs/includes/jquery/plugins/select2/select2_locale_eu.js
deleted file mode 100644
index 67ae8d05ae5..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_eu.js
+++ /dev/null
@@ -1,45 +0,0 @@
-/**
- * Select2 Basque translation.
- *
- * Author: Julen Ruiz Aizpuru <julenx at gmail dot com>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['eu'] = {
-        formatNoMatches: function () {
-          return "Ez da bat datorrenik aurkitu";
-        },
-        formatInputTooShort: function (input, min) {
-          var n = min - input.length;
-          if (n === 1) {
-            return "Idatzi karaktere bat gehiago";
-          } else {
-            return "Idatzi " + n + " karaktere gehiago";
-          }
-        },
-        formatInputTooLong: function (input, max) {
-          var n = input.length - max;
-          if (n === 1) {
-            return "Idatzi karaktere bat gutxiago";
-          } else {
-            return "Idatzi " + n + " karaktere gutxiago";
-          }
-        },
-        formatSelectionTooBig: function (limit) {
-          if (limit === 1 ) {
-            return "Elementu bakarra hauta dezakezu";
-          } else {
-            return limit + " elementu hauta ditzakezu soilik";
-          }
-        },
-        formatLoadMore: function (pageNumber) {
-          return "Emaitza gehiago kargatzen…";
-        },
-        formatSearching: function () {
-          return "Bilatzen…";
-        }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['eu']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_fa.js b/htdocs/includes/jquery/plugins/select2/select2_locale_fa.js
deleted file mode 100644
index b3ffd8b7da6..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_fa.js
+++ /dev/null
@@ -1,21 +0,0 @@
-/**
- * Select2 Persian translation.
- * 
- * Author: Ali Choopan <choopan@arsh.co>
- * Author: Ebrahim Byagowi <ebrahim@gnu.org>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['fa'] = {
-        formatMatches: function (matches) { return matches + " نتیجه موجود است، کلیدهای جهت بالا و پایین را برای گشتن استفاده کنید."; },
-        formatNoMatches: function () { return "نتیجه‌ای یافت نشد."; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "لطفاً " + n + " نویسه بیشتر وارد نمایید"; },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "لطفاً " + n + " نویسه را حذف کنید."; },
-        formatSelectionTooBig: function (limit) { return "شما فقط می‌توانید " + limit + " مورد را انتخاب کنید"; },
-        formatLoadMore: function (pageNumber) { return "در حال بارگیری موارد بیشتر…"; },
-        formatSearching: function () { return "در حال جستجو…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['fa']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_fi.js b/htdocs/includes/jquery/plugins/select2/select2_locale_fi.js
deleted file mode 100644
index 6487fbdad35..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_fi.js
+++ /dev/null
@@ -1,30 +0,0 @@
-/**
- * Select2 Finnish translation
- */
-(function ($) {
-    "use strict";
-    $.fn.select2.locales['fi'] = {
-        formatNoMatches: function () {
-            return "Ei tuloksia";
-        },
-        formatInputTooShort: function (input, min) {
-            var n = min - input.length;
-            return "Ole hyvä ja anna " + n + " merkkiä lisää";
-        },
-        formatInputTooLong: function (input, max) {
-            var n = input.length - max;
-            return "Ole hyvä ja anna " + n + " merkkiä vähemmän";
-        },
-        formatSelectionTooBig: function (limit) {
-            return "Voit valita ainoastaan " + limit + " kpl";
-        },
-        formatLoadMore: function (pageNumber) {
-            return "Ladataan lisää tuloksia…";
-        },
-        formatSearching: function () {
-            return "Etsitään…";
-        }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['fi']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_fr.js b/htdocs/includes/jquery/plugins/select2/select2_locale_fr.js
deleted file mode 100644
index d5485d6be76..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_fr.js
+++ /dev/null
@@ -1,18 +0,0 @@
-/**
- * Select2 French translation
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['fr'] = {
-        formatMatches: function (matches) { return matches + " résultats sont disponibles, utilisez les flèches haut et bas pour naviguer."; },
-        formatNoMatches: function () { return "Aucun résultat trouvé"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Saisissez " + n + " caractère" + (n == 1? "" : "s") + " supplémentaire" + (n == 1? "" : "s") ; },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Supprimez " + n + " caractère" + (n == 1? "" : "s"); },
-        formatSelectionTooBig: function (limit) { return "Vous pouvez seulement sélectionner " + limit + " élément" + (limit == 1 ? "" : "s"); },
-        formatLoadMore: function (pageNumber) { return "Chargement de résultats supplémentaires…"; },
-        formatSearching: function () { return "Recherche en cours…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['fr']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_gl.js b/htdocs/includes/jquery/plugins/select2/select2_locale_gl.js
deleted file mode 100644
index 9335167da96..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_gl.js
+++ /dev/null
@@ -1,45 +0,0 @@
-/**
- * Select2 Galician translation
- * 
- * Author: Leandro Regueiro <leandro.regueiro@gmail.com>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['gl'] = {
-        formatNoMatches: function () {
-            return "Non se atoparon resultados";
-        },
-        formatInputTooShort: function (input, min) {
-            var n = min - input.length;
-            if (n === 1) {
-                return "Engada un carácter";
-            } else {
-                return "Engada " + n + " caracteres";
-            }
-        },
-        formatInputTooLong: function (input, max) {
-            var n = input.length - max;
-            if (n === 1) {
-                return "Elimine un carácter";
-            } else {
-                return "Elimine " + n + " caracteres";
-            }
-        },
-        formatSelectionTooBig: function (limit) {
-            if (limit === 1 ) {
-                return "Só pode seleccionar un elemento";
-            } else {
-                return "Só pode seleccionar " + limit + " elementos";
-            }
-        },
-        formatLoadMore: function (pageNumber) {
-            return "Cargando máis resultados…";
-        },
-        formatSearching: function () {
-            return "Buscando…";
-        }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['gl']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_he.js b/htdocs/includes/jquery/plugins/select2/select2_locale_he.js
deleted file mode 100644
index 789dcdcaaf2..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_he.js
+++ /dev/null
@@ -1,19 +0,0 @@
-/**
-* Select2 Hebrew translation.
-*
-* Author: Yakir Sitbon <http://www.yakirs.net/>
-*/
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['he'] = {
-        formatNoMatches: function () { return "לא נמצאו התאמות"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "נא להזין עוד " + n + " תווים נוספים"; },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "נא להזין פחות " + n + " תווים"; },
-        formatSelectionTooBig: function (limit) { return "ניתן לבחור " + limit + " פריטים"; },
-        formatLoadMore: function (pageNumber) { return "טוען תוצאות נוספות…"; },
-        formatSearching: function () { return "מחפש…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['he']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_hr.js b/htdocs/includes/jquery/plugins/select2/select2_locale_hr.js
deleted file mode 100644
index ce8051c788e..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_hr.js
+++ /dev/null
@@ -1,24 +0,0 @@
-/**
- * Select2 Croatian translation.
- *
- * @author  Edi Modrić <edi.modric@gmail.com>
- * @author  Uriy Efremochkin <efremochkin@uriy.me>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['hr'] = {
-        formatNoMatches: function () { return "Nema rezultata"; },
-        formatInputTooShort: function (input, min) { return "Unesite još" + character(min - input.length); },
-        formatInputTooLong: function (input, max) { return "Unesite" + character(input.length - max) + " manje"; },
-        formatSelectionTooBig: function (limit) { return "Maksimalan broj odabranih stavki je " + limit; },
-        formatLoadMore: function (pageNumber) { return "Učitavanje rezultata…"; },
-        formatSearching: function () { return "Pretraga…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['hr']);
-
-    function character (n) {
-        return " " + n + " znak" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "a" : "" : "ova");
-    }
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_hu.js b/htdocs/includes/jquery/plugins/select2/select2_locale_hu.js
deleted file mode 100644
index f431f246360..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_hu.js
+++ /dev/null
@@ -1,17 +0,0 @@
-/**
- * Select2 Hungarian translation
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['hu'] = {
-        formatNoMatches: function () { return "Nincs találat."; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Túl rövid. Még " + n + " karakter hiányzik."; },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Túl hosszú. " + n + " karakterrel több, mint kellene."; },
-        formatSelectionTooBig: function (limit) { return "Csak " + limit + " elemet lehet kiválasztani."; },
-        formatLoadMore: function (pageNumber) { return "Töltés…"; },
-        formatSearching: function () { return "Keresés…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['hu']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_id.js b/htdocs/includes/jquery/plugins/select2/select2_locale_id.js
deleted file mode 100644
index e9c1fd9b974..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_id.js
+++ /dev/null
@@ -1,19 +0,0 @@
-/**
- * Select2 Indonesian translation.
- * 
- * Author: Ibrahim Yusuf <ibrahim7usuf@gmail.com>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['id'] = {
-        formatNoMatches: function () { return "Tidak ada data yang sesuai"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Masukkan " + n + " huruf lagi" + (n == 1 ? "" : "s"); },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Hapus " + n + " huruf" + (n == 1 ? "" : "s"); },
-        formatSelectionTooBig: function (limit) { return "Anda hanya dapat memilih " + limit + " pilihan" + (limit == 1 ? "" : "s"); },
-        formatLoadMore: function (pageNumber) { return "Mengambil data…"; },
-        formatSearching: function () { return "Mencari…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['id']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_is.js b/htdocs/includes/jquery/plugins/select2/select2_locale_is.js
deleted file mode 100644
index 273f33de8c0..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_is.js
+++ /dev/null
@@ -1,17 +0,0 @@
-/**
- * Select2 Icelandic translation.
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['is'] = {
-        formatNoMatches: function () { return "Ekkert fannst"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vinsamlegast skrifið " + n + " staf" + (n > 1 ? "i" : "") + " í viðbót"; },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Vinsamlegast styttið texta um " + n + " staf" + (n > 1 ? "i" : ""); },
-        formatSelectionTooBig: function (limit) { return "Þú getur aðeins valið " + limit + " atriði"; },
-        formatLoadMore: function (pageNumber) { return "Sæki fleiri niðurstöður…"; },
-        formatSearching: function () { return "Leita…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['is']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_it.js b/htdocs/includes/jquery/plugins/select2/select2_locale_it.js
deleted file mode 100644
index 6e2b8e23709..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_it.js
+++ /dev/null
@@ -1,17 +0,0 @@
-/**
- * Select2 Italian translation
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['it'] = {
-        formatNoMatches: function () { return "Nessuna corrispondenza trovata"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Inserisci ancora " + n + " caratter" + (n == 1? "e" : "i"); },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Inserisci " + n + " caratter" + (n == 1? "e" : "i") + " in meno"; },
-        formatSelectionTooBig: function (limit) { return "Puoi selezionare solo " + limit + " element" + (limit == 1 ? "o" : "i"); },
-        formatLoadMore: function (pageNumber) { return "Caricamento in corso…"; },
-        formatSearching: function () { return "Ricerca…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['it']);
-})(jQuery);
\ No newline at end of file
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_ja.js b/htdocs/includes/jquery/plugins/select2/select2_locale_ja.js
deleted file mode 100644
index 7dbd8d7ee86..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_ja.js
+++ /dev/null
@@ -1,17 +0,0 @@
-/**
- * Select2 Japanese translation.
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['ja'] = {
-        formatNoMatches: function () { return "該当なし"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "後" + n + "文字入れてください"; },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "検索文字列が" + n + "文字長すぎます"; },
-        formatSelectionTooBig: function (limit) { return "最多で" + limit + "項目までしか選択できません"; },
-        formatLoadMore: function (pageNumber) { return "読込中･･･"; },
-        formatSearching: function () { return "検索中･･･"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['ja']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_ka.js b/htdocs/includes/jquery/plugins/select2/select2_locale_ka.js
deleted file mode 100644
index 6cbe1d8f31e..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_ka.js
+++ /dev/null
@@ -1,19 +0,0 @@
-/**
- * Select2 Georgian (Kartuli) translation.
- * 
- * Author: Dimitri Kurashvili dimakura@gmail.com
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['ka'] = {
-        formatNoMatches: function () { return "ვერ მოიძებნა"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "გთხოვთ შეიყვანოთ კიდევ " + n + " სიმბოლო"; },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "გთხოვთ წაშალოთ " + n + " სიმბოლო"; },
-        formatSelectionTooBig: function (limit) { return "თქვენ შეგიძლიათ მხოლოდ " + limit + " ჩანაწერის მონიშვნა"; },
-        formatLoadMore: function (pageNumber) { return "შედეგის ჩატვირთვა…"; },
-        formatSearching: function () { return "ძებნა…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['ka']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_ko.js b/htdocs/includes/jquery/plugins/select2/select2_locale_ko.js
deleted file mode 100644
index bf036e09e6e..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_ko.js
+++ /dev/null
@@ -1,19 +0,0 @@
-/**
- * Select2 Korean translation.
- * 
- * @author  Swen Mun <longfinfunnel@gmail.com>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['ko'] = {
-        formatNoMatches: function () { return "결과 없음"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "너무 짧습니다. "+n+"글자 더 입력해주세요."; },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "너무 깁니다. "+n+"글자 지워주세요."; },
-        formatSelectionTooBig: function (limit) { return "최대 "+limit+"개까지만 선택하실 수 있습니다."; },
-        formatLoadMore: function (pageNumber) { return "불러오는 중…"; },
-        formatSearching: function () { return "검색 중…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['ko']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_lt.js b/htdocs/includes/jquery/plugins/select2/select2_locale_lt.js
deleted file mode 100644
index 7d7040f72f1..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_lt.js
+++ /dev/null
@@ -1,26 +0,0 @@
-/**
- * Select2 Lithuanian translation.
- * 
- * @author  CRONUS Karmalakas <cronus dot karmalakas at gmail dot com>
- * @author  Uriy Efremochkin <efremochkin@uriy.me>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['lt'] = {
-        formatNoMatches: function () { return "Atitikmenų nerasta"; },
-        formatInputTooShort: function (input, min) { return "Įrašykite dar" + character(min - input.length); },
-        formatInputTooLong: function (input, max) { return "Pašalinkite" + character(input.length - max); },
-        formatSelectionTooBig: function (limit) {
-        	return "Jūs galite pasirinkti tik " + limit + " element" + ((limit%100 > 9 && limit%100 < 21) || limit%10 == 0 ? "ų" : limit%10 > 1 ? "us" : "ą");
-        },
-        formatLoadMore: function (pageNumber) { return "Kraunama daugiau rezultatų…"; },
-        formatSearching: function () { return "Ieškoma…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['lt']);
-
-    function character (n) {
-        return " " + n + " simbol" + ((n%100 > 9 && n%100 < 21) || n%10 == 0 ? "ių" : n%10 > 1 ? "ius" : "į");
-    }
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_lv.js b/htdocs/includes/jquery/plugins/select2/select2_locale_lv.js
deleted file mode 100644
index 4afc5b41c80..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_lv.js
+++ /dev/null
@@ -1,19 +0,0 @@
-/**
- * Select2 Latvian translation.
- *
- * @author  Uriy Efremochkin <efremochkin@uriy.me>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['lv'] = {
-        formatNoMatches: function () { return "Sakritību nav"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Lūdzu ievadiet vēl " + n + " simbol" + (n == 11 ? "us" : n%10 == 1 ? "u" : "us"); },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Lūdzu ievadiet par " + n + " simbol" + (n == 11 ? "iem" : n%10 == 1 ? "u" : "iem") + " mazāk"; },
-        formatSelectionTooBig: function (limit) { return "Jūs varat izvēlēties ne vairāk kā " + limit + " element" + (limit == 11 ? "us" : limit%10 == 1 ? "u" : "us"); },
-        formatLoadMore: function (pageNumber) { return "Datu ielāde…"; },
-        formatSearching: function () { return "Meklēšana…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['lv']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_mk.js b/htdocs/includes/jquery/plugins/select2/select2_locale_mk.js
deleted file mode 100644
index 8a51a9e0b3c..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_mk.js
+++ /dev/null
@@ -1,19 +0,0 @@
-/**
- * Select2 Macedonian translation.
- * 
- * Author: Marko Aleksic <psybaron@gmail.com>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['mk'] = {
-        formatNoMatches: function () { return "Нема пронајдено совпаѓања"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Ве молиме внесете уште " + n + " карактер" + (n == 1 ? "" : "и"); },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Ве молиме внесете " + n + " помалку карактер" + (n == 1? "" : "и"); },
-        formatSelectionTooBig: function (limit) { return "Можете да изберете само " + limit + " ставк" + (limit == 1 ? "а" : "и"); },
-        formatLoadMore: function (pageNumber) { return "Вчитување резултати…"; },
-        formatSearching: function () { return "Пребарување…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['mk']);
-})(jQuery);
\ No newline at end of file
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_ms.js b/htdocs/includes/jquery/plugins/select2/select2_locale_ms.js
deleted file mode 100644
index 46588d6d72c..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_ms.js
+++ /dev/null
@@ -1,19 +0,0 @@
-/**
- * Select2 Malay translation.
- * 
- * Author: Kepoweran <kepoweran@gmail.com>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['ms'] = {
-        formatNoMatches: function () { return "Tiada padanan yang ditemui"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Sila masukkan " + n + " aksara lagi"; },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Sila hapuskan " + n + " aksara"; },
-        formatSelectionTooBig: function (limit) { return "Anda hanya boleh memilih " + limit + " pilihan"; },
-        formatLoadMore: function (pageNumber) { return "Sedang memuatkan keputusan…"; },
-        formatSearching: function () { return "Mencari…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['ms']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_nb.js b/htdocs/includes/jquery/plugins/select2/select2_locale_nb.js
deleted file mode 100644
index cb5dfaeef22..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_nb.js
+++ /dev/null
@@ -1,22 +0,0 @@
-/**
- * Select2 Norwegian Bokmål translation.
- *
- * Author: Torgeir Veimo <torgeir.veimo@gmail.com>
- * Author: Bjørn Johansen <post@bjornjohansen.no>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['nb'] = {
-        formatMatches: function (matches) { if (matches === 1) { return "Ett resultat er tilgjengelig, trykk enter for å velge det."; } return matches + " resultater er tilgjengelig. Bruk piltastene opp og ned for å navigere."; },
-        formatNoMatches: function () { return "Ingen treff"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vennligst skriv inn " + n + (n>1 ? " flere tegn" : " tegn til"); },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Vennligst fjern " + n + " tegn"; },
-        formatSelectionTooBig: function (limit) { return "Du kan velge maks " + limit + " elementer"; },
-        formatLoadMore: function (pageNumber) { return "Laster flere resultater …"; },
-        formatSearching: function () { return "Søker …"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['no']);
-})(jQuery);
-
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_nl.js b/htdocs/includes/jquery/plugins/select2/select2_locale_nl.js
deleted file mode 100644
index 985741ec20f..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_nl.js
+++ /dev/null
@@ -1,17 +0,0 @@
-/**
- * Select2 Dutch translation
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['nl'] = {
-        formatNoMatches: function () { return "Geen resultaten gevonden"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vul nog " + n + " karakter" + (n == 1? "" : "s") + " in"; },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Haal " + n + " karakter" + (n == 1? "" : "s") + " weg"; },
-        formatSelectionTooBig: function (limit) { return "Maximaal " + limit + " item" + (limit == 1 ? "" : "s") + " toegestaan"; },
-        formatLoadMore: function (pageNumber) { return "Meer resultaten laden…"; },
-        formatSearching: function () { return "Zoeken…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['nl']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_pl.js b/htdocs/includes/jquery/plugins/select2/select2_locale_pl.js
deleted file mode 100644
index 87c26194131..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_pl.js
+++ /dev/null
@@ -1,54 +0,0 @@
-/**
- * Select2 Polish translation.
- *
- * @author  Jan Kondratowicz <jan@kondratowicz.pl>
- * @author  Uriy Efremochkin <efremochkin@uriy.me>
- * @author  Michał Połtyn <mike@poltyn.com>
- * @author  Damian Zajkowski <damian.zajkowski@gmail.com>
- */
-(function($) {
-    "use strict";
-
-    $.fn.select2.locales['pl'] = {
-        formatNoMatches: function() {
-            return "Brak wyników";
-        },
-        formatInputTooShort: function(input, min) {
-            return "Wpisz co najmniej" + character(min - input.length, "znak", "i");
-        },
-        formatInputTooLong: function(input, max) {
-            return "Wpisana fraza jest za długa o" + character(input.length - max, "znak", "i");
-        },
-        formatSelectionTooBig: function(limit) {
-            return "Możesz zaznaczyć najwyżej" + character(limit, "element", "y");
-        },
-        formatLoadMore: function(pageNumber) {
-            return "Ładowanie wyników…";
-        },
-        formatSearching: function() {
-            return "Szukanie…";
-        }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['pl']);
-
-    function character(n, word, pluralSuffix) {
-        //Liczba pojedyncza - brak suffiksu
-        //jeden znak
-        //jeden element
-        var suffix = '';
-        if (n > 1 && n < 5) {
-            //Liczaba mnoga ilość od 2 do 4 - własny suffiks
-            //Dwa znaki, trzy znaki, cztery znaki.
-            //Dwa elementy, trzy elementy, cztery elementy
-            suffix = pluralSuffix;
-        } else if (n == 0 || n >= 5) {
-            //Ilość 0 suffiks ów
-            //Liczaba mnoga w ilości 5 i więcej - suffiks ów (nie poprawny dla wszystkich wyrazów, np. 100 wiadomości)
-            //Zero znaków, Pięć znaków, sześć znaków, siedem znaków, osiem znaków.
-            //Zero elementów Pięć elementów, sześć elementów, siedem elementów, osiem elementów.
-            suffix = 'ów';
-        }
-        return " " + n + " " + word + suffix;
-    }
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_pt-BR.js b/htdocs/includes/jquery/plugins/select2/select2_locale_pt-BR.js
deleted file mode 100644
index 51b037de580..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_pt-BR.js
+++ /dev/null
@@ -1,18 +0,0 @@
-/**
- * Select2 Brazilian Portuguese translation
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['pt-BR'] = {
-        formatNoMatches: function () { return "Nenhum resultado encontrado"; },
-        formatAjaxError: function () { return "Erro na busca"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Digite " + (min == 1 ? "" : "mais") + " " + n + " caracter" + (n == 1? "" : "es"); },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " caracter" + (n == 1? "" : "es"); },
-        formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
-        formatLoadMore: function (pageNumber) { return "Carregando mais resultados…"; },
-        formatSearching: function () { return "Buscando…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['pt-BR']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_pt-PT.js b/htdocs/includes/jquery/plugins/select2/select2_locale_pt-PT.js
deleted file mode 100644
index ae55a4fc4ef..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_pt-PT.js
+++ /dev/null
@@ -1,17 +0,0 @@
-/**
- * Select2 Portuguese (Portugal) translation
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['pt-PT'] = {
-        formatNoMatches: function () { return "Nenhum resultado encontrado"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduza " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " car" + (n == 1 ? "ácter" : "acteres"); },
-        formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); },
-        formatLoadMore: function (pageNumber) { return "A carregar mais resultados…"; },
-        formatSearching: function () { return "A pesquisar…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['pt-PT']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_ro.js b/htdocs/includes/jquery/plugins/select2/select2_locale_ro.js
deleted file mode 100644
index 21b0cf18186..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_ro.js
+++ /dev/null
@@ -1,17 +0,0 @@
-/**
- * Select2 Romanian translation.
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['ro'] = {
-        formatNoMatches: function () { return "Nu a fost găsit nimic"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vă rugăm să introduceți incă " + n + " caracter" + (n == 1 ? "" : "e"); },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Vă rugăm să introduceți mai puțin de " + n + " caracter" + (n == 1? "" : "e"); },
-        formatSelectionTooBig: function (limit) { return "Aveți voie să selectați cel mult " + limit + " element" + (limit == 1 ? "" : "e"); },
-        formatLoadMore: function (pageNumber) { return "Se încarcă…"; },
-        formatSearching: function () { return "Căutare…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['ro']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_rs.js b/htdocs/includes/jquery/plugins/select2/select2_locale_rs.js
deleted file mode 100644
index 72c16389c9e..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_rs.js
+++ /dev/null
@@ -1,19 +0,0 @@
-/**
- * Select2 Serbian translation.
- *
- * @author  Limon Monte <limon.monte@gmail.com>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['rs'] = {
-        formatNoMatches: function () { return "Ništa nije pronađeno"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Ukucajte bar još " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Obrišite " + n + " simbol" + (n % 10 == 1 && n % 100 != 11	 ? "" : "a"); },
-        formatSelectionTooBig: function (limit) { return "Možete izabrati samo " + limit + " stavk" + (limit % 10 == 1 && limit % 100 != 11	 ? "u" : (limit % 10 >= 2 && limit % 10 <= 4 && (limit % 100 < 12 || limit % 100 > 14)? "e" : "i")); },
-        formatLoadMore: function (pageNumber) { return "Preuzimanje još rezultata…"; },
-        formatSearching: function () { return "Pretraga…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['rs']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_ru.js b/htdocs/includes/jquery/plugins/select2/select2_locale_ru.js
deleted file mode 100644
index 2a6c7702c42..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_ru.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/**
- * Select2 Russian translation.
- *
- * @author  Uriy Efremochkin <efremochkin@uriy.me>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['ru'] = {
-        formatNoMatches: function () { return "Совпадений не найдено"; },
-        formatInputTooShort: function (input, min) { return "Пожалуйста, введите еще хотя бы" + character(min - input.length); },
-        formatInputTooLong: function (input, max) { return "Пожалуйста, введите на" + character(input.length - max) + " меньше"; },
-        formatSelectionTooBig: function (limit) { return "Вы можете выбрать не более " + limit + " элемент" + (limit%10 == 1 && limit%100 != 11 ? "а" : "ов"); },
-        formatLoadMore: function (pageNumber) { return "Загрузка данных…"; },
-        formatSearching: function () { return "Поиск…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['ru']);
-
-    function character (n) {
-        return " " + n + " символ" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 20) ? n%10 > 1 ? "a" : "" : "ов");
-    }
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_sk.js b/htdocs/includes/jquery/plugins/select2/select2_locale_sk.js
deleted file mode 100644
index 027530c9388..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_sk.js
+++ /dev/null
@@ -1,50 +0,0 @@
-/**
- * Select2 Slovak translation.
- *
- * Author: David Vallner <david@vallner.net>
- */
-(function ($) {
-    "use strict";
-    // use text for the numbers 2 through 4
-    var smallNumbers = {
-        2: function(masc) { return (masc ? "dva" : "dve"); },
-        3: function() { return "tri"; },
-        4: function() { return "štyri"; }
-    };
-    $.fn.select2.locales['sk'] = {
-        formatNoMatches: function () { return "Nenašli sa žiadne položky"; },
-        formatInputTooShort: function (input, min) {
-            var n = min - input.length;
-            if (n == 1) {
-                return "Prosím, zadajte ešte jeden znak";
-            } else if (n <= 4) {
-                return "Prosím, zadajte ešte ďalšie "+smallNumbers[n](true)+" znaky";
-            } else {
-                return "Prosím, zadajte ešte ďalších "+n+" znakov";
-            }
-        },
-        formatInputTooLong: function (input, max) {
-            var n = input.length - max;
-            if (n == 1) {
-                return "Prosím, zadajte o jeden znak menej";
-            } else if (n >= 2 && n <= 4) {
-                return "Prosím, zadajte o "+smallNumbers[n](true)+" znaky menej";
-            } else {
-                return "Prosím, zadajte o "+n+" znakov menej";
-            }
-        },
-        formatSelectionTooBig: function (limit) {
-            if (limit == 1) {
-                return "Môžete zvoliť len jednu položku";
-            } else if (limit >= 2 && limit <= 4) {
-                return "Môžete zvoliť najviac "+smallNumbers[limit](false)+" položky";
-            } else {
-                return "Môžete zvoliť najviac "+limit+" položiek";
-            }
-        },
-        formatLoadMore: function (pageNumber) { return "Načítavajú sa ďalšie výsledky…"; },
-        formatSearching: function () { return "Vyhľadávanie…"; }
-    };
-
-	$.extend($.fn.select2.defaults, $.fn.select2.locales['sk']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_sv.js b/htdocs/includes/jquery/plugins/select2/select2_locale_sv.js
deleted file mode 100644
index 96f8c0a881d..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_sv.js
+++ /dev/null
@@ -1,19 +0,0 @@
-/**
- * Select2 Swedish translation.
- *
- * Author: Jens Rantil <jens.rantil@telavox.com>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['sv'] = {
-        formatNoMatches: function () { return "Inga träffar"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Var god skriv in " + n + (n>1 ? " till tecken" : " tecken till"); },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Var god sudda ut " + n + " tecken"; },
-        formatSelectionTooBig: function (limit) { return "Du kan max välja " + limit + " element"; },
-        formatLoadMore: function (pageNumber) { return "Laddar fler resultat…"; },
-        formatSearching: function () { return "Söker…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['sv']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_th.js b/htdocs/includes/jquery/plugins/select2/select2_locale_th.js
deleted file mode 100644
index 7f3e6ef8c39..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_th.js
+++ /dev/null
@@ -1,19 +0,0 @@
-/**
- * Select2 Thai translation.
- *
- * Author: Atsawin Chaowanakritsanakul <joke@nakhon.net>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['th'] = {
-        formatNoMatches: function () { return "ไม่พบข้อมูล"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "โปรดพิมพ์เพิ่มอีก " + n + " ตัวอักษร"; },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "โปรดลบออก " + n + " ตัวอักษร"; },
-        formatSelectionTooBig: function (limit) { return "คุณสามารถเลือกได้ไม่เกิน " + limit + " รายการ"; },
-        formatLoadMore: function (pageNumber) { return "กำลังค้นข้อมูลเพิ่ม…"; },
-        formatSearching: function () { return "กำลังค้นข้อมูล…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['th']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_tr.js b/htdocs/includes/jquery/plugins/select2/select2_locale_tr.js
deleted file mode 100644
index 1dda95ca376..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_tr.js
+++ /dev/null
@@ -1,19 +0,0 @@
-/**
- * Select2 Turkish translation.
- * 
- * Author: Salim KAYABAŞI <salim.kayabasi@gmail.com>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['tr'] = {
-        formatNoMatches: function () { return "Sonuç bulunamadı"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "En az " + n + " karakter daha girmelisiniz"; },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return n + " karakter azaltmalısınız"; },
-        formatSelectionTooBig: function (limit) { return "Sadece " + limit + " seçim yapabilirsiniz"; },
-        formatLoadMore: function (pageNumber) { return "Daha fazla…"; },
-        formatSearching: function () { return "Aranıyor…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['tr']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_ug-CN.js b/htdocs/includes/jquery/plugins/select2/select2_locale_ug-CN.js
deleted file mode 100644
index 579588a7ac0..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_ug-CN.js
+++ /dev/null
@@ -1,16 +0,0 @@
-/**
- * Select2 Uyghur translation
- */
-(function ($) {
-    "use strict";
-    $.fn.select2.locales['ug-CN'] = {
-        formatNoMatches: function () { return "ماس كېلىدىغان ئۇچۇر تېپىلمىدى"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "يەنە " + n + " ھەرپ كىرگۈزۈڭ";},
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "" + n + "ھەرپ ئۆچۈرۈڭ";},
-        formatSelectionTooBig: function (limit) { return "ئەڭ كۆپ بولغاندا" + limit + " تال ئۇچۇر تاللىيالايسىز"; },
-        formatLoadMore: function (pageNumber) { return "ئۇچۇرلار ئوقۇلىۋاتىدۇ…"; },
-        formatSearching: function () { return "ئىزدەۋاتىدۇ…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['ug-CN']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_uk.js b/htdocs/includes/jquery/plugins/select2/select2_locale_uk.js
deleted file mode 100644
index b5bd0e02d2c..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_uk.js
+++ /dev/null
@@ -1,25 +0,0 @@
-/**
- * Select2 Ukrainian translation.
- * 
- * @author  bigmihail <bigmihail@bigmir.net>
- * @author  Uriy Efremochkin <efremochkin@uriy.me>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['uk'] = {
-        formatMatches: function (matches) { return character(matches, "результат") + " знайдено, використовуйте клавіші зі стрілками вверх та вниз для навігації."; },
-        formatNoMatches: function () { return "Нічого не знайдено"; },
-        formatInputTooShort: function (input, min) { return "Введіть буль ласка ще " + character(min - input.length, "символ"); },
-        formatInputTooLong: function (input, max) { return "Введіть буль ласка на " + character(input.length - max, "символ") + " менше"; },
-        formatSelectionTooBig: function (limit) { return "Ви можете вибрати лише " + character(limit, "елемент"); },
-        formatLoadMore: function (pageNumber) { return "Завантаження даних…"; },
-        formatSearching: function () { return "Пошук…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['uk']);
-
-    function character (n, word) {
-        return n + " " + word + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "и" : "" : "ів");
-    }
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_vi.js b/htdocs/includes/jquery/plugins/select2/select2_locale_vi.js
deleted file mode 100644
index cc67065f972..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_vi.js
+++ /dev/null
@@ -1,20 +0,0 @@
-/**
- * Select2 Vietnamese translation.
- * 
- * Author: Long Nguyen <olragon@gmail.com>
- */
-(function ($) {
-    "use strict";
-
-    $.fn.select2.locales['vi'] = {
-        formatNoMatches: function () { return "Không tìm thấy kết quả"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "Vui lòng nhập nhiều hơn " + n + " ký tự" + (n == 1 ? "" : "s"); },
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "Vui lòng nhập ít hơn " + n + " ký tự" + (n == 1? "" : "s"); },
-        formatSelectionTooBig: function (limit) { return "Chỉ có thể chọn được " + limit + " tùy chọn" + (limit == 1 ? "" : "s"); },
-        formatLoadMore: function (pageNumber) { return "Đang lấy thêm kết quả…"; },
-        formatSearching: function () { return "Đang tìm…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['vi']);
-})(jQuery);
-
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_zh-CN.js b/htdocs/includes/jquery/plugins/select2/select2_locale_zh-CN.js
deleted file mode 100644
index e988dac1a4c..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_zh-CN.js
+++ /dev/null
@@ -1,16 +0,0 @@
-/**
- * Select2 Chinese translation
- */
-(function ($) {
-    "use strict";
-    $.fn.select2.locales['zh-CN'] = {
-        formatNoMatches: function () { return "没有找到匹配项"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "请再输入" + n + "个字符";},
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "请删掉" + n + "个字符";},
-        formatSelectionTooBig: function (limit) { return "你只能选择最多" + limit + "项"; },
-        formatLoadMore: function (pageNumber) { return "加载结果中…"; },
-        formatSearching: function () { return "搜索中…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['zh-CN']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2_locale_zh-TW.js b/htdocs/includes/jquery/plugins/select2/select2_locale_zh-TW.js
deleted file mode 100644
index 85dbd5afc23..00000000000
--- a/htdocs/includes/jquery/plugins/select2/select2_locale_zh-TW.js
+++ /dev/null
@@ -1,16 +0,0 @@
-/**
- * Select2 Traditional Chinese translation
- */
-(function ($) {
-    "use strict";
-    $.fn.select2.locales['zh-TW'] = {
-        formatNoMatches: function () { return "沒有找到相符的項目"; },
-        formatInputTooShort: function (input, min) { var n = min - input.length; return "請再輸入" + n + "個字元";},
-        formatInputTooLong: function (input, max) { var n = input.length - max; return "請刪掉" + n + "個字元";},
-        formatSelectionTooBig: function (limit) { return "你只能選擇最多" + limit + "項"; },
-        formatLoadMore: function (pageNumber) { return "載入中…"; },
-        formatSearching: function () { return "搜尋中…"; }
-    };
-
-    $.extend($.fn.select2.defaults, $.fn.select2.locales['zh-TW']);
-})(jQuery);
diff --git a/htdocs/includes/jquery/plugins/select2/select2x2.png b/htdocs/includes/jquery/plugins/select2/select2x2.png
deleted file mode 100644
index 4bdd5c961d452c49dfa0789c2c7ffb82c238fc24..0000000000000000000000000000000000000000
GIT binary patch
literal 0
HcmV?d00001

literal 845
zcmV-T1G4;yP)<h;3K|Lk000e1NJLTq004LZ002-31^@s6(wnh~0009NNkl<Zc-rlq
zv2GJV5I`eA5ebSzqy-%%f8hdLP~9h_qV^Xci^>upQ6WKflyv?C|ADVW!U!t`EpA+x
zB)5#EjWk-_X77YJZtQo`E0SF)^1bZr%<ScI;+%s6=ICz#f&syRU}(wBHJi=KJtvV%
z&q1&qv^eJpB{$ANuo1Mlh~(%T1ltp=DYaY#8zmuerN1Ub+fTAw3X&{)g1bmADU*y5
zUblqhl?+n{vw|Hrl|2~9qJcUX=wx*w)_|YxX&9mxeE=mzu0C`g40D>)B7Cd`*OK*r
z5WG-7e-R9G9^69ksDt29&oyHqxPSt|-S>xi3%PTd+GjY+BGF|nWC(7D-sd(kxqd9~
zS@2YF5vB+>dP8+$l^{oO3-lEWiGA*QI<ZQyKyWv~v4m^Xqu?O1N>U)Wds#9M6RZ9N
zcQ4y4)xqQOxD=vwu%7cz1nY#$lT&y8HCmkWgpwQP#3dhnYj9|2aS_R}IUF_^6s#$=
zTm%~>A#oM?KIg$kh=<`gJkeoHa2LrulVy$Yx+N_0R3$4I!R*0677f(FKqm`2_o4~W
z0h}fQZ`lC^1A+m;fM7uI(R1`S0KtG@KrkQ}5DW+&@cTnDVIow56KciMk7a899t0bC
zC1KI<NAq=n6MhK=f(@YLo(pv#^;)>{TsMe5NAR%GD_5`B-@<p{rSMpIB)k$<!Y=ql
zC=fhg{GPi}!nVSD;k03YekgqMb862<$PheS!4oBGC%j9%)a;J%LAX>ad4k~K3SO%H
z_M31|`HV?E6)u$E3c&*<*n20+V@mRCop>R5;DWuZCmjSo7p@R&OYl<!6QXYf&j`^5
z2wIX~h5Ie!o(UI9@DjnpE|YYF<D+mlkwJf^OtRPLs6AUR@T@`Z1L2FXRdRPirluiy
zpsh;Xe!LWZ2ycXE!VBT8@Kdi`MTuYwhYjIDL;SG8HBchh)^TC22*vJVk`Zj@z<=2w
zxbkC}P{t%9`0)R&U5Q}xg42=_Y+Z0#a)n^ig42=_Y+P_C8Nv2R^{Fc*c#2>^@G<ZQ
XF(xQ&SEjMs00000NkvXXu0mjf{}FjY

diff --git a/htdocs/main.inc.php b/htdocs/main.inc.php
index 5aab84920aa..df6e3db64e8 100644
--- a/htdocs/main.inc.php
+++ b/htdocs/main.inc.php
@@ -1145,7 +1145,7 @@ function top_htmlhead($head, $title='', $disablejs=0, $disablehead=0, $arrayofjs
 			if (! defined('DISABLE_SELECT2') && (! empty($conf->global->MAIN_USE_JQUERY_MULTISELECT) || defined('REQUIRE_JQUERY_MULTISELECT')))     // jQuery plugin "mutiselect", "multiple-select", "select2"...
 			{
 				$tmpplugin=empty($conf->global->MAIN_USE_JQUERY_MULTISELECT)?constant('REQUIRE_JQUERY_MULTISELECT'):$conf->global->MAIN_USE_JQUERY_MULTISELECT;
-				print '<link rel="stylesheet" type="text/css" href="'.DOL_URL_ROOT.'/includes/jquery/plugins/'.$tmpplugin.'/'.$tmpplugin.'.css'.($ext?'?'.$ext:'').'">'."\n";
+				print '<link rel="stylesheet" type="text/css" href="'.DOL_URL_ROOT.'/includes/jquery/plugins/'.$tmpplugin.'/dist/css/'.$tmpplugin.'.css'.($ext?'?'.$ext:'').'">'."\n";
 			}
 			// jQuery Timepicker
 			if (! empty($conf->global->MAIN_USE_JQUERY_TIMEPICKER) || defined('REQUIRE_JQUERY_TIMEPICKER'))
@@ -1290,7 +1290,7 @@ function top_htmlhead($head, $title='', $disablejs=0, $disablehead=0, $arrayofjs
             if (! defined('DISABLE_SELECT2') && (! empty($conf->global->MAIN_USE_JQUERY_MULTISELECT) || defined('REQUIRE_JQUERY_MULTISELECT')))     // jQuery plugin "mutiselect", "multiple-select", "select2", ...
             {
             	$tmpplugin=empty($conf->global->MAIN_USE_JQUERY_MULTISELECT)?constant('REQUIRE_JQUERY_MULTISELECT'):$conf->global->MAIN_USE_JQUERY_MULTISELECT;
-            	print '<script type="text/javascript" src="'.DOL_URL_ROOT.'/includes/jquery/plugins/'.$tmpplugin.'/'.$tmpplugin.'.min.js'.($ext?'?'.$ext:'').'"></script>'."\n";
+            	print '<script type="text/javascript" src="'.DOL_URL_ROOT.'/includes/jquery/plugins/'.$tmpplugin.'/dist/js/'.$tmpplugin.'.min.js'.($ext?'?'.$ext:'').'"></script>'."\n";
             }
         }
 
diff --git a/htdocs/theme/eldy/style.css.php b/htdocs/theme/eldy/style.css.php
index d5489a432db..c631fd16c74 100644
--- a/htdocs/theme/eldy/style.css.php
+++ b/htdocs/theme/eldy/style.css.php
@@ -399,7 +399,7 @@ select.flat, form.flat select {
 	font-weight: normal;
 }
 .optionblue {
-	color: rgb(<?php echo $colortextlink; ?>) !important;
+	color: rgb(<?php echo $colortextlink; ?>);
 }
 .select2-results .select2-highlighted.optionblue {
 	color: #FFF !important;
@@ -4225,10 +4225,39 @@ div.dataTables_length select {
 .select2-drop.select2-drop-above {
 	box-shadow: none !important;
 }
+.select2-container--open .select2-dropdown--above {
+    border-bottom: solid 1px rgba(0,0,0,.2);
+}
 .select2-drop.select2-drop-above.select2-drop-active {
 	border-top: 1px solid #ccc;
 	border-bottom: solid 1px rgba(0,0,0,.2);
 }
+.select2-container--default .select2-selection--single
+{
+	outline: none;
+	border-top: none;
+	border-left: none;
+	border-right: none;
+	border-bottom: solid 1px rgba(0,0,0,.2);
+	-webkit-box-shadow: none !important;
+	box-shadow: none !important;
+	border-radius: 0 !important;
+}
+.select2-container--default .select2-selection--multiple {
+	border: solid 1px rgba(0,0,0,.2);
+	border-radius: 0 !important;
+}
+.select2-search__field
+{
+	outline: none;
+	border-top: none !important;
+	border-left: none !important;
+	border-right: none !important;
+	border-bottom: solid 1px rgba(0,0,0,.2) !important;
+	-webkit-box-shadow: none !important;
+	box-shadow: none !important;
+	border-radius: 0 !important;
+}
 .select2-container-active .select2-choice, .select2-container-active .select2-choices
 {
 	outline: none;
@@ -4322,9 +4351,16 @@ a span.select2-chosen
 
 /* Special case for the select2 add widget */
 #addbox .select2-container .select2-choice > .select2-chosen, #actionbookmark .select2-container .select2-choice > .select2-chosen {
-    text-align: left;
+    text-align: <?php echo $left; ?>;
     opacity: 0.4;
 }
+span#select2-boxbookmark-container, span#select2-boxcombo-container {
+    text-align: <?php echo $left; ?>;
+    opacity: 0.5;
+}
+.select2-container .select2-selection--single .select2-selection__rendered {
+	padding-left: 6px;
+}
 /* Style used before the select2 js is executed on boxcombo */
 #boxbookmark.boxcombo, #boxcombo.boxcombo {
     text-align: left;